| |
|
|
|
|
|
 |
| |
|
산텐미드린피점안액 Santen Mydrin-P Eye Drop
|
전문의약품 | 급여
| 
|
|
수입의약품
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
665600241
[보험코드에 따른 약품기본정보 직접조회]
\3,130 원/10mL/병(2017.06.01)(최신약가)
[상병코드조회]
[질병코드집 다운로드]
[우리집건강주치의 바로가기]
|
| 빠른조회 |
|
| 제품성상 |
무색 내지 연한 노란색의 투명한 액이 연한 파란색의 투명한 플라스틱 용기에 든 점안제
[제형정보 확인]
|
| 포장·유통단위 |
10mL/병 |
| 포장·코드단위 |
| 약품규격 |
단위 |
대표코드 |
표준코드 |
비고 |
| 10밀리리터 |
1 점안액 |
8806656002403 |
8806656002410 |
|
|
| 주성분코드 |
539000COS
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 대표코드 |
8806656002403 |
| 보관방법 |
기밀용기, 실온보관(1~30℃) |
| 약리작용 |
[조회]
|
| 효능효과 |
[적응증 별 검색]
진단 또는 치료를 목적으로 하는 산동 또는 조절 마비
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
․산동에는 1회 1-2방울을 점안한다. 또는 1회 1방울을 3-5분 간격으로 2회 점안한다.
․조절마비에는 1회 1방울을 3-5분 간격으로 2-3회 점안한다.
|
| 주요약물 상호작용 |
[보기]
|
| 금기 |
1) 녹내장 또는 협우각과 전방이 좁은 경우 등의 안압상승의 소인이 있는 환자(급성 폐색 우각 녹내장의 발작을 일으킬 수 있다.)
2) 이 제품의 성분에 과민증이 있는 환자
|
| 신중투여 |
1) 소아(전신의 부작용이 일어나기 쉽다.)
2) 고혈압 환자
3) 동맥경화증 환자
4) 관부전 또는 심부전 등의 심질환 환자
5) 당뇨병 또는 갑상선 기능항진증 환자
|
| 이상반응 |
1) 쇽 : 쇽, 아나필락시 양증상이 나타날 수 있으므로 이상이 나타날 경우에는 투여를 중지하고 적절한 처치를 한다.
2) 과민증 : 안검발적, 종창, 안검피부염, 가려움, 발진, 두드러기 등의 증상이 나타날 수 있으므로 이러한 증상이 나타날 경우에는 투여를 중지한다.
3) 눈 : 결막염(결막 충혈과 부종, 눈곱 등), 각막상피장애, 안압 상승 등의 증상이 나타날 수 있다.
4) 소화기 : 갈증, 오심과 구토 등의 증상이 나타날 수 있다.
5) 기타 : 안면홍조, 빈맥, 혈압 상승, 두통 등의 전신 증상이 나타날 수 있으므로 이러한 증상이 나타날 경우에는 투여를 중지한다.
|
| 일반적 주의 |
1) 페닐레프린염산염은 안과영역 사용시 치료를 지연시키고 충혈 및 밀폐된 녹내장각 침전을 유발한다는 보고가 있다.
2) 미숙아의 안저검사실시에는 서맥, 무호흡등이 일어난 보고가 있으므로 투여중에는 충분히 관찰하고 신중히 투여할 것(소아에 대한 투여 참조)
3) 산동이나 조절마비가 일어날 수 있으므로 회복시까지 운전이나 위험한 기계조작을 하지 않도록 주의한다(또한 선글라스를 착용하는 등 태양광선이나 강한 빛을 직접 보지 않도록 한다.) |
| 상호작용 |
MAO저해제로 치료중인 또는 치료 후 3주가 경과되지 않은 환자와 삼환계 및 사환계 항우울약으로 치료중인 환자에서 급격한 혈압상승을 일으킬 수 있으므로 신중히 투여한다. |
| 소아에 대한 투여 |
소아에 투여시 전신적인 부작용이 나타날 수 있으므로 충분히 관찰하면서 신중히 투여한다. 특히, 미숙아에서 서맥, 무호흡 일어났다는 보고가 있으므로 충분히 관찰하고 이상이 인정되면 투여를 중지하고 적절한 처치를 한다. 필요에 따라 이 약을 희석해 사용하는 것이 바람직하다. |
| 고령자에 대한 투여 |
일반적으로 고령자는 생리기능이 저하되어 있으므로 주의한다. |
| 적용상의 주의 |
1) 점안시 환자는 원칙적으로 누운 상태에서 눈꺼풀을 들어 결막낭내에 점안하고 1-5분간 눈꺼풀을 닫고 누낭부를 압박한 후 눈을 뜬다.
2) 변색하거나 침전이 생긴 것은 사용하지 않는다.
3) 점안용으로만 사용한다.
4) 점안시 용기의 입구가 직접 눈에 닿지 않도록 주의한다.
5) 오염을 방지하기 위해 될 수 있는 한 공동으로 사용하지 않는다. |
| 보관 및 취급상의 주의 |
1) 소아의 손이 닿지 않는 곳에 보관한다.
2) 직사일광을 피하고 되도록 서늘한 곳에 보관한다.
3) 오용을 막고 품질의 보존을 위하여 다른 용기에 바꾸어 넣지 않는다.
|
| 기타 |
변색하거나 침전이 생긴 것은 사용하지 않는다. |
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
(phenylephrine;tropicamide; )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 제형별 복약지도 |
[점안액] |
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Phenylephrine에 대한 Mechanism_Of_Action 정보
Phenylephrine produces its ophthalmic and systemic actions by acting on alpha 1 adrenergic receptors in the pupillary dilator muscle and the vascular smooth musle, resulting in contraction of the dilator muscle and contraction of the smooth muscle in the arterioles of the conjunctiva and peripheral vasoconstriction. Phenylephrine decreases nasal congestion by acting on alpha 1 adrenergic receptors in the arterioles of the nasal mucosa to produce constriction.
Tropicamide에 대한 Mechanism_Of_Action 정보
Tropicamide binds to and blocks the receptors in the muscles of the eye (muscarinic receptor M4). Tropicamide acts by blocking the responses of the iris sphincter muscle to the iris and ciliary muscles to cholinergic stimulation, producing dilation of the pupil and paralysis of the ciliary muscle.
|
| Pharmacology |
Phenylephrine에 대한 Pharmacology 정보
Phenylephrine is a powerful vasoconstrictor. It is used as a mydriatic, nasal decongestant, and cardiotonic agent. Phenylephrine is a postsynaptic alpha-receptor stimulant with little effect on the beta receptors of the heart. Parenteral administration of Phenylephrine causes a rise in systolic and diastolic pressures, cardiac output is slightly decreased and peripheral resistance is considerably increased, most vascular beds are constricted; renal, splanchnic, cutaneous, and limb blood flows are reduced but coronary blood flow is increased. Pulmonary vessels are constricted, and pulmonary arterial pressure is raised. This alpha receptor sympathetic agonist is also used locally because its vasoconstrictor and mydriatic action.
Tropicamide에 대한 Pharmacology 정보
Tropicamide belongs to the group of medicines called anti-muscarinics. Tropicamide blocks the receptors in the muscles of the eye (muscarinic receptors). These receptors are involved controlling the pupil size and the shape of the lens. By blocking these receptors, tropicamide produces dilatation of the pupil (mydriasis) and prevents the eye from accommodating for near vision (cycloplegia). Tropicamide is given as eye drops to dilate the pupil and relax the lens so that eye examinations can be carried out thoroughly.
|
| Metabolism |
Phenylephrine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Monoamine oxidase type A (MAO-A)
|
| Protein Binding |
Phenylephrine에 대한 단백결합 정보
95% binding-plasma proteins
Tropicamide에 대한 단백결합 정보
45%
|
| Half-life |
Phenylephrine에 대한 반감기 정보
2.1 to 3.4 hours
Tropicamide에 대한 반감기 정보
Not Available
|
| Absorption |
Phenylephrine에 대한 Absorption 정보
Reduced bioavailability (compared to pseudoephedrine) following oral administration due to significant first-pass metabolism.
Tropicamide에 대한 Absorption 정보
Not Available
|
| Pharmacokinetics |
Phenylephrine HCl의 약물동력학자료
- 효과발현시간
- 근육주사, 피하주사 : 10~15분 이내
- 정맥주사 : 즉시
- 효과지속시간
- 근육주사 : 30분 ~ 2시간
- 정맥주사 : 15~30분
- 피하주사 : 1시간
- 대사 : Phenolic 포합체로 대사됨. Monoamine oxidase에 의해 간과 장에서 대사됨.
- 반감기 : 2.5 시간
- 소실 : 신배설 (90%)
Tropicamide의 약물동력학자료
- 최고 효과 발현
- 산동 : 20-40 분
- 조절근마비 : 20-35 분
- 회복시기
|
| Biotransformation |
Phenylephrine에 대한 Biotransformation 정보
Oral phenylephrine is extensively metabolised by monoamine oxidase, an enzyme which is present in the stomach and liver.
Tropicamide에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
Phenylephrine에 대한 Toxicity 정보
Not Available
Tropicamide에 대한 Toxicity 정보
Overdose can casue dry mouth, blurred vision, photophobia, hallucinations and rapid/irregular pulse.
|
| Drug Interactions |
Phenylephrine에 대한 Drug_Interactions 정보
Alseroxylon Increased arterial pressureIsocarboxazid Increased arterial pressureDeserpidine Increased arterial pressureGuanethidine The agent decreases the effect of guanethidineRasagiline Increased arterial pressureMethyldopa Increased arterial pressureMidodrine Increased arterial pressurePargyline Increased arterial pressurePhenelzine Increased arterial pressureReserpine Increased arterial pressureTranylcypromine Increased arterial pressureOxytocin Possible marked increase of arterial pressureMethylergonovine Possible marked increase of arterial pressureLinezolid Possible increase of arterial pressureErgonovine Possible marked increase of arterial pressureTrimipramine The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectNortriptyline The tricyclic increases the sympathomimetic effectClomipramine The tricyclic increases the sympathomimetic effectAmitriptyline The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectDoxepin The tricyclic increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectMoclobemide Moclobemide increases the sympathomimetic effect
Tropicamide에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Phenylephrine에 대한 Food Interaction 정보
Take without regard to meals.
Tropicamide에 대한 Food Interaction 정보
Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Phenylephrine에 대한 Description 정보
An alpha-adrenergic agonist used as a mydriatic, nasal decongestant, and cardiotonic agent. [PubChem]
Tropicamide에 대한 Description 정보
One of the muscarinic antagonists with pharmacologic action similar to atropine and used mainly as an ophthalmic parasympatholytic or mydriatic. [PubChem]
|
| Dosage Form |
Phenylephrine에 대한 Dosage_Form 정보
Liquid IntramuscularLiquid IntravenousLiquid OphthalmicOintment TopicalSolution IntravenousSolution / drops OphthalmicStrip OralTablet Oral
Tropicamide에 대한 Dosage_Form 정보
Liquid OphthalmicSolution OphthalmicSolution / drops Ophthalmic
|
| Drug Category |
Phenylephrine에 대한 Drug_Category 정보
Adrenergic alpha-AgonistsCardiotonic AgentsMydriaticsNasal DecongestantsSympathomimeticsVasoconstrictor Agents
Tropicamide에 대한 Drug_Category 정보
Diagnostic aid, cycloplegicDiagnostic aid, mydriaticMuscarinic AntagonistsMydriatics
|
| Smiles String Canonical |
Phenylephrine에 대한 Smiles_String_canonical 정보
CNCC(O)C1=CC(O)=CC=C1
Tropicamide에 대한 Smiles_String_canonical 정보
CCN(CC1=CC=NC=C1)C(=O)C(CO)C1=CC=CC=C1
|
| Smiles String Isomeric |
Phenylephrine에 대한 Smiles_String_isomeric 정보
CNC[C@H](O)C1=CC(O)=CC=C1
Tropicamide에 대한 Smiles_String_isomeric 정보
CCN(CC1=CC=NC=C1)C(=O)[C@@H](CO)C1=CC=CC=C1
|
| InChI Identifier |
Phenylephrine에 대한 InChI_Identifier 정보
InChI=1/C9H13NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1
Tropicamide에 대한 InChI_Identifier 정보
InChI=1/C17H20N2O2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15/h3-11,16,20H,2,12-13H2,1H3
|
| Chemical IUPAC Name |
Phenylephrine에 대한 Chemical_IUPAC_Name 정보
3-[(1R)-1-hydroxy-2-methylaminoethyl]phenol
Tropicamide에 대한 Chemical_IUPAC_Name 정보
N-ethyl-3-hydroxy-2-phenyl-N-(pyridin-4-ylmethyl)propanamide
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-11-03
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
