| |
|
|
|
|
|
 |
| |
|
µ¿±¹¿°»ê³ª·Ï¼ÕÁÖ»ç0.4mg(ÇÁ¸®Çʵå) NALOXONE HCL INJ. 0.4MG DONGKOOK[Naloxone HCl]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| ¾ÈÀü¼º ¼ÇÑ |
[ÀǾàǰ ¾ÈÀü¼º ¼ÇÑ Á¶È¸]
|
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[A00701061]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml/°ü(2007.03.01)(ÇöÀç¾à°¡)
\1,204 ¿ø/1ml/°ü(2000.07.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Æ÷À塤À¯Åë´ÜÀ§ |
0.4MG ¡¿ 1, 10, 20°ü |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. õ¿¬¡¤ÇÕ¼º¸¶¾à, ÇÁ·ÎÆø½ÃÆæ, ¸ÞŸµ· ¹× ¸¶¾à±æÇ×ÁøÅëÁ¦(¿¹ : ³¯ºÎÇÉ, ÆæÅ¸Á¶½Å, ºÎÅ丣ÆÇ¿Ã) µîÀÇ ¾ÆÆí·ù¿¡ ÀÇÇÑ È£Èí¾ïÁ¦¸¦ Æ÷ÇÔÇÏ´Â ¸¶¾à ¾ïÁ¦ÀÇ ÀüüÀû ¶Ç´Â ºÎºÐÀû ¿ªÀü
2. ±Þ¼º¸¶¾à °ú·®Åõ¿©½Ã Áø´Ü
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
³¯·Ï¼Õ¿°»ê¿°Àº Á¤¸Æ, ±ÙÀ° ¶Ç´Â ÇÇÇÏÁÖ»çÇÑ´Ù. °¡Àå ½Å¼ÓÇÑ ÀÛ¿ë¹ßÇöÀº Á¤¸ÆÅõ¿© ÈÄ¿¡ ³ªÅ¸³ª¸ç, À̰ÍÀº ÀÀ±Þ»óÅ¿¡¼ ÃßõµÈ´Ù. ¾î¶² ¸¶¾àÀÇ ÀÛ¿ë½Ã°£Àº ³¯·Ï¼ÕÀÇ ÀÛ¿ë½Ã°£À» ÃʰúÇϹǷΠȯÀÚ¸¦ °è¼Ó °üÂûÇÏ¿©¾ß Çϸç ÇÊ¿äÇÏ´Ù¸é ¹Ýº¹Åõ¿©ÇÑ´Ù.
<Á¤¸Æ³» ÁÖÀÔ½Ã>
»ý¸®½Ä¿° ÁÖ»ç¾× ¶Ç´Â 5 % Æ÷µµ´ç ÁÖ»ç¾×¿¡ Èñ¼®ÇÒ ¼ö ÀÖÀ¸¸ç, °¢ ¿ë¾× 500 mL¿¡ ³¯·Ï¼Õ¿°»ê¿° 2 mg È¥Çսà 0.004 mg/mL³óµµ°¡ µÈ´Ù. È¥ÇÕÈñ¼®¾×Àº 24½Ã°£ À̳»¿¡ »ç¿ëÇϸç, 24½Ã°£ÀÌÈÄ¿¡´Â ³²Àº ¾×Àº ¹ö·Á¾ß ÇÑ´Ù. Åõ¿©·®°ú Åõ¿©¼Óµµ´Â ȯÀÚÀÇ ¹ÝÀÀ¿¡ µû¶ó °áÁ¤ÇÑ´Ù. ÁÖ»ç¿ë¾×Àº ÁÖ»çÀü ¹Ì¸³ÀÚ¹°°ú º¯»ö¿©ºÎ¸¦ À°¾ÈÀ¸·Î °üÂûÇØ¾ß ÇÑ´Ù. ºñ¼³ÆÄÀÌÆ®, ¸ÞŸºñ¼³ÆÄÀÌÆ®, Àå¼â ¶Ç´Â °íºÐÀÚ·®ÀÇ À½À̿ ¹× ¾ËÄ®¸®¿ë¾×°ú È¥ÇÕÇÏ¸é ¾ÈµÈ´Ù. ¿ë¾×ÀÇ ¹°¸®ÈÇÐÀû ¾ÈÁ¤¼º¿¡ ´ëÇÑ È¿°ú°¡ ¸ÕÀú È®¸³µÇÁö ¾Ê´Â ÇÑ ¾àÀ̳ª ÈÇй°ÁúÀ» °¡Çؼ´Â ¾ÈµÈ´Ù.
1. õ¿¬¡¤ÇÕ¼º¸¶¾à, ÇÁ·ÎÆø½ÃÆæ, ¸ÞŸµ· ¹× ¸¶¾à±æÇ×ÁøÅëÁ¦ µîÀÇ ¾ÆÆí·ù¿¡ ÀÇÇÑ È£Èí¾ïÁ¦ ¸¦ Æ÷ÇÔÇÏ´Â ¸¶¾à ¾ïÁ¦ÀÇ ÀüüÀû ¶Ç´Â ºÎºÐÀû ¿ªÀü, ¸¶¾à °ú·®Åõ¿©½Ã Áø´Ü
¡Û ¼ºÀÎ
1) ¸¶¾àÀÇ °ú·®Åõ¿© ¶Ç´Â °ú·®Åõ¿©°¡ ¿¹»óµÉ ¶§
(1) Á¤¸ÆÁÖ»ç½Ã ÃÊȸ·®Àº ³¯·Ï¼Õ¿°»ê¿°À¸·Î¼ 0.4 ¢¦ 2 mgÀÌ´Ù.
(2) ¸¸¾à È£Èí±â´ÉÀÌ ¹Ù¶÷Á÷ÇÏ°Ô »ó¼â ¶Ç´Â °³¼±µÇÁö ¾ÊÀ¸¸é 2 ¢¦ 3ºÐ °£°ÝÀ¸·Î ¹Ýº¹ Á¤¸ÆÁÖ»ç ÇÒ ¼ö ÀÖ´Ù.
(3) ÀÌ ¾à 10 mg Åõ¿©ÈÄ¿¡µµ ¹ÝÀÀÀÌ ¾øÀ¸¸é ¸¶¾àÀÇ ÀüüÀû ¶Ç´Â ºÎºÐÀû À¯µµµ¶¼ºÀÇ Áø´ÜÀ» ÀǽÉÇØ¾ß ÇÑ´Ù.
(4) Á¤¸ÆÁֻ簡 °ï¶õÇÒ °æ¿ì¿¡´Â ±ÙÀ° ¶Ç´Â ÇÇÇÏÁֻ縦 ÇÒ ¼ö ÀÖ´Ù.
2) ¼ö¼úÈÄ ¸¶¾à¼º ¾ïÁ¦½Ã
(1) ¼ö¼úÁß ¸¶¾à·ù »ç¿ë¿¡ µû¸¥ ¸¶¾à¼º ¾ïÁ¦ÀÇ ºÎºÐÀû ¿ªÀü¿¡´Â ÀÌ ¾à ¼Ò·®À¸·Î ÃæºÐÇϳª ȯÀÚÀÇ ¹ÝÀÀ¿¡ µû¶ó ¿ë·®À» °áÁ¤ÇØ¾ß ÇÑ´Ù.
(2) È£Èí¾ïÁ¦ÀÇ ÃÖÃÊ ¿ªÀü½Ã¿¡´Â ¹Ù¶÷Á÷ÇÑ ¿ªÀüÀÇ Á¤µµ Áï, ÅëÁõ ¹× ºÒÄèÁõ»óÀÌ ¾ø´Â ÃæºÐÇÑ È£Èí ¹× Á¤½ÅÀû ȸº¹½Ã±îÁö 2 ¢¦ 3ºÐ °£°ÝÀ¸·Î 0.1 ¢¦ 0.2 mg¾¿ Áõ·®ÇÏ¿© Á¤¸ÆÁÖ»ç ÇØ¾ß ÇÑ´Ù.
(3) ÀÌ ¾àÀÇ ¹Ýº¹Åõ¿©´Â ÃÖÁ¾ ¸¶¾àÅõ¿©ÈÄÀÇ ½Ã°£°£°Ý°ú ¸¶¾à°úÀÇ Åõ¿©·®, ¸¶¾àÀÇ ÇüÅ <´Ü½Ã°£ ¶Ç´Â Àå½Ã°£ ÀÛ¿ëÇü>¿¡ µû¶ó 1 ¢¦ 2½Ã°£ °£°Ý³»¿¡ ¿ä±¸ µÉ ¼ö ÀÖ´Ù.
(4) Ãß°¡ ±ÙÀ°ÁÖ»ç·Î ÀÛ¿ë½Ã°£ÀÌ Áö¼ÓµÈ´Ù.
¡Û ¼Ò¾Æ
1) ¸¶¾àÀÇ °ú·®Åõ¿© ¶Ç´Â °ú·®Åõ¿©°¡ ¿¹»óµÉ ¶§
(1) Á¤¸ÆÁÖ»ç½Ã º¸Åë ÃÊȸ·®Àº üÁß kg´ç 0.01 mgÀÌ´Ù. ÀÌ ¿ë·®À¸·Î ¸¸Á·ÇÒ Á¤µµÀÇ ÀÓ»óÀû °³¼±ÀÌ ³ªÅ¸³ªÁö ¾ÊÀ¸¸é üÁß kg´ç 0.1 mgÀ» ´Ù½Ã Á¤¸ÆÁÖ»çÇÒ ¼ö ÀÖ´Ù.
(2) Á¤¸ÆÁֻ簡 °ï¶õÇÒ °æ¿ì ºÐÇÒÇÏ¿© ±ÙÀ° ¶Ç´Â ÇÇÇÏÁÖ»çÇÒ ¼ö ÀÖ´Ù. ÇÊ¿ä½Ã ÁÖ»ç¿ëÁõ·ù¼ö¿¡ Èñ¼®ÇÏ¿© »ç¿ëÇÒ ¼ö ÀÖ´Ù.
2) ¼ö¼úÈÄ ¸¶¾à¼º ¾ïÁ¦½Ã : ¼ºÀÎ ¿ë¹ý¿¡ µû¸£¸ç, È£Èí¾ïÁ¦ÀÇ ÃÖÃÊ ¿ªÀü½Ã¿¡´Â ¹Ù¶÷Á÷ÇÑ ¿ªÀüÀÇ Á¤µµ°¡ ³ªÅ¸³¯ ¶§±îÁö 2 ¢¦ 3ºÐ °£°ÝÀ¸·Î 0.005 ¢¦ 0.01 mg Áõ·®ÇÏ¿© Á¤¸ÆÁÖ»ç ÇØ¾ß ÇÑ´Ù.
¡Û ½Å»ý¾Æ
¸¶¾àÀ¯µµ ¾ïÁ¦½Ã : º¸Åë ÃÊȸ·® üÁß kg´ç 0.01 mgÀ» Á¤¸Æ, ±ÙÀ° ¶Ç´Â ÇÇÇÏÁÖ»çÇÑ´Ù. ÀÌ ¿ë·®À» ¼ö¼úÈÄ ¸¶¾à¼º ¾ïÁ¦¿¡ ´ëÇÑ ¼ºÀÎÀÇ ¿ë¹ý¿¡ µû¶ó ¹Ýº¹ Åõ¿©ÇÒ ¼ö ÀÖ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
2) ¹Ù¸£ºñÅ»°è ¾à¹° µîÀÇ ºñ¸¶¾à¼º ÁßÃ߽Űæ¾ïÁ¦Á¦ ¶Ç´Â º´Àû ¿øÀο¡ ÀÇÇÑ È£Èí ¾ïÁ¦°¡ Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) °íÇ÷¾Ð, ½ÉÀåÁúȯ ȯÀÚ(ÀÌ ¾àÀ¸·Î ¸¶¾à µî¿¡ ÀÇÇÑ ¾ïÁ¦°¡ ±Þ°ÝÈ÷ ±æÇ׵Ǿî Ç÷¾Ð»ó½Â, ºó¸Æ µîÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù)
2) ½ÅºÎÀü ȯÀÚ
3) °£Áúȯ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ¸¶¾à µî¿¡ ÀÇÇÑ È£Èí¾ïÁ¦ÀÇ °©ÀÛ½º·± ¿ªÀüÀº ´ÙÀ½°ú °°Àº Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
(1) ¼øÈ¯±â°è : Ç÷¾Ð»ó½Â(1 % ÀÌ»ó), ºó¸Æ(0.5 ¢¦ 1 % ¹Ì¸¸), ÈäºÎºÒÄè°¨(ºóµµºÒ¸í)
(2) Á¤½Å½Å°æ°è : ÁøÀü(0.5 %¹Ì¸¸), ¼ö¼ú ÈÄ ÅëÁõ(0.5 %¹Ì¸¸)
(3) ¼Òȱâ°è : ±¸¿ª¤ý±¸Åä(0.5 ¢¦ 1 % ¹Ì¸¸), º¹Åë(0.5 %¹Ì¸¸)
(4) °£ : AST »ó½Â, ALT »ó½Â, °£±â´ÉÀå¾Ö(¸ðµÎ 0.5 % ¹Ì¸¸)
(5) ±âŸ : ¹ßÇÑ, ¹ßÀÛ, ½ÉÁ¤Áö
2) ¼ö¼úÈÄ È¯ÀÚ¿¡¼ °ú·®Åõ¿©·Î ÁøÅëÈ¿°úÀÇ ¿ªÀüÀ̳ª ÈïºÐÀ» ÀÏÀ¸Å³ ¼öµµ ÀÖ´Ù.
3) ½ÉÀåÁúȯ ȯÀÚ ¶Ç´Â ½ÉÇ÷°ü¼º ÀÌ»ó¹ÝÀÀÀÌ ÀÖ´Â ¾à¹° Åõ¿©È¯ÀÚ¿¡ ´ëÇØ ¼ö¼úÈÄ »ç¿ë½Ã ÀúÇ÷¾Ð, °íÇ÷¾Ð, ½É½Ç¼ººó¸Æ, ¼¼µ¿ ¹× ÆóºÎÁ¾À» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù.
4) µå¹°°Ô °æ·ÃÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| BIT ¾àÈ¿ºÐ·ù |
±âŸ ½Å°æ±Ù°è ¾à¹°(Other Neuromuscular System)
|
| ATC ÄÚµå |
Naloxone / V03AB15
[ÄÚµåºÐ·ù»ó¼¼¼³¸í]
[ATCÄÚµå¿¹Ãø]
|
| º¹ÁöºÎºÐ·ùÄÚµå |
221 (È£ÈíÃËÁøÁ¦ )
|
| ÀǾàǰ ¹ÙÄÚµåÁ¤º¸ |
³»¿ëº¸±â
8806109102339//±âŸ//1 ´ÜÀ§/¼ö·®: 10 8806109102353//±âŸ//1 ´ÜÀ§/¼ö·®: 100 18806109102343//±âŸ//27 ´ÜÀ§/¼ö·®: 270 18806109102367//±âŸ//3 ´ÜÀ§/¼ö·®: 300
|
ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä |
[ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä]
|
| Drugs By Indication |
[Àüüº¸±â]
|
| Drugs By Classification |
[Àüüº¸±â]
|
|
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Naloxone¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Naloxone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ While the mechanism of action of naloxone is not fully understood, the preponderance of evidence suggests that naloxone antagonizes the opioid effects by competing for the same receptor sites, especially the opioid mu receptor. Recently, naloxone has been shown to bind all three opioid receptors (mu, kappa and gamma) but the strongest binding is to the mu receptor.
|
| Pharmacology |
Naloxone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Naloxone is an opiate antagonist and prevents or reverses the effects of opioids including respiratory depression, sedation and hypotension. Also, it can reverse the psychotomimetic and dysphoric effects of agonist-antagonists such as pentazocine. Naloxone is an essentially pure narcotic antagonist, i.e., it does not possess the "agonistic" or morphine-like properties characteristic of other narcotic antagonists; naloxone does not produce respiratory depression, psychotomimetic effects or pupillary constriction. In the absence of narcotics or agonistic effects of other narcotic antagonists, it exhibits essentially no pharmacologic activity.
|
| Metabolism |
Naloxone¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Naloxone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Naloxone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 30-81 minutes
|
| Absorption |
Naloxone¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed following intramuscular injection.
|
| Pharmacokinetics |
Naloxone HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ :
- ±â°ü³» Åõ¿©, ±ÙÀ°ÁÖ»ç, ÇÇÇÏÁÖ»ç : 2-5ºÐ À̳»
- Á¤¸ÆÁÖ»ç : 2ºÐ À̳»
- ÀÛ¿ëÁö¼Ó½Ã°£ : 20-60ºÐ. ´ëºÎºÐÀÇ ¸¶¾à¼º Á¦Á¦º¸´Ù Áö¼Ó½Ã°£ÀÌ ÂªÀ¸¹Ç·Î ¹Ýº¹ Åõ¿©°¡ ÇÊ¿äÇÏ´Ù.
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú
- ´ë»ç : ÁÖ·Î °£¿¡¼ glucuronide Æ÷ÇÕ
- ¹Ý°¨±â :
- ½Å»ý¾Æ : 1.2-3 ½Ã°£
- ¼ºÀÎ : 1-1.5 ½Ã°£
- ¼Ò½Ç : ´ë»çü·Î¼ ½Å¹è¼³µÊ
|
| Biotransformation |
Naloxone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic.
|
| Toxicity |
Naloxone¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Naloxone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aminophylline Propafenone increases the effect of theophyllineDyphylline Propafenone increases the effect of theophyllineOxtriphylline Propafenone increases the effect of theophyllineTheophylline Propafenone increases the effect of theophyllineWarfarin The agent increases the effect of anticoagulantAcenocoumarol The agent increases the effect of anticoagulantDicumarol The agent increases the effect of anticoagulantAnisindione The agent increases the effect of anticoagulantVenlafaxine Propafenone increases the effect and toxicity of venlafaxineSertraline Fluoxetine increases the effect and toxicity of propafenoneRitonavir Ritonavir increases the effect and toxicity of propafenoneMexiletine Propafenone increases the effect and toxicity of mexilitineCyclosporine Propafenone increases the effect and toxicity of cyclosporineDigoxin Propafenone increases the effect of digoxinAtomoxetine Tje CYP2D6 inhibitor could increase the effect and toxicity of atomoxetinePropranolol Propafenone increases the effect of the beta-blockerMetoprolol Propafenone increases the effect of the beta-blockerQuinidine Quinidine increases the effect of propafenoneQuinidine barbiturate Quinidine increases the effect of propafenoneDihydroquinidine barbiturate Quinidine increases the effect of propafenoneRifabutin Rifampin decreases the effect of propafenoneRifampin Rifampin decreases the effect of propafenoneDuloxetine Possible increase in the levels of this agent when used with duloxetineCisapride Increased risk of cardiotoxicity and arrhytmiasMesoridazine Increased risk of cardiotoxicity and arrhytmiasThioridazine Increased risk of cardiotoxicity and arrhytmiasTerfenadine Increased risk of cardiotoxicity and arrhytmiasFluoxetine Fluoxetine increases the effect and toxicity of propafenoneParoxetine Fluoxetine increases the effect and toxicity of propafenone
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Naloxone¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Naloxone¿¡ ´ëÇÑ Description Á¤º¸ A specific opiate antagonist that has no agonist activity. It is a competitive antagonist at mu, delta, and kappa opioid receptors. [PubChem]
|
| Drug Category |
Naloxone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antinarcotic AgentsDepressantsNarcotic AntagonistsOpiate Antagonists
|
| Smiles String Canonical |
Naloxone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ OC1=C2OC3C(=O)CCC4(O)C5CC(C=C1)=C2C34CCN5CC=C
|
| Smiles String Isomeric |
Naloxone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ OC1=C2O[C@H]3C(=O)CC[C@@]4(O)[C@H]5CC(C=C1)=C2[C@@]34CCN5CC=C
|
| InChI Identifier |
Naloxone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H21NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,14,17,21,23H,1,5-10H2/t14-,17+,18+,19-/m1/s1
|
| Chemical IUPAC Name |
Naloxone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ Not Available
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-11-26
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|