|   | 
        
            
         | 
          | 
        
        
        
            | 
                
             | 
         
        
             | 
         
        
            
            
            
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    »êÅپ˷¹±â»ìÁ¡¾È¾×(Æä¹Ì·Î¶ó½ºÆ®Ä®·ý) 5mL  Santen Alegysal Eye Drops  
                    
                 | 
               
              
                
                     Àü¹®ÀǾàǰ | ±Þ¿©  
                         |  
                    
                    	
                    
                 | 
               
              
                | 
					
                     
                     ¼öÀÔÀǾàǰ
	                
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |  
                              
                                  | 
                                   | 
                               
            
            
                
            
            
              
            
                            
              
                                                     
            
            
   |  
  
    | 
      
     | 
   
   
     | 
   
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
   
  
    
      
	
	  
	     |  
	    
	      
	        
            
                | Çã°¡Á¤º¸ | 
                         
	         
	       | 
	     
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        665600221  
	    
	    Àú°¡¾à ´ëü Àμ¾Æ¼ºê Áö±Þ ´ë»ó
          [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \4,090 ¿ø/5mL/º´(2022.06.01)(ÇöÀç¾à°¡) 
            \4,544 ¿ø/5mL/º´(2018.06.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
     [¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
   
    | Á¦Ç°¼º»ó | 
    
      ¹«»öÅõ¸íÇÑ ¾×ÀÌ ¹«»öÅõ¸íÇÑ ÇÃ¶ó½ºÆ½¿ë±â¿¡ µç Á¡¾ÈÁ¦  
      
	    [Á¦ÇüÁ¤º¸ È®ÀÎ]
     |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    5mL/º´ | 
   
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 5¹Ð¸®¸®ÅÍ | 
            1 °³ | 
            8806656002205 | 
            8806656002212 | 
             | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      209630COS  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806656002205 | 
   
  
  
  
  
   
    | º¸°ü¹æ¹ý | 
    ±â¹Ð¿ë±â, ½Ç¿Â(1~30¡É)º¸°ü | 
   
  
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
      
        [Á¶È¸]
     | 
      
  
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      ¾Ë·¹¸£±â°á¸·¿°, º½Ã¶ °¢¸·¿°À̳ª °á¸·¿°
      
      
      
      
     | 
   
  
  
  
  
  
  
  
  
    
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
     [󹿾à¾î] 
      1ȸ 1¹æ¿ï 1ÀÏ 2ȸ(¾ÆÄ§, Àú³á) Á¡¾ÈÇÑ´Ù.     
      	    
     | 
   
  
  
  
   
    | ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë | 
    
        
	  [º¸±â]
     | 
   
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    
       ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ
  
     | 
   
  
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
       1) °ú¹Î¹ÝÀÀ : ¶§¶§·Î ¾È°Ë¿°, µå¹°°Ô ¾È°ËÇǺο° µî. ÀÌ¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù. 
 2) ´« : ¶§¶§·Î °á¸·ÃæÇ÷, Àڱذ¨, ´«°ö, °¡·Á¿ò, ÀÛ¿°¨, ¾È±¸°ÇÁ¶Áõ, ºÒÆí°¨, À̹°°¨ µå¹°°Ô °á¸·¿° µî. À̿Ͱ°Àº Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù. 
 3) ±âŸ : ¶§¶§·Î ¾Ë·¹¸£±â, µîÅëÁõ, ±â°üÁö¿°, ±âħ, ¿ù°æÅë, ¹ß¿, ºÎºñµ¿¿°, Àçä±â, ÄÚ¸·Èû 
 4) ÷°¡Á¦ : ÀÌ ¾àÀº Àλ꿰À» Æ÷ÇÔÇϰí ÀÖ´Ù. »ó´çÇÑ °¢¸· ¼Õ»óÀÌ ÀÖ´Â ÀϺΠȯÀÚ¿¡¼ Àλ꿰 ÇÔÀ¯ Á¡¾È¾×ÀÇ »ç¿ë°ú ¿¬°üµÇ¾î °¢¸· ¼®È¸ÈÀÇ »ç·Ê°¡ ¸Å¿ì µå¹°°Ô(0.01% ¹Ì¸¸) º¸°íµÈ ¹Ù ÀÖ´Ù.
  
          
     | 
   
  
  
  
  
  
  
  
  
   
    | ÀӺο¡ ´ëÇÑ Åõ¿© | 
    
      
	[ÀӺαݱ⠼ººÐ Á¶È¸]       
      ÀÓ½ÅÁßÀÇ Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀº È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º¿¡°Ô´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
  
     | 
   
  
  
  
  
   
    | ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© | 
    ÀÌ ¾àÀÌ »ç¶÷ÀÇ ¸ðÀ¯·Î ÀÌÇàµÇ´ÂÁö´Â ¾Ë·ÁÁöÁö ¾ÊÀ¸³ª ·§Æ®¿¡¼ À¯ÁóÀ¸·ÎÀÇ ÀÌÇàÀÌ º¸°íµÇ¾ú°í ¸¹Àº ¾à¹°ÀÌ ¸ðÀ¯·Î ÀÌÇàµÇ±â ¶§¹®¿¡ ¼öÀ¯ºÎ¿¡°Ô´Â ½ÅÁßÇÏ°Ô Åõ¿©ÇÑ´Ù.
 
  | 
   
  
  
  
  
   
    | ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© | 
    
      
       
      ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© 
  ¹Ì¼÷¾Æ, ½Å»ý¾Æ, À¯¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼ºÀº È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù(»ç¿ë°æÇèÀÌ ¾ø´Ù.).
 
  | 
   
  
  
  
  
  
  
  
  
  
  
  
    
   
    | Àû¿ë»óÀÇ ÁÖÀÇ | 
     1) ÀÌ ¾àÀº Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù. 
 2) Á¡¾È ½Ã ¾×ÀÌ ¾È°ËÇǺΠµî¿¡ ´êÀº °æ¿ì, Áï½Ã ¾Ä¾î³½´Ù. 
 3) ¿ë±âÀÇ ³¡ÀÌ ´«²¨Ç® ¹× ¼Ó´«½ç¿¡ ´êÀ¸¸é ´«°öÀ̳ª Áø±Õ µî¿¡ ÀÇÇØ ¾à¾×ÀÌ ¿À¿° ¶Ç´Â ȥŹµÉ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ¶ÇÇÑ È¥Å¹µÈ °ÍÀº »ç¿ëÇÏÁö ¾Ê´Â´Ù. 
 4) ÀÌ ¾à¿¡ º¸Á¸Á¦·Î ÇÔÀ¯µÈ º¥ÀßÄÚ´½¿°È¹°ÀÌ ·»Áî¿¡ ÈíÂøµÉ ¼ö ÀÖÀ¸¹Ç·Î ¼ÒÇÁÆ® ·»Á Âø¿ëÇÑ »óÅ¿¡¼´Â »ç¿ëÇÏÁö ¾Ê¾Æ¾ß Çϸç, ÀÌ ¾àÀÇ Åõ¿© ÈÄ Àû¾îµµ 15ºÐÀÌ °æ°úÇÑ ÈÄ ·»Á Âø¿ëÇØ¾ß ÇÑ´Ù(º¥ÀßÄÚ´½¿°È¹° ÇÔÀ¯Á¦Á¦¿¡ ÇÑÇÔ.). 
 5) ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
  
 | 
   
  
  
  
  
  
  		
  
  
   
    | º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ | 
     1) ¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù. 
 2) Á÷»çÀϱ¤À» ÇÇÇÏ°í µÇµµ·Ï ¼´ÃÇÑ °÷¿¡ ¹ÐÀüÇÏ¿© º¸°üÇÑ´Ù. 
 3) ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù.
  
 | 
   
  	
  
  
    
   
    | ±âŸ | 
      µ¿¹°À» ÀÌ¿ëÇÑ »ý½Äµ¶¼º ½ÃÇè : ·§Æ®ÀÇ »ý½Ä´É·Â ¹× ÀÓ½ÅÃʱ⠻ý½Ä µ¶¼º ½ÃÇè¿¡¼ 400 mg/kg/day Åõ¿© ½Ã ¸ðüµ¶¼º(üÁßÁõ°¡ÀÇ À¯ÀÇÀûÀÎ ¾ïÁ¦¿Í »ç·á¼·Ãë·®ÀÇ °¨¼Ò)°ú Âø»ó¼ö ¹× »ýÁ¸ÅÂÀÚ¼öÀÇ À¯ÀÇÀûÀÎ °¨¼Ò°¡ °üÂûµÇ¾ú´Ù. ·§Æ®ÀÇ ±âÇü¹ß»ý ½ÃÇè¿¡¼´Â 250 ¹× 400 mg/kg/day Åõ¿© ½Ã ¸ðüµ¶¼º(üÁßÁõ°¡ ¾ïÁ¦ ¹× »ç·á¼·Ãë·® °¨¼Ò)°ú »ýÁ¸ ÅÂÀÚÀÇ Ã¼Áß°¨¼Ò ¹× °ñ°Ýº¯ÀÌÀÇ À¯ÀÇÀûÀÎ ¹ßÇö µîÀÌ °üÂûµÇ¾ú´Ù. Åä³¢ÀÇ ±âÇü¹ß»ý ½ÃÇè¿¡¼´Â 150 mg/kg/day Åõ¿© ½Ã ¸ðüµ¶¼º(üÁßÁõ°¡ ¾ïÁ¦ ¹× »ç·á¼·Ãë·® °¨¼Ò)Àº °üÂûµÇ¾úÀ¸³ª ÅÂÀÚ¿¡ÀÇ ¿µÇâÀº ÀÎÁ¤µÇÁö ¾Ê¾Ò´Ù. 
  ·§Æ®ÀÇ ÁÖ»ê․¼öÀ¯±â ½ÃÇè¿¡¼´Â 250 ¹× 400 mg/kg/day Åõ¿© ½Ã ¸ðüµ¶¼º(üÁßÁõ°¡ ¾ïÁ¦ ¹× »ç·á¼·Ãë·® °¨¼Ò)°ú Ãâ»ýÀÚÀÇ ½Åü¹ß´Þ Áö¿¬°æÇâÀÌ ³ªÅ¸³µ´Ù.
  
 | 
   
  
  
  
  
   
    | Related FDA Approved Drug | 
    
      
      ±âÁØ ¼ººÐ: PEMIROLAST POTASSIUMALAMAST (PEMIROLAST POTASSIUM) 
        
     | 
      
  
  
      							
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¤º¸¿ä¾à | 
                 
	         
	       | 
	           	    
	     |  
	    | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ | 
                 
	         
	       | 
	           	    
	     |  
	    | 	 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¦Ç°Á¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | º¹¾àÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        	
					  
					
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
  
  
  
  
  
  	
  
  
  	
  
  
   
    | Á¦Çüº° º¹¾àÁöµµ | 
    [Á¡¾È¾×] | 
   
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ½É»çÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | ÇмúÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | µ¶¼ºÁ¤º¸ | 
    Potassium¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â 
  Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do  | 
   
  
   
    | Mechanism of Action | 
    
       Pemirolast¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Pemirolast binds to the histamine H1 receptor. This blocks the action of endogenous histamine, which subsequently leads to temporary relief of the negative symptoms brought on by histamine. Pemirolast has also been observed to block antigen-stimulated calcium ion influx into mast cells. Pemirolast inhibits the chemotaxis of eosinophils into ocular tissue, and prevents inflammatory mediator release from human eosinophils.
  potassium¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Potassium is the major cation (positive ion) inside animal cells, while sodium is the major cation outside animal cells. The concentration differences of these charged particles causes a difference in electric potential between the inside and outside of cells, known as the membrane potential. The balance between potassium and sodium is maintained by ion pumps in the cell membrane. The cell membrane potential created by potassium and sodium ions allows the cell generate an action potential?”a "spike" of electrical discharge. The ability of cells to produce electrical discharge is critical for body functions such as neurotransmission, muscle contraction, and heart function. Potassium is also an essential mineral needed to regulate water balance, blood pressure and levels of acidity. 
     | 
   
  
   
    | Pharmacology | 
     
       Pemirolast¿¡ ´ëÇÑ Pharmacology Á¤º¸ Pemirolast is used for the prophylactic treatment of itching of the eye associated with allergic conjunctivitis. Pemirolast potassium is a mast cell stabilizer that inhibits the in vivo Type I immediate hypersensitivity reaction. Pemirolast inhibits the antigen-induced release of inflammatory mediators (e.g., histamine, leukotriene C4, D4, E4) from human mast cells. Allergic reactions lead to cell-degranulation and the release of histamine (and other chemical mediators) from the mast cell or basophil. Once released, histamine can react with local or widespread tissues through histamine receptors. Histamine, acting on H1-receptors, produces pruritis, vasodilatation, Pemirolast is a histamine H1 antagonist. It competes with histamine for the normal H1-receptor sites on effector cells of blood vessels. It provides effective, temporary relief of watery and itchy eyes.
  potassium¿¡ ´ëÇÑ Pharmacology Á¤º¸ Not Available 
     | 
   
  
   
    | Metabolism | 
    
       potassium¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 11B2 (CYP11B2) 
     | 
   
  
   
    | Protein Binding | 
    
       Pemirolast¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available 
     | 
   
  
   
    | Half-life | 
    
       Pemirolast¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 4.5 hours (Ophthalmic) 
     | 
   
  
   
    | Absorption | 
    
       Pemirolast¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
  potassium¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available 
     | 
   
  
   
    | Biotransformation | 
    
       Pemirolast¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic (Ophthalmic) 
     | 
   
  
   
    | Toxicity | 
    
       Pemirolast¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
  potassium¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available 
     | 
   
  
   
    | Drug Interactions | 
    
       Pemirolast¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
  potassium¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amiloride	Increased risk of hyperkaliemiaBenazepril	Increased risk of hyperkaliemiaCandesartan	Increased risk of hyperkaliemiaCaptopril	Increased risk of hyperkaliemiaCilazapril	Increased risk of hyperkaliemiaDrospirenone	Increased risk of hyperkaliemiaEnalapril	Increased risk of hyperkaliemiaEplerenone	This association presents an increased risk of hyperkaliemiaEprosartan	Increased risk of hyperkaliemiaForasartan	Increased risk of hyperkaliemiaFosinopril	Increased risk of hyperkaliemiaIrbesartan	Increased risk of hyperkaliemiaLisinopril	Increased risk of hyperkaliemiaLosartan	Increased risk of hyperkaliemiaMoexipril	Increased risk of hyperkaliemiaPerindopril	Increased risk of hyperkaliemiaPolystyrene sulfonate	Antagonism of actionQuinapril	Increased risk of hyperkaliemiaRamipril	Increased risk of hyperkaliemiaSaprisartan	Increased risk of hyperkaliemiaSpirapril	Increased risk of hyperkaliemiaSpironolactone	Increased risk of hyperkaliemiaTasosartan	Increased risk of hyperkaliemiaTelmisartan	Increased risk of hyperkaliemiaTrandolapril	Increased risk of hyperkaliemiaTriamterene	Increased risk of hyperkaliemiaValsartan	Increased risk of hyperkaliemia 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Food Interaction | 
    
       potassium¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Pemirolast¿¡ ´ëÇÑ Description Á¤º¸ Pemirolast is an antiallergic agent. Pemirolast potassium is a slightly yellow powder soluble in water; as an ophthalmic aqueous sterile solution is used for the prevention of itching of the eyes caused by allergies such as hay fever, and allergic conjunctivitis. Pemirolast is potentially useful for prophylaxis of pulmonary hypersensitivity reactions to drugs such as paclitaxel.
  potassium¿¡ ´ëÇÑ Description Á¤º¸ Potassium is the major cation (positive ion) inside animal cells, while sodium is the major cation outside animal cells. The concentration differences of these charged particles causes a difference in electric potential between the inside and outside of cells, known as the membrane potential. The balance between potassium and sodium is maintained by ion pumps in the cell membrane. The cell membrane potential created by potassium and sodium ions allows the cell generate an action potential?”a "spike" of electrical discharge. The ability of cells to produce electrical discharge is critical for body functions such as neurotransmission, muscle contraction, and heart function. Potassium is also an essential mineral needed to regulate water balance, blood pressure and levels of acidity. 
     | 
   
  
   
    | Dosage Form | 
    
       Pemirolast¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Solution / drops	Ophthalmic
  potassium¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Aerosol	OralCapsule	OralCapsule, extended release	OralElixir	OralLiquid	IntravenousLiquid	OralLiquid	SublingualPowder	OralPowder, for solution	OralSolution	IntravenousSolution	OralSolution / drops	OralTablet	OralTablet, extended release	Oral 
     | 
   
  
   
    | Drug Category | 
    
       Pemirolast¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Allergic AgentsAntipruriticsHistamine AntagonistsOphthalmics 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Pemirolast¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1=CC=CN2C(=O)C(=CN=C12)C1=NNN=N1
  potassium¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ Not Available 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Pemirolast¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC1=CC=CN2C(=O)C(=CN=C12)C1=NNN=N1
  potassium¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ Not Available 
     | 
   
  
   
    | InChI Identifier | 
    
       Pemirolast¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H8N6O/c1-6-3-2-4-16-9(6)11-5-7(10(16)17)8-12-14-15-13-8/h2-5H,1H3,(H,12,13,14,15)/f/h14H
  potassium¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ Not Available 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Pemirolast¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 9-methyl-3-(2H-tetrazol-5-yl)pyrido[2,1-b]pyrimidin-4-one
  potassium¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ Not Available 
     | 
   
    
  |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ | 
                             
	         
	       | 
	           	  
       |  
	     |  
	   
	     	
 
  | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2022-06-03
              
 
              - 
                
                º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
                    
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  
  |  
             
             | 
         
         
         | 
         |