| |
|
|
|
|
|
 |
| |
|
지씨엔에이씨주(아세틸시스테인) GCNAC Inj.
|
|
전문의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
681100181[681100180]
[보험코드에 따른 약품기본정보 직접조회]
[비급여]
[상병코드조회]
[질병코드집 다운로드]
[우리집건강주치의 바로가기]
|
| 빠른조회 |
|
| 제품성상 |
무색투명한 액이 든 갈색앰플 주사제
[제형정보 확인]
|
| 포장·유통단위 |
3mL × 10, 25, 50 앰플
|
| 주성분코드 |
101831BIJ
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 대표코드 |
8806811001807 |
| 보관방법 |
차광밀봉용기, 실온보관(1~30℃) |
| 약리작용 |
[조회]
|
| 효능효과 |
[적응증 별 검색]
1. 진하고 점도높은 가래를 수반하는 다음의 기관지 질환에서의 객담배출곤란 증상 :
1) 성인 : 급·만성 기관지염, 기관지확장증, 천식모양기관기지염, 인·후두염, 부비동염, 낭성섬유증, 수술후 폐합병증
2) 소아 : 급·만성 기관지염, 낭성섬유증
2. 아세트아미노펜 중독의 해독
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
* 10 %
1. 점액의 용해
1) 정맥주사
성인 아세틸시스테인으로서 1회 600 ～ 900 mg, 소아 이 약으로서 1회 300 ～ 450 mg을 1일 2 ～ 3회 주사(주사액의 조제 : 생리식염 주사액 또는 5 % 포도당 주사액으로 희석하고 그 용액을 천천히 짧게 주입(약 5분 이상))한다.
2) 근육주사
성인 이 약으로서 1회 300 mg, 소아 이 약으로서 1회 150 mg을 1일 1 ～ 2회 주사한다.
2. 아세트아미노펜 중독의 해독
처음 15분간 이 약으로서 체중 kg당 150 mg을 5 % 포도당 주사액 200 mL에 희석하여 점적정맥주사한다. 다음에 체중 kg당 50 mg을 5 % 포도당 주사액 500 mL에 희석하여 4시간동안 점적정맥주사한다. 마지막으로 체중 kg당 100 mg을 5 % 포도당 주사액 1,000 mL에 희석하여 16시간동안 점적정맥주사한다. 총 주입량은 체중 kg당 300 mg, 투여시간은 20시간 15분으로 한다. 해독작용은 1회요법으로 충분하고 환자의 체중에 따라 주입용액의 양을 조절한다.
|
| 경고 |
앰플주사제는 용기 절단시 유리파편이 혼입되어, 부작용을 초래할 수 있으므로 사용시 유리파편 혼입이 최소화 될 수 있도록 신중하게 절단 사용하되, 특히 어린이, 노약자 사용시에는 각별히 주의할 것(유리앰플주사제에 한함).
|
| 금기 |
이 약 또는 이 약의 구성성분에 과민반응 환자
|
| 신중투여 |
1) 기관지 천식, 호흡기능부전을 수반한 환자(기관지 경련을 일으킬 수 있으므로 이상이 인정되는 경우에는 투여를 중지하고 기관지 확장제 투여 등의 적절한 처치를 한다)
2) 신생아(중증 질환이 아닌 경우 신생아에 투여하지 않는다) |
| 이상반응 |
1) 소화기계 : 때때로 구역, 구토, 식욕부진, 설사 등이 나타날 수 있다.
2) 과민반응 : 드물게 두드러기, 가려움, 발진, 두통, 이명, 기관지경련(특히 천식환자)등이 나타날 수 있다.
3) 드물게 빈맥, 고혈압이 나타날 수 있다. 매우 드물게 아나필락시스가 나타날 수 있다.
4) 해독제로서 다량을 정맥 내에 투여하는 경우, 때에 따라 과민반응과 유사한 증세를 보이며, 심각한 고혈압 증세를 유발시킨다. 그러한 환자들은 주의를 하여야 하며, 과민성 증세를 보이는 경우 즉시 투약을 중단한다.
5) 국내 자발적 유해사례 보고자료(1989 ～ 2013 상반기)를 분석한 결과, 유해사례가 보고된 다른 의약품에서 발생한 유해사례에 비해 통계적으로 유의하게 많이 보고된 유해사례는 다음과 같이 나타났다. 다만, 이로서 곧 해당성분과 다음의 유해사례 간에 인과관계가 입증된 것을 의미하는 것은 아니다.
(1) 호흡곤란
(2) 혈관부종
|
| 일반적 주의 |
1) 액화된 기관지 분비물이 증량되는 경우가 있으므로 관찰을 충분히 하고, 자연적인 객출이 곤란한 경우에는 기계적 흡인 또는 체위변환 등 적절한 처치를 한다.
2) 근육주사시 깊숙이 주사한다.
3) 해독제로서 투여할 경우에는 가급적 중독후 10시간 이내에 투여하도록 한다. |
| 상호작용 |
아세틸시스테인의 반응기 때문에 아세틸시스테인이 특정물질과 직접 접촉을 하는 경우(예, 에어로졸 혼합, 주입 등) 물리화학적 상반의 특성이 나타날 수 있다.
| 작용물질 |
물리화학적 적합성 |
아세틸시스테인 |
| 국소마취제 : |
리도카인 |
유 |
10 % |
| 기관지 확장제: |
이소프로테레놀 에피네프린 살부타몰 0.5 % 페노테롤 0.5 % 테르부탈린 0.5 % 이프라트로피움브로마이드 0.025 % 타일록사폴 1.25 % |
유 유 유 유 유 유 유 |
10 % 13.3 % 10 % 10 % 10 % 10 % 10 % |
| 항생제: |
암피실린 세팔로리딘 세팔로틴 에리트로마이신 네오마이신 겐타마이신 올레안도마이신 페니실린GK 롤리테트라사이클린 스트렙토마이신 티암페니콜 |
무 무 무 유 유 유 무 유 유 유 유 |
10 % 10 % 10 % 10 % 10 % 10 % 10 % 10 % 10 % 10 % 10 % |
| 교감신경흥분제: |
페닐에페드린 |
유 |
3 % |
| 호르몬: |
덱사메타손포스페이트나트륨 프레드니솔론포스페이트나트륨 인슐린 |
유 유 무 |
16 % 16.7 % 10 % |
|
| 임부에 대한 투여 |
[임부금기 성분 조회]
임부에 대한 적절한 연구가 없으므로 반드시 필요한 경우에만 투여한다.
|
| 수유부에 대한 투여 |
이 약이 모유로 이행되는 지 알려져 있지 않으나 많은 약들이 모유로 이행되므로 수유부에 투여할 때는 신중히 투여한다. |
| 고령자에 대한 투여 |
일반적으로 고령자는 생리기능이 저하되어 있으므로 환자의 상태를 관찰하는 등 신중히 투여한다. |
| 보관 및 취급상의 주의 |
차광밀봉용기, 실온보관(1~30℃) |
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
681100181[681100180]
[보험코드에 따른 약품기본정보 직접조회]
[비급여]
[상병코드조회]
[질병코드집 다운로드]
|
| 제품성상 |
무색투명한 액이 든 갈색앰플 주사제
[제형정보 확인]
|
| 포장·유통단위 |
3mL × 10, 25, 50 앰플
|
| 보관방법 |
차광밀봉용기, 실온보관(1~30℃) |
특수관리의약품
부가정보 |
유료정보입니다.
|
| Brandname 정보 |
Acetylcysteine
Brand Names/Synonyms
- (R)-2-Amino-3-mercaptopropanoic acid
- (R)-Cysteine
- 2-Amino-3-mercaptopropionic acid
- C
- Cys
- Cystein
- Cysteine, L-
- Half-cystine
- L-(+)-Cysteine
- L-Alanine, 3-mercapto-
- L-Cys
- L-cysteine
- N-acetyl-L-cysteine (NAC)
- Propanoic acid, 2-amino-3-mercapto-, (R)-
- Thioserine
- acetylcysteine
- b-Mercaptoalanine
- carbocysteine
Brand Name Mixtures
- Amino Acid Concentrate Inj (Arginine Hcl + Calcium Chloride + Dexpanthenol + Dextrose + Dl-Methionine + Glutamic Acid + Histidine Hcl + Isoleucine + L-Cysteine Hydrochloride + L-Lysine Hydrochloride + Leucine + Magnesium Sulfate + Nicotinamide + Phenylalanine + Potassium Chloride + Sodium Acetate + Threonine + Tryptophan + Valine + Vitamin B1 (Thiamine) + Vitamin B12 + Vitamin B2 (Riboflavin) + Vitamin B6 (Pyridoxine))
- Amino Acid Inj (Arginine + Calcium Chloride + D-Pantothenic Acid (Calcium D-Pantothenate) + Dextrose + Histidine + Isoleucine + L-Cysteine Hydrochloride + Leucine + Lysine + Magnesium Sulfate + Methionine + Nicotinamide + Phenylalanine + Potassium Chloride + Pyridoxine Hydrochloride + Sodium Acetate + Threonine + Tryptophan + Valine + Vitamin B1 + Vitamin B12 + Vitamin B2)
- Amino Lite (Arginine + Calcium Chloride + Dextrose + Isoleucine + L-Cysteine Hydrochloride + L-Histidine Hcl + L-Lysine Hydrochloride + Leucine + Magnesium Sulfate + Methionine + Nicotinic Acid + Phenylalanine + Potassium Chloride + Pyridoxine Hydrochloride + Sodium Glutamate + Thiamine Hydrochloride + Threonine + Tryptophan + Valine + Vitamin B12 + Vitamin B2 (Riboflavin 5'-Phosphate Sodium))
- Aminoderm Poudre (Glycine + L-Cysteine + Neomycin Sulfate + Threonine)
- Bvs Amino Acid Solution Inj (Arginine Hcl + Calcium Chloride + Dexpanthenol + Dextrose + Dl-Isoleucine + L-Cysteine Hydrochloride + L-Histidine Hcl + L-Lysine Hydrochloride + Leucine + Magnesium Sulfate + Methionine + Nicotinamide + Phenylalanine + Potassium Chloride + Pyridoxine Hydrochloride + Sodium Acetate Hemodialysis + Sodium Glutamate + Threonine + Tryptophan + Valine + Vitamin B1 + Vitamin B12 + Vitamin B2)
- Cicatrin Powder (Bacitracin Zinc + Glycine + L-Cysteine + Neomycin Sulfate + Threonine)
- Nephramine Liq Iv (Dl-Methionine + Histidine + Isoleucine + L-Cysteine (L-Cysteine Hydrochloride) + Leucine + Lysine (Lysine Acetate) + Phenylalanine + Sodium Bisulfite + Threonine + Tryptophan + Valine)
- Primene 10% (Glutamic Acid + Glycine + Histidine + L-Alanine + L-Arginine + L-Aspartic Acid + L-Cysteine + L-Isoleucine + L-Leucine + L-Lysine + L-Ornithine Dihydrochloride + L-Phenylalanine + L-Proline + L-Threonine + L-Tyrosine + L-Valine + Methionine + Serine + Taurine + Tryptophan)
- Primene 10%-Liq Iv (Glutamic Acid + Glycine + Histidine + L-Alanine + L-Arginine + L-Aspartic Acid + L-Cysteine Hydrochloride + L-Isoleucine + L-Leucine + L-Lysine + L-Ornithine + L-Phenylalanine + L-Proline + L-Threonine + L-Tyrosine + L-Valine + Methionine + Serine + Taurine + Tryptophan)
- Stv Amino Acid Sol Inj (Arginine Hcl + Calcium Chloride + Dexpanthenol + Dextrose + Dl-Methionine + Glutamic Acid + Histidine Hcl + Isoleucine + L-Cysteine Hydrochloride + L-Lysine Hydrochloride + Leucine + Magnesium Sulfate + Nicotinamide + Phenylalanine + Potassium Chloride + Pyridoxine Hydrochloride + Sodium Acetate + Threonine + Tryptophan + Valine + Vitamin B1 (Thiamine) + Vitamin B12 + Vitamin B2 (Riboflavin))
- Vamin 18 Electrolyte-Free (Glutamic Acid + Glycine + Histidine + L-Alanine + L-Arginine + L-Aspartic Acid + L-Cysteine + L-Isoleucine + L-Leucine + L-Lysine (Lysine Acetate) + L-Phenylalanine + L-Proline + L-Threonine + L-Tyrosine + L-Valine + Methionine + Serine + Tryptophan)
- Vamin N (Calcium Chloride + Glutamic Acid + Glycine + Histidine + L-Alanine + L-Arginine + L-Aspartic Acid + L-Cysteine (L-Cysteine Hydrochloride) + L-Isoleucine + L-Leucine + L-Lysine (L-Lysine Hydrochloride) + L-Phenylalanine + L-Proline + L-Threonine + L-Tyrosine + L-Valine + Magnesium Sulfate + Methionine + Potassium Chloride + Potassium Hydroxide + Serine + Sodium Hydroxide + Tryptophan)
Chemical IUPAC Name2-amino-3-sulfanyl-propanoic acid
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : B등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Acetylcysteine에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Acetylcysteine에 대한 Mechanism_Of_Action 정보
Acetylcysteine may protect against acetaminophen overdose-induced hepatotoxicity by maintaining or restoring hepatic concentrations of glutathione. Glutathione is required to inactivate an intermediate metabolite of acetaminophen that is thought to be hepatotoxic. In acetaminophen overdose, excessive quantities of this metabolite are formed because the primary metabolic (glucuronide and sulfate conjugation) pathways become saturated. Acetylcysteine may act by reducing the metabolite to the parent compound and/or by providing sulfhydryl for conjugation of the metabolite. Experimental evidence also suggests that a sulfhydryl-containing compound such as acetylcysteine may also directly inactivate the metabolite. Inhalation - Acetylcysteine exerts its mucolytic action through its free sulfhydryl group, which opens the disulfide bonds and lowers mucus viscosity. This action increases with increasing pH and is most significant at pH 7 to 9. The mucolytic action of acetylcysteine is not affected by the presence of DNA.
|
| Pharmacology |
Acetylcysteine에 대한 Pharmacology 정보
Acetylcysteine has been shown to reduce the extent of liver injury following acetaminophen overdose. It is most effective when given early, with benefit seen principally in patients treated within 8-10 hours of the overdose. Acetylcysteine likely protects the liver by maintaining or restoring the glutathione levels, or by acting as an alternate substrate for conjugation with, and thus detoxification of, the reactive metabolite.
|
| Protein Binding |
Acetylcysteine에 대한 단백결합 정보
83%
|
| Half-life |
Acetylcysteine에 대한 반감기 정보
5.6 hours (adults), 11 hours (neonates)
|
| Absorption |
Acetylcysteine에 대한 Absorption 정보
Bioavailability is 6??0% following oral administration and less than 3% following topical administration.
|
| Pharmacokinetics |
Acetylcysteine의 약물동력학자료
- 최대 점액용해효과 발현시간
- 작용지속시간 : 1시간 이상
- 혈중최고농도 도달시간
- 분포용적
- 단백결합
- 반감기
- 환원형 acetylcysteine : 2시간
- 전체 acetylcysteine으로서 5.5 시간
|
| Biotransformation |
Acetylcysteine에 대한 Biotransformation 정보
Hepatic. Deacetylated by the liver to cysteine and subsequently metabolized.
|
| Toxicity |
Acetylcysteine에 대한 Toxicity 정보
Single intravenous doses of acetylcysteine at 1000 mg/kg in mice, 2445 mg/kg in rats, 1500 mg/kg in guinea pigs, 1200 mg/kg in rabbits and 500 mg/kg in dogs were lethal. Symptoms of acute toxicity were ataxia, hypoactivity, labored respiration, cyanosis, loss of righting reflex and convulsions.
|
| Drug Interactions |
Acetylcysteine에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Description |
Acetylcysteine에 대한 Description 정보
The N-acetyl derivative of cysteine. It is used as a mucolytic agent to reduce the viscosity of mucous secretions. It has also been shown to have antiviral effects in patients with HIV due to inhibition of viral stimulation by reactive oxygen intermediates. [PubChem]
|
| Drug Category |
Acetylcysteine에 대한 Drug_Category 정보
Antiviral AgentsExpectorantsFree Radical Scavengers
|
| Smiles String Canonical |
Acetylcysteine에 대한 Smiles_String_canonical 정보
CC(=O)NC(CS)C(O)=O
|
| Smiles String Isomeric |
Acetylcysteine에 대한 Smiles_String_isomeric 정보
CC(=O)N[C@@H](CS)C(O)=O
|
| InChI Identifier |
Acetylcysteine에 대한 InChI_Identifier 정보
InChI=1/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1/f/h6,8H
|
| Chemical IUPAC Name |
Acetylcysteine에 대한 Chemical_IUPAC_Name 정보
(2R)-2-acetamido-3-sulfanylpropanoic acid
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-08-12
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ≥4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. ACETYLCYSTEINE[GGT Increase][Composite Activity](Score) NA(Marginal) 0(Active) 1[Alkaline Phosphatase Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGOT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGPT Increase](Activity Score) A(Number of Rpts) ≥4(Index value) 4.8[LDH Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[GGT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
