| |
|
|
|
|
|
 |
| |
|
³ë½ºº¥½Ã·´ NOSBEN SYR.[Dextromethorphan HBr , Lysozyme chloride , Methylephedrine HCl]
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
651100120[A01003641]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2006.11.01)(ÇöÀç¾à°¡)
\15 ¿ø/1ml(2001.04.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
µîȲ»öÀÇ Åõ¸íÇÑ ½Ã·´Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
1SYR |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
±âħ, °¡·¡
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ȸ º¹¿ë ½Ã
¸¸ 15¼¼ ÀÌ»ó 15 mL
¸¸ 11¼¼ ÀÌ»ó - ¸¸ 15¼¼ ¹Ì¸¸ 10 mL
¸¸ 8¼¼ ÀÌ»ó - ¸¸ 11¼¼ ¹Ì¸¸ 7.5 mL
¸¸ 5¼¼ ÀÌ»ó - ¸¸ 8¼¼ ¹Ì¸¸ 5 mL
¸¸ 3¼¼ ÀÌ»ó - ¸¸ 5¼¼ ¹Ì¸¸ 3.5 mL
¸¸ 2¼¼ ÀÌ»ó - ¸¸ 3¼¼ ¹Ì¸¸ 3 mL
¸¸ 2¼¼ ¹Ì¸¸¿¡°Ô Åõ¿©ÇÏÁö ¾Ê´Â´Ù. ´Ù¸¸, ²À ÇÊ¿äÇÑ °æ¿ì ÀÇ»çÀÇ Áø·á¸¦ ¹Þ´Â´Ù.
1ÀÏ 3-4ȸ ½ÄÈÄ, Ãëħ½Ã º¹¿ë
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[º¸±â]
|
| ±Ý±â |
1) ¸¸ 3°³¿ù ¹Ì¸¸ÀÇ ¿µ¾Æ
2) ÀÌ ¾à ¹× ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ ´ëÇÑ °ú¹Î¹ÝÀÀ ¹× ±× º´·ÂÀÌ ÀÖ´Â »ç¶÷
3) MAO¾ïÁ¦Á¦(Ç׿ì¿ïÁ¦, Ç×Á¤½Åº´Á¦, °¨Á¤Á¶ÀýÁ¦, ÇׯÄŲ½¼Á¦ µî)¸¦ º¹¿ëÇϰí Àְųª º¹¿ëÀ» Áß´ÜÇÑ ÈÄ 2ÁÖ À̳»ÀÇ »ç¶÷
|
| ½ÅÁßÅõ¿© |
´ÙÀ½°ú °°Àº »ç¶÷Àº ÀÌ ¾àÀ» º¹¿ëÇϱâ Àü¿¡ ÀÇ»ç, Ä¡°úÀÇ»ç, ¾à»ç¿Í »óÀÇ ÇÒ °Í.
1) º»ÀÎ, ¾çÄ£ ¶Ç´Â ÇüÁ¦ µîÀÌ µÎµå·¯±â, Á¢Ã˼º ÇǺο°, ¾Ë·¹¸£±â¼ººñ¿°, ÆíµÎÅë, À½½Ä¹°¾Ë·¹¸£±â µîÀ» ÀÏÀ¸Å°±â ½¬¿î üÁúÀ» °®°í ÀÖ´Â »ç¶÷
2) Áö±Ý±îÁö ¾à¿¡ ÀÇÇØ ¾Ë·¹¸£±â Áõ»ó(¿¹ : ¹ß¿, ¹ßÁø, °üÀýÅë, °¡·Á¿òÁõ µî)À» ÀÏÀ¸Å² ÀûÀÌ ÀÖ´Â »ç¶÷
3) °£ÀåÁúȯ, ½ÅÀåÁúȯ, ½ÉÀåÁúȯ, °©»ó¼±Áúȯ, ´ç´¢º´, °íÇ÷¾ÐµîÀÌ ÀÖ´Â »ç¶÷, °í·ÉÀÚ, ¸öÀÌ ¾àÇÑ »ç¶÷ ¶Ç´Â °í¿ÀÌ ÀÖ´Â »ç¶÷
4) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º, ¼öÀ¯ºÎ
5) ÀÇ»ç ¶Ç´Â Ä¡°úÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ°í ÀÖ´Â »ç¶÷
6) ´ÙÀ½°ú °°Àº ±âħÀÌ ÀÖ´Â »ç¶÷
Èí¿¬, õ½Ä, ¸¸¼º ±â°üÁö¿°, Æó±âÁ¾, °úµµÇÑ °¡·¡°¡ µ¿¹ÝµÇ´Â ±âħ, 1ÁÖ ÀÌ»ó Áö¼Ó ¶Ç´Â Àç¹ßµÇ´Â ±âħ, ¸¸¼º ±âħ, ¹ß¿¡¤¹ßÁøÀ̳ª Áö¼ÓÀûÀÎ µÎÅëÀÌ µ¿¹ÝµÇ´Â ±âħ
|
| ÀÌ»ó¹ÝÀÀ |
´ÙÀ½°ú °°Àº °æ¿ì ÀÌ ¾àÀÇ º¹¿ëÀ» Áï°¢ ÁßÁöÇϰí ÀÇ»ç, Ä¡°úÀÇ»ç, ¾à»ç¿Í »óÀÇÇÒ °Í. »ó´ã ½Ã °¡´ÉÇÑ ÇÑ ÀÌ Ã·ºÎ¹®¼¸¦ ¼ÒÁöÇÒ °Í.
1) ÀÌ ¾àÀÇ º¹¿ë¿¡ ÀÇÇØ ´ÙÀ½ÀÇ Áõ»óÀÌ ³ªÅ¸³ °æ¿ì
¹ßÁø¡¤¹ßÀû, °¡·Á¿ò, ±¸¿ª¡¤±¸Åä, ½Ä¿åºÎÁø, ¾îÁö·¯¿ò, ºÒ¾È, ¶³¸², ºÒ¸é
2£©ÀÌ ¾àÀÇ º¹¿ë¿¡ ÀÇÇØ µå¹°°Ô ¾Æ·¡ÀÇ ÁßÁõ Áõ»óÀÌ ³ªÅ¸³ °æ¿ì
¨ç ¼ï(¾Æ³ªÇʶô½Ã) : º¹¿ëÈÄ ¹Ù·Î µÎµå·¯±â, ºÎÁ¾, °¡½¿´ä´äÇÔ µî°ú ÇÔ²² ¾È»öÀÌ Ã¢¹éÇϰí, ¼Õ¹ßÀÌ Â÷°í, ½ÄÀº¶¡, ¼û½¬±â °ï¶õÇÔ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
¨è ÇǺÎÁ¡¸·¾ÈÁõÈıº(½ºÆ¼ºì½º-Á¸½¼ÁõÈıº), Áßµ¶¼ºÇ¥ÇDZ«»ç¿ëÇØ(¸®¿¤ÁõÈıº) : °í¿À» µ¿¹ÝÇϰí, ¹ßÁø¡¤¹ßÀû, È»ó°ú °°ÀÌ ¹°ÁýÀÌ »ý±â´Â µîÀÇ ½ÉÇÑ Áõ»óÀÌ Àü½ÅÇǺÎ, ÀÔÀ̳ª ´«Á¡¸·¿¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) 5¢¦6ȸ º¹¿ëÇÏ¿©µµ Áõ»óÀÌ ÁÁ¾ÆÁöÁö ¾ÊÀ» °æ¿ì
|
| ÀϹÝÀû ÁÖÀÇ |
1) Á¤ÇØÁø ¿ë¹ý¡¤¿ë·®À» Àß Áöų °Í
2) ¼Ò¾Æ¿¡°Ô º¹¿ë½Ãų °æ¿ì¿¡´Â º¸È£ÀÚÀÇ Áöµµ °¨µ¶ÇÏ¿¡ º¹¿ë½Ãų °Í.
3) º¹¿ë½Ã¿¡´Â À½ÁÖÇÏÁö ¸» °Í.
4) ÀÌ ¾àÀº Ȳ»ö5È£(¼±¼Â¿»·Î¿ì FCF, Sunset Yellow FCF)¸¦ ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î ÀÌ ¼ººÐ¿¡ °ú¹ÎÇϰųª ¾Ë·¹¸£±â º´·ÂÀÌ Àִ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
ÀÌ ¾àÀ» º¹¿ëÇÏ´Â µ¿¾È ´ÙÀ½ÀÇ ¾àÀ» º¹¿ë(»ç¿ë)ÇÏÁö ¸» °Í.
´Ù¸¥ ÁøÇذŴãÁ¦, °¨±â¾à, Ç×È÷½ºÅ¸¹ÎÁ¦¸¦ ÇÔÀ¯ÇÏ´Â ³»º¹¾à(ºñ¿°¿ë °æ±¸Á¦, ¸Ö¹Ì¾à, ¾Ë·¹¸£±â¿ë¾à), ÁøÁ¤Á¦, µðÆæÈ÷µå¶ó¹ÎÀ» ÇÔÀ¯ÇÏ´Â Á¦Á¦
|
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿©
¸¸ 2¼¼ ¹Ì¸¸¿¡°Ô Åõ¿©ÇÏÁö ¾Ê´Â´Ù. ´Ù¸¸, ²À ÇÊ¿äÇÑ °æ¿ì ÀÇ»çÀÇ Áø·á¸¦ ¹Þ´Â´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
1) ¾î¸°ÀÌÀÇ ¼Õ¿¡ ´êÁö ¾Ê´Â Àå¼Ò¿¡ º¸°üÇÒ °Í
2) Á÷»ç±¤¼±À» ÇÇÇÏ°í µÉ ¼ö ÀÖ´Â ÇÑ ½À±â°¡ ÀûÀº ¼´ÃÇÑ °÷¿¡ ¹ÐÆóÇÏ¿© º¸°üÇÒ °Í
3) ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¸» °Í.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| BIT ¾àÈ¿ºÐ·ù |
ÁøÇذŴãÁ¦ & ±âħ°¨±â¾à (Cough & Cold remedies)
|
| º¹ÁöºÎºÐ·ùÄÚµå |
222 (ÁøÇذŴãÁ¦ )
|
| ÀǾàǰ ¹ÙÄÚµåÁ¤º¸ |
³»¿ëº¸±â
8806106500046//º´//1 ´ÜÀ§/¼ö·®: 1*8806106500053//º´//1 ´ÜÀ§/¼ö·®: 1*
|
ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä |
[ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä]
|
| Drugs By Indication |
[Àüüº¸±â]
|
| Drugs By Classification |
[Àüüº¸±â]
|
|
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(dextromethorphan )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Dextromethorphan¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ephedrine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Lysozyme¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Dextromethorphan¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Dextromethorphan is an opioid-like drug that binds to and acts as antagonist to the NMDA glutamatergic receptor, it is an agonist to the opioid sigma 1 and sigma 2 receptors, it is also an alpha3/beta4 nicotinic receptor antagonist and targets the serotonin reuptake pump. Dextromethorphan is rapidly absorbed from the gastrointestinal tract, where it enters the bloodstream and crosses the blood-brain barrier. The first-pass through the hepatic portal vein results in some of the drug being metabolized into an active metabolite of dextromethorphan, dextrorphan, the 3-hydroxy derivative of dextromethorphan.
|
| Pharmacology |
Dextromethorphan¿¡ ´ëÇÑ Pharmacology Á¤º¸ Dextromethorphan suppresses the cough reflex by a direct action on the cough center in the medulla of the brain. Dextromethorphan shows high affinity binding to several regions of the brain, including the medullary cough center. This compound is an NMDA receptor antagonist and acts as a non-competitive channel blocker. It is one of the widely used antitussives, and is also used to study the involvement of glutamate receptors in neurotoxicity.
|
| Metabolism |
Dextromethorphan¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2D6 (CYP2D6)
|
| Half-life |
Dextromethorphan¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 3-6 hours
|
| Absorption |
Dextromethorphan¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly absorbed from the gastrointestinal tract.
|
| Biotransformation |
Dextromethorphan¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic. Rapidly and extensively metabolized to dextrorphan (active metabolite). One well known metabolic catalyst involved is a specific cytochrome P450 enzyme known as 2D6, or CYP2D6.
|
| Toxicity |
Dextromethorphan¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Dextromethorphan¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Dihydroquinidine barbiturate Quinidine increases the toxicity of dextromethorphanQuinidine Quinidine increases the toxicity of dextromethorphanQuinidine barbiturate Quinidine increases the toxicity of dextromethorphanFluoxetine Combination associated with possible serotoninergic syndromeIsocarboxazid Possible severe adverse reactionMemantine Increased risk of CNS adverse effectsMoclobemide Increased CNS toxicityParoxetine Combination associated with possible serotoninergic syndromePhenelzine Possible severe adverse reactionRasagiline Possible severe adverse reactionSelegiline Combination associated with possible serotoninergic syndromeSibutramine Combination associated with possible serotoninergic syndromeTerbinafine Terbinafine increases dextromethorphan levelsTranylcypromine Possible severe adverse reaction
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸] Dextromethorphan¿¡ ´ëÇÑ P450 table
SUBSTRATES
CYP 2D6
Beta Blockers:
S-metoprolol
propafenone
timolol
Antidepressants:
amitriptyline
clomipramine
desipramine
imipramine
paroxetine
Antipsychotics:
haloperidol
risperidone
thioridazine
aripiprazole
codeine
**dextromethorphan**
duloxetine
flecainide
mexiletine
ondansetron
tamoxifen
tramadol
venlafaxine
INHIBITORS
CYP 2D6
amiodarone
buproprion
chlorpheniramine
cimetidine
clomipramine
duloxetine
fluoxetine
haloperidol
methadone
mibefradil
paroxetine
quinidine
ritonavir
INDUCERS
CYP 2D6
N/A
|
| Drug Target |
[Drug Target]
|
| SNP Á¤º¸ |
Name:Dextromethorphan (DB00514)
Interacting Gene/Enzyme:Cytochrome P450 2D6 (Gene symbol = CYP2D6) Swissprot P10635
SNP(s):CYP2D6*6 rs5030655 (T deletion, homozygote)
Effect:Poor drug metabolizer, lower dose requirements
Reference(s):Bradford LD, Gaedigk A, Leeder JS: High frequency of CYP2D6 poor and "intermediate" metabolizers in black populations: a review and preliminary data. Psychopharmacol Bull. 1998;34(4):797-804. [PubMed]
|
| Description |
Dextromethorphan¿¡ ´ëÇÑ Description Á¤º¸ The d-isomer of the codeine analog of levorphanol. Dextromethorphan shows high affinity binding to several regions of the brain, including the medullary cough center. This compound is an NMDA receptor antagonist (receptors, N-methyl-D-aspartate) and acts as a non-competitive channel blocker. It is one of the widely used antitussives, and is also used to study the involvement of glutamate receptors in neurotoxicity. [PubChem]
|
| Dosage Form |
Dextromethorphan¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralLiquid OralLozenge OralStrip OralSuspension OralSyrup OralTablet Oral
|
| Drug Category |
Dextromethorphan¿¡ ´ëÇÑ Drug_Category Á¤º¸ Analgesics, OpioidAntitussive AgentsExcitatory Amino Acid Antagonists
|
| Smiles String Canonical |
Dextromethorphan¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ COC1=CC2=C(CC3C4CCCCC24CCN3C)C=C1
|
| Smiles String Isomeric |
Dextromethorphan¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ COC1=CC2=C(C[C@H]3[C@H]4CCCC[C@@]24CCN3C)C=C1
|
| InChI Identifier |
Dextromethorphan¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18-/m1/s1
|
| Chemical IUPAC Name |
Dextromethorphan¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ Not Available
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2020-05-08
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|