| |
|
|
|
|
|
 |
| |
|
리모콘정 LIMOCON TABLET[Ethinyl Estradiol , Norethisterone acetate]
|
|
일반의약품 | 미생산
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
비급여
[상병코드조회]
[질병코드집 다운로드]
[우리집건강주치의 바로가기]
|
| 빠른조회 |
|
| 제품성상 |
등황색 당의정.
[제형정보 확인]
|
| 포장·유통단위 |
2, 4, 8, 100정 |
| 보관방법 |
밀페용기, 실온보존 |
| 약리작용 |
[조회]
|
| 효능효과 |
[적응증 별 검색]
단기간의 속발성 무월경 (1년이내)
[Drugbank 의 성분정보열람]
[Estradiol][Ethinyl Estradiol]
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
보통 성인 1회 1정 1일 1회 2일간 연속 복용한다.
|
| 경고 |
반드시 의사의 지시에 의해 사용할 것.
|
| 금기 |
- 임부 및 임신하고 있을 가능성이 있는 부인
- 임신포진의 병력이 있는 환자
|
| 신중투여 |
- 중증 간장애 환자
- 임신중에 황달 도는 지속적 가려움증의 병력이 있는 환자
- Dubin - Johnson증후군 환자
- Roter 증후군 환자
- 혈전색전증 및 그러한 병력이 있는 환자
- 중증 당뇨병 환자
- 겸상적혈구 빈혈 환자
|
| 이상반응 |
드물게 구역,유방긴장감,두통이 나타날 수 있다.
|
| 일반적 주의 |
다음과 같은 경우 또는 증상이 나타나면 즉시 투여를 중지할 것.
두통이 아주 심하거나 자주 발생할 경우 이전에는 없었던 편두통이 발생할 경우,갑작스런 지각장애(시각 또는 청각장애),황달, 전신의 가려움증,가슴조임,또는 흉통,급격한 혈압상승,혈전색전증 또는 혈전성 정맥염의 첫징후 (다리가 붓거나 통증이 있는 경우 이유없이 기침이 나거나 호흡시의 찌르는 듯한 통증)가 발생한 경우,수술 6주전. |
| 임부에 대한 투여 |
[임부금기 성분 조회]
황체호르몬제의 사용과 선천적 기형아 출산과의 인과관계는 아직 확립되어 있지 않다. 그러나 역학조사 결과에 의하면,심장,사지드의 선천적 기형아를 출산한 산모와 대조군 사이에는 임신초기 황체 및 황체.난포호르몬제 사용 비율에 있어 유의성 있는 차이가 있다는 보고가 있으며 또한 이 약의 사용이 여성태아의 외부생식기 남성화,남성태아의 요도하열과 관 련이 있다는 보고가 있으므로 임신초기 4개월 동안에는 치료상의 유익성이 위험성을 상회하는 경우에만 사용할 것.
|
| 보관 및 취급상의 주의 |
밀페용기, 실온보존 |
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| 항목 |
내용 |
| BIT 약효분류 |
여성호르몬제 (Estrogens & progesterones and related drugs)
|
| ATC 코드 |
Norethisterone and estrogen / G03FA01
[코드분류상세설명]
[ATC코드예측]
|
| 복지부분류코드 |
247 (난포호르몬 및 황체호르몬제 )
|
| Drugs By Indication |
[전체보기]
|
| Drugs By Classification |
[전체보기]
|
|
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : X등급
(estradiol; )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
임산부 또는 임신계획중 복용금지 |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Estradiol에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Estradiol에 대한 Mechanism_Of_Action 정보
Estradiol enters target cells freely (e.g., female organs, breasts, hypothalamus, pituitary) and interacts with a target cell receptor. When the estrogen receptor has bound its ligand it can enter the nucleus of the target cell, and regulate gene transcription which leads to formation of messenger RNA. The mRNA interacts with ribosomes to produce specific proteins that express the effect of estradiol upon the target cell. Estrogens increase the hepatic synthesis of sex hormone binding globulin (SHBG), thyroid-binding globulin (TBG), and other serum proteins and suppress follicle-stimulating hormone (FSH) from the anterior pituitary.
|
| Pharmacology |
Estradiol에 대한 Pharmacology 정보
Estradiol, the principal intracellular human estrogen, is substantially more active than its metabolites, estrone and estriol, at the cellular level.
|
| Metabolism |
Estradiol에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 1A2 (CYP1A2)Cytochrome P450 2A6 (CYP2A6)Glucuronosyltransferase
|
| Protein Binding |
Estradiol에 대한 단백결합 정보
>95%
|
| Half-life |
Estradiol에 대한 반감기 정보
36 hours
|
| Absorption |
Estradiol에 대한 Absorption 정보
43%
|
| Pharmacokinetics |
Ethinyl Estradiol의 약물동력학자료
- 흡수 : 위장관으로부터 신속하고 거의 완전히 흡수된다.
- 생체내이용률 : 약 50%
- 분포 : 체내 조직에 신속하게 분포한다.
- 단백결합 : 95% 이상
- 대사 : 간에서 불활성화된다.
- 반감기 : 약 8시간 (범위 : 5-16 시간)
- 혈중최고농도 도달시간 : 대개 1시간 이내
- 소실 : 약 60%는 뇨를 통해, 40%는 대변을 통해 배설된다.
|
| Biotransformation |
Estradiol에 대한 Biotransformation 정보
Exogenous estrogens are metabolized using the same mechanism as endogenous estrogens. Estrogens are partially metabolized by cytochrome P450.
|
| Toxicity |
Estradiol에 대한 Toxicity 정보
Can cause nausea and vomiting, and withdrawal bleeding may occur in females.
|
| Drug Interactions |
Estradiol에 대한 Drug_Interactions 정보
Amobarbital The enzyme inducer decreases the effect of hormonesAprobarbital The enzyme inducer decreases the effect of hormonesButabarbital The enzyme inducer decreases the effect of hormonesButalbital The enzyme inducer decreases the effect of hormonesButethal The enzyme inducer decreases the effect of hormonesEthotoin The enzyme inducer decreases the effect of hormonesFosphenytoin The enzyme inducer decreases the effect of hormonesGriseofulvin The enzyme inducer decreases the effect of hormonesHeptabarbital The enzyme inducer decreases the effect of hormonesHexobarbital The enzyme inducer decreases the effect of hormonesMephenytoin The enzyme inducer decreases the effect of hormonesMethohexital The enzyme inducer decreases the effect of hormonesMethylphenobarbital The enzyme inducer decreases the effect of hormonesPentobarbital The enzyme inducer decreases the effect of hormonesPhenobarbital The enzyme inducer decreases the effect of hormonesPhenytoin The enzyme inducer decreases the effect of hormonesPrednisolone The estrogenic agent increases the effect of corticosteroidPrednisone The estrogenic agent increases the effect of corticosteroidPrimidone The enzyme inducer decreases the effect of hormonesSecobarbital The enzyme inducer decreases the effect of hormonesTalbutal The enzyme inducer decreases the effect of hormonesRaloxifene Association not recommendedUrsodeoxycholic acid Estrogens decreases the effect of ursodiol
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Estradiol에 대한 Food Interaction 정보
Take with food to decrease nausea.
|
| Drug Target |
[Drug Target]
|
| Description |
Estradiol에 대한 Description 정보
Generally refers to the 17-beta-isomer of estradiol, an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans, it is produced primarily by the cyclic ovaries and the placenta. It is also produced by the adipose tissue of men and postmenopausal women. The 17-alpha-isomer of estradiol binds weakly to estrogen receptors (receptors, estrogen) and exhibits little estrogenic activity in estrogen-responsive tissues. Various isomers can be synthesized. [PubChem]
|
| Dosage Form |
Estradiol에 대한 Dosage_Form 정보
Disc TransdermalGel TransdermalLiquid IntramuscularPatch TransdermalRing IntravaginalTablet IntravaginalTablet Oral
|
| Drug Category |
Estradiol에 대한 Drug_Category 정보
Anti-menopausal AgentsAnticholesteremic AgentsEstrogens
|
| Smiles String Canonical |
Estradiol에 대한 Smiles_String_canonical 정보
CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CCC2O
|
| Smiles String Isomeric |
Estradiol에 대한 Smiles_String_isomeric 정보
C[C@]12CC[C@H]3[C@@H](CCC4=C3C=CC(O)=C4)[C@@H]1CC[C@@H]2O
|
| InChI Identifier |
Estradiol에 대한 InChI_Identifier 정보
InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1
|
| Chemical IUPAC Name |
Estradiol에 대한 Chemical_IUPAC_Name 정보
(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
|
| Drug-Induced Toxicity Related Proteins |
ESTRADIOL 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:Myc proto-oncogene protein
Drug:estradiol
Toxicity:cytotoxic responses .
[바로가기]
Replated Protein:3-hydroxy-3-methylglutaryl-coenzyme A reductase
Drug:estradiol
Toxicity:stimulate steroidogenesis.
[바로가기]
Replated Protein:Stromelysin-2
Drug:estradiol
Toxicity:nonbacterial prostatitis.
[바로가기]
Replated Protein:Transcription factor E2F1
Drug:estradiol
Toxicity:cytotoxic responses.
[바로가기]
Replated Protein:Glucocorticoid receptor
Drug:estradiol
Toxicity:glucocorticoid resistance.
[바로가기]
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2019-03-29
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
