| |
|
|
|
|
|
 |
| |
|
ÇÁ·¹µåÆ÷¸£Å×Á¡¾È¾×(ÇÁ·¹µå´Ï¼Ö·Ð¾Æ¼¼Å×ÀÌÆ®) PRED-FORTE EYE DROPS
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
692000120[W52420071]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2015.10.01)(ÇöÀç¾à°¡)
\168 ¿ø/1ml(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ Çöʼº Á¡¾È¾×
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
5ml/bottle |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 5¹Ð¸®¸®ÅÍ |
1 °³ |
8806920001200 |
8806920001217 |
|
| 10¹Ð¸®¸®ÅÍ |
1 Á¡¾È¾× |
8806920001200 |
8806920001224 |
|
|
| ÁÖ¼ººÐÄÚµå |
217103COS
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806920001200 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Âº¸°ü |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¾È°Ë¿°, °á¸·¿°, °¢¸·¿°, °ø¸·¿°, Æ÷µµ¸·¿°, ¼ö¼ú ÈÄ ¿°Áõ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ȸ 1-2¹æ¿ï 1ÀÏ 2-4ȸ Á¡¾ÈÇÑ´Ù. óÀ½ 1-2Àϰ£Àº ÇÊ¿ä½Ã ¸Å½Ã°£ »ç¿ëÇÒ ¼ö ÀÖ´Ù.
Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
1) Ç¥À缺 ´Ü¼øÆ÷Áø °¢¸·¿°(¼öÁö»ó °¢¸·¿°), ¿ìµÎ, ¼öµÎ¸¦ Æ÷ÇÔÇÏ´Â ¹ÙÀÌ·¯½º¼º °¢¸·°á¸·Áúȯ ȯÀÚ
2) Áø±Õ¼º ¾ÈÁúȯ ȯÀÚ
3) °áÇÙ¼º ¾ÈÁúȯ ȯÀÚ
4) Ä¡·áµÇÁö ¾ÊÀº È³ó¼º °¨¿° ȯÀÚ
5) ÀÌ ¾à¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
6) °¢¸·»óÇǹڸ® ¹× ±Ë¾çȯÀÚ(°¢¸· õ°øÀÌ »ý±æ ¼ö ÀÖ´Ù.)
|
| ½ÅÁßÅõ¿© |
1) ³ì³»Àå ȯÀÚ
2) 2¼¼ ¹Ì¸¸ÀÇ ¿µ¾Æ
3) ¾ÆÈ²»ê¼ö¼Ò³ªÆ®·ýÀÌ ÇÔÀ¯µÇ¾î ÀÖÀ¸¹Ç·Î ¾ÆÈ²»ê ¾Æ³ªÇʶô½Ã¿Í °°Àº ¾Ë·¹¸£±â¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¸ç, ÀÏ ºÎ °¨¼ö¼º ȯÀÚ¿¡¼´Â »ý¸íÀ» À§ÇùÇÒ Á¤µµ ¶Ç´Â À̺¸´Ù ¾àÇÑ Ãµ½Ä¹ßÀÛÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. ÀÏ¹Ý »ç¶÷ ¿¡¼ÀÇ ¾ÆÈ²»ê°¨¼ö¼º¿¡ ´ëÇÑ ÃѰýÀûÀÎ ºóµµ´Â ¾Ë·ÁÁöÁö ¾Ê¾ÒÀ¸³ª ³·Àº °ÍÀ¸·Î º¸ÀÌ¸ç ¾ÆÈ²»ê°¨¼ö¼º Àº ºñõ½Ä ȯÀÚº¸´Ù õ½ÄȯÀÚ¿¡¼ ºó¹øÇÑ °ÍÀ¸·Î ³ªÅ¸³µ´Ù.
|
| ÀÌ»ó¹ÝÀÀ |
1) ´«
¨ç ¿¬¿ë½Ã ¶§¶§·Î ¼öÁÖÀÏ ÈÄ¿¡ ¾È¾Ð »ó½Â ¶Ç´Â µå¹°°Ô ½Ã½Å°æ ¼Õ»ó, ½Ã·ÂÀúÇÏ ¹× ½Ã¾ß°á¼ÕÀ» µ¿¹ÝÇÑ ³ì³»ÀåÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Á¤±âÀûÀ¸·Î ¾È¾Ð °Ë»ç¸¦ ÇÑ´Ù.
¨è °¢¸·Æ÷Áø, °¢¸·Áø±ÕÁõ, ³ì³ó±Õ °¨¿°Áõ µîÀ» À¯¹ßÇÒ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ °æ¿ì¿¡´Â ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
¨é °¢¸·Æ÷Áø, °¢¸·±Ë¾ç ¶Ç´Â ¿Ü»ó µî¿¡ »ç¿ëÇÒ °æ¿ì õ°øÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù.
¨ê Àå±â°£ »ç¿ëÀ¸·Î µå¹°°Ô Èij¶ÇϹ鳻Àå, °¢¸·¿¬È°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
¨ë ±Þ¼º Àü¹æ Æ÷µµ¸·¿°, °¢¸·¿°, °á¸·¿°, °¢¸·±Ë¾ç, »êµ¿, °á¸·ÃæÇ÷, ¾È°ËÇϼö ¹× Á¶Àý¸¶ºñ°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
¨ìºóµµºÒ¸íÀÇ ½Ã¾ßÈ帲ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) ÇǺΠ: Àå±â»ç¿ë¿¡ ÀÇÇØ â»óÄ¡À¯°¡ Áö¿¬µÉ ¼ö ÀÖ´Ù.
3) ³»ºÐºñ°è : Àå±â°£ »ç¿ëÀ¸·Î ÇϼöüºÎ½ÅÇÇÁú°è ±â´ÉÀÇ ¾ïÁ¦°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) °ú¹ÎÁõ : µå¹°°Ô Àڱذ¨ µîÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
5) µå¹°°Ô Àü½Å »ç¿ë½Ã¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Àå±â°£ ¿¬¿ëÀ» ÇÇÇÑ´Ù.
6) Àå±â¿¬¿ë½Ã ¸é¿ª ¾ïÁ¦·Î ÀÎÇÑ 2Â÷ ¾È°¨¿°ÀÇ À§ÇèÀÌ Áõ°¡ÇÑ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ÀÇ»çÀÇ Áø´Ü¾øÀÌ ÃæÇ÷µÈ ´«¿¡ ±¹¼Ò ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵åÁ¦ÀÇ Åõ¿©´Â ½Ç¸íÀ» ÃÊ·¡ÇÒ ¼ö ÀÖ´Ù.
2) ½ºÅ×·ÎÀ̵强 ¹é³»Àå ¹× ³ì³»Àå À¯¹ß °¡´É¼ºÀÌ ÀÖÀ¸¹Ç·Î 10ÀÏ ÀÌ»ó Àå±â Åõ¿©½Ã ¼Ò¾Æ ¶Ç´Â ºñÇùÁ¶Àû ÀΠȯÀÚ¶óµµ Á¤±âÀûÀÎ ¾È¾ÐÃøÁ¤ ¹× ¼öÁ¤Ã¼ °Ë»ç¸¦ ÇÑ´Ù.
3) ´Ü¼ø Æ÷ÁøÀÇ º´·ÂÀÌ Àִ ȯÀÚ¿¡°Ô ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å Åõ¿©½Ã Æ÷Áø¼º °¢¸·ÁúȯÀÇ ¾ÇÈ À§ÇèÀ» ¹æÁö Ű À§ÇØ ÀÚÁÖ ¼¼±Øµî °Ë»ç¸¦ ÇÑ´Ù.
4) ±¹¼Ò ½ºÅ×·ÎÀ̵åÁ¦´Â Ä¡·áµÇÁö ¾ÊÀº ´«ÀÇ ±Þ¼º È³ó¼º °¨¿°À» ÀºÆó ¶Ç´Â ¾ÇȽÃų ¼ö ÀÖ´Ù.
5) ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å´Â ¸Ó½ºÅ¸µå °¡½º °¢¸·¿° ¹× ¼î±×·» °¢°á¸·¿°¿¡´Â È¿°ú°¡ ¾ø´Ù.
6) ÄÜÅÃÆ®·»Áî Âø¿ëÀÚ´Â ÀÌ ¾à Åõ¿©Àü ·»Á Á¦°ÅÇϰí Àû¾îµµ Åõ¿© 30ºÐ ÀÌÈÄ¿¡ ÀçÂø¿ëÇÑ´Ù.
7) ¿°ÁõÀ̳ª ÅëÁõÀÌ 48½Ã°£ ÀÌ»ó Áö¼ÓµÇ°Å³ª ¾ÇȵǸé Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç¿Í »óÀÇÇÑ´Ù.
8) Á¡¾È½Ã ÀϽÃÀûÀÎ ½Ã·ÂºÒ¼±¸íÀÌ »ý±æ ¼ö ÀÖÀ¸¹Ç·Î ½Ã¾ß°¡ ¼±¸íÇØÁú ¶§±îÁö ¿îÀüÀ̳ª À§ÇèÇÑ ±â°èÁ¶ÀÛ À» ÇÏÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù.
9) ƯÈ÷, ÀÌ ¾à Åõ¿©Áß¿¡ ¼öµÎ ¶Ç´Â È«¿ª¿¡ °¨¿°µÇ¸é, Ä¡¸íÀûÀÎ °æ°ú¿¡ À̸¦ ¼ö ÀÖÀ¸¹Ç·Î, ´ÙÀ½ ÁÖÀǰ¡ ÇÊ¿äÇÏ´Ù.
¨ç ÀÌ ¾à Åõ¿©Àü¿¡ ¼öµÎ eh´Â È«¿ªÀÇ º´·Â°ú ¿¹¹æÁ¢Á¾ÀÇ À¯¹«¸¦ È®ÀÎÇÑ´Ù.
¨è ¼öµÎ ¶Ç´Â È«¿ªÀÇ º´·ÂÀÌ ¾ø´Â ȯÀÚ¿¡ ´ëÇØ¼´Â ¼öµÎ ¶Ç´Â È«¿ª¿¡ÀÇ °¨¿°À» ÃÖ´ëÇÑ ¹æÁöÇÏ¿© Ãæ ºÐÇÑ ¹è·Á¿Í °üÂûÀ» ÇÑ´Ù. °¨¿°ÀÌ Àǽɽº·¯¿î °æ¿ì¿Í °¨¿°µÈ °æ¿ì¿¡´Â Áï½Ã ÁøÂûÀ» ¹Þ¾Æ ÁöµµÇÏ °í, ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
¨é ¼öµÎ ¶Ç´Â È«¿ªÀÇ º´·Â°ú ¿¹¹æÁ¢Á¾À» ¹ÞÀº ÀûÀÌ Àִ ȯÀÚ¿¡¼µµ ÀÌ ¾à Åõ¿© Áß¿¡ ¼öµÎ ¶Ç´Â È« ¿ªÀÌ ³ªÅ¸³¯ °¡´É¼ºÀÌ ÀÖÀ¸¹Ç·Î À¯ÀÇÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
¾ÆÆ®·ÎÇɰú °°Àº Äݸ° ¾ïÁ¦Á¦¿Í º´¿ë½Ã ¾È¾Ð »ó½ÂÀÌ ³ªÅ¸³´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
ÀӽŠÁßÀÇ »ç¿ë¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î
ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡°Ô´Â Ä¡·á »óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ ½ÅÁßÈ÷ Åõ¿©Çϰí Àå±â°£ »ç ¿ëÀ» ÇÇÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
ÀÌ ¾à¹°ÀÇ À¯ÁóÀ¸·ÎÀÇ ÀÌÇà¿©ºÎ´Â ¹àÇôÁöÁö ¾Ê¾ÒÀ¸³ª Àü½ÅÅõ¿©½Ã ³ªÅ¸³ª´Â ¼ºÀåÀå¾Ö, ³»ºÐºñ ÄÚ¸£Æ¼ ÄÚÀÌµå »ý»ê¹æÇØ µîÀÇ ½É°¢ÇÑ ºÎÀÛ¿ëÀ» °í·ÁÇÒ ¶§ ¼öÀ¯ Áß´Ü ¶Ç´Â ¾à¹°ÀÇ Åõ¿©ÁßÁö¸¦ °í·ÁÇÑ´Ù.
|
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
À¯¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼º ¹× À¯È¿¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î, ƯÈ÷ 2¼¼ ¹Ì¸¸ÀÇ °æ¿ì¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. |
| °í·ÉÀÚ¿¡ ´ëÇÑ Åõ¿© |
ÀϹÝÀûÀ¸·Î °í·ÉÀÚ´Â »ý¸®±â´ÉÀÌ ÀúÇϵǾî ÀÖÀ¸¹Ç·Î ƯÈ÷ ÁÖÀÇÇÑ´Ù.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù.
2) Á¡¾È½Ã ¿ë±âÀÇ ÀÔ±¸°¡ Á÷Á¢ ´«¿¡ ´êÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù.
3) ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| °ú·®Åõ¿© ¹× óġ |
°ú·®Åõ¿©½Ã ±ÞÇÑ ¹®Á¦¸¦ ÀÏÀ¸Å°Áö ¾ÊÁö¸¸ ¶æÇÏÁö ¾Ê°Ô °ú·®º¹¿ë½Ã À½·á¸¦ ¸¶¼Å Èñ¼®ÇÑ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
1) ¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
2) Á÷»çÀϱ¤À» ÇÇÇϰí(½À±â°¡ ÀûÀº)¼´ÃÇÑ °÷¿¡(¹ÐÀüÇÏ¿©) º¸°üÇÑ´Ù[°ýÈ£³»´Â ÇÊ¿ä½Ã¿¡ ±âÀçÇÑ´Ù.].
3) ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(prednisolone; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡¾È¾×] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Prednisolone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Glucocorticoids such as Prednisolone can inhibit leukocyte infiltration at the site of inflammation, interfere with mediators of inflammatory response, and suppress humoral immune responses. The antiinflammatory actions of glucocorticoids are thought to involve phospholipase A2 inhibitory proteins, lipocortins, which control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes. Prednisolone reduces inflammatory reaction by limiting the capillary dilatation and permeability of the vascular structures. These compounds restrict the accumulation of polymorphonuclear leukocytes and macrophages and reduce the release of vasoactive kinins. Recent research suggests that corticosteroids may inhibit the release of arachidonic acid from phospholipids, thereby reducing the formation of prostaglandins. Prednisolone is a glucocorticoid receptor agonist. On binding, the corticoreceptor-ligand complex translocates itself into the cell nucleus, where it binds to many glucocorticoid response elements (GRE) in the promoter region of the target genes. The DNA bound receptor then interacts with basic transcription factors, causing an increase or decrease in expression of specific target genes, including suppression of IL2 (interleukin 2) expression.
|
| Pharmacology |
Prednisolone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Prednisolone is a synthetic glucocorticoid used as antiinflammatory or immunosuppressive agent. Prednisolone is indicated in the treatment of various conditions, including congenital adrenal hyperplasia, psoriatic arthritis, systemic lupus erythematosus, bullous dermatitis herpetiformis, seasonal or perennial allergic rhinitis, allergic corneal marginal ulcers, symptomatic sarcoidosis, idiopathic thrombocytopenic purpura in adults, leukemias and lymphomas in adults, and ulcerative colitis. Glucocorticoids are adrenocortical steroids and cause profound and varied metabolic effects. In addition, they modify the body's immune responses to diverse stimuli.
|
| Metabolism |
Prednisolone¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Prednisolone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Very high (>90%)
|
| Half-life |
Prednisolone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 2-3 hours
|
| Absorption |
Prednisolone¿¡ ´ëÇÑ Absorption Á¤º¸ Readily absorbed by gastrointestinal tract, peak plasma concentration is reached 1-2 hours after administration.
|
| Pharmacokinetics |
Prednisolone acetateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ´Ü¹é°áÇÕ : 65¡91% (¿ë·® ÀÇÁ¸Àû)
- ´ë»ç : ÀÏÂ÷ÀûÀ¸·Î °£¿¡¼ ´ë»çµÇ³ª ´ëºÎºÐÀÇ Á¶Á÷¿¡¼µµ ´ë»ç°¡ ÀϾ¸ç ºñȰ¼ºÇü ´ë»çü°¡ »ý¼ºµÈ´Ù.
- ¹Ý°¨±â : 3.6½Ã°£
- »ý¸®Àû ¹Ý°¨±â : 18-36½Ã°£
- ¸»±â ½ÅÁúȯ ȯÀÚ¿¡¼ÀÇ ¹Ý°¨±â : 3¡5½Ã°£
- ¼Ò½Ç : ´ëºÎºÐ glucuronides, sulfates Æ÷ÇÕü³ª ºñÆ÷ÇÕ ´ë»çü·Î ½Å¹è¼³ µÈ´Ù.
|
| Biotransformation |
Prednisolone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Excreted in the urine as either free or glucoconjugate.
|
| Toxicity |
Prednisolone¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=500 mg/kg (oral, rat), short-term side effects include high blood glucose levels and fluid retention. Long term side effects include Cushing's syndrome, weight gain, osteoporosis, glaucoma, type II diabetes and adrenal suppression.
|
| Drug Interactions |
Prednisolone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Ambenonium The corticosteroid decreases the effect of anticholinesterasesEdrophonium The corticosteroid decreases the effect of anticholinesterasesNeostigmine The corticosteroid decreases the effect of anticholinesterasesPyridostigmine The corticosteroid decreases the effect of anticholinesterasesWarfarin The corticosteroid alters the anticoagulant effectAcenocoumarol The corticosteroid alters the anticoagulant effectDicumarol The corticosteroid alters the anticoagulant effectAnisindione The corticosteroid alters the anticoagulant effectMidodrine Increased arterial pressureAspirin The corticosteroid decreases the effect of salicylatesBismuth Subsalicylate The corticosteroid decreases the effect of salicylatesSalicylate-magnesium The corticosteroid decreases the effect of salicylatesSalicylate-sodium The corticosteroid decreases the effect of salicylatesSalsalate The corticosteroid decreases the effect of salicylatesTrisalicylate-choline The corticosteroid decreases the effect of salicylatesTalbutal The barbiturate decreases the effect of the corticosteroidSecobarbital The barbiturate decreases the effect of the corticosteroidQuinidine barbiturate The barbiturate decreases the effect of the corticosteroidPrimidone The barbiturate decreases the effect of the corticosteroidPhenobarbital The barbiturate decreases the effect of the corticosteroidPentobarbital The barbiturate decreases the effect of the corticosteroidMethylphenobarbital The barbiturate decreases the effect of the corticosteroidMethohexital The barbiturate decreases the effect of the corticosteroidHexobarbital The barbiturate decreases the effect of the corticosteroidHeptabarbital The barbiturate decreases the effect of the corticosteroidDihydroquinidine barbiturate The barbiturate decreases the effect of the corticosteroidButethal The barbiturate decreases the effect of the corticosteroidButalbital The barbiturate decreases the effect of the corticosteroidButabarbital The barbiturate decreases the effect of the corticosteroidAprobarbital The barbiturate decreases the effect of the corticosteroidAmobarbital The barbiturate decreases the effect of the corticosteroidChlorotrianisene The estrogenic agent increases the effect of the corticosteroidClomifene The estrogenic agent increases the effect of the corticosteroidDiethylstilbestrol The estrogenic agent increases the effect of the corticosteroidEstradiol The estrogenic agent increases the effect of the corticosteroidEstriol The estrogenic agent increases the effect of the corticosteroidConjugated Estrogens The estrogenic agent increases the effect of the corticosteroidEstrone The estrogenic agent increases the effect of the corticosteroidEstropipate The estrogenic agent increases the effect of the corticosteroidEthinyl Estradiol The estrogenic agent increases the effect of the corticosteroidMestranol The estrogenic agent increases the effect of the corticosteroidQuinestrol The estrogenic agent increases the effect of the corticosteroidEthotoin The enzyme inducer decreases the effect of the corticosteroidFosphenytoin The enzyme inducer decreases the effect of the corticosteroidMephenytoin The enzyme inducer decreases the effect of the corticosteroidPhenytoin The enzyme inducer decreases the effect of the corticosteroidRifampin The enzyme inducer decreases the effect of the corticosteroidItraconazole The imidazole increases the effect and toxicity of the corticosteroidKetoconazole The imidazole increases the effect and toxicity of the corticosteroid
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Prednisolone¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food to reduce gastric irritation.Avoid alcohol. Avoid caffeine.
|
| Drug Target |
[Drug Target]
|
| Description |
Prednisolone¿¡ ´ëÇÑ Description Á¤º¸ A glucocorticoid with the general properties of the corticosteroids. It is the drug of choice for all conditions in which routine systemic corticosteroid therapy is indicated, except adrenal deficiency states. [PubChem]
|
| Drug Category |
Prednisolone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic AgentsAnti-inflammatory AgentsAntineoplastic AgentsAntineoplastic Agents, HormonalGlucocorticoids
|
| Smiles String Canonical |
Prednisolone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CC(O)C3C(CCC4=CC(=O)C=CC34C)C1CCC2(O)C(=O)CO
|
| Smiles String Isomeric |
Prednisolone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)C=C[C@]34C)[C@@H]1CC[C@]2(O)C(=O)CO
|
| InChI Identifier |
Prednisolone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-16,18,22,24,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1
|
| Chemical IUPAC Name |
Prednisolone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one
|
| Drug-Induced Toxicity Related Proteins |
PREDNISOLONE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:DNA topoisomerase 1 Drug:prednisolone Toxicity:appearance of apoptotic cells. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-12-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|