| |
|
|
|
|
|
 |
| |
|
¿ÉƼÆå½Ã·´ OPTIPECT SYR.[Ammonia solution conc. , Camphor , Ephedrine HCl , Eucalyptus oil , Liquiritiae extract , Menthol , Peppermint oil
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
646802300[A03804891]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2002.01.01)(ÇöÀç¾à°¡)
\13 ¿ø/1ml(2001.04.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¾Ï°¥»öÀÇ ¹æÇâÀÌ ÀÖ´Â ½Ã·´Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
1SYR |
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
±âħ, °¡·¡, õ½Ä
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:269200ASY ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
- ¼ºÀÎ: 1ȸ 5-10ml, 1ÀÏ 3-4ȸ º¹¿ëÇÑ´Ù.
- ¼Ò¾Æ: 1ȸ 2.5-5ml, 1ÀÏ 2-3ȸ º¹¿ëÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
30°³¿ù ÀÌÇÏÀÇ À¯¾Æ |
| ½ÅÁßÅõ¿© |
- ¼Ò¾Æ¿¡ Àû¿ë½Ã °æ·ÃÀ» À¯¹ß½Ãų ¼ö ÀÖÀ¸¹Ç·Î ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
- º»ÀÎ ¶Ç´Â ¾çÄ£, ÇüÁ¦µîÀÌ µÎµå·¯±â, Á¢Ã˼º ÇǺο°, ¾Ë·¹¸£±â¼º ºñ¿°, ÆíµÎÅë, À½½Ä¹° ¾Ë·¹¸£±â µîÀ» ÀÏÀ¸Å°±â ½¬¿î üÁúÀ» °®°í Àִ ȯÀÚ
- ¾àÀ¸·Î ¾Ë·¹¸£±â Áõ»ó(¹ß¿, ¹ßÁø, °üÀýÅë, °¡·Á¿ò µî)À» ÀÏÀ¸Å² ÀÏÀÌ Àִ ȯÀÚ
- °£Àå¾Ö, ½ÅÀå¾Ö, °©»ó¼±Áúȯ, ´ç´¢º´µî º´ÀÌ Àִ ȯÀÚ, °í¿È¯ÀÚ, Çã¾àÀÚ
- ½ÉÀå¾Ö ¹× °íÇ÷¾Ð ȯÀÚ, °í·ÉÀÚ
- ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ, ¼öÀ¯ºä
- ´Ù¸¥ ¾à¹°À» Åõ¿©¹Þ°í Àִ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
ÀÌ ¾àÀ» Åõ¿©ÇÏ´Â µ¿¾È ¹ßÁø, ¹ßÀû, ±¸¿ª, ±¸Åä, ½Ä¿åºÎÁø, ¾îÁö·¯¿ò µîÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ°í ¾à»ç ¶Ç´Â ÀÇ»ç¿Í »óÀÇÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
- ´ÙÀ½ ¾àµé°ú º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
- ´Ù¸¥ ÁøÇذŴãÁ¦, °¨±â¾à, Ç×È÷½ºÅ¸¹ÎÁ¦, ÁøÁ¤Á¦, ¾ËÄÚ¿Ã µî
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Ammonia¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Camphor¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ephedrine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Ephedrine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Ephedrine is a sympathomimetic amine - that is, its principal mechanism of action relies on its direct and indirect actions on the adrenergic receptor system, which is part of the sympathetic nervous system. Ephedrine increases post-synaptic noradrenergic receptor activity by (weakly) directly activating post-synaptic α-receptors and β-receptors, but the bulk of its effect comes from the pre-synaptic neuron being unable to distinguish between real adrenaline or noradrenaline from ephedrine. The ephedrine, mixed with noradrenaline, is transported through the noradrenaline reuptake complex and packaged (along with real noradrenaline) into vesicles that reside at the terminal button of a nerve cell. Ephedrine's action as an agonist at most major noradrenaline receptors and its ability to increase the release of both dopamine and to a lesser extent, serotonin by the same mechanism is presumed to have a major role in its mechanism of action.
Menthol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Menthol is classified as a calcium channel blocker. Calcium channel blockers are a class of drugs with effects on many excitable cells of the body, like the muscle of the heart, smooth muscles of the vessels or neuron cells. Calcium channel blockers work by blocking voltage-sensitive calcium channels in the heart and in the blood vessels. This prevents calcium levels from increasing as much in the cells when stimulated, leading to less contraction.
|
| Pharmacology |
Menthol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Menthol is a covalent organic compound made synthetically or obtained from peppermint or other mint oils. Menthol's ability to chemically trigger cold-sensitive receptors in the skin is responsible for the well known cooling sensation that it provokes when inhalated, eaten, or applied to the skin. It should be noted that menthol does not cause an actual drop in temperature.
|
| Protein Binding |
Menthol¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Menthol¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available
|
| Absorption |
Menthol¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
|
| Pharmacokinetics |
Ephedrine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- °æ±¸Åõ¿©½Ã
- ÀÛ¿ë¹ßÇö½Ã°£ : 0.25-1½Ã°£ À̳»
- ÀÛ¿ëÁö¼Ó½Ã°£ : 3-6 ½Ã°£
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ
- ´ë»ç : °£´ë»ç¸¦ °ÅÀÇ ¹ÞÁö ¾ÊÀ½
- ¹Ý°¨±â : 2.5-3.6 ½Ã°£
- ¼Ò½Ç : 24½Ã°£³»¿¡ Åõ¿©·®ÀÇ 60-77%°¡ ¹Ìº¯Èü·Î ´¢¸¦ ÅëÇØ ¹è¼³µÊ
MentholÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ¼Ò½Ç : Èí¼öµÈ ¾à¹°Àº glucuronide Æ÷ÇÕü·Î¼ ¼Òº¯ ¹× ´ãÁóÀ» ÅëÇØ ¹è¼³µÈ´Ù.
|
| Toxicity |
Menthol¿¡ ´ëÇÑ Toxicity Á¤º¸ Menthol, DL: ORAL (LD50): Acute: 2900 mg/kg [Rat], 3100 mg/kg [Mouse]. DERMAL (LD50): Acute: 5001 mg/kg [Rabbit].
|
| Drug Interactions |
Menthol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Camphor¿¡ ´ëÇÑ Description Á¤º¸ A bicyclic monoterpene ketone found widely in plants, especially cinnamomum camphora. It is used topically as a skin antipruritic and as an anti-infective agent. [PubChem]
Ephedrine¿¡ ´ëÇÑ Description Á¤º¸ An alpha- and beta-adrenergic agonist that may also enhance release of norepinephrine. It has been used in the treatment of several disorders including asthma, heart failure, rhinitis, and urinary incontinence, and for its central nervous system stimulatory effects in the treatment of narcolepsy and depression. It has become less extensively used with the advent of more selective agonists. [PubChem]
Menthol¿¡ ´ëÇÑ Description Á¤º¸ Menthol is a covalent organic compound made synthetically or obtained from peppermint or other mint oils. It is a waxy, crystalline substance, clear or white in color, which is solid at room temperature and melts slightly above. The main form of menthol occurring in nature is (-)-menthol, which is assigned the (1R,2S,5R) configuration. Menthol has local anesthetic and counterirritant qualities, and it is widely used to relieve minor throat irritation.
|
| Dosage Form |
Ephedrine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralLiquid IntramuscularLiquid IntravenousPowder OralSolution IntramuscularTablet Oral
Menthol¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream TopicalGel TopicalLiquid NasalLiquid OralLiquid TopicalLozenge OralOintment TopicalPatch TopicalPowder TopicalSolution / drops OralSpray Topical
|
| Drug Category |
Camphor¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Infective Agents, Local
Ephedrine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic AgentsCentral Nervous System StimulantsSympathomimeticsVasoconstrictor Agents
Menthol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antipruritics
|
| Smiles String Canonical |
Camphor¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1(C)C2CCC1(C)C(=O)C2
Ephedrine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CNC(C)C(O)C1=CC=CC=C1
Menthol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C)C1CCC(C)CC1O
|
| Smiles String Isomeric |
Camphor¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC1(C)[C@H]2CC[C@]1(C)C(=O)C2
Ephedrine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN[C@@H](C)[C@H](O)C1=CC=CC=C1
Menthol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O
|
| InChI Identifier |
Camphor¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3
Ephedrine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10-/m0/s1
Menthol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1
|
| Chemical IUPAC Name |
Camphor¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
Ephedrine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (1R,2S)-2-methylamino-1-phenylpropan-1-ol
Menthol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|