| |
|
|
|
|
|
 |
| |
|
¾×ƼºêÇǷϽÃį°Ö(ÇǷϽÃį) 75g Activepiroxicam Gel 75g
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
Àü¹®/ÀÏ¹Ý |
ÀϹÝ
|
|
Á¦Á¶È¸»ç |
ÀϾç¹ÙÀÌ¿ÀÆÊ(ÁÖ)
|
ÆÇ¸Åȸ»ç |
ÀϾç¹ÙÀÌ¿ÀÆÊ(ÁÖ)
|
Çã°¡Á¤º¸ |
Á¤»ó
(2019.02.26)
|
BIT ¾àÈ¿ºÐ·ù |
¿Ü¿ë ¼Ò¿°ÁøÅëÁ¦ (NSAIDs : Skin & Mucous Membrane)
|
º¹ÁöºÎºÐ·ù |
264[ÁøÅ롤Áø¾ç¡¤¼ö·Å¡¤¼Ò¿°Á¦ ] |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå |
|
696601871 [ºñ±Þ¿©]
|
|
|
ATCÄÚµå |
Piroxicam / M02AA07 |
NDCÄÚµå |
[Proprietary Name Search _ ƯÇãµî·Ï¸í,»óÇ¥¸íÀ¸·Î °Ë»ö]
[Active Ingredient Search _ ÁÖ¼ººÐÀ¸·Î °Ë»ö]
[NDC Number Search _ NDCÄÚµå·Î °Ë»ö]
|
¼ººÐ / ÇÔ·® |
[½ÉÆò¿ø ÁÖ¼ººÐÄÚµå ±âÁØ ¼ººÐÇÔ·®Á¤º¸ Á¶È¸]

|
÷°¡Á¦ |
³ó±Û¸®¼¼¸°,
µð¿¡Æ¿·»±Û¸®Äݸð³ë¿¡Æ¿¿¡Å׸£,
¾Ë·Î¿¡¿¢½º(09),
¿¡Åº¿Ã,
Á¤Á¦¼ö,
Ä¡ÀÚȲ»ö¼Ò,
Ä«º¸¸Ó940,
Æ®·Ñ¾Æ¹Î,
ÆÄ¶ó¿Á½Ãº¥Á¶»ê¸ÞÆ¿,
ÆÄ¶ó¿Á½Ãº¥Á¶»êÇÁ·ÎÇÊ,
Ç÷ϻç¸Ó 407,
L-¸àÅç
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
696601871
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¿¯Àº Ȳ»öÀÇ Åõ¸íÇÑ °ÖÁ¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
75±×·¥/Åë |
| ÁÖ¼ººÐÄÚµå |
214038CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806966018705 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Â(1~30¡É)º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½ Áúȯ ¹× Áõ»óÀÇ ÁøÅë¤ý¼Ò¿°(Ç׿°) : ÅðÇ༺°üÀý¿°(°ñ°üÀý¿°), ¾î±ú°üÀýÁÖÀ§¿°, °Ç¿°(ÈûÁÙ¿°)¤ý°ÇÃÊ¿°(ÈûÁÙÀ±È°¸·¿°), °ÇÁÖÀ§¿°, »ó¿Ï°ñ(À§ÆÈ»À)»ó°ú¿°(Å״Ͻº ¿¤º¸¿ì µî), ±ÙÀ°Åë(±Ù¿°, ±Ù¸·¿° µî), ¿Ü»óÈÄÀÇ Á¾Ã¢(ºÎ±â)¤ýµ¿Åë(ÅëÁõ)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ 1ȸ 1g(¾à 3cm), 1ÀÏ 3-4ȸ ȯºÎ(ÁúȯºÎÀ§)¿¡ ¹Ù¸£°í Àß ½º¸çµéµµ·Ï °¡º±°Ô ¹®Áö¸¥´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[º¸±â]
|
| ±Ý±â |
´ÙÀ½ ȯÀÚ´Â Åõ¿©ÇÏÁö ¸» °Í.
1) ÀÌ ¾à ¶Ç´Â ±âŸÀÇ ÇǷϽÃį Á¦Á¦¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) ¾Æ½ºÇǸ° õ½Ä(ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°(Ç׿°)ÁøÅëÁ¦ µî¿¡ ÀÇÇÑ Ãµ½Ä¹ßÀÛ À¯¹ß) ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ(ÁßÁõ(½ÉÇÑÁõ»ó) õ½Ä¹ßÀÛÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù)
3) ¾Æ½ºÇǸ° ¶Ç´Â ±âŸÀÇ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°(Ç׿°)ÁøÅëÁ¦¿¡ µÎµå·¯±â, ºñ¿°(ÄÚ¿°) ¹× ¸Æ°üºÎÁ¾(Ç÷°üºÎ±â)À» ÀÏÀ¸Å² ȯÀÚ
4) 14¼¼ ÀÌÇÏÀÇ ¼Ò¾Æ
|
| ½ÅÁßÅõ¿© |
´ÙÀ½ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÒ °Í.
±â°üÁö õ½Ä ȯÀÚ(ÁßÁõ(½ÉÇÑÁõ»ó) õ½Ä¹ßÀÛÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù)
|
| ÀÌ»ó¹ÝÀÀ |
1) ÇǺΠ: ¶§¶§·Î ±¹¼ÒÀÇ °¡·Á¿ò, ¹ßÀû(ÃæÇ÷µÇ¾î ºÓ¾îÁü), ¹ßÁø, Àμ³(ºñ´Ã), ½ÀÁø¤ýÇǺο°, Á¢ÃËÇǺο°, È«¹Ý(ºÓÀº¹ÝÁ¡), µå¹°°Ô ±¤°ú¹ÎÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀÌ ½ÉÇÒ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
2) Àå±â°£ ¶Ç´Â °ú·®Åõ¿©½Ã Àü½ÅºÎÀÛ¿ëÀ¸·Î ±¸¿ª, À§Àå°ü ºÒÄè°¨, È£Èí°ï¶õ, ½ÅºÎÀü ¹× ½ÅÁõÈıº ȯÀÚ¿¡¼ÀÇ ±Þ¼º °£Áú¼º ½Å¿°(½ÅÀå¿°)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ¼Ò¿°(Ç׿°)ÁøÅëÁ¦¿¡ ÀÇÇÑ Ä¡·á´Â ¿øÀοä¹ýÀÌ ¾Æ´Ñ ´ëÁõ¿ä¹ý(Áõ»óº°·Î Ä¡·áÇÏ´Â ¹æ¹ý)ÀÓ¿¡ À¯ÀÇÇÑ´Ù.
2) ÇǺΰ¨¿°ÁõÀ» ºÒÇö¼ºÈ(°ÑÀ¸·Î µå·¯³ªÁö ¾Ê°Ô) ½Ãų ¼ö ÀÖÀ¸¹Ç·Î °¨¿°À» ¼ö¹ÝÇÏ´Â ¿°Áõ¿¡ »ç¿ëÇÏ´Â °æ¿ì¿¡´Â ÀûÀýÇÑ Ç×±ÕÁ¦ ¶Ç´Â Ç×Áø±ÕÁ¦¸¦ º´¿ë(ÇÔ²² º¹¿ë(»ç¿ë))Çϰí ÃæºÐÈ÷ °üÂûÇÏ¿© ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
3) ¸¸¼ºÁúȯ(ÅðÇ༺°üÀý¿°(°ñ°üÀý¿°) µî)¿¡ »ç¿ëÇÏ´Â °æ¿ì¿¡´Â ¾à¹°¿ä¹ý ÀÌ¿ÜÀÇ ¿ä¹ýµµ °í·ÁÇÑ´Ù. ¶ÇÇÑ È¯ÀÚÀÇ »óŸ¦ ÃæºÐÈ÷ °üÂûÇÏ¿© ºÎÀÛ¿ë ¹ßÇö(µå·¯³¿)¿¡ À¯ÀÇÇÑ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
1) ÀӽŠ3±â : ÇÁ·Î½ºÅ¸±Û¶õµò ÇÕ¼ºÀúÇØ·Î ÀÎÇØ Ãâ»êÀÌ Áö¿¬µÉ ¼ö ÀÖÀ¸¸ç Ãâ»ê½Ã ½ÇÇ÷, ½Å»ý¾Æ ÃâÇ÷, žÆÀÇ ½ÉÆóµ¶¼º(µ¿¸Æ°ü Á¶±âÆó¼â¸¦ ¼ö¹ÝÇÏ´Â Æó°íÇ÷¾Ð), ½Å±â´ÉÀúÇÏ·Î ¾ç¼ö°ú¼ÒÁõÀ» ¼ö¹ÝÇÏ´Â ½ÅºÎÀü µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ ½Ã±âÀÇ ÀӺο¡´Â »ç¿ëÇÏÁö ¾Ê´Â´Ù.
2) ÀӽŠ1±â ¹× 2±â : µ¿¹°ÀÇ »ý½Ä½ÇÇè °á°ú ÅÂÀÚµ¶¼ºÀº ¹ß»ýÇÏÁö ¾Ê¾ÒÀ¸³ª ÀӺο¡ ´ëÇÑ ¿¬±¸´Â ¾ÆÁ÷ ¹àÇôÁø ¹Ù ¾ø´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
ÇǷϽÃįÀ» °æ±¸ Åõ¿©ÇÑ ÈÄ Ç÷Áß ³óµµÀÇ ¾à 1%°¡ ¸ðÀ¯¿¡¼ ¹ß°ßµÇ¾ú´Ù. ¸ðÀ¯¿¡¼ÀÇ ÁÖ¼ººÐ ³óµµ¿Í ÀÓ»óÀû °ü·Ã¼ºÀº ¾ÆÁ÷ ¹àÇôÁø ¹Ù ¾øÀ¸³ª ¼öÀ¯ºÎ¿¡´Â Åõ¿©ÇÏÁö ¾Ê´Â´Ù. |
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¹Ì¼÷¾Æ, ½Å»ý¾Æ, ¿µ¾Æ(°«³¾Æ±â), À¯¾Æ ¹× ¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù. |
| °í·ÉÀÚ¿¡ ´ëÇÑ Åõ¿© |
°í·ÉÀÚ(³ëÀÎ)¿¡´Â ºÎÀÛ¿ëÀÇ ¹ßÇö(µå·¯³¿)¿¡ ƯÈ÷ ÁÖÀÇÇϰí ÇÊ¿äÇÑ ÃÖ¼ÒÇÑÀÇ Åõ¿©·Î ÇÑÁ¤ÇÏ´Â µî ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) º´º¯(º´¿¡ ÀÇÇÑ ¸öÀÇ º¯È)ÀÌ ÀÖ´Â ÇǺÎ(ÃâÇ÷¼º ÇǺÎÁúȯ, ½ÀÁø, °¨¿°µÈ º´º¯(º´¿¡ ÀÇÇÑ ¸öÀÇ º¯È), È»ó, »óó), ´« ¹× Á¡¸·ºÎÀ§¿¡´Â »ç¿ëÇÏÁö ¾Ê´Â´Ù.
2) ¹ÐºÀºØ´ë¹ýÀ¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
3) ÇǺο¡ ¼Õ»óÀÌ ÀÖÀ» °æ¿ì »ç¿ëÇϸé ÀϽÃÀûÀÎ Àڱذ¨À» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î »ç¿ë ½Ã ÁÖÀÇÇÑ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
±â¹Ð¿ë±â, ½Ç¿Â(1~30¡É)º¸°ü |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
(ÀӽŠ3±â ȤÀº Ãâ»êÀÌ °¡±î¿î ½ÃÁ¡¿¡ Åõ¿©µÉ °æ¿ì )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Piroxicam¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The antiinflammatory effect of Piroxicam may result from the reversible inhibition of cyclooxygenase, causing the peripheral inhibition of prostaglandin synthesis. The prostaglandins are produced by an enzyme called Cox-1. Piroxicam blocks the Cox-1 enzyme, resulting into the disruption of production of prostaglandins. Piroxicam also inhibits the migration of leukocytes into sites of inflammation and prevents the formation of thromboxane A2, an aggregating agent, by the platelets.
|
| Pharmacology |
Piroxicam¿¡ ´ëÇÑ Pharmacology Á¤º¸ Piroxicam is in a class of drugs called nonsteroidal anti-inflammatory drugs (NSAIDs). Piroxicam works by reducing hormones that cause inflammation and pain in the body. Piroxicam is used to reduce the pain, inflammation, and stiffness caused by rheumatoid arthritis and osteoarthritis.
|
| Metabolism |
Piroxicam¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Half-life |
Piroxicam¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 30 to 86 hours
|
| Absorption |
Piroxicam¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed following oral administration.
|
| Pharmacokinetics |
PiroxicamÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÁøÅëÈ¿°ú ¹ßÇö½Ã°£ : °æ±¸ : 1½Ã°£ À̳»
- ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£ : 3-5 ½Ã°£
- ´Ü¹é°áÇÕ : 99%
- ´ë»ç : °£´ë»ç
- ¹Ý°¨±â : 45-50 ½Ã°£
- ¼Ò½Ç : ¹Ìº¯Èü(5%) ¹× ´ë»çü·Î¼ ÁÖ·Î ´¢¸¦ ÅëÇØ, ¼Ò·®Àº ´ëº¯À¸·Î ¹è¼³µÊ
|
| Biotransformation |
Piroxicam¿¡ ´ëÇÑ Biotransformation Á¤º¸ Renal
|
| Toxicity |
Piroxicam¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose include drowsiness, nausea, stomach pain, and/or vomiting.
|
| Drug Interactions |
Piroxicam¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Acebutolol Risk of inhibition of renal prostaglandinsAtenolol Risk of inhibition of renal prostaglandinsBetaxolol Risk of inhibition of renal prostaglandinsBevantolol Risk of inhibition of renal prostaglandinsBisoprolol Risk of inhibition of renal prostaglandinsCarteolol Risk of inhibition of renal prostaglandinsCarvedilol Risk of inhibition of renal prostaglandinsEsmolol Risk of inhibition of renal prostaglandinsLabetalol Risk of inhibition of renal prostaglandinsMetoprolol Risk of inhibition of renal prostaglandinsNadolol Risk of inhibition of renal prostaglandinsOxprenolol Risk of inhibition of renal prostaglandinsPenbutolol Risk of inhibition of renal prostaglandinsPindolol Risk of inhibition of renal prostaglandinsPractolol Risk of inhibition of renal prostaglandinsPropranolol Risk of inhibition of renal prostaglandinsSotalol Risk of inhibition of renal prostaglandinsTimolol Risk of inhibition of renal prostaglandinsRitonavir Ritonavir increases the toxicity of piroxicamWarfarin The NSAID increases the anticoagulant effectAcenocoumarol The NSAID increases the anticoagulant effectDicumarol The NSAID increases the anticoagulant effectAnisindione The NSAID increases the anticoagulant effectLithium The NSAID increases serum levels of lithiumMethotrexate The NSAID increases the effect and toxicity of methotrexateCyclosporine Monitor for nephrotoxicityAlendronate Increased risk of gastric toxicity
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸] Piroxicam¿¡ ´ëÇÑ P450 table
SUBSTRATES
CYP 2C9
NSAIDs:
diclofenac
ibuprofen
**piroxicam**
Oral Hypoglycemic Agents:
tolbutamide
glipizide
Angiotensin II Blockers:
NOT candesartan
irbesartan
losartan
NOT valsartan
celecoxib
fluvastatin naproxen
phenytoin
sulfamethoxazole
tamoxifen
tolbutamide
torsemide
warfarin
INHIBITORS
CYP 2C9
amiodarone
fluconazole
isoniazid
INDUCERS
CYP 2C9
rifampin
secobarbital
|
| Food Interaction |
Piroxicam¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food. Avoid alcohol.
|
| Drug Target |
[Drug Target]
|
| Description |
Piroxicam¿¡ ´ëÇÑ Description Á¤º¸ A cyclooxygenase inhibiting, non-steroidal anti-inflammatory agent (NSAID) that is well established in treating rheumatoid arthritis and osteoarthritis and used for musculoskeletal disorders, dysmenorrhea, and postoperative pain. Its long half-life enables it to be administered once daily. [PubChem]
|
| Dosage Form |
÷°¡Á¦1 º¥Áú¾ËÄÚ¿Ã (ÁÖ»çÁ¦¿¡ ÇÑÇÔ.) ¡Û °æ°í
º¥Áú¾ËÄÚ¿ÃÀº ¹Ì¼÷¾Æ¿¡¼ Ä¡¸íÀûÀÎ °¡»Û È£ÈíÁõ»ó°ú ¿¬°üÀÌ ÀÖ´Â °ÍÀ¸·Î º¸°íµÇ¾ú´Ù.
¡Û ´ÙÀ½ ȯÀÚ¿¡´Â Åõ¿©ÇÏÁö ¸» °Í.
½Å»ý¾Æ, ¹Ì¼÷¾Æ(º¥Áú¾ËÄÚ¿ÃÀ» ÇÔÀ¯Çϰí ÀÖ´Ù.)
|
| Drug Category |
Piroxicam¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Inflammatory Agents, Non-SteroidalCyclooxygenase Inhibitors
|
| Smiles String Canonical |
Piroxicam¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1S(=O)(=O)C2=CC=CC=C2C(=O)C1=C(O)NC1=CC=CC=N1
|
| Smiles String Isomeric |
Piroxicam¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN1S(=O)(=O)C2=CC=CC=C2C(=O)\C1=C(/O)NC1=CC=CC=N1
|
| InChI Identifier |
Piroxicam¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C15H13N3O4S/c1-18-13(15(20)17-12-8-4-5-9-16-12)14(19)10-6-2-3-7-11(10)23(18,21)22/h2-9,20H,1H3,(H,16,17)/b15-13+/f/h17H
|
| Chemical IUPAC Name |
Piroxicam¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (3E)-3-[hydroxy-(pyridin-2-ylamino)methylidene]-2-methyl-1,1-dioxobenzo[e]thiazin-4-one
|
| Drug-Induced Toxicity Related Proteins |
PIROXICAM ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Glycogen synthase Drug:piroxicam Toxicity:impairment into glycogen metabolism. liver unable to maintain glucose homeostasis. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-10-21
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|