| |
|
|
|
|
|
 |
| |
|
½Ådz°ÕŸ¸¶À̽ÅȲ»ê¿°Å©¸²(°ÕŸ¸¶À̽ÅȲ»ê¿°)250g Shinpoong Gentamicin Sulfate Cream
|
|
ÀϹÝÀǾàǰ | ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
Àü¹®/ÀÏ¹Ý |
ÀϹÝ
|
|
Á¦Á¶È¸»ç |
½ÅdzÁ¦¾à(ÁÖ)
|
ÆÇ¸Åȸ»ç |
½ÅdzÁ¦¾à(ÁÖ)
|
Çã°¡Á¤º¸ |
Á¤»ó
(1982.07.29)
|
BIT ¾àÈ¿ºÐ·ù |
¿Ü¿ë Ç×±ÕÁ¦ (Antibiotics : Skin & Mucous Membrane)
|
º¹ÁöºÎºÐ·ù |
618[ÁÖ·Î ±×¶÷¾ç¼º, À½¼º±Õ¿¡ ÀÛ¿ëÇÏ´Â °Í ] |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå |
648502446 \9,639 ¿ø/250g/Åë(2024.07.01)(ÇöÀç¾à°¡)\9,640 ¿ø/250g/Åë(2022.01.01) (º¯°æÀü¾à°¡)
|
|
|
ATCÄÚµå |
Gentamicin / D06AX07 |
NDCÄÚµå |
[Proprietary Name Search _ ƯÇãµî·Ï¸í,»óÇ¥¸íÀ¸·Î °Ë»ö]
[Active Ingredient Search _ ÁÖ¼ººÐÀ¸·Î °Ë»ö]
[NDC Number Search _ NDCÄÚµå·Î °Ë»ö]
|
¼ººÐ / ÇÔ·® |
[½ÉÆò¿ø ÁÖ¼ººÐÄÚµå ±âÁØ ¼ººÐÇÔ·®Á¤º¸ Á¶È¸]

|
÷°¡Á¦ |
¼¼Åº¿Ã,
¼Ò¸£ºñź¸ð³ë½ºÅ׾Ʒ¹ÀÌÆ®,
½ºÅ׾Ƹ±¾ËÄÚ¿Ã,
À¯µ¿ÆÄ¶óÇÉ,
Á¤Á¦¼ö,
ÆÄ¶ó¿Á½Ãº¥Á¶»ê¸ÞÆ¿,
ÆÄ¶ó¿Á½Ãº¥Á¶»êÇÁ·ÎÇÊ,
Æú¸®¼Ò¸£º£ÀÌÆ®60,
ÇÁ·ÎÇÊ·»±Û¸®ÄÝ
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
648502446
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\9,639 ¿ø/250g/Åë(2024.07.01)(ÇöÀç¾à°¡)
\9,640 ¿ø/250g/Åë(2022.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ Å©¸²Á¦ÀÌ´Ù.
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
10±×·¥/Æ©ºê, 250±×·¥/Åë, 450±×·¥/Åë |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 250±×·¥ |
1 °³ |
8806485024409 |
8806485024461 |
|
|
| ÁÖ¼ººÐÄÚµå |
165138CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806485024409 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Â(1~30¡É) º¸°ü
|
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¡Û À¯È¿±ÕÁ¾
¿¬¼â±¸±Õ(A±º¥á, ¥â-¿ëÇ÷¼º), Æ÷µµ±¸±Õ(Æä´Ï½Ç¸®³ªÁ¦ »ý¼º±Õ Æ÷ÇÔ), ³ì³ó±Õ,¾Æ¿¡·Î¹ÚÅÍ ¾Æ¿¡·Î°Ô³×½º±Õ, ´ëÀå±Õ, º¯Çü±Õ, Æó·Å°£±Õ
¡Û ÀûÀÀÁõ
- 1Â÷ ÇǺΰ¨¿°Áõ : Àü¿°¼º³ó°¡Áø, Ç¥À缺¸ð³¶¿°, ³óâ, Á¾±â, ¸ðâ
- 2Â÷ ÇǺΰ¨¿°Áõ
Àü¿°¼º ½ÀÁø¾çÇǺο°, ³óÆ÷¼º°Ç¼±
ȳ󼺼¼±Õ¿¡ ÀÇÇÏ¿© 2Â÷ °¨¿°µÈ Áö·çÇǺο°, Á¢ÃËÇǺο°,â»ó ¹× ³óÆ÷¼º¿©µå¸§
Áø±Õ ¶Ç´Â ¹ÙÀÌ·¯½ºÀÇ °¨¿°¿¡ ÀÇÇÑ Áߺ¹ °¨¿°
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1¢¦4ȸ ȯºÎ¿¡ ¹Ù¸£°í ºÎµå·´°Ô ¹®Áö¸¥´Ù. ÇÊ¿ä½Ã °ÅÁ µ¤À» ¼ö ÀÖ´Ù. Àü¿°¼º ³ó°¡ÁøÀÎ °æ¿ì¿¡´Â ÀÌ ¾à°ú °¨¿°ºÎÀ§¿ÍÀÇ Á¢ÃËÀ» ÃÖ´ëÇÑÀ¸·Î Çϱâ À§ÇÏ¿© °¡ÇÇ(ºÎ½º·³, µüÁö)¸¦ Á¦°ÅÇÑ ÈÄ ¹Ù¸£´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. ÀÌ ¶§ ´Ù¸¥ Á¤»óÇǺΰ¡ ¿À¿°µÇÁö ¾Êµµ·Ï ÁÖÀÇÇÏ¸é¼ Á¦°ÅÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[º¸±â]
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â ´Ù¸¥ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è Ç×»ý¹°Áú(½ºÆ®·¾Å丶À̽Å, Ä«³ª¸¶À̽Å, °ÕŸ¸¶À̽Å, ³×¿À¸¶À̽Å) ¹× ¹Ù½ÃÆ®¶ó½Å¿¡ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) 1¼¼ ¹Ì¸¸ÀÇ ¿µ¾Æ
|
| ÀÌ»ó¹ÝÀÀ |
1) ÇǺΠ: ¹ßÁø, Á¢ÃËÇǺο° µî °ú¹Î¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
2) ±âŸ : ½ÅÀå¾Ö, ³Ã»ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Àå±â¿¬¿ëÇÏÁö ¾Ê´Â´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ÀÌ ¾àÀÇ »ç¿ë¿¡ ÀÖ¾î¼ ³»¼º±ÕÀÇ ¹ßÇö µîÀ» ¹æÁöÇϱâ À§ÇÏ¿© °¨¼ö¼ºÀ» È®ÀÎÇϰí Ä¡·á »ó ÇÊ¿äÇÑÃÖ¼Ò ±â°£¸¸ Åõ¿©ÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
2) ±¹¼Ò¿ë Ç×»ý¹°Áú »ç¿ëÀ¸·Î ¶§¶§·Î Áø±Õ·ù¸¦ Æ÷ÇÔÇÏ¿© ºñ°¨¼ö¼º±ÕÀÇ °úµµÇÑ Áõ½ÄÀ» ÃÊ·¡ÇÒ ¼ö ÀÖ´Ù. ÇǺÎÀÚ±Ø(È«¹Ý, °¡·Á¿òµî), °ú¹Î¹ÝÀÀ, Áߺ¹°¨¿°ÀÌ ¹ß»ýÇÒ ¶§´Â »ç¿ëÀ» ÁßÁöÇϰíÀûÀýÇÑ Ä¡·á¸¦ ÇÑ´Ù.
3) °¨ÀÛÇÒ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ°í °¨ÀÛ¡ÈÄ(°¡·Á¿ò, ¹ßÀû, Á¾Ã¢, ±¸Áø, ¼Ò¼öÆ÷ µî)°¡ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º¿¡´Â Ä¡·á »óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÉ°æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
ÀÌ ¾àÀÌ ¸ðÀ¯ ÁßÀ¸·Î ÀÌÇàÇÏ´Â Áö ¿©ºÎ´Â ¾Ë·ÁÁ® ÀÖÁö ¾ÊÀ¸³ª ÀÌ ¾àÀ» ¼öÀ¯ºÎ¿¡ Åõ¿© ½Ã ÁÖÀÇÇÑ´Ù.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
¾È°ú¿ëÀ¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Gentamicin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Aminoglycosides like gentamicin "irreversibly" bind to specific 30S-subunit proteins and 16S rRNA. Specifically gentamicin binds to four nucleotides of 16S rRNA and a single amino acid of protein S12. This interferes with decoding site in the vicinity of nucleotide 1400 in 16S rRNA of 30S subunit. This region interacts with the wobble base in the anticodon of tRNA. This leads to interference with the initiation complex, misreading of mRNA so incorrect amino acids are inserted into the polypeptide leading to nonfunctional or toxic peptides and the breakup of polysomes into nonfunctional monosomes.
|
| Pharmacology |
Gentamicin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Gentamicin is a broad spectrum aminoglycoside antibiotic. Aminoglycosides work by binding to the bacterial 30S ribosomal subunit, causing misreading of t-RNA, leaving the bacterium unable to synthesize proteins vital to its growth. Aminoglycosides are useful primarily in infections involving aerobic, Gram-negative bacteria, such as Pseudomonas, Acinetobacter, and Enterobacter. In addition, some mycobacteria, including the bacteria that cause tuberculosis, are susceptible to aminoglycosides. Infections caused by Gram-positive bacteria can also be treated with aminoglycosides, but other types of antibiotics are more potent and less damaging to the host. In the past the aminoglycosides have been used in conjunction with penicillin-related antibiotics in streptococcal infections for their synergistic effects, particularly in endocarditis. Aminoglycosides are mostly ineffective against anaerobic bacteria, fungi and viruses.
|
| Protein Binding |
Gentamicin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Low (between 0 and 30%)
|
| Half-life |
Gentamicin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 3-3¨ö hours in infants one week to six months of age; this increases to 5¨ö hours in full-term and large premature infants less than one week old.
|
| Absorption |
Gentamicin¿¡ ´ëÇÑ Absorption Á¤º¸ Injections lead to peak serum concentrations in 30-60 minutes. Topical gentamicin is readily absorbed from large burned, denuded, or granulating areas but not through intact skin. Absorption of gentamicin is faster and greater with the cream compared to the ointment. Gentamicin is absorbed in small quantities following topical application to the eye. Gentamicin is also absorbed in small amounts following topical application to the ear (especially if the eardrum is perforated or if tissue damage is present).
|
| Pharmacokinetics |
Gentamicin SulfateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ : Èí¼öµÇÁö ¾Ê´Â´Ù.
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú
- ºÐÆ÷¿ëÀû : ºÎÁ¾À̳ª º¹¼ö°¡ Àְųª ¼ö¾×À» °ú´Ù Åõ¿©ÇßÀ» ¶§ Áõ°¡µÇ°í, Å»¼ö½Ã¿¡ °¨¼ÒµÈ´Ù.
- ½Å»ý¾Æ : 0.4-0.6 L/kg
- ¼Ò¾Æ : 0.3-0.35 L/kg
- ¼ºÀÎ : 0.2-0.3 L/kg
Ç¥ 1. ´Ù¾çÇÑ Á¶Á÷À¸·Î ºÐÆ÷µÈ Á¤µµ (Ç÷¾×°úÀÇ ºñÀ² (%))
|
À§Ä¡ |
ºÐÆ÷ Á¤µµ |
|
´« |
¹Ì¹ÌÇÏ´Ù. |
|
ÁßÃ߽Űæ°è |
¹Ì¹ÌÇÏ´Ù.(25% ÀÌÇÏ) |
|
È丷 |
¿ì¼öÇÏ´Ù |
|
±â°üÁö ºÐºñ¹° |
¹Ì¹ÌÇÏ´Ù. |
|
Ÿ¾× |
¾î´ÀÁ¤µµ ºÐÆ÷µÈ´Ù.(10-50%) |
|
ÆóÁ¶Á÷ |
¿ì¼öÇÏ´Ù. |
|
º¹¼ö |
´Ù¾çÇÏ´Ù.(43-132%) |
|
º¹¸·¾× |
¹Ì¹ÌÇÏ´Ù. |
|
´ãÁó |
´Ù¾çÇÏ´Ù.(25-90%) |
|
´ãµµ ÆÐ»ö½Ã ´äÁó |
¹Ì¹ÌÇÏ´Ù. |
|
Ȱ¾× |
¿ì¼öÇÏ´Ù. |
|
»À |
¹Ì¹ÌÇÏ´Ù. |
|
Àü¸³¼± |
¹Ì¹ÌÇÏ´Ù. |
|
¿ä |
¿ì¼öÇÏ´Ù. |
|
½ÅÀåÁ¶Á÷ |
¿ì¼öÇÏ´Ù. |
- ³úô¼ö¾×À¸·ÎÀÇ ºÐÆ÷´Â ³ú¸·¿¡ ¿°ÁõÀÌ ÀÖÀ» ¶§µµ ¹Ì¹ÌÇÏ´Ù.
- ³úô¼ö¾× ´ë Ç÷¾×ÀÇ ³óµµºñ (%)
- Á¤»ó ³ú¸· : 0
- ¿°Áõ¼º ³ú¸· : 10-30
- ´Ü¹é°áÇÕ : 30% ÀÌÇÏ
- ¹Ý°¨±â :
- ½Å»ý¾Æ
- 1ÁÖ ÀÌÇÏ : 3-11.5 ½Ã°£
- 1ÁÖ-6°³¿ù : 3-3.5 ½Ã°£
- ¼ºÀÎ :
- 1.5-3 ½Ã°£
- ¸»±â ½ÅÁúȯ : 36-70 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ :
- ±ÙÀ°ÁÖ»ç : 30-90 ºÐ À̳»
- Á¤¸ÆÁÖ»ç : 30ºÐ ÁÖÀÔ ÈÄ 30ºÐ À̳»
- ¼Ò½Ç : Ŭ¸®·¯·±½º´Â ȯÀÚÀÇ ½Å±â´É¿¡ ÀÇÁ¸ÇÑ´Ù. ´ëºÎºÐÀÌ »ç±¸Ã¼ ¿©°ú¸¦ ÅëÇØ ¹Ìº¯Èü·Î ½Å¹è¼³
|
| Toxicity |
Gentamicin¿¡ ´ëÇÑ Toxicity Á¤º¸ Mouse, intravenous LD50: 52 mg/kg; rat, intravenous LD50: 96 mg/kg.
|
| Drug Interactions |
Gentamicin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Atracurium The agent increases the effect of muscle relaxantDoxacurium The agent increases the effect of muscle relaxantGallamine Triethiodide The agent increases the effect of muscle relaxantMetocurine The agent increases the effect of muscle relaxantMivacurium The agent increases the effect of muscle relaxantPancuronium The agent increases the effect of muscle relaxantPipecuronium The agent increases the effect of muscle relaxantRocuronium The agent increases the effect of muscle relaxantSuccinylcholine The agent increases the effect of muscle relaxantTubocurarine The agent increases the effect of muscle relaxantVecuronium The agent increases the effect of muscle relaxantBumetanide Increased ototoxicityEthacrynic acid Increased ototoxicityFurosemide Increased ototoxicityTorasemide Increased ototoxicityThalidomide Thalidomide increases the renal toxicity of the aminoglycosideCisplatin Increased risk of nephrotoxicityCefradine Increased risk of nephrotoxicityCephapirin Increased risk of nephrotoxicityCefamandole Increased risk of nephrotoxicityCefazolin Increased risk of nephrotoxicityCefonicid Increased risk of nephrotoxicityCefoperazone Increased risk of nephrotoxicityCeforanide Increased risk of nephrotoxicityCefotaxime Increased risk of nephrotoxicityCefotetan Increased risk of nephrotoxicityCefoxitin Increased risk of nephrotoxicityCeftazidime Increased risk of nephrotoxicityCeftizoxime Increased risk of nephrotoxicityCeftriaxone Increased risk of nephrotoxicityCefuroxime Increased risk of nephrotoxicityCephalothin Group Increased risk of nephrotoxicity
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Gentamicin¿¡ ´ëÇÑ Description Á¤º¸ A complex of three different closely related aminoglycoside sulfates, Gentamicins C1, C2, and C1(subA), obtained from Micromonospora purpurea and related species. They are broad-spectrum antibiotics, but may cause ear and kidney damage. They act to inhibit protein synthesis (genetic translation). [PubChem]
|
| Dosage Form |
Gentamicin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream TopicalLiquid OphthalmicOintment OphthalmicOintment TopicalSolution Auricular (otic)Solution IntravenousSolution OphthalmicSolution / drops Auricular (otic)Solution / drops Ophthalmic
|
| Drug Category |
Gentamicin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsProtein Synthesis Inhibitors
|
| Smiles String Canonical |
Gentamicin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CNC(C)C1CCC(N)C(O1)OC1C(N)CC(N)C(OC2OCC(C)(O)C(NC)C2O)C1O
|
| Smiles String Isomeric |
Gentamicin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN[C@H](C)[C@@H]1CC[C@@H](N)[C@@H](O1)O[C@H]1[C@H](N)C[C@H](N)[C@@H](O[C@@H]2OC[C@@](C)(O)[C@H](NC)[C@H]2O)[C@@H]1O
|
| InChI Identifier |
Gentamicin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3
|
| Chemical IUPAC Name |
Gentamicin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-[4,6-diamino-3-[3-amino-6-(1-methylaminoethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-methylaminooxane-3,5-diol
|
| Drug-Induced Toxicity Related Proteins |
GENTAMICIN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Phospholipase A Drug:gentamicin Toxicity:aminoglycoside toxicity. [¹Ù·Î°¡±â] Replated Protein:phospholipases C Drug:gentamicin Toxicity:aminoglycoside toxicity. [¹Ù·Î°¡±â] Replated Protein:Angiotensinase A Drug:gentamicin Toxicity:important consequences upon renal function and metabolism. [¹Ù·Î°¡±â] Replated Protein:Dipeptidylpeptidase IV Drug:gentamicin Toxicity:important consequences upon renal function and metabolism. [¹Ù·Î°¡±â] Replated Protein:Sodium/potassium-transporting ATPase Drug:Gentamicin Toxicity:necrosis. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2022-01-04
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|