| |
|
|
|
|
|
 |
| |
|
Ä«Å׳Áúݼ¿ CATENOL SOFT CAPSULE[Pyridoxine HCl , Tocopherol Acetate]
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| BIT ¾àÈ¿ºÐ·ù |
±âŸ ½ÉÇ÷°ü°è ¾à¹° (Other Cardiovascular System drugs)
|
| ATC ÄÚµå |
Other lipid modifying agents / C10AX
[ÄÚµåºÐ·ù»ó¼¼¼³¸í]
[ATCÄÚµå¿¹Ãø]
|
| º¹ÁöºÎºÐ·ùÄÚµå |
218 (µ¿¸Æ°æÈ¿ëÁ¦ )
|
| Drugs By Indication |
[Àüüº¸±â]
|
| Drugs By Classification |
[Àüüº¸±â]
|
|
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Aµî±Þ
(pyridoxine; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Pyridoxine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Pyridoxine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Vitamin B6 is the collective term for a group of three related compounds, pyridoxine (PN), pyridoxal (PL) and pyridoxamine (PM), and their phosphorylated derivatives, pyridoxine 5'-phosphate (PNP), pyridoxal 5'-phosphate (PLP) and pyridoxamine 5'-phosphate (PMP). Although all six of these compounds should technically be referred to as vitamin B6, the term vitamin B6 is commonly used interchangeably with just one of them, pyridoxine. Vitamin B6, principally in the form of the coenzyme pyridoxal 5'-phosphate, is involved in a wide range of biochemical reactions, including the metabolism of amino acids and glycogen, the synthesis of nucleic acids, hemogloblin, sphingomyelin and other sphingolipids, and the synthesis of the neurotransmitters serotonin, dopamine, norepinephrine and gamma-aminobutyric acid (GABA).
|
| Pharmacology |
Pyridoxine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Vitamin B6 (pyridoxine) is a water-soluble vitamin used in the prophylaxis and treatment of vitamin B6 deficiency and peripheral neuropathy in those receiving isoniazid (isonicotinic acid hydrazide, INH). Vitamin B6 has been found to lower systolic and diastolic blood pressure in a small group of subjects with essential hypertension. Hypertension is another risk factor for atherosclerosis and coronary heart disease. Another study showed pyridoxine hydrochloride to inhibit ADP- or epinephrine-induced platelet aggregation and to lower total cholesterol levels and increase HDL-cholesterol levels, again in a small group of subjects. Vitamin B6, in the form of pyridoxal 5'-phosphate, was found to protect vascular endothelial cells in culture from injury by activated platelets. Endothelial injury and dysfunction are critical initiating events in the pathogenesis of atherosclerosis. Human studies have demonstrated that vitamin B6 deficiency affects cellular and humoral responses of the immune system. Vitamin B6 deficiency results in altered lymphocyte differentiation and maturation, reduced delayed-type hypersensitivity (DTH) responses, impaired antibody production, decreased lymphocyte proliferation and decreased interleukin (IL)-2 production, among other immunologic activities.
|
| Metabolism |
Pyridoxine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Methylenetetrahydrofolate reductase
|
| Protein Binding |
Pyridoxine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 22%
|
| Half-life |
Pyridoxine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 15-20 days
|
| Absorption |
Pyridoxine¿¡ ´ëÇÑ Absorption Á¤º¸ The B vitamins are readily absorbed from the gastrointestinal tract, except in malabsorption syndromes. Pyridoxine is absorbed mainly in the jejunum.
|
| Pharmacokinetics |
Tocopherol AcetateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ :
- ¼ÒÀåÀ¸·ÎºÎÅÍ Èí¼öµÇ´Â µ¥¿¡´Â ´ãÁóÀÌ ÇÊ¿äÇÏ´Ù.
- Èí¼ö ÀúÇÏ : Èí¼öÀå¾Ö ȯÀÚ, ÀúüÁß ¹Ì¼÷¾Æ, °í¿ë·® Åõ¿©
- À¯ÈÁ¦Á¦º¸´Ù ¼ö¿ë¼º Á¦Á¦°¡ ´õ Àß Èí¼öµÈ´Ù.
- ºÐÆ÷ : ¸ðµç Á¶Á÷¿¡ ºÐÆ÷Çϸç, ƯÈ÷ Áö¹æÁ¶Á÷¿¡ °í³óµµ·Î ºÐÆ÷Çϰí ÀúÀåµÈ´Ù.
- ´ë»ç : °£¿¡¼ glucuronides Æ÷ÇÕ
- ¼Ò½Ç : ÁÖ·Î ´ãÁóÀ» ÅëÇØ (70-80%) ¹è¼³µÈ´Ù.
Pyridoxine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À§Àå°üÀ¸·ÎºÎÅÍ Àß Èí¼öµÈ´Ù.
- ´ë»ç : °£¿¡¼ 4-pyridoxic acid·Î ´ë»çµÈ´Ù.
- ¹Ý°¨±â : 15-20ÀÏ
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : °æ±¸ : 1.25 ½Ã°£
- ¼Ò½Ç : 4-pyridoxic acid·Î ½Å¹è¼³µÇ¸ç, ¼Ò·® (¾à 2%)Àº ´ãÁóÀ» ÅëÇØ ¹è¼³µÈ´Ù.
|
| Toxicity |
Pyridoxine¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral Rat LD50 = 4 gm/kg. Toxic effects include convulsions, dyspnea, hypermotility, diarrhea, ataxia and muscle weakness.
|
| Drug Interactions |
Pyridoxine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Pyridoxine¿¡ ´ëÇÑ Description Á¤º¸ The 4-methanol form of vitamin B 6 which is converted to pyridoxal phosphate which is a coenzyme for synthesis of amino acids, neurotransmitters (serotonin, norepinephrine), sphingolipids, aminolevulinic acid. Although pyridoxine and Vitamin B 6 are still frequently used as synonyms, especially by medical researchers, this practice is erroneous and sometimes misleading (EE Snell; Ann NY Acad Sci, vol 585 pg 1, 1990). [PubChem]
|
| Dosage Form |
Pyridoxine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Liquid IntramuscularSolution IntramuscularSolution / drops OralTablet Oral
|
| Drug Category |
Pyridoxine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-inflammatory AgentsEssential VitaminVitamin B ComplexVitamins (Vitamin B Complex)
|
| Smiles String Canonical |
Pyridoxine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1=NC=C(CO)C(CO)=C1O
|
| Smiles String Isomeric |
Pyridoxine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC1=NC=C(CO)C(CO)=C1O
|
| InChI Identifier |
Pyridoxine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C8H11NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,10-12H,3-4H2,1H3
|
| Chemical IUPAC Name |
Pyridoxine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2022-07-05
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|