|   | 
        
            
         | 
          | 
        
        
        
            | 
                
             | 
         
        
             | 
         
        
            
            
            
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    Ä«¹Ð·¹Á¡¾È¾×  CAMILE EYE DROPS  
                    
                 | 
               
              
                | 
                     ÀϹÝÀǾàǰ | ºñ±Þ¿©  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |  
                              
                                  | 
                                   | 
                               
            
            
                
            
            
              
            
                            
              
                                                     
            
            
   |  
  
    | 
      
     | 
   
   
     | 
   
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
   
  
    
      
	
	  
	     |  
	    
	      
	        
            
                | Çã°¡Á¤º¸ | 
                         
	         
	       | 
	     
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        643702110  
	    
	    
          [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
                    [ºñ±Þ¿©]
                
       
      
       
       
     
      
      
     
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
     [¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
   
    | Á¦Ç°¼º»ó | 
    
      û»öÀÇ Åõ¸íÇÑ Á¡¾È¾×  
      
	    [Á¦ÇüÁ¤º¸ È®ÀÎ]
     |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    15ml | 
   
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 13¹Ð¸®¸®ÅÍ | 
            1 °³ | 
            8806437021104 | 
            8806437021128 | 
             | 
	     
        
        
            | 5¹Ð¸®¸®ÅÍ | 
            1 °³ | 
            8806437021104 | 
            8806437021111 | 
             | 
	     
        
        
            | 20¹Ð¸®¸®ÅÍ | 
            1 °³ | 
            8806437021104 | 
            8806437021142 | 
             | 
	     
        
        
            | 15¹Ð¸®¸®ÅÍ | 
            1 °³ | 
            8806437021104 | 
            8806437021135 | 
             | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      A23100COS  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806437021104 | 
   
  
  
  
  
   
    | º¸°ü¹æ¹ý | 
    Â÷±¤±â¹Ð¿ë±â | 
   
  
  
  
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      ´«ÀÇ ÇÇ·Î, °á¸·ÃæÇ÷, ¼ö¿µ ÈÄ ´«ÀÇ ºÒÄè°¨ ¶Ç´Â ¸ÕÁö³ª ¶¡ÀÌ ´«¿¡ µé¾î°¬À» ¶§, Àڿܼ± ¹× ±âŸ ±¤¼±¿¡ ÀÇÇÑ ¾È¿°(¼³¾È¿°), ¾È°Ë¿°(´«²¨Ç®ÀÇ Áø¹«¸§), ÇϵåÄÜÅÃÆ®·»Á ³¢°í ÀÖÀ» ¶§ÀÇ ºÒÄè°¨, ´«ÀÇ °¡·Á¿ò, ´«ÀÇ Ä§Ä§ÇÔ(´«°öÀÌ ¸¹À» ¶§ µî)
  
      
      
      
      
     | 
   
  
  
  
  
  
  
  
  
    
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
     [󹿾à¾î] 
      1ȸ 2-3¹æ¿ï 1ÀÏ 3-6ȸ Á¡¾ÈÇÑ´Ù.
  
     
      	    
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
     ´ÙÀ½ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÒ °Í. 
 1) ´«ÀÇ ÅëÁõÀÌ ½ÉÇÑ È¯ÀÚ 
 2) Áö±Ý±îÁö ¾È¾à¿¡ ÀÇÇÑ ¾Ë·¹¸£±â Áõ»ó(¿¹¸¦ µé¾î ´«ÀÇ ÃæÇ÷, °¡·Á¿ò, ºÎÁ¾, ¹ßÁø, ¹ßÀû µî)À» ÀÏÀ¸Å² ÀÏÀÌ Àִ ȯÀÚ 
 3) ³ì³»Àå ȯÀÚ 
 4) ÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ°í Àִ ȯÀÚ 
 | 
   
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
       ÀÌ ¾àÀÇ Åõ¿©¿¡ ÀÇÇØ ´«ÀÇ ÃæÇ÷, °¡·Á¿ò, ºÎÁ¾ µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÑ´Ù.
  
          
     | 
   
  
  
    
   
    | ÀϹÝÀû ÁÖÀÇ | 
    ÀϹÝÀû ÁÖÀÇ 
 1) ÀÌ ¾àÀº °úµµÇÏ°Ô »ç¿ëÇÏ¸é ¿ÀÈ÷·Á ÃæÇ÷À» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î Á¤ÇØÁø ¿ë¹ý¡¤¿ë·®À» Àß ÁöŲ´Ù. 
 2) ÀÌ ¾àÀÇ Åõ¿©¿¡ ÀÇÇØ ´«ÀÇ Ä§Ä§ÇÔÀÌ °³¼±µÇÁö ¾Ê´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÑ´Ù. 
 3) ¼öÀϰ£ Åõ¿©ÈÄ¿¡µµ Áõ»óÀÇ °³¼±ÀÌ º¸ÀÌÁö ¾ÊÀ» °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÑ´Ù. 
 4) À߸øÇÏ¿© ÀǺ¹ µî¿¡ Âø»öµÈ °æ¿ì¿¡´Â ¹°·Î ¼¼Ã´ÇÏ¿© Á¦°ÅÇÑ´Ù.
 
  
 | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
    
   
    | Àû¿ë»óÀÇ ÁÖÀÇ | 
    Àû¿ë»óÀÇ ÁÖÀÇ 
 1) ÀÌ ¾àÀº Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù. 
 2) ¼ÒÇÁÆ®ÄÜÅÃÆ®·»ÁîÀÇ ÀåÂø¾×À¸·Î ¶ÇÇÑ ¼ÒÇÁÆ®ÄÜÅÃÆ®·»Á Âø¿ëÇÑ Ã¤ »ç¿ëÇÏÁö ¾Ê´Â´Ù. 
 3) ¿ë±âÀÇ ³¡ÀÌ ´«²¨Ç® ¹× ¼Ó´«½ç¿¡ ´êÀ¸¸é ´«°öÀ̳ª Áø±Õ µî¿¡ ÀÇÇØ ¾à¾×ÀÌ ¿À¿° ¶Ç´Â ȥŹµÉ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ¶ÇÇÑ È¥Å¹µÈ °ÍÀº »ç¿ëÇÏÁö ¾Ê´Â´Ù. 
 4) ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù. 
 5) »ç¿ë±âÇÑÀ» ÃʰúÇÑ °ÍÀº Åõ¿©ÇÏÁö ¾Ê°í ÀÏ´Ü °³ºÀÇÑ °ÍÀº °¡´ÉÇÑ ÇÑ »¡¸® »ç¿ëÇÑ´Ù.
 
  
 | 
   
  
  
  
  
  
  		
  
  
   
    | º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ | 
    ÀúÀå»óÀÇ ÁÖÀÇ»çÇ× 
 1) ¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù. 
 2) ÀÌ ¾à ¼ººÐÀÎ ¾ÆÁÙ·»Àº ±¤¼±¿¡ ÀÇÇØ º¯Çϱ⠽¬¿ì¹Ç·Î »ç¿ëÈÄ´Â Â÷±¤¿ë±â¿¡ º¸°üÇÑ´Ù. 
 3) ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù.
  
 | 
   
  	
  
  
    
   
    | ±âŸ | 
    ÀϹÝÀû ÁÖÀÇ 
 1) ÀÌ ¾àÀº °úµµÇÏ°Ô »ç¿ëÇÏ¸é ¿ÀÈ÷·Á ÃæÇ÷À» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î Á¤ÇØÁø ¿ë¹ý¡¤¿ë·®À» Àß ÁöŲ´Ù. 
 2) ÀÌ ¾àÀÇ Åõ¿©¿¡ ÀÇÇØ ´«ÀÇ Ä§Ä§ÇÔÀÌ °³¼±µÇÁö ¾Ê´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÑ´Ù. 
 3) ¼öÀϰ£ Åõ¿©ÈÄ¿¡µµ Áõ»óÀÇ °³¼±ÀÌ º¸ÀÌÁö ¾ÊÀ» °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÑ´Ù. 
 4) À߸øÇÏ¿© ÀǺ¹ µî¿¡ Âø»öµÈ °æ¿ì¿¡´Â ¹°·Î ¼¼Ã´ÇÏ¿© Á¦°ÅÇÑ´Ù.
 
  
Àû¿ë»óÀÇ ÁÖÀÇ 
 1) ÀÌ ¾àÀº Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù. 
 2) ¼ÒÇÁÆ®ÄÜÅÃÆ®·»ÁîÀÇ ÀåÂø¾×À¸·Î ¶ÇÇÑ ¼ÒÇÁÆ®ÄÜÅÃÆ®·»Á Âø¿ëÇÑ Ã¤ »ç¿ëÇÏÁö ¾Ê´Â´Ù. 
 3) ¿ë±âÀÇ ³¡ÀÌ ´«²¨Ç® ¹× ¼Ó´«½ç¿¡ ´êÀ¸¸é ´«°öÀ̳ª Áø±Õ µî¿¡ ÀÇÇØ ¾à¾×ÀÌ ¿À¿° ¶Ç´Â ȥŹµÉ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ¶ÇÇÑ È¥Å¹µÈ °ÍÀº »ç¿ëÇÏÁö ¾Ê´Â´Ù. 
 4) ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù. 
 5) »ç¿ë±âÇÑÀ» ÃʰúÇÑ °ÍÀº Åõ¿©ÇÏÁö ¾Ê°í ÀÏ´Ü °³ºÀÇÑ °ÍÀº °¡´ÉÇÑ ÇÑ »¡¸® »ç¿ëÇÑ´Ù.
 
  
ÀúÀå»óÀÇ ÁÖÀÇ»çÇ× 
 1) ¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù. 
 2) ÀÌ ¾à ¼ººÐÀÎ ¾ÆÁÙ·»Àº ±¤¼±¿¡ ÀÇÇØ º¯Çϱ⠽¬¿ì¹Ç·Î »ç¿ëÈÄ´Â Â÷±¤¿ë±â¿¡ º¸°üÇÑ´Ù. 
 3) ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù.
  
 | 
   
  
  
  
  
  
      							
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¤º¸¿ä¾à | 
                 
	         
	       | 
	           	    
	     |  
	    | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ | 
                 
	         
	       | 
	           	    
	     |  
	    | 	 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¦Ç°Á¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | º¹¾àÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    | 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ½É»çÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | ÇмúÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Chlorpheniramine binds to the histamine H1 receptor. This blocks the action of endogenous histamine, which subsequently leads to temporary relief of the negative symptoms brought on by histamine. 
     | 
   
  
   
    | Pharmacology | 
     
       Chlorpheniramine¿¡ ´ëÇÑ Pharmacology Á¤º¸ In allergic reactions an allergen interacts with and cross-links surface IgE antibodies on mast cells and basophils. Once the mast cell-antibody-antigen complex is formed, a complex series of events occurs that eventually leads to cell-degranulation and the release of histamine (and other chemical mediators) from the mast cell or basophil. Once released, histamine can react with local or widespread tissues through histamine receptors. Histamine, acting on H1-receptors, produces pruritis, vasodilatation, hypotension, flushing, headache, tachycardia, and bronchoconstriction. Histamine also increases vascular permeability and potentiates pain. Chlorpheniramine, is a histamine H1 antagonist (or more correctly, an inverse histamine agonist) of the alkylamine class. It competes with histamine for the normal H1-receptor sites on effector cells of the gastrointestinal tract, blood vessels and respiratory tract. It provides effective, temporary relief of sneezing, watery and itchy eyes, and runny nose due to hay fever and other upper respiratory allergies. 
     | 
   
  
   
    | Metabolism | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)Cytochrome P450 2D6 (CYP2D6) 
     | 
   
  
   
    | Protein Binding | 
    
       Chlorpheniramine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 72% 
     | 
   
  
   
    | Half-life | 
    
       Chlorpheniramine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 21-27 hours 
     | 
   
  
   
    | Absorption | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed in the gastrointestinal tract. 
     | 
   
  
   
    | Pharmacokinetics | 
    
       Chlorpheniramine MaleateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
	- ´Ü¹é°áÇÕ : 69-72%
	
 - ´ë»ç : °£´ë»ç
	
 - ¹Ý°¨±â : 20-24 ½Ã°£
	
 - ¼Ò½Ç : ´ë»çü, ¾à¹°(3-4%)ÀÌ ½Å¹è¼³µÇ¸ç, 48½Ã°£³»¿¡ ÀüüÀÇ 35%°¡ ¼Ò½ÇµÈ´Ù.
  
     | 
   
  
   
    | Biotransformation | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Primarily hepatic via Cytochrome P450 (CYP450) enzymes. 
     | 
   
  
   
    | Toxicity | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50 = 306 mg/kg in humans, mild reproductive toxin to women of childbearing age. 
     | 
   
  
   
    | Drug Interactions | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Donepezil	Possible antagonism of actionGalantamine	Possible antagonism of actionRivastigmine	Possible antagonism of actionEthotoin	The antihistamine increases the effect of hydantoinFosphenytoin	The antihistamine increases the effect of hydantoinMephenytoin	The antihistamine increases the effect of hydantoinPhenytoin	The antihistamine increases the effect of hydantoin 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] Chlorpheniramine¿¡ ´ëÇÑ P450 table
  SUBSTRATES 
CYP 2D6 
Beta Blockers: 
S-metoprolol 
propafenone 
timolol 
Antidepressants: 
amitriptyline 
clomipramine 
desipramine 
imipramine 
paroxetine 
Antipsychotics: 
haloperidol 
risperidone 
thioridazine 
aripiprazole 
codeine 
dextromethorphan 
duloxetine 
flecainide 
mexiletine 
ondansetron 
tamoxifen 
tramadol 
venlafaxine 
 INHIBITORS 
CYP 2D6 
amiodarone 
buproprion 
**chlorpheniramine** 
cimetidine 
clomipramine 
duloxetine 
fluoxetine 
haloperidol 
methadone 
mibefradil 
paroxetine 
quinidine 
ritonavir 
 INDUCERS 
CYP 2D6 
N/A 
 
     | 
   
  
   
    | Food Interaction | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food.Avoid alcohol. 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Description Á¤º¸ A histamine H1 antagonist used in allergic reactions, hay fever, rhinitis, urticaria, and asthma. It has also been used in veterinary applications. One of the most widely used of the classical antihistaminics, it generally causes less drowsiness and sedation than promethazine. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Syrup	OralTablet	OralTablet, extended release	Oral 
     | 
   
  
   
    | Drug Category | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Allergic AgentsAntihistaminesAntipruriticsHistamine H1 Antagonists 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN(C)CCC(C1=CC=C(Cl)C=C1)C1=CC=CC=N1 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN(C)CC[C@H](C1=CC=C(Cl)C=C1)C1=CC=CC=N1 
     | 
   
  
   
    | InChI Identifier | 
    
       Chlorpheniramine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine 
     | 
   
  
   
    | Drug-Induced Toxicity Related Proteins | 
    
      MALEATE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Intercellular adhesion molecule 1  Drug:maleate Toxicity:hepatic injury.  [¹Ù·Î°¡±â] 
     | 
   
    
  |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ | 
                             
	         
	       | 
	           	  
       |  
	     |  
	   
	     	
 
  | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
                    
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
 |  
             
             | 
         
         
         | 
         |