| |
|
|
|
|
|
 |
| |
|
아제클점안액 AZECLE EYE DROPS
|
|
전문의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
645303360[A37854351]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1ml(2016.10.01)(현재약가)
\969 원/1ml(2016.03.01)(변경전약가)
[상병코드조회]
[질병코드집 다운로드]
[우리집건강주치의 바로가기]
|
| 빠른조회 |
|
| 제품성상 |
무색투명한 플라스틱 용기에 든 무색투명한 점안액
[제형정보 확인]
|
| 포장·유통단위 |
1개(5밀리리터) |
| 포장·코드단위 |
| 약품규격 |
단위 |
대표코드 |
표준코드 |
비고 |
| 5밀리리터 |
1 개 |
8806453033600 |
8806453033617 |
|
| 5밀리리터 |
1 개 |
8806453033600 |
8806453033624 |
수출용 |
|
| 주성분코드 |
112503COS
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 대표코드 |
8806453033600 |
| 보관방법 |
기밀용기, 2~25℃보관 |
| 약리작용 |
[조회]
|
| 효능효과 |
[적응증 별 검색]
알러지성 결막염의 증상 완화
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
4세 이상 소아 및 성인: 1회 1적, 1일 2회 점안, 증상이 심할 경우에는 1일 3~4회까지 점안할 수 있다.
|
| 금기 |
이 약 성분에 과민증의 병력이 있거나 의심되는 환자
|
| 이상반응 |
1.이상반응
1) 투여 후 일시적인 작열감
2) 두통, 쓴맛
3) 1-10%의 환자에서 천식, 결막염, 호흡곤란, 안통, 피로, 인플루엔자양 증상, 인두염, 가려움증, 비염, 일시적 시각 흐림이 나타났다.
2. 국내 시판 후 조사
국내에서 재심사를 위하여 6년 동안 619명의 환자를 대상으로 실시한 시판 후 조사결과 이상반응의 발현 증례율은 인과관계와 상관없이 12.12%(75명/619명)로 보고되었다. 이 중 약물과의 인과관계를 배제할 수 없는 이상반응 발현율은 11.95%(74명/619명)이며 다음과 같다. ‘적용부위 작열감'이 7.92%(49/619명)로 가장 많았으며, 5%미만의 환자에서 나타나는 이상반응은 쓴맛, 눈의 통증, 적응부위자극, 시각 흐림, 두통, 눈 마름 증, 구토를 포함한다. 중대한 이상반응은 없었으며, 이 중 예상치 못한 약물 이상반응은 ‘안구충혈’ 3건, ‘구토’ 1건으로 총 4건(0.64%, 4명/619명)이 보고되었다.
|
| 일반적 주의 |
1) 이 약은 안과용으로만 사용하고, 주사 또는 경구투약을 해서는 안 된다.
2) 안전성 및 유효성은 임상시험에서 8주까지만 확인되었다.
3) 콘택트렌즈와 관련된 자극을 치료하는 목적으로 사용되어서는 안 된다.
4) 이 약은 염화벤잘코늄을 함유하고 있으며, 이 성분은 콘택트 렌즈에 흡수될 수 있다. 그러므로 이 약은 렌즈를 착용하지 않은 상태에서 점적하여야 하며, 점적하고 15분 이상 지난 후에 다시 착용하여야 한다.
5) 점안 후 시각이상(작열감, 시각흐림 등)을 경험한 사람은 이 같은 증상이 사라질 때까지 운전이나 기계 조작을 해서는 안 된다.
6) 점안제는 눈 주위 주사 또는 눈 내부 주사를 통해 사용할 수 없다.
|
| 상호작용 |
알코올의 섭취에 의해 진정 작용이 증강될 수 있으며 시메티딘과 병용투여 시에도 주의한다. |
| 임부에 대한 투여 |
[임부금기 성분 조회]
동물 실험에서 대량 경구투여(사람의 추천 점안용량의 57,000배)에 의해 배태자독성, 기형유발이 보고되고 있으므로 임부 또는 임신하고 있을 가능성이 있는 부인에게는 치료 상의 유익성이 위험성을 상회한다고 판단되는 경우에만 투여한다.
|
| 수유부에 대한 투여 |
모유로의 분비여부는 알려져 있지 않다. 많은 약물이 모유로 분비되기 때문에 수유부에게는 주의를 기울여 투여되어야 한다. |
| 소아에 대한 투여 |
소아에 대한 투여
3세 이하 어린이의 안전성과 유효성은 확립되어있지 않다.
고령자에 대한 투여
노인과 젊은 성인 환자들 간의 안전성과 유효성에서의 차이는 관찰되지 않았다.
|
| 적용상의 주의 |
1) 변색하거나 침전이 생긴 것은 사용하지 않는다.
2) 점안 시 용기의 입구가 눈에 직접 닿지 않도록 주의한다.
3) 오염을 방지하기 위해 될 수 있는 한 공동으로 사용하지 않는다.
|
| 보관 및 취급상의 주의 |
1) 직사일광을 피하고 되도록 습기가 적은 서늘한 곳에 세워서 보관한다.
2) 사용 후 곧바로 마개를 닫고, 개봉 후에는 4주 이내에 사용한다. |
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 제형별 복약지도 |
[점안액] |
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Azelastine에 대한 Mechanism_Of_Action 정보
Antihistamines such as azelastine appear to compete with histamine for histamine H1- receptor sites on effector cells (mast cells). The antihistamines antagonize those pharmacological effects of histamine which are mediated through activation of H1- receptor sites and thereby reduce the intensity of allergic reactions and tissue injury response involving histamine release.
|
| Pharmacology |
Azelastine에 대한 Pharmacology 정보
Azelastine is a relatively selective histamine H1 antagonist and an inhibitor of the release of histamine and other mediators from cells (e.g. mast cells) involved in the allergic response. Based on in vitro studies using human cell lines, inhibition of other mediators involved in allergic reactions (e.g. leukotrienes and PAF) has been demonstrated with azelastine. Decreased chemotaxis and activation of eosinophils has also been demonstrated.
|
| Protein Binding |
Azelastine에 대한 단백결합 정보
In-vitro studies in human plasma indicate that the plasma protein binding of azelastine and N-desmethylazelastine are approximately 88% and 97%, respectively.
|
| Half-life |
Azelastine에 대한 반감기 정보
Elimination half-life (based on intravenous and oral administration) is 22 hours. Elimination half-life of the active metabolite, desmethylazelastine, is 54 hours (after oral administration of azelastine).
|
| Absorption |
Azelastine에 대한 Absorption 정보
Absorption of azelastine following ocular administration was relatively low. Systemic bioavailability is approximately 40% after nasal administration.
|
| Pharmacokinetics |
Azelastine HCl의 약물동력학자료
- 작용발현시간
- 작용지속시간
- 흡수
- 분포 : 태반 통과
- 단백결합 : 55%
- 반감기 : 약 16시간
- 소실 : 약 50%는 대변으로, 약 30%는 소변을 통해 배설됨
|
| Biotransformation |
Azelastine에 대한 Biotransformation 정보
Azelastine hydrochloride is oxidatively metabolized to the principal metabolite, N-desmethylazelastine, by the cytochrome P450 enzyme system, however the exact cytochrome P450 isoenzyme involved has not been determined. The major metabolite, desmethylazelastine, also has H1-receptor antagonist activity.
|
| Toxicity |
Azelastine에 대한 Toxicity 정보
Not Available
|
| Drug Interactions |
Azelastine에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Azelastine에 대한 Description 정보
Azelastine is an antihistamine and mast cell stabilizer available as a nasal spray for hay fever and as eye drops for allergic conjunctivitis.
|
| Dosage Form |
Azelastine에 대한 Dosage_Form 정보
Solution / drops Ophthalmic
|
| Drug Category |
Azelastine에 대한 Drug_Category 정보
Anti-Allergic AgentsAnti-Inflammatory Agents, Non-SteroidalBronchodilator AgentsHistamine H1 AntagonistsHistamine H1 Antagonists, Non-SedatingLipoxygenase InhibitorsPlatelet Aggregation Inhibitors
|
| Smiles String Canonical |
Azelastine에 대한 Smiles_String_canonical 정보
CN1CCCC(CC1)N1N=C(CC2=CC=C(Cl)C=C2)C2=CC=CC=C2C1=O
|
| Smiles String Isomeric |
Azelastine에 대한 Smiles_String_isomeric 정보
CN1CCC[C@@H](CC1)N1N=C(CC2=CC=C(Cl)C=C2)C2=CC=CC=C2C1=O
|
| InChI Identifier |
Azelastine에 대한 InChI_Identifier 정보
InChI=1/C22H24ClN3O/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16/h2-3,6-11,18H,4-5,12-15H2,1H3
|
| Chemical IUPAC Name |
Azelastine에 대한 Chemical_IUPAC_Name 정보
4-[(4-chlorophenyl)methyl]-2-(1-methylazepan-4-yl)phthalazin-1-one
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2024-10-07
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ≥4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. AZELASTINE[GGT Increase][Composite Activity](Score) I(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGOT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGPT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[LDH Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[GGT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
