| |
|
|
|
|
|
 |
| |
|
부비코프정
|
|
일반의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
644800990
[보험코드에 따른 약품기본정보 직접조회]
[비급여]
[상병코드조회]
[질병코드집 다운로드]
[우리집건강주치의 바로가기]
|
| 빠른조회 |
|
| 제품성상 |
하늘색의 원형정제
[제형정보 확인]
|
| 포장·유통단위 |
자사포장단위에 따름 |
| 주성분코드 |
385600ATB
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 대표코드 |
8806448009900 |
| 보관방법 |
기밀용기, 실온보관(1~30℃) |
| 약리작용 |
[조회]
|
| 효능효과 |
[적응증 별 검색]
계절성 및 통년성 비(코) 알레르기, 급성 비염(코염) 및 부비동염, 급성 및 아급성 부비강염, 이관폐색 및 분비성 중이(가운데 귀)염에서의 상기도 점막 충혈의 증상 변화
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
성인 및 12세 이상의 소아 : 1일 3～4회, 1회 1정씩 식후 복용
6세～12세 미만의 소아 : 1일 3～4회, 1회 1/2정씩 식후 복용
|
| 주요약물 상호작용 |
[보기]
|
| 경고 |
슈도에페드린 함유 의약품 복용시 급성 전신성 발진성 농포증(AGEP)과 같은 중증 피부 이상반응이 나타날 수 있다. 발열, 홍반, 다수의 작은 농포와 같은 증상이 관찰될 경우 이 약의 복용을 중단하고 의사 또는 약사와 상의해야 한다.
|
| 금기 |
1) 선행하는 2주에서 MAO 억제약물을 복용한 환자 혹은 복용중인 환자
2) 혈압상승 효과가 있는 아민 혹은 항히스타민제에 대해 과민반응이 알려져 있는 환
자
3) 중증 또는 조절되지 않는 고혈압 환자
4) 중증 급성 또는 만성 신장질환/신부전 환자
|
| 이상반응 |
1) 때때로 경증(경증상, 가벼운 증상)의 졸음 및 피부발적(충혈되어 붉어짐)이 나타날 수 있습니다.
2) 불안, 긴장, 안절부절증, 신경과민증, 진전(떨림), 허약, 불면증, 두통, 심계항진(두근거림), 빈맥(빠른맥), 협심증, 혈압상승, 발한(땀이 남), 동공산대, 식욕부진, 오심(구역), 구토, 현기증(어지러움), 변비 및 방광괄약근(조임근) 경련으로 인한 배뇨곤란이 나타날 수 있다.
3) 급성 전신성 발진성 농포증(AGEP), 발열, 홍반, 다수의 작은 농포와 같은 중증 피부 이상반응이 나타날 수 있다.
4) 슈도에페드린 성분과 관련하여 허혈성 대장염의 증상(급격한 복통, 직장 출혈 등)이 발현될 수 있다. 이 경우 이 약의 복용을 중단해야 한다.
5) 슈도에페드린 성분과 관련하여 가역적 후뇌 병증 증후군 및 가역적 뇌혈관 수축 증후군 증상(갑작스러운 심한 두통, 번개 두통, 구역, 구토, 혼돈, 발작, 시각 장애 등)이 나타나면 이 약의 복용을 즉시 중단해야 한다.
|
| 일반적 주의 |
1) 슈도에페드린은 정상혈압을 나타내는 사람에게는 실제적으로 어떠한 혈압상승효과도 유발하지 않으나, 노인환자와 고혈압, 만성폐질환, 당뇨병, 잠복성 혹은 임상적으로 인식되는 폐쇄각 녹내장, 관상동맥(심장동맥)질환, 울혈성심부전, 요폐(소변축적), 전립선(전립샘)비대증 및 갑상선기능항진증을 지니고 있는 환자에 대하여는 신중히 투여하여야 한다.
2) d-브롬페니라민은 졸음을 유발하여, 민첩성을 요하는 업무수행 혹은 운전능력 등에 손상을 일으킬 수 있다.
3) 항히스타민제의 억제효과는 중추신경계에 영향을 나타내는 다른 약물과의 병용(함께 복용)투여 시 부가적으로 나타날 수 있으므로 항히스타민제 치료요법을 실시하고 있는 동안, 알코올성 음료를 음용하거나 수면제, 진정제, 정신치료약물 혹은 중추신경계 억제 효과가 있는 기타 약물을 복용하고 있는 환자에 대해 주의가 요구된다. |
| 임부에 대한 투여 |
[임부금기 성분 조회]
임신 및 수유기간 동안 이 약의 안전한 사용에 대해서는 아직 명확히 수립되지 않았으므로 투여 전에 의사 또는 약사와 상의할 것.
|
| 수유부에 대한 투여 |
임신 및 수유기간 동안 이 약의 안전한 사용에 대해서는 아직 명확히 수립되지 않았으므로 투여 전에 의사 또는 약사와 상의할 것. |
| 보관 및 취급상의 주의 |
1) 소아의 손이 닿지 않는 곳에 보관할 것.
2) 직사일광을 피하고 될 수 있는대로 습기가 적고 서늘한 곳에 밀전하여(뚜껑을 꼭 닫아) 보관할 것.
3) 오용(잘못 사용)을 막고 품질의 보존을 위해 다른 용기에 바꾸어 넣지 말 것. |
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
변비가 생길수 있습니다. |
|
 |
어지러움이 있을수 있습니다. |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Ephedrine에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Dexbrompheniramine에 대한 Mechanism_Of_Action 정보
Dexbrompheniramine competitively binds to the histamine H1-receptor. It competes with histamine for the normal H1-receptor sites on effector cells of the gastrointestinal tract, blood vessels and respiratory tract. This blocks the action of endogenous histamine, which subsequently leads to temporary relief of the negative symptoms brought on by histamine.
Pseudoephedrine에 대한 Mechanism_Of_Action 정보
Pseudoephedrine acts directly on both alpha- and, to a lesser degree, beta-adrenergic receptors. Through direct action on alpha-adrenergic receptors in the mucosa of the respiratory tract, pseudoephedrine produces vasoconstriction. Pseudoephedrine relaxes bronchial smooth muscle by stimulating beta2-adrenergic receptors. Like ephedrine, pseudoephedrine releasing norepinephrine from its storage sites, an indirect effect.
|
| Pharmacology |
Dexbrompheniramine에 대한 Pharmacology 정보
In allergic reactions an allergen interacts with and cross-links surface IgE antibodies on mast cells and basophils. Once the mast cell-antibody-antigen complex is formed, a complex series of events occurs that eventually leads to cell-degranulation and the release of histamine (and other chemical mediators) from the mast cell or basophil. Once released, histamine can react with local or widespread tissues through histamine receptors. Histamine, acting on H1-receptors, produces pruritis, vasodilatation, hypotension, flushing, headache, tachycardia, and bronchoconstriction. Histamine also increases vascular permeability and potentiates pain. Dexbrompheniramine is a histamine H1 antagonist (or more correctly, an inverse histamine agonist) of the alkylamine class. It provides effective, temporary relief of sneezing, watery and itchy eyes, and runny nose due to hay fever and other upper respiratory allergies.
Pseudoephedrine에 대한 Pharmacology 정보
Pseudoephedrine is a sympathomimetic agent, structurally similar to ephedrine, used to relieve nasal and sinus congestion and reduce air-travel-related otalgia in adults. The salts pseudoephedrine hydrochloride and pseudoephedrine sulfate are found in many over-the-counter preparations either as single-ingredient preparations, or more commonly in combination with antihistamines and/or paracetamol/ibuprofen. Unlike antihistamines, which modify the systemic histamine-mediated allergic response, pseudoephedrine only serves to relieve nasal congestion commonly associated with colds or allergies. The advantage of oral pseudoephedrine over topical nasal preparations, such as oxymetazoline, is that it does not cause rebound congestion (rhinitis medicamentosa).
|
| Protein Binding |
Dexbrompheniramine에 대한 단백결합 정보
Not Available
Pseudoephedrine에 대한 단백결합 정보
Pseudoephedrine does not bind to human plasma proteins over the concentration range of 50 to 2000 ng/mL
|
| Half-life |
Dexbrompheniramine에 대한 반감기 정보
25 hours
Pseudoephedrine에 대한 반감기 정보
9-16 hours
|
| Absorption |
Dexbrompheniramine에 대한 Absorption 정보
Antihistamines are well absorbed from the gastrointestinal tract after oral administration.
Pseudoephedrine에 대한 Absorption 정보
Pseudoephedrine is readily and almost completely absorbed from the GI tract and there is no evidence of first-pass metabolism.
|
| Pharmacokinetics |
Pseudoephedrine sulfate의 약물동력학자료
- 비충혈제거 효과의 발현시간 (경구투여시) : 15-30분
- 작용지속시간 : 4-6 시간 (서방형 제제는 12시간 지속)
- 대사 : 간에서 일부 대사
- 반감기 : 9-16 시간
- 소실 : 투여량의 70-90%가 미변화체로, 1-6%가 norpseudoephedrine으로 소변으로 배설됨. 신배설은 뇨 pH와 뇨량에 의해 변화되며 알칼리뇨는 pseudoephedrine의 신배설을 감소시킴.
|
| Biotransformation |
Dexbrompheniramine에 대한 Biotransformation 정보
Hepatic (cytochrome P-450 system), some renal.
Pseudoephedrine에 대한 Biotransformation 정보
Hepatic.
|
| Toxicity |
Dexbrompheniramine에 대한 Toxicity 정보
Signs of an overdose include fast or irregular heartbeat, mental or mood changes, tightness in the chest, and unusual tiredness or weakness.
Pseudoephedrine에 대한 Toxicity 정보
Common adverse reactions include nervousness, restlessness, and insomnia. Rare adverse reactions include difficult/painful urination, dizziness/lightheadedness, heart palpitations, headache, increased sweating, nausea/vomiting, trembling, troubled breathing, unusual paleness, and weakness.
|
| Drug Interactions |
Dexbrompheniramine에 대한 Drug_Interactions 정보
Not Available
Pseudoephedrine에 대한 Drug_Interactions 정보
Alseroxylon Increased arterial pressureIsocarboxazid Increased arterial pressureLinezolid Possible increase of arterial pressureMethyldopa Increased arterial pressureBromocriptine The sympathomimetic increases the toxicity of bromocriptineTranylcypromine Increased arterial pressureMidodrine Increased arterial pressureMoclobemide Moclobemide increases the sympathomimetic effectPargyline Increased arterial pressurePhenelzine Increased arterial pressureRasagiline Increased arterial pressureReserpine Increased arterial pressureTrimipramine The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectNortriptyline The tricyclic increases the sympathomimetic effectAmitriptyline The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectClomipramine The tricyclic increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectDoxepin The tricyclic increases the sympathomimetic effectDeserpidine Increased arterial pressureGuanethidine The agent decreases the effect of guanethidine
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Dexbrompheniramine에 대한 Description 정보
Dexbrompheniramine maleate is an antihistamine used to treat allergic conditions such as hay fever or urticaria.
Pseudoephedrine에 대한 Description 정보
An alpha- and beta-adrenergic agonist that may also enhance release of norepinephrine. It has been used in the treatment of several disorders including asthma, heart failure, rhinitis, and urinary incontinence, and for its central nervous system stimulatory effects in the treatment of narcolepsy and depression. It has become less extensively used with the advent of more selective agonists. [PubChem]
|
| Dosage Form |
Dexbrompheniramine에 대한 Dosage_Form 정보
Not Available
Pseudoephedrine에 대한 Dosage_Form 정보
Liquid OralSyrup OralTablet OralTablet, extended release Oral
|
| Drug Category |
Dexbrompheniramine에 대한 Drug_Category 정보
Antihistamines
Pseudoephedrine에 대한 Drug_Category 정보
Adrenergic AgentsBronchodilator AgentsCentral Nervous System AgentsNasal DecongestantsSympathomimeticsVasoconstrictor Agents
|
| Smiles String Canonical |
Dexbrompheniramine에 대한 Smiles_String_canonical 정보
CN(C)CCC(C1=CC=C(Br)C=C1)C1=CC=CC=N1
Pseudoephedrine에 대한 Smiles_String_canonical 정보
CNC(C)C(O)C1=CC=CC=C1
|
| Smiles String Isomeric |
Dexbrompheniramine에 대한 Smiles_String_isomeric 정보
CN(C)CC[C@@H](C1=CC=C(Br)C=C1)C1=CC=CC=N1
Pseudoephedrine에 대한 Smiles_String_isomeric 정보
CN[C@@H](C)[C@@H](O)C1=CC=CC=C1
|
| InChI Identifier |
Dexbrompheniramine에 대한 InChI_Identifier 정보
InChI=1/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/t15-/m0/s1
Pseudoephedrine에 대한 InChI_Identifier 정보
InChI=1/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1
|
| Chemical IUPAC Name |
Dexbrompheniramine에 대한 Chemical_IUPAC_Name 정보
(3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine
Pseudoephedrine에 대한 Chemical_IUPAC_Name 정보
(1S,2S)-2-methylamino-1-phenylpropan-1-ol
|
| Drug-Induced Toxicity Related Proteins |
MALEATE 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:Intercellular adhesion molecule 1
Drug:maleate
Toxicity:hepatic injury.
[바로가기]
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-11-03
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
