| |
|
|
|
|
|
 |
| |
|
¾¾Å¬·Î´ýÅ©¸²(½ÃÅ©·ÎÇǷϽº¿Ã¾Æ¹Î) CYCLODERM CREAM[Ciclopirox Olamine]
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
ºñ±Þ¿©
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö ³»Áö ¹ÌȲ»öÀÇ À¯Á¦Çü Å©¸²À¸·Î ¾à°£ ƯÀÌÇÑ ³¿»õ°¡ ÀÖ´Ù.
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
- ´ÙÀ½ ÇǺÎÁø±ÕÁõÀÇ Ä¡·á
- ¹é¼± : üºÎ¹é¼±, °íºÎ¹é¼±(¿Ï¼±), ÇÑÆ÷»ó¹é¼±
- ÇǺÎĵð´ÙÁõ : °£ÂûÁø, À¯¾Æ ±â»ý±Õ¼º È«¹Ý, Áö°£¹Ì¶õÁõ(¼Õ°¡¶ô»çÀÌÁþ¹«¸§Áõ)
- ÇǺÎÁø±ÕÁõÀÇ ¿¹¹æ ¹× Ä¡·áÈÄ Àç¹ß ¹æÁö(»êÁ¦¿¡ ÇÑÇÔ)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1-3ȸ ȯºÎ¿¡ ¹Ù¸¥´Ù.
Ä¡·á±â°£ ÀÌÈÄ¿¡µµ ÀÓ»óÀûÀÎ Áõ»óÀÌ °³¼±µÇÁö ¾ÊÀ¸¸é Áø´ÜÀ» ´Ù½Ã ÇØ¾ß ÇÑ´Ù.
[Á¦Çüº°º¹¾àÁöµµ]
|
| ±Ý±â |
- ÀÌ ¾à¿¡ °ú¹ÎÁõ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
- ½Å»ý¾Æ, 6¼¼ ¹Ì¸¸ÀÇ À¯¾Æ
|
| ÀÌ»ó¹ÝÀÀ |
- Ä¡·áÃʱ⿡ ÀÛ¿°¨, È«¹Ý, °¡·Á¿ò°ú °°Àº ÀϽÃÀûÀÎ ±¹¼ÒÀû ¾ÇȰ¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç ÀÌ·¯ÇÑ °æ¿ì Åõ¿©¸¦ ÁßÁöÇÒ ÇÊ¿ä´Â ¾ø´Ù.
- ¶§¶§·Î ÇǺο°, ÇǺÎÀÚ±ØÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
- µå¹°°Ô °¡·Á¿ò, ÀÛ¿°¨ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
- °ú¹Î¹ÝÀÀ¿¡ ÀÇÇØ ƯÈ÷ ¼öÆ÷¿Í °°Àº ±¹¼ÒÀû ¹ßÇöÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
- ¼Õ»óµÇÁö ¾ÊÀº ÇǺο¡ ÀÖ¾î¼ ÀÌ ¾àÀÇ ÀçÈí¼öÀ²ÀÌ ³·¾Æ Àü½ÅÀû È¿°ú°¡ ³ªÅ¸³¯ °¡´É¼ºÀº Èñ¹ÚÇϳª »óóºÎÀ§, ³ÐÀº ºÎÀ§, Á¡¸·, ¹ÐºÀºØ´ë ¾Æ·¡¿¡ »ç¿ë½Ã Àü½ÅÀûÀÎ È¿°ú°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
- »ê¼º¿¡¼ ĵð´Ù±ÕÀÇ Áõ½ÄÀÌ Àß µÇ¹Ç·Î ĵð´ÙÁõÀÏ °æ¿ì¿¡´Â »ê¼º ºñ´©¸¦ »ç¿ëÇÏÁö ¾Ê´Â´Ù.
- ÀÌ ¾à¿¡ ´ëÇÑ ¹ÝÀÀÀÌ ³ªÅ¸³ªÁö ¾ÊÀ¸¸é Áø±ÕÇÐÀûÀÎ °Ë»ç¸¦ ½Ç½ÃÇÏ¿© ´Ù¸¥ º´¿ø±Õ¿¡ ÀÇÇÑ °¨¿° ¿©ºÎ È®ÀÎ ÈÄ ´Ù¸¥ Ç×Áø±Õ¿ä¹ýÀ» ½ÃÇàÇÑ´Ù.
- ÀÇ»çÀÇ Áö½Ã°¡ ¾ø´Â ÇÑ ¹ÐºÀºØ´ë¹ý ¶Ç´Â Æ÷Àå¹ýÀ» »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
ÀÓ½ÅÁß ÀÌ ¾à Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
ÀÌ ¾àÀº ¸ðÀ¯·Î ¹èÃâµÉ ¼ö ÀÖÀ¸¹Ç·Î ¼öÀ¯ºÎ¿¡ Åõ¿©ÇÏÁö ¾Ê´Â´Ù. |
| Àû¿ë»óÀÇ ÁÖÀÇ |
- ÀÌ ¾àÀº ¿Ü¿ëÀ¸·Î¸¸ Àû¿ëÇÑ´Ù.
- ÀÌ ¾àÀº ¾È°ú¿ëÀ¸·Î °¢¸·, °á¸·¿¡ »ç¿ëÇÏÁö ¾Ê´Â´Ù.
- ³ëÃâµÈ »óó¿¡´Â Àû¿ëÇÏÁö ¾Ê´Â´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù. |
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| BIT ¾àÈ¿ºÐ·ù |
¿Ü¿ë Ç×Áø±ÕÁ¦ (Antifungals : Skin & Mucous Membrane)
|
| º¹ÁöºÎºÐ·ùÄÚµå |
265 (±â»ý¼º ÇǺÎÁúȯ¿ëÁ¦ )
|
| Drugs By Indication |
[Àüüº¸±â]
|
| Drugs By Classification |
[Àüüº¸±â]
|
|
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Ciclopirox¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Unlike antifungals such as itraconazole and terbinafine, which affect sterol synthesis, ciclopirox is thought to act through the chelation of polyvalent metal cations, such as Fe3+ and Al3+. These cations inhibit many enzymes, including cytochromes, thus disrupting cellular activities such as mitochondrial electron transport processes and energy production. Ciclopirox also appears to modify the plasma membrane of fungi, resulting in the disorganization of internal structures. The anti-inflammatory action of ciclopirox is most likely due to inhibition of 5-lipoxygenase and cyclooxygenase.
|
| Pharmacology |
Ciclopirox¿¡ ´ëÇÑ Pharmacology Á¤º¸ Ciclopirox is a broad-spectrum antifungal medication that also has antibacterial and anti-inflammatory properties. Its main mode of action is thought to be its high affinity for trivalent cations, which inhibit essential co-factors in enzymes. Ciclopirox exhibits either fungistatic or fungicidal activity in vitro against a broad spectrum of fungal organisms, such as dermatophytes, yeasts, dimorphic fungi, eumycetes, and actinomycetes. In addition to its broad spectrum of action, ciclopirox also exerts antibacterial activity against many Gram-positive and Gram-negative bacteria. Furthermore, the anti-inflammatory effects of ciclopirox have been demonstrated in human polymorphonuclear cells, where ciclopirox has inhibited the synthesis of prostaglandin and leukotriene. Ciclopirox can also exhibit its anti-inflammatory effects by inhibiting the formation of 5-lipoxygenase and cyclooxygenase.
|
| Protein Binding |
Ciclopirox¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Protein binding is 94-97% following topical administration.
|
| Half-life |
Ciclopirox¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 1.7 hours for 1% topical solution.
|
| Absorption |
Ciclopirox¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly absorbed after oral administration. Mean absorption of ciclopirox after application to nails of all twenty digits and adjacent 5 millimeters of skin once daily for 6 months in patients with dermatophytic onychomycoses was less than 5% of the applied dose. Ciclopirox olamine also penetrates into hair and through the epidermis and hair follicles into sebaceous glands and dermis.
|
| Pharmacokinetics |
Ciclopirox OlamineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : ¿Ü¿ë : Á¤»ó ÇǺΠ: 2% ¹Ì¸¸
- ´Ü¹é°áÇÕ : 94-98%
- ¹Ý°¨±â : 1.7½Ã°£
- ¼Ò½Ç : Èí¼öµÈ ¼Ò·®ÀÇ ¾à¹°Àº ÁÖ·Î ½Å¹è¼³µÇ°í, ¼Ò·®ÀÌ º¯¹è¼³µÈ´Ù.
|
| Biotransformation |
Ciclopirox¿¡ ´ëÇÑ Biotransformation Á¤º¸ Glucuronidation is the main metabolic pathway of ciclopirox.
|
| Toxicity |
Ciclopirox¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral LD50 in rat is >10 ml/kg. Symptoms of overexposure include drowsiness and headache.
|
| Drug Interactions |
Ciclopirox¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Ciclopirox¿¡ ´ëÇÑ Description Á¤º¸ Ciclopirox (also called Loprox®, Penlac® and Stieprox®) is a synthetic antifungal agent for topical dermatologic use. [Wikipedia]
|
| Dosage Form |
Ciclopirox¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream TopicalLotion TopicalShampoo TopicalSolution Topical
|
| Drug Category |
Ciclopirox¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antifungal Agents
|
| Smiles String Canonical |
Ciclopirox¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1=CC(=O)N(O)C(=C1)C1CCCCC1
|
| Smiles String Isomeric |
Ciclopirox¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC1=CC(=O)N(O)C(=C1)C1CCCCC1
|
| InChI Identifier |
Ciclopirox¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C12H17NO2/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10/h7-8,10,15H,2-6H2,1H3
|
| Chemical IUPAC Name |
Ciclopirox¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2022-07-05
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|