|   | 
        
            
         | 
          | 
        
        
        
            | 
                
             | 
         
        
             | 
         
        
            
            
            
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    ¼¼Æ®¶ô»ìÇ÷¯½ºÁ¡ÀÌ¾× 10mL  CETRAXAL PLUS OTIC SOLUTION  
                    
                 | 
               
              
                
                     Àü¹®ÀǾàǰ | ±Þ¿©  
                         |  
                    
                    	
                    
                 | 
               
              
                | 
					
                     
                     ¼öÀÔÀǾàǰ
	                
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |  
                              
                                  | 
                                   | 
                               
            
            
                
            
            
              
            
             |  
            
                
                
                
                      | 
                    Á¦Ç°º° ÀӺαݱ⠰í½Ã | 
                 
                 
                 | 
             
             |  
            
                | 
                 1µî±Þ: ¿øÄ¢Àû »ç¿ë±Ý±â / 2µî±Þ: ¸íÈ®ÇÑ ÀÓ»óÀû ±Ù°Å ¶Ç´Â »çÀ¯°¡ ÀÖ´Â °æ¿ì ºÎµæÀÌÇÏ°Ô »ç¿ë / Mµî±Þ: ÀÓ»óÀû»óȲ¿¡ µû¶ó 1µî±Þ ¶Ç´Â 2µî±ÞÀ¸·Î ºÐ·ùµÇ´Â ¼ººÐ 
                
                
                    | ¼ººÐ¸í | 
                    ¼ººÐÄÚµå | 
                    ±Ý±âµî±Þ | 
                    °í½Ã¹øÈ£ | 
                    °í½ÃÀÏÀÚ | 
                    ºñ°í | 
                 
                
                    | Fluocinolone acetonide | 
                    542400CLQ | 
                    2 | 
                    20200130 | 
                    20201228 | 
                    (Á¡ÀÌÁ¦) µ¿¹°½ÇÇè¿¡¼ ±¹¼ÒµµÆ÷·Î ±âÇü ¹ß»ý | 
                 
                 
                
                 | 
                                                                                          
            
                            
              
                                                     
            
            
   |  
  
    | 
      
     | 
   
   
     | 
   
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
   
  
    
      
	
	  
	     |  
	    
	      
	        
            
                | Çã°¡Á¤º¸ | 
                         
	         
	       | 
	     
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        679700101  
	    
	    
          [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \10,931 ¿ø/10mL/º´(2024.07.01)(ÇöÀç¾à°¡) 
            \10,936 ¿ø/10mL/º´(2023.07.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
     [¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
   
    | Á¦Ç°¼º»ó | 
    
      ¹é»öÀÇ ºÒÅõ¸íÇÑ ÇÃ¶ó½ºÆ½ ¿ë±â¿¡ µç ¹«»ö ³»Áö ¹ÌȲ»öÀÇ Åõ¸íÇÑ ¾×Á¦  
      
	    [Á¦ÇüÁ¤º¸ È®ÀÎ]
     |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    10ml/1ÅëÆ÷Àå | 
   
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 10¹Ð¸®¸®ÅÍ | 
            1 °³ | 
            8806797001006 | 
            8806797001013 | 
             | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      542400CLQ  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806797001006 | 
   
  
  
  
  
   
    | º¸°ü¹æ¹ý | 
    ±â¹Ð¿ë±â, 25¡ÉÀÌÇÏ¿¡¼ º¸°ü | 
   
  
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
      
        [Á¶È¸]
     | 
      
  
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      Á¤»ó °í¸·À» °¡Áø ȯÀÚÀÇ Staphylococcus aureus, Proteus mirabilis, Pseudomonas aeruginosa ¿¡ ÀÇÇÑ ±Þ¼º ¿ÜÀÌ¿°ÀÇ Ä¡·á
      
      
      
      
     | 
   
  
  
  
  
  
  
  
  
    
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
     [󹿾à¾î] 
      7¼¼ ÀÌ»óÀÇ ¼Ò¾Æ ¹× ¼ºÀÎ; 
ÀÌ ¾à 4¢¦6¹æ¿ïÀ» 8½Ã°£¸¶´Ù °¨¿°µÈ ¿ÜÀ̵µ¿¡ Á¡ÀûÇÑ´Ù. Ä¡·á±â°£Àº 7¢¦8ÀÏÀÌ´Ù. 
»ç¿ë ½Ã ¾à¾×ÀÇ ¿Âµµ°¡ ³·À¸¸é ¾îÁö·¯¿òÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î À̸¦ ÇÇÇϱâ À§ÇÏ¿© ¿ë±â¸¦ 1¢¦2ºÐ Á¤µµ ¼ÕÀ¸·Î Àâ¾Æ µû¶æÇÏ°Ô ÇÑ ÈÄ Åõ¿©ÇÑ´Ù. ¸Ó¸®´Â ¿·À¸·Î ±â¿ï¿©¼ °¨¿°µÈ ±Í°¡ À§ÂÊÀ¸·Î ÇâÇÏ°Ô ÇÑ ÀÚ¼¼¿¡¼ ÀÌ ¾àÀ» Á¡ÀûÇÏ¸ç ¾à¹°¹æ¿ïÀÌ ¿ÜÀ̵µ¿¡ µé¾î°¡µµ·Ï ¾à 30Ãʰ£ À¯ÁöÇÑ´Ù. ÇÊ¿äÇÑ °æ¿ì ¹Ý´ëÂÊ ±Í¿¡µµ µ¿ÀÏÇÑ ¹æ¹ýÀ¸·Î Åõ¿©ÇÑ´Ù.
     
      	    
     | 
   
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    
       1) Ç÷ç¿À½Ã³î·Ð, ½ÃÇÁ·ÎÇ÷ϻç½Å ¶Ç´Â ´Ù¸¥ Äû³î·Ð°è ¾à¹° ¹× ÀÌ ¾àÀÇ ´Ù¸¥ ¼ººÐ¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ 
2) ¼öµÎ ¹× ´Ü¼øÆ÷Áø °¨¿°À» Æ÷ÇÔÇÑ ¿ÜÀ̵µÀÇ ¹ÙÀÌ·¯½º¼º °¨¿°È¯ÀÚ 
     | 
   
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
    °í¸·Ãµ°øÀÌ ÀÖ´Â ±Þ¼º ¿ÜÀÌ¿° ȯÀÚ¿¡ ´ëÇÑ ¾ÈÀü¼º¤ýÀ¯È¿¼ºÀº È®¸³µÇÁö ¾Ê¾Ò´Ù. °í¸·Ãµ°øÀÌ ÀÖ´Ù°í ¾Ë·ÁÁ® Àְųª ÀǽɵǴ ȯÀÚ´Â ÁÖÀÇÇÏ¿© Åõ¿©ÇÑ´Ù.  | 
   
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
       ÀÌ»ó¹ÝÀÀÀÇ ¹ßÇö ºóµµ´Â ´ÙÀ½°ú °°ÀÌ Á¤ÀÇÇÑ´Ù. 
 
  
  |   -¸Å¿ì ÈçÇÏ°Ô (¡Ã1/10)   |  
    -ÈçÇÏ°Ô (¡Ã1/100, <1/10)   |  
   
  
  |   -ÈçÇÏÁö ¾ÊÀ½ (¡Ã1/1000, <1/100)   |  
    -µå¹°°Ô (¡Ã1/10000, <1/1000)   |  
   
  
  |   -¸Å¿ì µå¹°°Ô (<1/10000)   |  
    -ºóµµºÒ¸í(Ȱ¿ë °¡´ÉÇÑ ÀÚ·á·ÎºÎÅÍ ÃßÁ¤ÇÒ ¼ö ¾øÀ½)   |  
   
  
ÀÌ ¾àÀÇ ÀÌ»ó¹ÝÀÀÀº ´ÙÀ½°ú °°´Ù. 
 
  
  |   ¹ßÇöºÎÀ§   |  
    ¹ßÇöºóµµ   |  
    Áõ»ó   |  
   
  
  |   Á¤½Å ½Å°æ°èÀå¾Ö   |  
    ÈçÇÏÁö ¾ÊÀ½   |  
    µÎÅë   |  
   
  
  |   ±Í ¹× ¹Ì·Î°èÀå¾Ö   |  
    ÈçÇÏÁö ¾ÊÀ½   |  
    ÀÌ¸í   |  
   
  
  |   ÇǺΠ¹× ÇÇÇÏÁ¶Á÷Àå¾Ö   |  
    ÈçÇÏÁö ¾ÊÀ½   |  
    ±¹¼Ò ¼Ò¾çÁõ  (°¡·Á¿òÁõ)   |  
   
  
  |   Àü½Å Àå¾Ö ¹× Åõ¿©ºÎÀ§ »óÅ   |  
    ÈçÇÏÁö ¾ÊÀ½   |  
    Áö°¢°ú¹Î   |  
   
  
  |   ½Ã°¢Àå¾Ö   |  
    ºóµµºÒ¸í   |  
    ½Ã¾ßÈ帲   |  
   
  
          
     | 
   
  
  
    
   
    | ÀϹÝÀû ÁÖÀÇ | 
    1) ÀÌ ¾àÀº ÁßÀÌ¿° ȯÀÚ¿¡ ´ëÇÑ ¾ÈÀü¼º¤ýÀ¯È¿¼ºÀº È®¸³µÇÁö ¾Ê¾Ò´Ù. 
2) µÎµå·¯±â³ª ±¹¼Ò ¶Ç´Â Àü½ÅÀû °ú¹ÎÁõÀÇ Áõ»óÀÌ ÀÖ´Ù¸é Ä¡·á¸¦ Áß´ÜÇÒ °Í 
3) ÀÌ ¾àÀ» »ïŰ°Å³ª ÁÖ»çÇÏÁö ¸» °Í 
4) ¿À¿°À» ¿¹¹æÇϱâ À§ÇØ ÀÌ ¾àÀ» Á¡ÀûÇÒ ¶§ Á¡Àû±â¿Í ±Í ¹× ¼Õ°¡¶ô°úÀÇ Á¢ÃËÀ» ÇÇÇϵµ·Ï ÁÖÀÇÇÒ °Í 
5) ÀÌ ¾àÀº ´Ù¸¥ Á¡À̾à°ú º´¿ëÇÏ¿© »ç¿ëÇÏÁö ¸» °Í 
6) ´Ù¸¥ Ç×±ÕÁ¦¿Í ¸¶Âù°¡Áö·Î ÀÌ ¾àÀÇ »ç¿ëÀ¸·Î Áø±ÕÀ̳ª À̽ºÆ®¿Í °°Àº ºñ°¨¼ö¼º ±ÕÀÌ °úµµÇÏ°Ô ¼ºÀåÇÒ ¼ö ÀÖ´Ù. ¸¸¾à 1ÁÖÀÏÀ» Ä¡·áÇÏ¿©µµ °¨¿°ÁõÀÇ °³¼±ÀÌ ¾øÀ» °æ¿ì¿¡´Â ±ÕÀ» ¹è¾çÇÏ¿© ´õ ³ªÀº Ä¡·á¸¦ ÇÒ ¼ö ÀÖµµ·Ï ÇÑ´Ù. Ä¡·á°¡ ³¡³ ÈÄ¿¡µµ ÀÌ·ç°¡ Áö¼ÓµÇ°Å³ª, 6°³¿ù ¾È¿¡ 2¹ø ÀÌ»óÀÇ ÀÌ·ç°¡ ³ªÅ¸³ª¸é ÄÝ·¹½ºÅ׸°Á¾, À̹°, Á¾¾ç µî¿¡ °üÇÑ Á¤¹ÐÇÑ °Ë»ç°¡ ±ÇÀåµÈ´Ù. 
7) ½ÃÇÁ·ÎÇ÷ϻç½ÅÀ» Æ÷ÇÔÇÑ Äû³î·Ð°è ¾à¹°ÀÌ ±Í·Î Èí¼öµÇ°Å³ª Åõ¿©µÇ´Â °Íº¸´Ù °í¿ë·®À¸·Î Àü½ÅÅõ¿©µÉ °æ¿ì ´Ù¾çÇÑ Á¾ÀÇ ¹Ì¼º¼÷ µ¿¹°ÀÇ Ã¼ÁßÀ» ÁöÁöÇÏ´Â °üÀý ¿¬°ñÀÇ ¼Õ»óÀ̳ª ħ½Ä, ȤÀº ´Ù¸¥ °üÀýÁúȯÀÇ ÁõÈİ¡ ³ªÅ¸³µ´Ù. 
8) ±¹¼Ò ÄÚ¸£Æ¼ÄÚÀ̵åÀÇ Àü½ÅÀû Èí¼ö´Â ¸î¸î ȯÀÚ¿¡¼ °¡¿ªÀûÀÎ ½Ã»óÇϺÎ-³úÇϼöü-ºÎ½Å(HPA)ÃàÀÇ ¾ïÁ¦, Äí½ÌÁõÈıº, °úÇ÷´çÁõ, ´ç´¢ µîÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÏ¿© Åõ¿©ÇÑ´Ù. 
9) ´Ù¸¥ Äû³î·Ð°è ¾à¹°¿¡¼ ±¤°ú¹Î¹ÝÀÀÀÌ º¸°íµÇ¾úÀ¸¹Ç·Î ÀÌ ¾àÀ» Åõ¿©ÁßÀΠȯÀÚ´Â Àڿܼ±À̳ª °¡½Ã±¤¼±¿¡ ±¤¹üÀ§ÇÑ ³ëÃâÀº ÇÇÇØ¾ß ÇÑ´Ù. 
10) Àü½Å ¹× ±¹¼Ò ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀÌµå »ç¿ëÀ¸·Î ½Ã·ÂÀå¾Ö°¡ º¸°íµÉ ¼ö ÀÖ´Ù. ȯÀÚ¿¡°Ô ½Ã¾ßÈ帲 ¶Ç´Â ±âŸ ½Ã·ÂÀå¾Ö¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì, ȯÀÚ¸¦ ¾È°úÀǻ翡°Ô º¸³»¾î ¹é³»Àå, ³ì³»Àå ¶Ç´Â Àü½Å ¹× ±¹¼Ò ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀÌµå »ç¿ë ÈÄ º¸°íµÈ Áß½ÉÀå¾×¸Æ¶ô¸Á¸·º´(CSCR)°ú °°Àº Èñ±ÍÁúȯÀ» Æ÷ÇÔÇÏ¿© ¹ß»ý °¡´ÉÇÑ ¿øÀÎ Æò°¡¸¦ °í·ÁÇØ¾ß ÇÑ´Ù. 
11) ÀÌ ¾àÀº º¸Á¸Á¦·Î¼ ÆÄ¶ó¿Á½Ãº¥Á¶»ê¸ÞÆ¿°ú ÆÄ¶ó¿Á½Ãº¥Á¶»êÇÁ·ÎÇÊÀ» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î ¾Ë·¯Áö ¹ÝÀÀÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. 
 | 
   
  
  
  
    
   
    | »óÈ£ÀÛ¿ë | 
    ´Ù¸¥ ¾à¹°°úÀÇ »óÈ£ÀÛ¿ë¿¡ ´ëÇÏ¿© ¿¬±¸µÈ ¹Ù´Â ¾ø´Ù. 
 | 
   
  
  
  
   
    | ÀӺο¡ ´ëÇÑ Åõ¿© | 
    
      
	[ÀӺαݱ⠼ººÐ Á¶È¸]       
      µ¿¹°½ÃÇè¿¡¼ Ç÷ç¿À½Ã³î·ÐÀÇ ±¹¼ÒµµÆ÷·Î ÀÎÇØ ±âÇü¹ß»ýÀÌ ³ªÅ¸³µ´Ù´Â º¸°í°¡ ÀÖÀ¸¸ç ÀÌ ¾àÀ» ÀӺθ¦ ´ë»óÀ¸·Î ÇÑ ¿¬±¸´Â ¼öÇàµÇÁö ¾Ê¾ÒÀ¸¹Ç·Î ÀӺο¡ ´ëÇÑ ¾ÈÀü¼º¤ýÀ¯È¿¼ºÀº È®¸³µÇ¾îÀÖÁö ¾Ê´Ù. ÀÓ½ÅÇÑ ¿©¼º¿¡°Ô »ç¿ëÇÒ °æ¿ì¿¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÉ ¶§¿¡ ÇÑÇÏ¿© ÁÖÀÇÇÏ¿© Åõ¿©ÇÑ´Ù.
     | 
   
  
  
  
  
   
    | ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© | 
    ÀÌ ¾àÀÌ ±Í¸¦ ÅëÇØ ¸ðÀ¯·Î ºÐºñµÈ´Ù´Â Á¦ÇÑÀû Á¤º¸°¡ ÀÖ´Ù. ¼öÀ¯¸¦ ¹Þ´Â À¯¾Æ¿¡°Ô ÁßÁõÀÇ ºÎÀÛ¿ëÀÌ »ý±æ ¼öµµ Àֱ⠶§¹®¿¡ ÀÌ ¾àÀÇ Çʿ伺À» °í·ÁÇÏ¿© ¼öÀ¯ºÎ¿¡°Ô Åõ¿©ÇÒ ¶§ ¼öÀ¯¸¦ Áß´ÜÇÒ °ÍÀÎÁö Åõ¾àÀ» Áß´ÜÇÒ °ÍÀÎÁö °áÁ¤ÇÑ´Ù. | 
   
  
  
  
  
   
    | ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© | 
    
      
       
      ¸¸ 7¼¼ ¹Ì¸¸ÀÇ ¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼º¤ýÀ¯È¿¼ºÀº È®¸³µÇÁö ¾Ê¾Ò´Ù. | 
   
  
  
  
  
  
  
  
  
  
  
  
    
   
    | Àû¿ë»óÀÇ ÁÖÀÇ | 
    1) ¾È°ú¿ëÀ̳ª ÁÖ»ç¿ëÀ¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù. 
2) »ç¿ë ½Ã ¾à¾×ÀÇ ¿Âµµ°¡ ³·À¸¸é ¾îÁö·¯¿òÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î À̸¦ ÇÇÇϱâ À§ÇÏ¿© ¿ë±â¸¦ 1¢¦2ºÐ Á¤µµ ¼ÕÀ¸·Î Àâ¾Æ µû¶æÇÏ°Ô ÇÑ ÈÄ Åõ¿©ÇÏ¸ç »ç¿ë Àü Àß Èçµé¾î¼ »ç¿ëÇÑ´Ù. 
3) ÀÌ ¾àÀº Á÷»ç±¤¼±À» ÇÇÇÏ¿© ¾óÁö ¾Ê°Ô º¸°üÇÏ°í °³ºÀ ÈÄ 30ÀÏÀÌ Áö³ª¸é »ç¿ëÇÏÁö ¾Ê´Â´Ù.
 | 
   
  
  
  
   
    | °ú·®Åõ¿© ¹× óġ | 
    °ú·®Åõ¿©¿¡ ´ëÇÑ ÀÚ·á´Â ¾ø´Ù. ¸¸¾à ¿ì¹ßÀûÀ¸·Î ÀÌ ¾àÀ» »ïÄ×À» °æ¿ì ±¸Å䳪 À§¼¼Ã´, Ȱ¼ºÅº°ú ¸¶±×³×½· ¶Ç´Â Ä®½· µîÀ» Æ÷ÇÔÇÑ Á¦»êÁ¦¸¦ Åõ¿©ÇÏ´Â µî óġÇÑ´Ù. | 
   
  
  
  
  		
  
  
   
    | º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ | 
    ±â¹Ð¿ë±â, 25¡ÉÀÌÇÏ¿¡¼ º¸°ü | 
   
  	
  
  
    
   
    | ±âŸ | 
    ¿îÀüÀ̳ª ±â°èÁ¶ÀÛ¿¡ ´ëÇÑ ÀÓ»ó½ÃÇèÀÇ Á¤º¸´Â ¾ø´Ù. ±×·¯³ª ÀÌ ¾àÀÇ Åõ¿©°æ·Î³ª »ç¿ë Á¶°ÇÀ» °í·ÁÇÒ ¶§ ÀÌ ¾àÀº ¿îÀüÀ̳ª ±â°èÁ¶ÀÛÀÇ ´É·Â¿¡ ¿µÇâÀ» ¹ÌÄ¡Áö ¾Ê´Â´Ù. | 
   
  
  
  
  
  
      							
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¤º¸¿ä¾à | 
                 
	         
	       | 
	           	    
	     |  
	    | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ | 
                 
	         
	       | 
	           	    
	     |  
	    | 	 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¦Ç°Á¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | º¹¾àÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        	
					  
					
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  
   
    ½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  	
  
  
  	
  
  
   
    | Á¦Çüº° º¹¾àÁöµµ | 
    [Á¡ÀÌ] | 
   
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ½É»çÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | ÇмúÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The bactericidal action of ciprofloxacin results from inhibition of the enzymes topoisomerase II (DNA gyrase) and topoisomerase IV, which are required for bacterial DNA replication, transcription, repair, and recombination. 
     | 
   
  
   
    | Pharmacology | 
     
       Ciprofloxacin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Ciprofloxacin is a broad-spectrum antiinfective agent of the fluoroquinolone class. Ciprofloxacin has in vitro activity against a wide range of gram-negative and gram-positive microorganisms. The mechanism of action of quinolones, including ciprofloxacin, is different from that of other antimicrobial agents such as beta-lactams, macrolides, tetracyclines, or aminoglycosides; therefore, organisms resistant to these drugs may be susceptible to ciprofloxacin. There is no known cross-resistance between ciprofloxacin and other classes of antimicrobials. Notably the drug has 100 times higher affinity for bacterial DNA gyrase than for mammalian. 
     | 
   
  
   
    | Absorption | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly and well absorbed from the gastrointestinal tract after oral administration. The absolute bioavailability is approximately 70% with no substantial loss by first pass metabolism. 
     | 
   
  
   
    | Pharmacokinetics | 
    
       Ciprofloxacin HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
- Èí¼ö : °æ±¸ : À§Àå°ü¿¡¼ ºü¸£°Ô Èí¼öµÈ´Ù.
 - »ýü³»ÀÌ¿ë·ü : 50-80%
 - ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ, ü³»¿¡ ³Î¸® ºÐÆ÷
	
	-  ÈçÈ÷ Á¶Á÷³óµµ°¡ Ç÷Á߳󵵺¸´Ù ³ô´Ù.
	
 -  ½ÅÀå, ¹æ±¤, °£, Æó, ºÎÀΰúÀû Á¶Á÷, Àü¸³¼±¿¡ ³ôÀº ³óµµ·Î ºÐÆ÷ÇÑ´Ù.
	
 -  ³úô¼ö¾× ´ë Ç÷¾×ÀÇ ³óµµºñ (%)
		
		- 	   Á¤»ó ³ú¸· : 10 
		
 - 	   ¿°Áõ¼º ³ú¸· : 14-37
		
  
	  
 - ´Ü¹é°áÇÕ : 16-43%
 - ´ë»ç : ºÎºÐÀûÀ¸·Î °£´ë»ç
 - ¹Ý°¨±â : 
	
	-  ¼Ò¾Æ : 2.5½Ã°£
	
 -  Á¤»ó ½Å±â´ÉÀÇ ¼ºÀÎ : 3-5 ½Ã°£ 
	
  
 - Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : °æ±¸ : 0.5-2 ½Ã°£
 - ¼Ò½Ç : 30-50%°¡ ¹Ìº¯Èü·Î ½Å¹è¼³, 20-40%°¡ ´ãÁóÀ» ÅëÇØ º¯¹è¼³
  
 Fluocinolone AcetonideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
	- Èí¼ö : Á¦Á¦ÀÇ ³óµµ(strength)¿Í Àû¿ëµÈ ¾ç, Àû¿ë ºÎÀ§ÀÇ ÇǺΠ»óÅ¿¡ µû¶ó ´Ù¸£´Ù.
	
		- Èí¼öµÇ´Â ¹üÀ§´Â Èí¼öµÇ´Â ÃþÀÌ µÎ²¨¿î °æ¿ì´Â (¼Õ¹Ù´Ú, ¹ß¹Ù´Ú, ÆÈ²ÞÄ¡ µî) 1%¿¡¼ ºÎÅÍ Èí¼öµÇ´Â ÃþÀÌ ¾ãÀº °æ¿ì´Â (¾ó±¼, ¾È°Ë µî) 36% Á¤µµ±îÁö ´Ù¾çÇÏ´Ù.
 
		 - ÇǺο¡ ¼Õ»óÀ̳ª ¿°ÁõÀÌ Àְųª ±× ºÎÀ§¸¦ ¹ÐºÀ(occlude)½ÃÄÑ ÁÖ¸é Èí¼öµÇ´Â Á¤µµ°¡ Áõ°¡ÇÑ´Ù.
 
	  
	 - ºÐÆ÷ : ÁÖ·Î Àû¿ëµÈ ÇǺο¡ ºÐÆ÷ÇÑ´Ù. Àü½Å ¼øÈ¯°è·Î Èí¼öµÈ ¾à¹°Àº ±ÙÀ°, °£, ÇǺÎ, Àå°ü, ½ÅÀåÀ¸·Î ºü¸£°Ô ºÐÆ÷µÈ´Ù.
 
	 - ´ë»ç : ÀÏÂ÷ÀûÀ¸·Î ÇǺο¡¼ ´ë»çµÈ´Ù. Àü½Å ¼øÈ¯°è·Î Èí¼öµÈ ¼Ò·®ÀÇ ¾à¹°Àº ÀÏÂ÷ÀûÀ¸·Î °£¿¡¼ Ȱ¼ºÀÌ ¾ø´Â ´ë»çü·Î ´ë»çµÈ´Ù.
 
	 - ¼Ò½Ç : ÀÏÂ÷ÀûÀ¸·Î glucuronides, sulfates Æ÷ÇÕü³ª ºñÆ÷ÇÕ ´ë»çü·Î ½Å¹è¼³ µÈ´Ù. ¼Ò·®ÀÇ ´ë»çü´Â º¯À¸·Î ¹è¼³µÈ´Ù.
 
  
     | 
   
  
   
    | Toxicity | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Toxicity Á¤º¸ The major adverse effect seen with use of is gastrointestinal irritation, common with many antibiotics. 
     | 
   
  
   
    | Drug Interactions | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aluminium	Formation of non-absorbable complexesMethotrexate	Increases methotrexate toxicity Aminophylline	The quinolone increases the effect of theophyllineAnisindione	The quinolone increases the anticoagulant effectBismuth	Formation of non-absorbable complexesCaffeine	The quinolone increases the effect and toxicity of caffeineCalcium	Formation of non-absorbable complexesClozapine	Ciprofloxacin may increase clozapine serum levelsCyclosporine	The quinolone increases the effect and toxicity of cyclosporineDicumarol	The quinolone increases the anticoagulant effectDihydroxyaluminium	Formation of non-absorbable complexesDyphylline	The quinolone increases the effect of theophyllineDuloxetine	Increases the effect/toxicity of duloxetineDyphylline	The quinolone increases the effect of theophyllineEthotoin	Decreases the hydantoin effectFoscarnet	Increased risk of convulsionsFosphenytoin	Decreases the hydantoin effectMagnesium oxide	Formation of non-absorbable complexesMagnesium	Formation of non-absorbable complexesMephenytoin	Decreases the hydantoin effectAcenocoumarol	The quinolone increases the anticoagulant effectOxtriphylline	The quinolone increases the effect of theophyllinePhenytoin	Decreases the hydantoin effectProcainamide	The quinolone increases the effect of procainamideRasagiline	Increases effect/toxicity of rasagilineRopinirole	The quinolone increases the effect and toxicity of ropiniroleSevelamer	Sevelamer decreases ciprofloxacin bioavailabilitySildenafil	The quinolone increases sildenafil levelsSucralfate	Formation of non-absorbable complexesTheophylline	The quinolone increases the effect of theophyllineTizanidine	Increases the effect/toxicity of tizanidineWarfarin	The quinolone increases the anticoagulant effectIron	Formation of non-absorbable complexesZinc	Formation of non-absorbable complexes 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Description Á¤º¸ A broad-spectrum antimicrobial carboxyfluoroquinoline. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Ointment	OphthalmicSolution	IntravenousSolution	OphthalmicSuspension	OralTablet	OralTablet, extended release	Oral 
     | 
   
  
   
    | Drug Category | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Infective AgentsAnti-InfectivesNucleic Acid Synthesis InhibitorsQuinolones 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ OC(=O)C1=CN(C2CC2)C2=CC(N3CCNCC3)=C(F)C=C2C1=O 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ OC(=O)C1=CN(C2CC2)C2=CC(N3CCNCC3)=C(F)C=C2C1=O 
     | 
   
  
   
    | InChI Identifier | 
    
       Ciprofloxacin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C17H18FN3O3/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24/h7-10,19H,1-6H2,(H,23,24)/f/h23H 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Ciprofloxacin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid 
     | 
   
  
   
    | Drug-Induced Toxicity Related Proteins | 
    
      CIPROFLOXACIN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Alanine aminotransferase Drug:ciprofloxacin Toxicity:Fulminant hepatic failure.  [¹Ù·Î°¡±â] Replated Protein:Alanine aminotransferase Drug:ciprofloxacin Toxicity:significant haematological or biochemical toxicity.  [¹Ù·Î°¡±â] Replated Protein:Aspartate aminotransferase Drug:ciprofloxacin Toxicity:Fulminant hepatic failure.  [¹Ù·Î°¡±â] 
     | 
   
    
  |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ | 
                             
	         
	       | 
	           	  
       |  
	     |  
	   
	     	
 
  | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2023-06-28
              
 
              - 
                
                º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
                    
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  
  |  
             
             | 
         
         
         | 
         |