| |
|
|
|
|
|
 |
| |
|
µ¿ÀδçŰíÁö10%¾× DongInDang TEGO-G SOLUTION 10%
|
|
ÀϹÝÀǾàǰ | ±Þ¿© [»êÁ¤ºÒ°¡]
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
664101840
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1mL(2024.10.01)(ÇöÀç¾à°¡)
\0 ¿ø/1mL(2024.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹ÌȲ»öÀÇ ±âÆ÷¼ºÀÌ ÀÖ´Â Åõ¸íÇÑ ¾×
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
500ml, 1L, 3.78L, 5L, 10L |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 10¸®ÅÍ |
1 °³ |
8806641018402 |
8806641018440 |
|
| 3.78¸®ÅÍ |
1 °³ |
8806641018402 |
8806641018433 |
|
| 1¸®ÅÍ |
1 °³ |
8806641018402 |
8806641018426 |
|
| 450¹Ð¸®¸®ÅÍ |
1 °³ |
8806641018402 |
8806641018419 |
|
|
| ÁÖ¼ººÐÄÚµå |
382201CLQ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806641018402 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Âº¸°ü(1~30¡É) |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
- ¼Õ ¹× ÇǺÎÀÇ ¼Òµ¶
- ¼ö¼úºÎÀ§ÀÇ ÇǺμҵ¶
- ¼ö¼úºÎÀ§ÀÇ Á¡¸·¼Òµ¶
- ÇǺΤýÁ¡¸·ÀÇ Ã¢»óºÎÀ§ ¼Òµ¶
- ÀÇ·á¿ë±¸ÀÇ ¼Òµ¶
- ¼ö¼ú½Ç¤ýº´½Ç¤ý°¡±¸¤ý±â±¸¤ý¹°Ç° µîÀÇ ¼Òµ¶
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¿°»ê¾Ëųµð¾Æ¹Ì³ë¿¡Ä¥±Û¸®½ÅÀ¸·Î¼ ¿ëµµ¿¡ µû¶ó ´ÙÀ½ÀÇ ³óµµ·Î Èñ¼®ÇÏ¿© »ç¿ëÇÑ´Ù.
1) ¼Õ ¹× ÇǺÎÀÇ ¼Òµ¶ : 0.05 - 0.2% ¼ö¿ë¾×À¸·Î ¾à 5ºÐ°£ ¾Ä¾î³½ ÈÄ ¸ê±Õ °ÅÁî ¶Ç´Â Çë°ÒÀ¸·Î ±ú²ýÀÌ ´Û´Â´Ù.
2) ¼ö¼úºÎÀ§ÀÇ ÇǺμҵ¶ : ¼ö¼úÇÒ ÇǺθéÀ» 0.1% ¼ö¿ë¾×À¸·Î ¾à 5ºÐ°£ ¾Ä¾î³½ ÈÄ 0.2% ¼ö¿ë¾×À» ¹Ù¸¥´Ù.
3) ¼ö¼úºÎÀ§ÀÇ Á¡¸·¼Òµ¶, ÇǺΤýÁ¡¸·ÀÇ Ã¢»óºÎÀ§ ¼Òµ¶ : 0.01 - 0.05% ¼ö¿ë¾×
4) ÀÇ·á¿ë±¸ÀÇ ¼Òµ¶ : 0.05% - 0.2% ¼ö¿ë¾×¿¡ 10 - 15ºÐ°£ ´ã±Ù´Ù. ´Ù¸¸ °áÇÙȯÀÚ¿Í °ü·ÃµÈ ¼Òµ¶¿¡´Â 0.2 - 0.5% ¼ö¿ë¾×À» »ç¿ëÇÑ´Ù.
5) ¼ö¼ú½Ç¤ýº´½Ç¤ý°¡±¸¤ý±â±¸¤ý¹°Ç° µîÀÇ ¼Òµ¶ : 0.05% - 0.2% ¼ö¿ë¾×. ´Ù¸¸, °áÇÙȯÀÚ¿Í °ü·ÃµÈ ¼Òµ¶¿¡´Â 0.2 - 0.5% ¼ö¿ë¾×À» »ç¿ëÇÑ´Ù.
|
| ÀÌ»ó¹ÝÀÀ |
¶§¶§·Î ¹ßÁø, °¡·Á¿ò µîÀÇ °ú¹ÎÁõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç ÀÌ·¯ÇÑ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
´Ù¸¥ ¼Òµ¶Á¦¿Í È¥ÇÕÇÏ¿© »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) ÀÎü
(1) ¿Ü¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù.
(2) Á¶Á¦½Ã
¨ç ¿°Áõ ¶Ç´Â ÀÚ±ØÀ» ¹Þ±â ½¬¿î ºÎÀ§¿¡ »ç¿ëÇÏ´Â °æ¿ì¿¡´Â Á¤»ó ºÎÀ§¿¡¼º¸´Ù Àú³óµµ·Î ÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
¨è ±íÀº â»óºÎÀ§ ¶Ç´Â ´«¿¡ »ç¿ëÇÏ´Â °æ¿ìÀÇ Èñ¼®¾×À¸·Î ÁÖ»ç¿ë¼ö¿Í ¸ê±ÕÁ¤Á¦¼ö¸¦ »ç¿ëÇÏ¸ç ¼öµ¾¹°À̳ª Á¤Á¦¼ö´Â »ç¿ëÇÏÁö ¾Ê´Â´Ù.
(3) »ç¿ë½Ã
¨ç ¿ø¾× ¶Ç´Â ³óÈľ×ÀÌ ´«¿¡ µé¾î°¡Áö ¾Êµµ·Ï ÁÖÀÇÇÏ¸ç ¸¸¾à µé¾î°£ °æ¿ì¿¡´Â ¹°·Î ±ú²ýÀÌ ¾Ä¾î³½´Ù.
¨è ³óÈľ×À» »ç¿ëÇÏ´Â °æ¿ì ÇǺΤýÁ¡¸·¿¡ ÀÚ±ØÁõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
¨é Á¡¸·, â»ó¸é ¹× ¿°ÁõºÎÀ§¿¡ Àå±â°£ ¶Ç´Â ±¤¹üÀ§ÇÏ°Ô »ç¿ëÇÏÁö ¾Ê´Â´Ù(Àü½ÅÈí¼ö·Î ±Ù¹«·ÂÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù).
2) ±âŸ
(1) ºñ´©·ù´Â ÀÌ ¾àÀÇ »ì±ÕÀÛ¿ëÀ» ¾àȽÃŰ¹Ç·Î ÃæºÐÈ÷ ¾Ä¾î Á¦°ÅÇÑ ÈÄ »ç¿ëÇÑ´Ù.
(2) öÁ¦±â±¸¸¦ Àå½Ã°£ ´ã°¡ µÑ Çʿ䰡 ÀÖ´Â °æ¿ì ºÎ½ÄÀ» ¹æÁöÇϱâ À§ÇØ ¾ÆÁú»ê³ªÆ®·ýÀ» ¿ëÇØÇØ¼ »ç¿ëÇÑ´Ù(»ì±ÕÀÛ¿ë¿¡´Â ¿µÇâÀÌ ¾ø´Ù). ±¸¸®Á¦Ç°ÀÇ ±â±¸´Â ¾ÆÁú»ê³ªÆ®·ýÀ» Ãß°¡ÇÏ¿©µµ ºÎ½ÄÀ» ¹æÁöÇÒ ¼ö ¾øÀ¸¹Ç·Î Àå½Ã°£ ´ã°¡µÎÁö ¾Ê´Â´Ù. |
| °ú·®Åõ¿© ¹× óġ |
1) ´«¿¡ µé¾î°£ °æ¿ì : ¾È±¸ ¹× ´«²¨Ç®ÀÇ ±¸¼®±¸¼®À» Àß ¾Ä¾î³»°í ±ú²ýÇÑ ¹°¿¡ 15ºÐ ÀÌ»ó ´«À» ¾ÄÀº ÈÄ Áï½Ã ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
2) ½Ç¼ö·Î ÀÌ ¾àÀ» ¸¶½Å °æ¿ì¿¡´Â ¹°·Î ÀÔÀ» ¾Ä¾î³»°í ¹° ¶Ç´Â ¿ìÀ¯¸¦ ¸¶½Å ÈÄ(¹«¸®ÇÏ°Ô ±¸Å並 À¯¹ßÇÏ·Á ÇÏÁö ¾Ê´Â´Ù) Áï½Ã ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
|
ÀÓ»ó°Ë»çÄ¡¿¡ÀÇÇÑ ¿µÇâ |
ÀÌ ¾àÀ¸·Î ¼¼Á¤ÇÑ Ä«Å×Å͸¦ ÀÌ¿ëÇØ äÃëÇÑ ¿ä´Â ¼³Æ÷»ì¸®½Ç»ê¹ý¿¡ ÀÇÇÑ ¿ä´Ü¹é½ÃÇè¿¡¼ À§¾ç¼ºÀ» ³ªÅ¸³½ °æ¿ì°¡ ÀÖ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
´Ù¼Ò »öÁ¶ÀÇ ³ó¿°¿¡ Â÷À̰¡ ÀÖÀ» ¼ö ÀÖÀ¸¸ç ÇÑ·©½Ã¿¡´Â ´Ù¼Ò ȥŹÀÌ »ý±æ ¼ö ÀÖÀ¸³ª »ì±ÕÀÛ¿ë¿¡´Â ¿µÇâÀÌ ¾ø´Ù. ȥŹÀº °¡¿Â½Ã ¿ëÇØµÈ´Ù. |
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
glycine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ In the CNS, there exist strychnine-sensitive glycine binding sites as well as strychnine-insensitive glycine binding sites. The strychnine-insensitive glycine-binding site is located on the NMDA receptor complex. The strychnine-sensitive glycine receptor complex is comprised of a chloride channel and is a member of the ligand-gated ion channel superfamily. The putative antispastic activity of supplemental glycine could be mediated by glycine's binding to strychnine-sensitive binding sites in the spinal cord. This would result in increased chloride conductance and consequent enhancement of inhibitory neurotransmission. The ability of glycine to potentiate NMDA receptor-mediated neurotransmission raised the possibility of its use in the management of neuroleptic-resistant negative symptoms in schizophrenia. Animal studies indicate that supplemental glycine protects against endotoxin-induced lethality, hypoxia-reperfusion injury after liver transplantation, and D-galactosamine-mediated liver injury. Neutrophils are thought to participate in these pathologic processes via invasion of tissue and releasing such reactive oxygen species as superoxide. In vitro studies have shown that neutrophils contain a glycine-gated chloride channel that can attenuate increases in intracellular calcium and diminsh neutrophil oxidant production. This research is ealy-stage, but suggests that supplementary glycine may turn out to be useful in processes where neutrophil infiltration contributes to toxicity, such as ARDS.
|
| Pharmacology |
glycine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Helps trigger the release of oxygen to the energy requiring cell-making process; Important in the manufacturing of hormones responsible for a strong immune system.
|
| Absorption |
glycine¿¡ ´ëÇÑ Absorption Á¤º¸ Absorbed from the small intestine via an active transport mechanism.
|
| Biotransformation |
glycine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
glycine¿¡ ´ëÇÑ Toxicity Á¤º¸ ORL-RAT LD50 7930 mg/kg, SCU-RAT LD50 5200 mg/kg, IVN-RAT LD50 2600 mg/kg, ORL-MUS LD50 4920 mg/kg; Doses of 1 gram daily are very well tolerated. Mild gastrointestinal symptoms are infrequently noted. In one study doses of 90 grams daily were also well tole.
|
| Drug Interactions |
glycine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
glycine¿¡ ´ëÇÑ Description Á¤º¸ A non-essential amino acid. It is found primarily in gelatin and silk fibroin and used therapeutically as a nutrient. It is also a fast inhibitory neurotransmitter. [PubChem]
|
| Drug Category |
glycine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Dietary supplementGlycine AgentsMicronutrientNon-Essential Amino Acids
|
| Smiles String Canonical |
glycine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ NCC(O)=O
|
| Smiles String Isomeric |
glycine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ NCC(O)=O
|
| InChI Identifier |
glycine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/f/h4H
|
| Chemical IUPAC Name |
glycine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-aminoacetic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-12-05
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|