|   | 
        
            
         | 
          | 
        
        
        
            | 
                
             | 
         
        
             | 
         
        
            
            
            
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    ¾Ëº£Ä¡ÄÜ¿¬Áúĸ½¶  Alvethicone Soft Cap.   
                    
                 | 
               
              
                | 
                     Àü¹®ÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |  
                              
                                  | 
                                   | 
                               
            
            
                
            
            
              
            
                            
              
                                                     
            
            
   |  
  
    | 
      
     | 
   
   
     | 
   
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
   
  
    
      
	
	  
	     |  
	    
	      
	        
            
                | Çã°¡Á¤º¸ | 
                         
	         
	       | 
	     
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        696601290  
	    
	    
          [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \0 ¿ø/1ĸ½¶(2022.02.01)(ÇöÀç¾à°¡) 
            \80 ¿ø/1ĸ½¶(2020.06.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
     [¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
   
    | Á¦Ç°¼º»ó | 
    
      ¹é»öÀÇ Á¡Á¶¾×ÀÌ µç ³ì»öÀÇ Å¸¿øÇü ¿¬Áúĸ½¶  
      
	    [Á¦ÇüÁ¤º¸ È®ÀÎ]
     |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    30ĸ½¶/º´, 300ĸ½¶/º´ | 
   
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 300¹Ð¸®±×·¥ | 
            300 ĸ½¶ | 
            8806966012901 | 
            8806966012925 | 
             | 
	     
        
        
            | 300¹Ð¸®±×·¥ | 
            30 ĸ½¶ | 
            8806966012901 | 
            8806966012918 | 
             | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      294300ACS  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806966012901 | 
   
  
  
  
  
   
    | º¸°ü¹æ¹ý | 
    ±â¹Ð¿ë±â, ½Ç¿Â(1~30¡É)º¸°ü | 
   
  
  
  
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      À§Àå°ü°è °æ·ÃÀÇ Áø°æ ¹× Àå³» °¡½º Á¦°Å, º¹ºÎÆØ¸¸À¸·Î ÀÎÇÑ ¼Òȱâ°è ÅëÁõÀÇ °æ°¨  
      
      
      
      
     | 
   
  
  
  
  
  
  
  
  
    
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
     [󹿾à¾î] 
      ¼ºÀÎ: 1ȸ 1ĸ½¶, 1ÀÏ 2〜3ȸ ½ÄÀü¿¡ º¹¿ëÇÑ´Ù.      
      	    
     | 
   
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    
      1) ÀÌ ¾àÀÇ ¼ººÐ¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ 
2) ÀúÇ÷¾Ð ȯÀÚ 
3) ¹«·Â¼º ÀåÆó»öÁõ ȯÀÚ 
     | 
   
  
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      ÀÌ ¾àÀ» Åõ¿©ÇÏ´Â µ¿¾È ¹Ù¶÷Á÷ÇÏÁö ¾Ê°Å³ª ºÒÇÊ¿äÇÑ È¿°ú°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. 
1) °ú¹Î¹ÝÀÀ : µå¹°°Ô µÎµå·¯±â, °¡·Á¿òÁõ, ¹ßÁø ¹× ¾Æ³ªÇʶô½Ã½º¸¦ Æ÷ÇÔÇÏ´Â ¾Ë·¯Áö¹ÝÀÀÀÌ ³ªÅ¸³¯¼ö ÀÖÀ¸¸ç ÈĵκÎÁ¾, ¼ïÀ» µ¿¹ÝÇÒ ¼ö ÀÖ´Ù. 
2) ¼Òȱâ°è : ¶§¶§·Î ¿¬º¯, º¹ºÎºÒÄè°¨, ¼³»ç, º¹Åë, ±¸Åä, ±¸¿ª, º¹ºÎÁ߾а¨, ½Ä¿åºÎÁøÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. 
3) ±âŸ : µå¹°°Ô °£±â´É ÀÌ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ°í Åõ¿© Áß´Ü ÈÄ Á¤»óÈ µÉ ¼ö ÀÖÀ¸¸ç, µå¹°°Ô µÎÅë, ¾îÁö·³ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. 
4) ±¹³»¿¡¼ 6³âµ¿¾È 786¸íÀ» ´ë»óÀ¸·Î ½Ç½ÃÇÑ ½ÃÆÇÈÄ Á¶»ç°á°ú º¯ºñ 1·Ê°¡ º¸°íµÇ¾ú´Ù. 
          
     | 
   
  
  
    
   
    | ÀϹÝÀû ÁÖÀÇ | 
    1) µµÇÎÅ×½ºÆ®¸¦ ½Ç½ÃÇÒ ¶§ ¾ç¼º¹ÝÀÀÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. 
2) Á¤ÇØÁø ¿ë¹ý¤ý¿ë·®À» ÁöÄÑ¾ß ÇÑ´Ù. 
3) ÀÌ ¾àÀÇ º¹¿ëÀ¸·Î ÀÌ»óÁõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿¡°Ô ¾Ë¸°´Ù. 
4) ´Ù¸¥ ¾à¹°°úÀÇ ÀáÀçÀûÀÎ »óÈ£ÀÛ¿ëÀ» ÇÇÇϱâ À§ÇÏ¿© º¹¿ëÁßÀÎ ¾à¹°À» ÀÇ»ç ¶Ç´Â ¾à»ç¿¡°Ô ¾Ë¸°´Ù. 
 | 
   
  
  
  
  
  
  
   
    | ÀӺο¡ ´ëÇÑ Åõ¿© | 
    
      
	[ÀӺαݱ⠼ººÐ Á¶È¸]       
      µ¿¹°½ÃÇè¿¡¼ Áß´ëÇÑ Å¾Ƶ¶¼º ¶Ç´Â ÃÖ±âÇü¼ºÀ» ³ªÅ¸³»Áö´Â ¾Ê¾ÒÀ¸³ª, »ç¶÷¿¡ ´ëÇØ¼´Â È®ÀεÇÁö ¾Ê¾ÒÀ¸¸ç, ÀӽűⰣ ÁßÀÇ ¾à¹°ÀÇ »ç¿ëÀº ½ÅÁßÇÏ¿©¾ß Çϱ⠶§¹®¿¡ ÀӺο¡°Ô´Â Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. 
     | 
   
  
  
  
  
   
    | ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© | 
    °ËÅäµÈ ¹Ù°¡ ¾øÀ¸¹Ç·Î ¼öÀ¯ºÎ¿¡°Ô´Â Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
  | 
   
  
  
  
  
   
    | ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© | 
    
      
       
      ¸¸ 18¼¼ ¹Ì¸¸ÀÇ ¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼º‧À¯È¿¼ºÀº È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù.
  | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | °ú·®Åõ¿© ¹× óġ | 
    °ú·® Åõ¿©½Ã ÀúÇ÷¾Ð ¹× ¾ÆÆ®·ÎÇÉ À¯»ç µ¶¼ºÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. °ú·®Åõ¿©½Ã óġ´Â ÀúÇ÷¾Ð¿¡ ´ëÇÑ º¸Á¶¿ä¹ý°ú ÇÔ²² ¾ÆÆ®·ÎÇÉ ÇØµ¶°ú µ¿ÀÏÇÑ ¿ä¹ýÀ» ÇàÇÑ´Ù.
  | 
   
  
  
  
  		
  
  
   
    | º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ | 
    1) ¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù. 
2) ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³Ö´Â °ÍÀº »ç°í¿øÀÎÀÌ µÇ°Å³ª ǰÁúÀ¯Áö¸é¿¡¼ ¹Ù¶÷Á÷ÇÏÁö ¾ÊÀ¸¹Ç·Î À̸¦ ÁÖÀÇÇÒ °Í 
 | 
   
  	
  
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
       
     | 
      
  
  
      							
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¤º¸¿ä¾à | 
                 
	         
	       | 
	           	    
	     |  
	    | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ | 
                 
	         
	       | 
	           	    
	     |  
	    | 	 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¦Ç°Á¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | º¹¾àÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  	
  
  
  
   
    | º¹¾à¶óº§ | 
    
    
    
      | À̹ÌÁö | 
      º¹¾à¼³¸í | 
     
    
    
        | 
      º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
     |  
    
      
	
	  
            | *  | 
	    º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. | 
	   
	  
            | *  | 
	    º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. | 
	   
	  
            | *  | 
	    ±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. | 
	   
	   
     |   
     | 
   
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ½É»çÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | ÇмúÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Pharmacology | 
     
       Alverine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Alverine is a smooth muscle relaxant. Smooth muscle is a type of muscle that is not under voluntary control; it is the muscle present in places such as the gut and uterus. Alverine acts directly on the muscle in the gut, causing it to relax. This prevents the muscle spasms which occur in the gut in conditions such as irritable bowel syndrome and diverticular disease. Diverticular disease is a condition in which small pouches form in the gut lining. These pouches can trap particles of food and become inflamed and painful. In irritable bowel syndrome the normal activity of the gut muscle is lost. The muscle spasms result in symptoms such as heartburn, abdominal pain and bloating, constipation or diarrhoea. By relaxing the gut muscle, alverine citrate relieves the symptoms of this condition. Alverine also relaxes the smooth muscle in the womb (uterus). It is therefore also used to treat painful menstruation, which is caused by muscle spasms in the uterus (dysmenorrhea). 
     | 
   
  
   
    | Absorption | 
    
       Alverine¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available 
     | 
   
  
   
    | Pharmacokinetics | 
    
       SimethiconeÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
	- ¼Ò½Ç : ¹Ìº¯Èü·Î º¯¹è¼³µÈ´Ù.
 
  
 
	 
	 Alverine citrateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
- Èí¼ö : À§Àå°üÀ¸·ÎºÎÅÍ Èí¼ö
 - ´ë»ç : ºü¸£°Ô ´ë»ç
 - ÃÖ°í Ç÷Áß³óµµ µµ´Þ ½Ã°£ : 1¡1.5½Ã°£
 - ´ë»ç ¹× ¹è¼³ : ´ë»çü ÇüÅ·Π½Å¹è¼³
  
 	 
	 
	
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Description | 
    
       Alverine¿¡ ´ëÇÑ Description Á¤º¸ Alverine is a smooth muscle relaxant. Smooth muscle is a type of muscle that is not under voluntary control; it is the muscle present in places such as the gut and uterus. Alverine acts directly on the muscle in the gut, causing it to relax. This prevents the muscle spasms which occur in the gut in conditions such as irritable bowel syndrome and diverticular disease. It is used to  relieve cramps or spasms of the stomach and intestines. It is also useful in treating irritable bowel syndrome (IBS) and similar conditions. It can also be used to help relieve period pain. 
     | 
   
  
   
    | Drug Category | 
    
       Alverine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antispasmodics 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Alverine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCN(CCCC1=CC=CC=C1)CCCC1=CC=CC=C1 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Alverine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN(CCCC1=CC=CC=C1)CCCC1=CC=CC=C1 
     | 
   
  
   
    | InChI Identifier | 
    
       Alverine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C20H27N/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20/h3-8,11-14H,2,9-10,15-18H2,1H3 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Alverine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 
     | 
   
    
  |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ | 
                             
	         
	       | 
	           	  
       |  
	     |  
	   
	     	
 
  | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-10-21
              
 
              - 
                
                º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
                    
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  
  |  
             
             | 
         
         
         | 
         |