|   | 
        
            
         | 
          | 
        
        
        
            | 
                
             | 
         
        
             | 
         
        
            
            
            
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    ¿Ã°¡ºñ½Ã·´  ALLGABI SYR[Chlorpheniramine Maleate , Dl-methylephedrine hydrochloride , Lysozyme chloride , Tipepidine citrate]  
                    
                 | 
               
              
                | 
                     ÀϹÝÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |  
                              
                                  | 
                                   | 
                               
            
            
                
            
            
              
            
                            
              
                                                     
            
            
   |  
  
    | 
      
     | 
   
   
     | 
   
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
   
  
    
      
	
	  
	     |  
	    
	      
	        
            
                | Çã°¡Á¤º¸ | 
                         
	         
	       | 
	     
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
            ºñ±Þ¿©
          
        
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
     [¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
   
    | Á¦Ç°¼º»ó | 
    
      Æ÷µµÇâÀÌ ³ª´Â º¸¶ó»öÀÇ ¸¼Àº ½Ã·´                                                    
  
      
	    [Á¦ÇüÁ¤º¸ È®ÀÎ]
     |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    90ml | 
   
  
  
  
  
  
  
  
  
  
  
  
  
   
    | º¸°ü¹æ¹ý | 
    ±â¹Ð¿ë±â | 
   
  
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
      
        [Á¶È¸]
     | 
      
  
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
     
    
     
	 
      °¨±âÁ¦Áõ»ó(Ä๰, ÄÚ¸·Èû, Àçä±â, ÀÎÈÄÅë, ±âħ, °¡·¡, ¿ÀÇÑ, ¹ß¿, µÎÅë,°üÀýÅë, ±ÙÀ°Åë)ÀÇ ¿ÏÈ 
[Drugbank ÀÇ ¼ººÐÁ¤º¸¿¶÷] [Chlorpheniramine]
      
      
      
      
     | 
   
  
  
  
  
  
  
  
  
    
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
     [󹿾à¾î] 
       - ´ÙÀ½ÀÇ 1ȸ·®À» 1ÀÏ 4ȸ ½Ä ÈÄ 30ºÐ ¹× Ãëħ½Ã¿¡ º¹¿ëÇÑ´Ù.
 - ¾î¸°ÀÌ 1ȸ : 3°³¿ùÀÌ»ó¡5°³¿ù : 2.5§¢, 6°³¿ù¡1¼¼¹Ì¸¸ : 3§¢, 1¡2¼¼ : 3.5§¢, 3¡6¼¼ : 5§¢, 7¡10¼¼ : 7.5§¢, 11¡14¼¼ : 10§¢     
      	    
    
 
  | 
   
  
  
  
   
    | ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë | 
    
        
	  [º¸±â]
     | 
   
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    
      - Áö±Ý±îÁö ÀÌ ¾à¿¡ °ú¹ÎÁõ»ó(¿¹¸¦µé¸é ¹ßÁø, ¹ßÀû, °¡·Á¿ò, ºÎÁ¾(ÈĵÎ, ´«²¨Ç®, ÀÔ¼úµî))À» ÀÏÀ¸Å² ÀûÀÌ ÀÖ´Â »ç¶÷
 - Áö±Ý±îÁö ÀÌ ¾à ¶Ç´Â ´Ù¸¥ °¨±â¾à, ÇØ¿ÁøÅëÁ¦¸¦ »ç¿ëÇÏ¿© õ½ÄÀÌ ³ªÅ¸³ ÀûÀÌ ÀÖ´Â »ç¶÷
    
 
  | 
   
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
    - º»ÀÎ, ¾çÄ£ ¶Ç´Â ÇüÁ¦ µîÀÌ µÎµå·¯±â, Á¢Ã˼ºÇǺο°, ±â°üÁöõ½Ä, ¾Ë·¹¸£±â¼º ºñ¿°, ÆíµÎÅë, À½½Ä¹° ¾Ë·¹¸£±â µîÀ» ÀÏÀ¸Å°±â ½¬¿î üÁúÀ» °®°í ÀÖ´Â »ç¶÷
 - Áö±Ý±îÁö ¾àÀ̳ª ´Þ°¿¿¡ ¾Ë·¹¸£±â Áõ»ó(¿¹¸¦µé¸é ¹ß¿, ¹ßÁø, °üÀýÅë, õ½Ä, °¡·Á¿òÁõ µî)À» ÀÏÀ¸Å² ÀÏÀÌ ÀÖ´Â »ç¶÷
 - ¼öµÎ ¶Ç´Â ÀÎÇ÷翣ÀÚ¿¡ °¨¿°µÇ¾î Àְųª ¶Ç´Â ÀǽɵǴ À¯¡¤À¯¾Æ ¹×  ¾î¸°ÀÌ (14¼¼ ÀÌÇÏ)
 - °£Àå, ½ÅÀå, °©»ó¼±Áúȯ, ´ç´¢º´, °íÇ÷¾Ð µîÀÌ ÀÖ´Â »ç¶÷, ¸öÀÌ ¾àÇÑ»ç¶÷, ¶Ç´Â °í¿ÀÌ ÀÖ´Â »ç¶÷
 - ½ÉÀå¿¡ Àå¾Ö°¡ ÀÖ´Â »ç¶÷, ¶Ç´Â °í·ÉÀÚ
- ³ì³»Àå( ¿¹:
  ´«ÀÇ ÅëÁõ, ´«ÀÌ Ä§Ä§ÇÔ µî)ÀÌ ÀÖ´Â »ç¶÷, ¹è´¢°ï¶õÀÌ ÀÖ´Â »ç¶÷.
 - ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ, ¼öÀ¯ºÎ
 - ÀÇ»ç ¶Ç´Â Ä¡°úÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ°í ÀÖ´Â »ç¶÷
 
  | 
   
  
  
  
  
    
   
    | ÀϹÝÀû ÁÖÀÇ | 
    * º¹¿ëÇÒ ¶§ ´ÙÀ½ »çÇ×À» ÁÖÀÇÇÒ °Í.
- ¿ë¹ý¡¤¿ë·®À» Àß Áöų °Í.
 - ´ÙÀ½ ¾àµé°ú´Â µ¿½Ã¿¡ º¹¿ëÇÏÁö ¸» °Í.
 
ÁøÇذŴã¾à, ´Ù¸¥ °¨±â¾à, ÇØ¿ÁøÅë¾à, Ç×È÷½ºÅ¸¹ÎÁ¦, ÁøÁ¤Á¦ µî
 - ¾î¸°ÀÌ¿¡°Ô º¹¿ë½Ãų °æ¿ì´Â º¸È£ÀÚÀÇ Áöµµ °¨µ¶ÇÏ¿¡ º¹¿ë½Ãų °Í.
 - 3°³¿ù ¹Ì¸¸ÀÇ À¯¾Æ¿¡´Â º¹¿ëÀ» ÇÇÇϰí 3°³¿ù ÀÌ»óÀÎ °æ¿ìµµ 1¼¼ ¹Ì¸¸ÀÇ À¯¾Æ¿¡´Â ºÎµæÀÌÇÑ °æ¿ì¸¦ Á¦¿ÜÇϰí´Â º¹¿ë½ÃŰÁö ¾Ê´Â °ÍÀÌ ÁÁ´Ù. 
 - ¹Ù¸£ºñÅ»°è ¾à¹°, »ïȯ°è Ç׿ì¿ïÁ¦ ¹× ¾ËÄÚ¿ÃÀ» Åõ¿©ÇÑ È¯ÀÚ´Â ´Ù·®ÀÇ  ¾Æ¼¼Æ®¾Æ¹Ì³ëÆæÀ» ´ë»ç½ÃŰ´Â ´É·ÂÀÌ °¨¼ÒµÇ¾î ¾Æ¼¼Æ®¾Æ¹Ì³ëÆæÀÇ Ç÷Àå  ¹Ý°¨±â¸¦ Áõ°¡½Ãų ¼ö ÀÖ´Ù.
  
* º¹¿ëÁß ¶Ç´Â º¹¿ëÈÄ¿¡´Â ´ÙÀ½ »çÇ×À» ÁÖÀÇÇÒ °Í.
- ÀÌ ¾àÀÇ º¹¿ë ÈÄ °ð¹Ù·Î µÎµå·¯±â, ºÎÁ¾(ÈĵÎ, ´«²¨Ç®, ÀÔ¼ú µî), °¡½¿ ´ä´äÇÔ µî°ú ÇÔ²² ¾È»öÀÌ Ã¢¹éÇØÁö°í, ¼öÁ·ÀÌ Â÷°¡¿ÍÁö°í, ½ÄÀº¶¡, ¼û°¡»Õ µîÀÌ ³ªÅ¸³ª´Â °æ¿ì Áï½Ã º¹¿ëÀ» ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »óÀÇÇÒ °Í.
 - º¹¿ëÇÏ´Â µ¿¾È ¹ßÁø, ¹ßÀû, ±¸¿ª, ±¸Åä, º¯ºñ, ½Ä¿åºÎÁø, ¹è´¢°ï¶õ,  Çö±âÁõµîÀÇ Áõ»óÀÌ ³ªÅ¸³ª¸é º¹¿ëÀ» ÁßÁöÇϰí ÀÇ»ç, ¾à»ç¿Í »óÀÇÇÒ   °Í.
 - ÀÌ ¾àÀÇ º¹¿ëÈÄ °í¿À» ¼ö¹ÝÇÏ¸ç ¹ßÁø, ¹ßÀû, È»ó¸ð¾ç ¼öÆ÷ µîÀÇ °Ý·ÄÇÑ Áõ»óÀÌ Àü½ÅÇǺÎ, ÀÔ ¹× ´«ÀÇ Á¡¸·¿¡ ³ªÅ¸³ °æ¿ì Áï½Ã º¹¿ëÀ» ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÒ °Í.
 - ÀÌ ¾àÀÇ º¹¿ëÈÄ Ãµ½ÄÀÌ ³ªÅ¸³ª´Â °æ¿ì Áï½Ã º¹¿ëÀ» ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÒ °Í.
 - º¹¿ëÇÏ´Â µ¿¾È Á¹À½ÀÌ ¿À´Â °æ¿ì°¡ ÀÖÀ¸¹Ç·Î ÀÚµ¿Â÷ ¿îÀü ¶Ç´Â ±â°è·ùÀÇ ¿îÀüÁ¶ÀÛÀ» ÇÇÇÒ °Í.
 - ¼öȸ º¹¿ëÇÏ¿©µµ Áõ»óÀÇ °³¼±ÀÌ ¾øÀ» °æ¿ì´Â º¹¿ëÀ» ÁßÁöÇϰí ÀÇ»ç,  ¾à»ç¿Í »óÀÇÇÒ °Í.
 - Àå±â ¿¬¿ëÇÏÁö ¸» °Í.
 
  | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  		
  
  
   
    | º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ | 
    - ¾î¸°ÀÌÀÇ ¼Õ¿¡ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÒ °Í.
 - Á÷»çÀϱ¤À» ÇÇÇÏ°í µÉ ¼ö ÀÖÀ¸¸é (½À±â°¡ Àû°í) ¼´ÃÇÑ °÷¿¡ (¹ÐÀüÇÏ¿©) º¸°üÇÒ °Í.
 - ¿À¿ëÀ» ÇÇÇϰí ǰÁúÀ» º¸È£À¯ÁöÇϱâ À§ÇØ ´Ù¸¥ ¿ë±â¿¡ ³ÖÁö ¸» °Í.
 
  | 
   
  	
  
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
       
     | 
      
  
  
      							
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¤º¸¿ä¾à | 
                 
	         
	       | 
	           	    
	     |  
	    | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ | 
                 
	         
	       | 
	           	    
	     |  
	    | 	 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¦Ç°Á¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | º¹¾àÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        
				         (ephedrine; )
				        
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ½É»çÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | ÇмúÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | µ¶¼ºÁ¤º¸ | 
    Chlorpheniramine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â 
Ephedrine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â 
Lysozyme¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â 
  Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do  | 
   
  
   
    | Mechanism of Action | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Chlorpheniramine binds to the histamine H1 receptor. This blocks the action of endogenous histamine, which subsequently leads to temporary relief of the negative symptoms brought on by histamine. 
     | 
   
  
   
    | Pharmacology | 
     
       Chlorpheniramine¿¡ ´ëÇÑ Pharmacology Á¤º¸ In allergic reactions an allergen interacts with and cross-links surface IgE antibodies on mast cells and basophils. Once the mast cell-antibody-antigen complex is formed, a complex series of events occurs that eventually leads to cell-degranulation and the release of histamine (and other chemical mediators) from the mast cell or basophil. Once released, histamine can react with local or widespread tissues through histamine receptors. Histamine, acting on H1-receptors, produces pruritis, vasodilatation, hypotension, flushing, headache, tachycardia, and bronchoconstriction. Histamine also increases vascular permeability and potentiates pain. Chlorpheniramine, is a histamine H1 antagonist (or more correctly, an inverse histamine agonist) of the alkylamine class. It competes with histamine for the normal H1-receptor sites on effector cells of the gastrointestinal tract, blood vessels and respiratory tract. It provides effective, temporary relief of sneezing, watery and itchy eyes, and runny nose due to hay fever and other upper respiratory allergies. 
     | 
   
  
   
    | Metabolism | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)Cytochrome P450 2D6 (CYP2D6) 
     | 
   
  
   
    | Protein Binding | 
    
       Chlorpheniramine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 72% 
     | 
   
  
   
    | Half-life | 
    
       Chlorpheniramine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 21-27 hours 
     | 
   
  
   
    | Absorption | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed in the gastrointestinal tract. 
     | 
   
  
   
    | Pharmacokinetics | 
    
       Chlorpheniramine MaleateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
	- ´Ü¹é°áÇÕ : 69-72%
	
 - ´ë»ç : °£´ë»ç
	
 - ¹Ý°¨±â : 20-24 ½Ã°£
	
 - ¼Ò½Ç : ´ë»çü, ¾à¹°(3-4%)ÀÌ ½Å¹è¼³µÇ¸ç, 48½Ã°£³»¿¡ ÀüüÀÇ 35%°¡ ¼Ò½ÇµÈ´Ù.
  
 Tipepidine citrateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
 
	- ¹Ý°¨±â : 1.8 ½Ã°£
 
	 - Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 1.3 ½Ã°£
 
  
     | 
   
  
   
    | Biotransformation | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Primarily hepatic via Cytochrome P450 (CYP450) enzymes. 
     | 
   
  
   
    | Toxicity | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50 = 306 mg/kg in humans, mild reproductive toxin to women of childbearing age. 
     | 
   
  
   
    | Drug Interactions | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Donepezil	Possible antagonism of actionGalantamine	Possible antagonism of actionRivastigmine	Possible antagonism of actionEthotoin	The antihistamine increases the effect of hydantoinFosphenytoin	The antihistamine increases the effect of hydantoinMephenytoin	The antihistamine increases the effect of hydantoinPhenytoin	The antihistamine increases the effect of hydantoin 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] Chlorpheniramine¿¡ ´ëÇÑ P450 table
  SUBSTRATES 
CYP 2D6 
Beta Blockers: 
S-metoprolol 
propafenone 
timolol 
Antidepressants: 
amitriptyline 
clomipramine 
desipramine 
imipramine 
paroxetine 
Antipsychotics: 
haloperidol 
risperidone 
thioridazine 
aripiprazole 
codeine 
dextromethorphan 
duloxetine 
flecainide 
mexiletine 
ondansetron 
tamoxifen 
tramadol 
venlafaxine 
 INHIBITORS 
CYP 2D6 
amiodarone 
buproprion 
**chlorpheniramine** 
cimetidine 
clomipramine 
duloxetine 
fluoxetine 
haloperidol 
methadone 
mibefradil 
paroxetine 
quinidine 
ritonavir 
 INDUCERS 
CYP 2D6 
N/A 
 
     | 
   
  
   
    | Food Interaction | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food.Avoid alcohol. 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Description Á¤º¸ A histamine H1 antagonist used in allergic reactions, hay fever, rhinitis, urticaria, and asthma. It has also been used in veterinary applications. One of the most widely used of the classical antihistaminics, it generally causes less drowsiness and sedation than promethazine. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Syrup	OralTablet	OralTablet, extended release	Oral 
     | 
   
  
   
    | Drug Category | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Allergic AgentsAntihistaminesAntipruriticsHistamine H1 Antagonists 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN(C)CCC(C1=CC=C(Cl)C=C1)C1=CC=CC=N1 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN(C)CC[C@H](C1=CC=C(Cl)C=C1)C1=CC=CC=N1 
     | 
   
  
   
    | InChI Identifier | 
    
       Chlorpheniramine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Chlorpheniramine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine 
     | 
   
  
   
    | Drug-Induced Toxicity Related Proteins | 
    
      MALEATE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Intercellular adhesion molecule 1  Drug:maleate Toxicity:hepatic injury.  [¹Ù·Î°¡±â] 
     | 
   
    
  |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ | 
                             
	         
	       | 
	           	  
       |  
	     |  
	   
	     	
 
  | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2020-05-08
              
 
              - 
                
                º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
                    
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
 |  
             
             | 
         
         
         | 
         |