| |
|
|
|
|
|
 |
| |
|
Ǫ¶õÄÝÅ©¸²(È÷µå·ÎÄÚ¸£Æ¼¼ÕºÎƼ·¹ÀÌÆ®) 10g PLANCOL CREAM.[Hydrocortisone butyrate]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
644904291
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/10g/°³(2018.03.01)(ÇöÀç¾à°¡)
\660 ¿ø/10g/°³(2016.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö ³»Áö À¯¹é»öÀÇ Å©¸²Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
10g, 20g, 100g
|
| ÁÖ¼ººÐÄÚµå |
171130CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806449042906 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â
|
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
½ÀÁø¤ýÇǺο°±º(ÁøÇ༺ ÁöÀå°¢ÇÇÁõ, ¿©¼º¾È¸éÈæÇÇÁõ, ¸¸¼º´Ü¼øÅ¼±, ¹æ»ç¼±ÇǺο°, ±¤ÇǺο°À» Æ÷ÇÔ), °Ç¼±, ¼Õ¤ý¹ß¹Ù´Ú³óÆ÷Áõ, ¾çÁø±º(±¸ÁøµÎµå·¯±â¸¦ Æ÷ÇÔ), ¹ú·¹¹°¸°µ¥, ÆíÆòÈ«»öż±, ¸¸¼º¿øÆÇ»óÈ«¹Ý¼º·çǪ½º
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1-3ȸ Àû´ç·®À» ȯºÎ¿¡ ¹Ù¸£°í Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
1) ¼¼±Õ(°áÇÙ, ¸Åµ¶ µî)¤ýÁø±Õ(ĵð´ÙÁõ, ¹é¼± µî)¤ý¹ÙÀÌ·¯½º(´ë»óÆ÷Áø, ´Ü¼øÆ÷Áø, ¼öµÎ, Á¾µÎÁõ µî)¤ýµ¿¹°(¿È, »ç¸é¹ßÀÌ µî)¼º ÇǺΰ¨¿°Áõ ȯÀÚ(Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
2) ÀÌ ¾à ¶Ç´Â ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ
3) °í¸· õ°øÀÌ ÀÖ´Â ½ÀÁø¼º ¿ÜÀ̵µ¿° ȯÀÚ(õ°øºÎÀ§ÀÇ Ä¡À¯Áö¿¬ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
4) ±Ë¾ç(º£Ã¼Æ®º´ Á¦¿Ü), Á¦2µµ ½ÉÀ缺 ÀÌ»óÀÇ È»ó¤ýµ¿»ó ȯÀÚ(ÇǺÎÀç»ýÀÌ ¾ïÁ¦µÇ¾î Ä¡À¯°¡ Áö¿¬µÉ ¼ö ÀÖ´Ù)
5) ÀÔÁÖÀ§ÇǺο°, º¸Åë¿©µå¸§, ÁÖ»ç ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ
2) À¯¤ý¼Ò¾Æ
3) °í·ÉÀÚ |
| ÀÌ»ó¹ÝÀÀ |
1) ÇǺÎ
¨ç °¨¿°Áõ : ÇǺÎÀÇ ¼¼±Õ¼º(Àü¿°¼º ³ó°¡Áø, ¸ð³¶¿° µî) ¹× Áø±Õ¼º(ĵð´ÙÁõ, ¹é¼± µî) °¨¿°ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù[¹ÐºÀºØ´ë¹ý(ODT)ÀÇ °æ¿ì ³ªÅ¸³ª±â ½±´Ù]. ÀÌ¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â ÀûÀýÇÑ Ç×±ÕÁ¦³ª Ç×Áø±ÕÁ¦ µîÀ» º´¿ëÇϰí Áõ»óÀÌ ½Å¼ÓÈ÷ °³¼±µÇÁö ¾ÊÀ» °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
¨è ÀϹÝÀû ÇǺÎÁõ»ó : ¸ð³¶¿°, ºÎ½º·³, ÇǺÎÀÚ±Ø, ÀÚÅë, ¹ß¿, ÀÛ¿°¨, ¹ßÁø, ¹ßÀû, È«Á¶, °¡·Á¿ò, ÇǺΰÇÁ¶, ³óÆ÷¼ºÇǺο°, ¾Ë·¹¸£±â¼º Á¢ÃËÇǺο°, ¶¡¶ì, ÇÑÁø, »óó¾ÇÈ, ¿åâ, ³óÆ÷Áõ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
¨é Àå±â ¿¬¿ë : ½ºÅ×·ÎÀ̵强 ¿©µå¸§, ½ºÅ×·ÎÀ̵强 ÇǺÎ(ÇǺÎÀ§Ãà, ¸ð¼¼Ç÷°üÈ®Àå, ÀÚ¹Ý), ½ºÅ×·ÎÀ̵强 ÁÖ»ç, ÀÔÁÖÀ§ÇǺο°(ÀÔÁÖÀ§¤ý¾È¸éÀüü¿¡ È«¹Ý, ±¸Áø, ¸ð¼¼Ç÷°üÈ®Àå, µüÁö, Àμ³), ¾î¸°¼±(åÛ×÷àÈ)¾ç ÇǺκ¯È, ´Ù¸ð, »ö¼ÒÅ»½Ç, ¼±Á¶, ¼öÆ÷¼ºÇǺο°, ¾ÆÅäÇÇÇǺο°, ÇǺÎÃâÇ÷ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â õõÈ÷ »ç¿ë·®À» ÁÙ¿© ÄÚ¸£Æ¼ÄÚÀ̵带 ÇÔÀ¯ÇÏÁö ¾ÊÀº ¾àÀ¸·Î ¹Ù²Ù¾î »ç¿ëÇÑ´Ù.
2) ³»ºÐºñ°è : ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ¹ÐºÀºØ´ë¹ý¿¡ ÀÇÇØ ÄÚ¸£Æ¼ÄÚÀ̵å Àü½Å Åõ¿©¿Í °°Àº ³úÇϼöü¤ýºÎ½ÅÇÇÁú°è ±â´ÉÀÇ ¾ïÁ¦¸¦ °¡Á®¿Ã ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
3) ´« : ¾È°ËÇǺο¡ »ç¿ë½Ã ¾È¾Ð »ó½Â, ³ì³»ÀåÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ƯÈ÷ ¹ÐºÀºØ´ë¹ý¿¡ ÀÇÇØ Èij¶ÇϹ鳻Àå, ³ì³»Àå µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ºóµµºÒ¸íÀÇ ½Ã¾ßÈ帲ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ÇǺΠ°¨¿°À» ¼ö¹ÝÇÏ´Â ½ÀÁø¤ýÇǺο°¿¡´Â »ç¿ëÇÏÁö ¾Ê´Â °ÍÀ» ¿øÄ¢À¸·Î ÇÏÁö¸¸ ºÎµæÀÌÇÏ°Ô ÀÌ ¾àÀ» »ç¿ëÇÏ´Â °æ¿ì¿¡´Â ¸ÕÀú ÀûÀýÇÑ Ç×±ÕÁ¦(Àü½ÅÀû¿ë), Ç×Áø±ÕÁ¦·Î Ä¡·áÇϰųª À̵é°úÀÇ º´¿ëÀ» °í·ÁÇÑ´Ù.
2) ±¹¼Ò ÄÚ¸£Æ¼ÄÚÀ̵åÀÇ Àü½ÅÀû Èí¼ö´Â ¸î¸î ȯÀÚ¿¡¼ °¡¿ªÀûÀÎ ½Ã»óÇϺÎ-³úÇϼöü-ºÎ½Å(HPA) ÃàÀÇ ¾ïÁ¦, Äí½ÌÁõÈıº, °úÇ÷´çÁõ, ´ç´¢ µîÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ±¹¼Ò ÄÚ¸£Æ¼ÄÚÀ̵带 ±¤¹üÀ§ÇÑ Ã¼Ç¥¸é ¶Ç´Â ¹ÐºÀºØ´ë¹ý ÇÏ¿¡ »ç¿ëÇϴ ȯÀÚ´Â Á¤±âÀûÀ¸·Î Ç÷Áß ÄÚ¸£Æ¼¼Ö ³óµµ, ¿äÁß¿¡ À¯¸®µÇ´Â ÄÚ¸£Æ¼¼ÖÀ» ÃøÁ¤Çϰųª ACTH ÀڱؽÃÇèÀ» ÇÏ¿© HPAÃà ¾ïÁ¦¸¦ °Ë»çÇÑ´Ù.
3) ±¹¼Ò ÄÚ¸£Æ¼ÄÚÀ̵åÀÇ Àü½ÅÀû Èí¼ö·Î ÀÎÇØ HPAÃàÀÌ ¾ïÁ¦µÇ¾ú´Ù¸é ¾à¹°»ç¿ëÀÇ ÁßÁö, Åõ¿©ºóµµÀÇ °¨¼Ò, Ȱ¼ºÀÌ ¾àÇÑ ÄÚ¸£Æ¼ÄÚÀ̵å·ÎÀÇ ´ëü µîÀÇ ¹æ¹ýÀ» ½ÃµµÇϰí ÀϹÝÀûÀ¸·Î ±¹¼Ò ÄÚ¸£Æ¼ÄÚÀÌµå ¾à¹°Åõ¿© ÁßÁö ÈÄ HPAÃà ±â´ÉÀº ½Å¼ÓÈ÷ ȸº¹µÈ´Ù.
4) Áõ»óÀÌ °³¼±µÇÁö ¾Ê°Å³ª ¾ÇȵǴ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
5) Áõ»óÀÌ °³¼±µÇ¸é °¡´ÉÇÑ ÇÑ ºü¸¥ ½ÃÀÏ ³»¿¡ »ç¿ëÀ» ÁßÁöÇÑ´Ù.
6) Àü½Å ¹× ±¹¼Ò ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀÌµå »ç¿ëÀ¸·Î ½Ã·ÂÀå¾Ö°¡ º¸°íµÉ ¼ö ÀÖ´Ù. ȯÀÚ¿¡°Ô ½Ã¾ßÈ帲 ¶Ç´Â ±âŸ ½Ã·ÂÀå¾Ö¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì, ȯÀÚ¸¦ ¾È°úÀǻ翡°Ô º¸³»¾î ¹é³»Àå, ³ì³»Àå ¶Ç´Â Àü½Å ¹× ±¹¼Ò ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀÌµå »ç¿ë ÈÄ º¸°íµÈ Áß½ÉÀå¾×¸Æ¶ô¸Á¸·º´(CSCR)°ú °°Àº Èñ±ÍÁúȯÀ» Æ÷ÇÔÇÏ¿© ¹ß»ý °¡´ÉÇÑ ¿øÀÎ Æò°¡¸¦ °í·ÁÇØ¾ß ÇÑ´Ù. |
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
1) µ¿¹°½ÇÇè¿¡¼ ºñ±³Àû ÀûÀº ¿ë·®ÀÇ ÄÚ¸£Æ¼ÄÚÀ̵带 Àü½ÅÀûÀ¸·Î Åõ¿©ÇÑ °æ¿ì, Á» ´õ °·ÂÇÑ ÄÚ¸£Æ¼ÄÚÀ̵å ÇǺΠµµÆ÷·Î ÀÎÇØ ±âÇü¹ß»ýÀÌ ³ªÅ¸³µ´Ù.
2) ÀӺο¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ëÀ» ÇÇÇϰí Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
±¹¼ÒÀûÀ¸·Î Åõ¿©ÇÑ ÄÚ¸£Æ¼ÄÚÀ̵尡 ¸ðÀ¯·Î ÀÌÇàµÇ´ÂÁö ¿©ºÎ´Â ¾Ë·ÁÁ® ÀÖÁö´Â ¾ÊÀ¸³ª Àü½ÅÀûÀ¸·Î Åõ¿©µÈ ÄÚ¸£Æ¼ÄÚÀ̵尡 ¸ðÀ¯ ÁßÀ¸·Î ÀÌÇàµÇ¹Ç·Î Àå±â°£ ¶Ç´Â ±¤¹üÀ§ÇÏ°Ô »ç¿ëÇÏ´Â °æ¿ì ¼öÀ¯¸¦ ÇÇÇÑ´Ù. |
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
1) ¼Ò¾Æ´Â üÁß´ç üǥ¸éÀûÀÇ ºñÀ²ÀÌ ¼ºÀκ¸´Ù Ä¿¼ ÄÚ¸£Æ¼ÄÚÀ̵å·Î ÀÎÇØ HPAÃà ¾ïÁ¦, Äí½ÌÁõÈıº, ¹ßÀ°Àå¾Ö µîÀÌ ³ªÅ¸³ª±â ½¬¿ì¹Ç·Î ÁÖÀÇÇÑ´Ù.
2) ±âÀú±Í µîÀº ¹ÐºÀºØ´ë¹ý°ú °°Àº ÀÛ¿ëÀ» ³ªÅ¸³¾ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
3) 18¼¼ ÀÌÇÏ È¯ÀÚ¿¡´Â ƯÈ÷ ¿ä±¸µÇÁö ¾Ê´Â ÇÑ »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| °í·ÉÀÚ¿¡ ´ëÇÑ Åõ¿© |
ÀϹÝÀûÀ¸·Î °í·ÉÀÚ¿¡¼´Â ºÎÀÛ¿ëÀÌ ³ªÅ¸³ª±â ½¬¿ì¹Ç·Î ´ë·®, Àå±â°£, ±¤¹üÀ§ÇϰÔ(ƯÈ÷ ¹ÐºÀºØ´ë¹ý) »ç¿ëÇÒ °æ¿ì ÃæºÐÈ÷ °üÂûÇÏ´Â µî ÁÖÀÇÇÑ´Ù. |
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) ¾È°ú¿ëÀ¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
2) ÈÀåÀ̳ª ¸éµµ ÈÄ µî Ä¡·á ÀÌ¿ÜÀÇ ¸ñÀûÀ¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
3) ÀÇ»çÀÇ °¨µ¶ ¾øÀÌ ¹ÐºÀºØ´ë¹ýÀ» »ç¿ëÇÏÁö ¾Ê´Â´Ù(ƯÈ÷ ¹ÐºÀºØ´ë¹ýÀ» »ç¿ëÇÒ °æ¿ì ¼¼±Õ°¨¿°ÀÌ ³ªÅ¸³ª±â ½¬¿ì¹Ç·Î Àû¿ëÀü¿¡ ȯºÎ¸¦ û°áÈ÷ ÇÑ´Ù). |
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù. |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
(ÀӽŠ1±â Åõ¿©½Ã )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Hydrocortisone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Hydrocortisone binds to the cytosolic glucocorticoid receptor. After binding the receptor the newly formed receptor-ligand complex translocates itself into the cell nucleus, where it binds to many glucocorticoid response elements (GRE) in the promoter region of the target genes. The DNA bound receptor then interacts with basic transcription factors, causing the increase in expression of specific target genes. The anti-inflammatory actions of corticosteroids are thought to involve lipocortins, phospholipase A2 inhibitory proteins which, through inhibition arachidonic acid, control the biosynthesis of prostaglandins and leukotrienes. Specifically glucocorticoids induce lipocortin-1 (annexin-1) synthesis, which then binds to cell membranes preventing the phospholipase A2 from coming into contact with its substrate arachidonic acid. This leads to diminished eicosanoid production. The cyclooxygenase (both COX-1 and COX-2) expression is also suppressed, potentiating the effect. In another words, the two main products in inflammation Prostaglandins and Leukotrienes are inhibited by the action of Glucocorticoids. Glucocorticoids also stimulate the lipocortin-1 escaping to the extracellular space, where it binds to the leukocyte membrane receptors and inhibits various inflammatory events: epithelial adhesion, emigration, chemotaxis, phagocytosis, respiratory burst and the release of various inflammatory mediators (lysosomal enzymes, cytokines, tissue plasminogen activator, chemokines etc.) from neutrophils, macrophages and mastocytes. Additionally the immune system is suppressed by corticosteroids due to a decrease in the function of the lymphatic system, a reduction in immunoglobulin and complement concentrations, the precipitation of lymphocytopenia, and interference with antigen-antibody binding.
|
| Pharmacology |
Hydrocortisone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Hydrocortisone is the most important human glucocorticoid. It is essential for life and regulates or supports a variety of important cardiovascular, metabolic, immunologic and homeostatic functions. Topical hydrocortisone is used for its anti-inflammatory or immunosuppressive properties to treat inflammation due to corticosteroid-responsive dermatoses. Glucocorticoids are a class of steroid hormones characterised by an ability to bind with the cortisol receptor and trigger a variety of important cardiovascular, metabolic, immunologic and homeostatic effects. Glucocorticoids are distinguished from mineralocorticoids and sex steroids by having different receptors, target cells, and effects. Technically, the term corticosteroid refers to both glucocorticoids and mineralocorticoids, but is often used as a synonym for glucocorticoid. Glucocorticoids suppress cell-mediated immunity. They act by inhibiting genes that code for the cytokines IL-1, IL-2, IL-3, IL-4, IL-5, IL-6, IL-8 and TNF-alpha, the most important of which is the IL-2. Reduced cytokine production limits T cell proliferation. Glucocorticoids also suppress humoral immunity, causing B cells to express lower amounts of IL-2 and IL-2 receptors. This diminishes both B cell clonal expansion and antibody synthesis. The diminished amounts of IL-2 also leads to fewer T lymphocyte cells being activated.
|
| Metabolism |
Hydrocortisone¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Hydrocortisone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 95%
|
| Half-life |
Hydrocortisone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 6-8 hours
|
| Absorption |
Hydrocortisone¿¡ ´ëÇÑ Absorption Á¤º¸ Topical corticosteroids can be absorbed from normal intact skin. Inflammation and/or other disease processes in the skin increase percutaneous absorption.
|
| Pharmacokinetics |
Hydrocortisone butyrateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : Á÷ÀåÀ» Á¦¿ÜÇÑ ¸ðµç Åõ¿©°æ·Î¿¡¼ ºü¸£°Ô Èí¼öµÈ´Ù.
- ´ë»ç : °£¿¡¼ ´ë»çµÈ´Ù.
- »ý¸®Àû ¹Ý°¨±â : 8¡12½Ã°£
- ¼Ò½Ç : ÁÖ·Î 17-hydroxysteroids¿Í 17-ketosteroidsÀÇ ÇüÅ·Π½Å¹è¼³µÈ´Ù.
- ¿ëÇØ¼ºÀÌ Å« ´Ù¸¥ ¾à¹°°ú ºñ±³ÇßÀ» ¶§ hydrocortisone acetate´Â ÀÛ¿ë¹ßÇö½Ã°£Àº ´À¸®Áö¸¸ ÀÛ¿ëÁö¼Ó½Ã°£ÀÌ ±æ´Ù.
- Hydrocortisone sodium succinate´Â ¹°¿¡ ½±°Ô ³ì¾Æ »¡¸® Ȱ¼ºÈµÈ´Ù.
|
| Biotransformation |
Hydrocortisone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Primarily hepatic via CYP3A4
|
| Toxicity |
Hydrocortisone¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects include inhibition of bone formation, suppression of calcium absorption and delayed wound healing
|
| Drug Interactions |
Hydrocortisone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Ambenonium The corticosteroid decreases the effect of anticholinesterasesEdrophonium The corticosteroid decreases the effect of anticholinesterasesNeostigmine The corticosteroid decreases the effect of anticholinesterasesPyridostigmine The corticosteroid decreases the effect of anticholinesterasesAspirin The corticosteroid decreases the effect of salicylatesBismuth Subsalicylate The corticosteroid decreases the effect of salicylatesSalicylate-magnesium The corticosteroid decreases the effect of salicylatesSalicylate-sodium The corticosteroid decreases the effect of salicylatesSalsalate The corticosteroid decreases the effect of salicylatesTrisalicylate-choline The corticosteroid decreases the effect of salicylatesWarfarin The corticosteroid alters the anticoagulant effectAcenocoumarol The corticosteroid alters the anticoagulant effectDicumarol The corticosteroid alters the anticoagulant effectAnisindione The corticosteroid alters the anticoagulant effectCholestyramine Cholestyramine decreases the effect of hydrocortisoneColestipol Cholestyramine decreases the effect of hydrocortisoneAmobarbital The barbiturate decreases the effect of the corticosteroidAprobarbital The barbiturate decreases the effect of the corticosteroidButabarbital The barbiturate decreases the effect of the corticosteroidButalbital The barbiturate decreases the effect of the corticosteroidButethal The barbiturate decreases the effect of the corticosteroidDihydroquinidine barbiturate The barbiturate decreases the effect of the corticosteroidHeptabarbital The barbiturate decreases the effect of the corticosteroidHexobarbital The barbiturate decreases the effect of the corticosteroidMethohexital The barbiturate decreases the effect of the corticosteroidMethylphenobarbital The barbiturate decreases the effect of the corticosteroidPentobarbital The barbiturate decreases the effect of the corticosteroidPhenobarbital The barbiturate decreases the effect of the corticosteroidPrimidone The barbiturate decreases the effect of the corticosteroidQuinidine barbiturate The barbiturate decreases the effect of the corticosteroidSecobarbital The barbiturate decreases the effect of the corticosteroidTalbutal The barbiturate decreases the effect of the corticosteroidRifampin The enzyme inducer decreases the effect of the corticosteroidPhenytoin The enzyme inducer decreases the effect of the corticosteroidMephenytoin The enzyme inducer decreases the effect of the corticosteroidFosphenytoin The enzyme inducer decreases the effect of the corticosteroidEthotoin The enzyme inducer decreases the effect of the corticosteroidMidodrine Increased arterial pressure
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Hydrocortisone¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food to reduce irritation. Calcium, phosphorous, potassium, Vitamin A, C, D and zinc needs increased with long term use.
|
| Drug Target |
[Drug Target]
|
| Description |
Hydrocortisone¿¡ ´ëÇÑ Description Á¤º¸ The main glucocorticoid secreted by the adrenal cortex. Its synthetic counterpart is used, either as an injection or topically, in the treatment of inflammation, allergy, collagen diseases, asthma, adrenocortical deficiency, shock, and some neoplastic conditions. [PubChem]
|
| Dosage Form |
Hydrocortisone¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Aerosol RectalCream TopicalEnema RectalLiquid TopicalLotion TopicalOintment OphthalmicOintment TopicalPowder, for solution IntramuscularPowder, for solution IntravenousTablet Oral
|
| Drug Category |
Hydrocortisone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-inflammatory Agents
|
| Smiles String Canonical |
Hydrocortisone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC(=O)C=C1CCC1C3CCC(O)(C(=O)CO)C3(C)CC(O)C21
|
| Smiles String Isomeric |
Hydrocortisone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@](O)(C(=O)CO)[C@@]3(C)C[C@H](O)[C@H]21
|
| InChI Identifier |
Hydrocortisone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1
|
| Chemical IUPAC Name |
Hydrocortisone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one
|
| Drug-Induced Toxicity Related Proteins |
HYDROCORTISONE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Interleukin-8 Drug:hydrocortisone Toxicity:inflammation. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-07-25
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|