| |
|
|
|
|
|
 |
| |
|
Ä®´ÏƾÁ¤(¿¤Ä«¸£´Ïƾ) Carnitine Tab.
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
656004300
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»öÀÇ ¿øÇü Çʸ§ÄÚÆÃÁ¤
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
90Á¤(10Á¤/PTP ¡¿ 9) |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 330¹Ð¸®±×·¥ |
90 Á¤ |
8806560043004 |
8806560043011 |
|
|
| ÁÖ¼ººÐÄÚµå |
124503ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806560043004 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Â(1~30¡É)º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. 1Â÷¼º, 2Â÷¼º Ä«¸£´Ïƾ°áÇÌÁõ
2. ÇãÇ÷¼º½ÉÁúȯ¿¡ ÀÇÇÑ ½É±Ù´ë»çÀå¾Ö : Çù½ÉÁõ, ±Þ¼º½É±Ù°æ»ö
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : ¿¤-Ä«¸£´ÏƾÀ¸·Î¼ 1ÀÏ 2-3gÀ» 2-3ȸ ºÐÇÒ °æ±¸Åõ¿©ÇÑ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
´ÙÀ½ ȯÀÚ¿¡´Â Åõ¿©ÇÏÁö ¸» °Í.
ÀÌ ¾à¿¡ °ú¹ÎÁõ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
ÀϽÃÀûÀÎ ±¸¿ª¡¤±¸Åä, º¹Åë, ¼³»ç, üÃë°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
ÀÌ ¾àÀ» º¹¿ëÇÑ È¯ÀÚ¿¡°Ô¼ ¹ßÁø, µÎµå·¯±â, ¾È¸éºÎÁ¾ÀÌ º¸°íµÇ¾ú´Ù.
ÀÌ ¾àÀ» º¹¿ëÇÑ ¿äµ¶Áõ ȯÀÚ¿¡°Ô¼ °æÁõÀÇ ±Ù¹«·ÂÁõÀÌ º¸°íµÇ¾ú´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
ÀÓ½ÅÁßÀÇ Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
¸ðÀ¯ÀÇ ÀÌÇàÀº ¾Ë·ÁÁø ¹Ù ¾øÀ¸³ª ¸¹Àº ¾àµéÀÌ ¸ðÀ¯·Î ÀÌÇàµÇ¹Ç·Î ¼öÀ¯Áß¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
±â¹Ð¿ë±â, ½Ç¿Â(1~30¡É)º¸°ü |
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
L-carnitine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Levocarnitine can be synthesised within the body from the amino acids lysine or methionine. Vitamin C (ascorbic acid) is essential to the synthesis of carnitine. Levocarnitine is a carrier molecule in the transport of long chain fatty acids across the inner mitochondrial membrane. It also exports acyl groups from subcellular organelles and from cells to urine before they accumulate to toxic concentrations. Only the L isomer of carnitine (sometimes called vitamin BT) affects lipid metabolism. Levocarnitine is handled by several proteins in different pathways including carnitine transporters, carnitine translocases, carnitine acetyltransferases and carnitine palmitoyltransferases.
|
| Pharmacology |
L-carnitine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Levocarnitine is a carrier molecule in the transport of long chain fatty acids across the inner mitochondrial membrane. It also exports acyl groups from subcellular organelles and from cells to urine before they accumulate to toxic concentrations. Lack of carnitine can lead to liver, heart, and muscle problems. Carnitine deficiency is defined biochemically as abnormally low plasma concentrations of free carnitine, less than 20 µmol/L at one week post term and may be associated with low tissue and/or urine concentrations. Further, this condition may be associated with a plasma concentration ratio of acylcarnitine/levocarnitine greater than 0.4 or abnormally elevated concentrations of acylcarnitine in the urine. Only the L isomer of carnitine (sometimes called vitamin BT) affects lipid metabolism. The "vitamin BT" form actually contains D,L-carnitine, which competitively inhibits levocarnitine and can cause deficiency. Levocarnitine can be used therapeutically to stimulate gastric and pancreatic secretions and in the treatment of hyperlipoproteinemias.
|
| Metabolism |
L-carnitine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
L-carnitine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ None
|
| Half-life |
L-carnitine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 17.4 hours (elimination) following a single intravenous dose.
|
| Absorption |
L-carnitine¿¡ ´ëÇÑ Absorption Á¤º¸ Absolute bioavailability is 15% (tablets or solution).
|
| Biotransformation |
L-carnitine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Major metabolites include trimethylamine N-oxide and [3H]-gamma-butyrobetaine.
|
| Toxicity |
L-carnitine¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50 > 8g/kg (mouse, oral). Adverse effects include hypertension, fever, tachycardia and seizures.
|
| Drug Interactions |
L-carnitine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
L-carnitine¿¡ ´ëÇÑ Description Á¤º¸ Constituent of striated muscle and liver. It is used therapeutically to stimulate gastric and pancreatic secretions and in the treatment of hyperlipoproteinemias. [PubChem]
|
| Drug Category |
L-carnitine¿¡ ´ëÇÑ Drug_Category Á¤º¸ MetaboliteNootropic AgentsNutraceuticalVitamin B ComplexVitamins (Vitamin B Complex)
|
| Smiles String Canonical |
L-carnitine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ C[N+](C)(C)CC(O)CC([O-])=O
|
| Smiles String Isomeric |
L-carnitine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[N+](C)(C)C[C@H](O)CC([O-])=O
|
| InChI Identifier |
L-carnitine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/m1/s1
|
| Chemical IUPAC Name |
L-carnitine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (3R)-3-hydroxy-4-trimethylazaniumylbutanoate
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2022-02-11
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|