| |
|
|
|
|
|
 |
| |
|
´ëÇѾƹ̳ëÇʸ°ÁÖ»ç¾×(2.5%) DaiHan AMINOPHYLLINE INJ.2.5%
|
Àü¹®ÀǾàǰ | »èÁ¦ | ºÐ¾÷¿¹¿ÜÀǾàǰ(52)
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
645100720[A02701021]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/10ml/¾ÚÇÃ(2016.10.01)(ÇöÀç¾à°¡)
\399 ¿ø/10ml/¾ÚÇÃ(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»ö Åõ¸íÇÑ ¾×À¸·Î¼ ¸ÀÀº ¸Å¿ì ¾²´Ù. ±¤¼±¿¡ ÀÇÇÏ¿© õõÈ÷ º¯ÈÇϸç pH´Â 8 ~10 [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§¿¡ µû¸§ |
| ÁÖ¼ººÐÄÚµå |
107302BIJ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. ´ÙÀ½ ÁúȯÀÇ ±âµµÆó¼â¼ºÀå¾Ö¿¡ ÀÇÇÑ È£Èí°ï¶õ µî ¿©·¯ Áõ»óÀÇ ¿ÏÈ : ±â°üÁöõ½Ä, õ½Ä±â°üÁö¿°, Æó±âÁ¾, ¸¸¼º±â°üÁö¿°
2. ¿ïÇ÷½ÉºÎÀü, ½ÉÀåõ½Ä(¹ßÀÛ¿¹¹æ), üÀÎ-½ºÅäÅ©½ºÈ£Èí
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : ¾Æ¹Ì³ëÇʸ°¼öȹ°À¸·Î¼ 1ȸ 250 mgÀ» 1ÀÏ 1 ¡ 2ȸ »ý¸®½Ä¿°ÁÖ»ç¾× ¶Ç´Â Æ÷µµ´ç ÁÖ»ç¾×¿¡ Èñ¼®ÇÏ¿© 5 ¡ 10ºÐ µ¿¾È õõÈ÷ Á¤¸Æ ¶Ç´Â Á¡Àû Á¤¸ÆÁÖ»çÇÑ´Ù. Åõ¿©°£°ÝÀº 8½Ã°£ ÀÌ»óÀ¸·Î Çϰí ÃÖ°í¿ë·®Àº 1ÀÏ Ã¼Áß kg´ç 12 mgÀÌ´Ù.
Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à, ÀÌ ¾àÀÇ ±¸¼º¼ººÐ ¶Ç´Â ÀÜÆ¾°è ¾à¹°¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ
2) ÀÌ ¾à ¶Ç´Â ÀÜÆ¾°è ¾à¹°¿¡ ÁßÁõÀÇ ÀÌ»ó¹ÝÀÀ º´·ÂÀÌ Àִ ȯÀÚ
3) À§¡¤½ÊÀÌÁöÀå±Ë¾ç ȯÀÚ
4) Æ÷¸£ÇǸ°Áõ ȯÀÚ
5) Ä«ÆäÀÎ ¶Ç´Â Å׿Àºê·Î¹Î¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ(ÁÖ»çÁ¦¿¡ ÇÑÇÔ)
6) ±Þ¼º ºó¸Æ¼º ºÎÁ¤¸Æ ȯÀÚ(ÁÖ»çÁ¦¿¡ ÇÑÇÔ)
7) ½É±Ù°æ»ö ȯÀÚ(ÁÖ»çÁ¦¿¡ ÇÑÇÔ)
|
| ½ÅÁßÅõ¿© |
1) °£Áú ȯÀÚ
2) °©»ó»ù±â´ÉÇ×ÁøÁõ ȯÀÚ
3) ±Þ¼º ½Å¿°, ½ÅºÎÀü ȯÀÚ
4) °£Àå¾Ö ȯÀÚ
5) ¼Ò¾Æ, °í·ÉÀÚ
6) °íÇ÷¾Ð ȯÀÚ
7) ºñÈļº ½É±Ùº´Áõ ȯÀÚ
8) ºó¸Æ¼º ºÎÁ¤¸Æ ȯÀÚ
9) ½É±Ù°æ»ö ȯÀÚ(°æ±¸Á¦¿¡ ÇÑÇÔ)
10) ÀÓºÎ, ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º, »êºÎ ¹× ¼öÀ¯ºÎ
11) ¸¸¼º ¾ËÄÚ¿ÃÁßµ¶ ȯÀÚ
12) ±Þ¼º ¿¼ºÁúȯ ȯÀÚ
13) ½ÉºÎÀü ȯÀÚ(ÁÖ»çÁ¦¿¡ ÇÑÇÔ)
14) ¸¸¼º Æó¼âÆóÁúȯ ȯÀÚ(ÁÖ»çÁ¦¿¡ ÇÑÇÔ)
15) ´ç´¢º´ ȯÀÚ(ÁÖ»çÁ¦¿¡ ÇÑÇÔ)
16) ³ì³»Àå ȯÀÚ(ÁÖ»çÁ¦¿¡ ÇÑÇÔ)
17) ÁßÁõÀÇ Àú»ê¼ÒÇ÷Áõ ȯÀÚ(ÁÖ»çÁ¦¿¡ ÇÑÇÔ)
18) ºÒ¾ÈÁ¤Çü Çù½ÉÁõ ȯÀÚ(ÁÖ»çÁ¦¿¡ ÇÑÇÔ)
|
| ÀÌ»ó¹ÝÀÀ |
1) ¼îÅ© : ÁÖ»çÁ¦¿¡ ÀÇÇØ ¼îÅ©°¡ ¹ß»ýÇÑ ÀÏÀÌ ÀÖ´Ù´Â º¸°í°¡ ÀÖ´Ù.
2) Á¤½Å½Å°æ°è : ¶§¶§·Î µÎÅë, ºÒ¸é, ÁßÃ߽Űæ°è ÈïºÐ, ºÒ¾È, ¾îÁö·³, À̸í, ÁøÀü, ¸¶ºñ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ¶ÇÇÑ °ú·®Åõ¿©¿¡ ÀÇÇØ ¶§¶§·Î °æ·Ã, ¼¶¸Á, È¥¼ö µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) ¼øÈ¯±â°è : ¶§¶§·Î ½É°èÇ×Áø, ±â¿Ü¼öÃà, È«Á¶, ¾È¸éâ¹é, ºó¸Æ, ºÎÁ¤¸Æ, ÀúÇ÷¾Ð µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) ¼Òȱâ°è : ¶§¶§·Î ±¸¿ª, ±¸Åä, ½Ä¿åºÎÁø, º¹Åë, ¼ÒȺҷ®, ¼³»ç, º¹ºÎÆØ¸¸°¨, À§ÀÚ±Ø µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) °ú¹Î¹ÝÀÀ : ÇÇÁø, °¡·Á¿ò µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
6) ºñ´¢±â°è : ¶§¶§·Î ´Ü¹é´¢°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) ´ë»ç ¹× ¿µ¾ç°è : Ç÷û¿ä»êÄ¡»ó½Â, ÀúÀλêÇ÷Áõ, Àú³ªÆ®·ýÇ÷Áõ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
8) È£Èí±â°è : È£Èí·üÀÇ Áõ°¡°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
9) ±Ù°ñ°Ý°è : µå¹°°Ô Ⱦ¹®±ÙÀ¶ÇØÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Å©·¹¾ÆÆ¾Å°³ª¾ÆÁ¦(CK) »ó½Â µî¿¡ ÁÖÀÇÇÑ´Ù.
10) °£Àå : ¶§¶§·Î ALT, AST, ALP ÀÇ »ó½Â µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
11) ±âŸ : ¶§¶§·Î ºÎÁ¾ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ´Ù¸¥ ÀÜÆ¾°è ¾à¹°, ÁßÃ߽ŰæÈïºÐ¾à¹°°ú º´¿ëÅõ¿©½Ã °úµµÇÑ ÁßÃ߽ŰæÈïºÐÀÛ¿ëÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ ¾à¹°°ú´Â º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ¸ç ºÎµæÀÌÇÏ°Ô º´¿ëÅõ¿©ÇÒ °æ¿ì¿¡´Â °¨·®ÇÏ´Â µî ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
2) ¿¡¸®Æ®·Î¸¶À̽Å, Ŭ·¡¸®Æ®·Î¸¶À̽Å, Æ®¸®¾Æ¼¼Æ¿¿Ã·¹¾Èµµ¸¶À̽Å, Æ®¸®¾Ï½Ã³î·Ð, ¿¡³ì»ç½Å, ½ÃÇÁ·ÎÇ÷ϻç½Å, Åä¼öÇ÷ϻç½Å, ³ë¸£Ç÷ϻç½Å, ¿ÀÇ÷ϻç½Å, º£¶óÆÄ¹Ð¿°»ê¿°, ÀÎÅÍÆä·Ð, ½Ã¸ÞƼµò, ƼŬ·ÎÇǵò¿°»ê¿°, ¸ß½Ç·¹Æ¾¿°»ê¿°, ¾Ë·ÎǪ¸®³î, ÀÌÇÁ¸®Çöóº», ·Ï½ÃÆ®·Î¸¶À̽Å, ÇÇÆä¹Ìµò»ê»ï¼öȹ°, Ƽ¾Æº¥´ÙÁ¹, ¾Æ¹Ì¿À´Ù·Ð¿°»ê¿°, ½ÃŬ·Î½ºÆ÷¸°, µôƼ¾ÆÁª¿°»ê¿°, °æ±¸¿ëÇÇÀÓ¾à, ÇÁ·ÎÇÁ¶ó³î·Ñ, Ä«ºñ¸¶Á¹, µð¼³ÇǶ÷, Ç÷çÄÚ³ªÁ¹, À̼ҴϾÆÁöµå, ¸ÞÅ䯮·º¼¼ÀÌÆ®, ÇÁ·ÎÆÄÆä³í, ´ÏÀÚÆ¼µò, ¿Á½ºÆæÆ¼Çʸ°, ºô·Ï»çÁø¿°»ê¿°, Ÿũ¸°, ÀÚÇǸ£·çÄ«½ºÆ®, ÆæÅå½ÃÇʸ°, Æ®·Ñ·¹¾Èµµ¸¶À̽еî°ú º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ Ã»¼ÒÀ²À» °¨¼Ò½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÀÌ»ó¹ÝÀÀÀ» ¹æÁöÇϱâ À§ÇÏ¿© °¨·®ÀÌ ÇÊ¿äÇÒ ¼ö ÀÖ´Ù.
Ç÷纹»ç¹Î°ú º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷Çϸç, ºÎµæÀÌÇÏ°Ô º´¿ëÅõ¿©ÇÏ´Â °æ¿ì¿¡´Â ÀÌ ¾àÀÇ ¿ë·®À» 1/2·Î °¨·®Çϸç Ç÷Á߳󵵸¦ ÁÖÀDZí°Ô ¸ð´ÏÅÍÇÑ´Ù.
3) ¹Ù¸£ºñÅ»°è, ¸®ÆÊÇǽÅ, ¶õ¼ÒÇÁ¶óÁ¹, ¾Æ¹Ì³ë±Û·çÅׯ¼¹Ìµå, À̼ÒÇÁ·¹³¯¸°, ¸ð¶ó½ÃÁø, Æä´ÏÅäÀÎ, Ä«¸£¹Ù¸¶Á¦ÇÉ, ¼³ÇÉÇǶóÁ¸, ÇÁ¸®¹Ìµ·, ¸®Åä¶óºñ¾î, ÆæÅä½ÃÇʸ°, ¼¼ÀÎÆ®Á¸½º¿öÆ®Á¦Á¦(hypericum perforatum) µî°ú º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ Ã»¼ÒÀ²À» Áõ°¡½Ãų ¼ö ÀÖÀ¸¹Ç·Î Ä¡·áÈ¿°ú¸¦ ¹ßÇöÇϱâ À§ÇÏ¿© Áõ·®ÀÌ ÇÊ¿äÇÒ ¼ö ÀÖ´Ù. ¼¼ÀÎÆ®Á¸½º¿öÆ®Á¦Á¦(hypericum perforatum)¿Í º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ Ç÷Áß³óµµ°¡ ÀúÇ쵃 ¼ö ÀÖ´Ù. Èí¿¬ ¹× ¾ËÄÚ¿Ã ¼·Ãëµµ ÀÌ ¾àÀÇ Ã»¼ÒÀ²À» Áõ°¡½Ãų ¼ö ÀÖ´Ù.
4) Æä´ÏÅäÀÎ, Ä«¸£¹Ù¸¶Á¦Çɰú º´¿ë½Ã ¼·ÎÀÇ Ç÷Á߳󵵸¦ ÀúÇϽÃŲ´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. ÀÌ ¾àÀº Á¤»ó»óÅÂÀÇ Æä´ÏÅäÀÎ Ç÷Á߳󵵸¦ ÀúÇϽÃų ¼ö ÀÖ´Ù.
5) ´ÙÀ½ ±³°¨½Å°æÈ¿´É¾à(º£Å¸È¿´É¾à)°ú º´¿ëÅõ¿©½Ã ÀÌ»ó¹ÝÀÀÀÌ Áõ°µÈ´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. : À̼ÒÇÁ·¹³¯¸°¿°»ê¿°, Ŭ·»ºÎÅ×·Ñ¿°»ê¿°, Åø·ÎºÎÅ×·Ñ¿°»ê¿°, Å׸£ºÎÅ»¸°¶ôÆ®»ê¿°, ÇÁ·ÎÄ«Å×·Ñ¿°»ê¿° µî
6) ¾Æµ¥³ë½Å, º¥Á¶µð¾ÆÁ¦Çɰè, ÇÒ·Îź, ·Î¹«½ºÆ¾, ¸®Æ¬, ÄÉŸ¹Î, ÆÇÅ¥·Î´½°ú º´¿ëÅõ¿©½Ã ¾à¸®ÇÐÀû »óÈ£ÀÛ¿ëÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÏ¿© Åõ¿©ÇÑ´Ù. ÀÌ ¾à Åõ¿©ÇÏ¿¡ ÇÒ·Îź ¸¶Ã븦 ÇÒ °æ¿ì µ¿ºó¸Æ, ½É½Ç¼º ºÎÁ¤¸ÆÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç ¿¬¼Ó º´¿ë¿¡ ÀÇÇØ Å׿ÀÇʸ°ÀÇ Ç÷Áß³óµµ°¡ »ó½ÂÇÏ´Â °æ¿ì°¡ ÀÖ´Ù.
7) ÀÌ ¾à Åõ¿© ȯÀÚ¿¡¼ ź»ê¸®Æ¬ÀÇ ¹è¼³ÀÌ Áõ°¡µÈ´Ù.
8) ÀÌ ¾àÀº ÇÁ·ÎÇÁ¶ó³î·ÑÀÇ È¿°ú¸¦ ÀúÇØÇÒ ¼ö ÀÖ´Ù.
9) ÀÜÆ¾°è ¾à¹°ÀÇ Åõ¿©·Î º£Å¸2È¿´É¾à, ½ºÅ×·ÎÀ̵åÁ¦Á¦, ÀÌ´¢Á¦ ¹× Àú»ê¼ÒÁõÀ¸·Î ÀÎÇÑ Ç÷û Ä®·ýÄ¡ÀÇ ÀúÇÏÀÛ¿ëÀÌ ¾Ç鵃 ¼ö ÀÖÀ¸¹Ç·Î ÀÔ¿øÀ» ¿äÇÏ´Â ÁßÁõ õ½ÄȯÀÚÀÇ °æ¿ì¿¡´Â ƯÈ÷ ÁÖÀÇÇϰí Ç÷û Ä®·ýÄ¡¸¦ ¸ð´ÏÅÍÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
10) º£Å¸È¿´É¾à, ±Û·çÄ«°ï ¹× ±âŸ ÀÜÆ¾°è ¾à¹°°úÀÇ º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ È¿°ú°¡ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÏ¿©¾ß ÇÑ´Ù. ¿¡Æäµå¸° ¶Ç´Â °½É¹è´çü¿ÍÀÇ º´¿ëÅõ¿©´Â µ¶¼ºÀÛ¿ëÀÇ ¹ßÇöÀ» Áõ°¡½Ãų ¼ö ÀÖ´Ù.
11) °©»ó»ù Áúȯ ¹× °ü·Ã Ä¡·áÁ¦´Â ÀÌ ¾àÀÇ Ç÷Á߳󵵸¦ º¯È½Ãų ¼ö ÀÖ´Ù.
12) ÀÎÇ÷翣ÀÚ ¹é½ÅÀÌ ÀÌ ¾àÀÇ ÀÛ¿ëÀ» Áõ°½ÃŰ´Â °Í¿¡ °üÇÑ »ó¹ÝµÈ º¸°í°¡ ÀÖÀ¸¹Ç·Î »óÈ£ÀÛ¿ëÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ½¿¡ À¯ÀÇÇÑ´Ù.
13) º£Å¸Â÷´ÜÁ¦´Â ÀÌ ¾àÀÇ ±â°üÁö È®Àå È¿°ú¸¦ °¨¼Ò½Ãų ¼ö ÀÖ´Ù.
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
645100720[A02701021]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/10ml/¾ÚÇÃ(2016.10.01)(Ãֽžడ)
\399 ¿ø/10ml/¾ÚÇÃ(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
|
| Á¦Ç°¼º»ó |
¹«»ö Åõ¸íÇÑ ¾×À¸·Î¼ ¸ÀÀº ¸Å¿ì ¾²´Ù. ±¤¼±¿¡ ÀÇÇÏ¿© õõÈ÷ º¯ÈÇϸç pH´Â 8 ~10
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§¿¡ µû¸§ |
| º¸°ü¹æ¹ý |
Â÷±¤ÇÑ ¹ÐºÀ¿ë±â |
µ¿ÀÏÁÖ¼ººÐÄÚµå °Ë»ö¼øÀ§ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
Ư¼ö°ü¸®ÀǾàǰ ºÎ°¡Á¤º¸ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Brandname Á¤º¸ |
Aminophylline
Brand Names/Synonyms
- Aminocardol
- Aminodur
- Aminophyllin
- Aminophylline Anhydrous
- Aminophylline Dihydrate
- Aminophylline Dye Free
- Ammophyllin
- Cardiofilina
- Cardiomin
- Cardophylin
- Cardophyllin
- Carena
- Cariomin
- Diaphylline
- Diophllin
- Diuxanthine
- Dobo
- Dura-Tab S.M. Aminophylline
- Ethophylline
- Etilen-Xantisan Tabl.
- Euphyllin
- Euphylline
- Eurphyllin
- Euufillin
- Genophyllin
- Grifomin
- Inophylline
- Lasodex
- Linampheta
- Lixaminol
- Metaphyllin
- Metaphylline
- Methophylline
- Minaphil
- Miofilin
- Neophyiline
- Norofilina
- Peterphyllin
- Phylcardin
- Phyllindon
- Phyllocontin
- Phyllocontin-350
- Rectalad Aminophylline
- Rectalad-Aminophylline
- Somophyllin
- Somophyllin O
- Somophyllin-Df
- Somophyllin-O
- Stenovasan
- Syntophyllin
- Tefamin
- Theodrox
- Theolamine
- Theolone
- Theophyldine
- Theophyline Ethylenediamine
- Theophyllamine
- Theophyllaminum
- Theophyllin Aethylendiamin
- Theophyllin Ethylenediamine
- Theophylline Compound with Ethylenediamine
- Theophylline Ethylenediamine
- Thephyldine
- Truphylline
- Variaphylline
- Vasofilina
Brand Name Mixtures
- Ami-Nesine Liq (Aminophylline + Guaifenesin)
- Quiex - Forte Syr (Aminophylline + Guaifenesin)
- Quiex Liq (Aminophylline + Guaifenesin)
- Quiex-K1 Syr (Aminophylline + Guaifenesin + Potassium Iodide)
- Quiex-Pred Sus (Aminophylline + Guaifenesin + Prednisolone)
Chemical IUPAC Name1,3-dimethyl-7H-purine-2,6-dione; ethane-1,2-diamine
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Aminophylline¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Theophylline is structurally related to theobromine and caffeine. The precise mechanism of action of theophylline is not known.
|
| Pharmacology |
Aminophylline¿¡ ´ëÇÑ Pharmacology Á¤º¸ Aminophylline is the ethylenediamine salt of theophylline. Theophylline stimulates the CNS, skeletal muscles, and cardiac muscle. It relaxes certain smooth muscles in the bronchi, produces diuresis, and causes an increase in gastric secretion.
|
| Metabolism |
Aminophylline¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Aminophylline¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 60%
|
| Half-life |
Aminophylline¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 7-9 hours
|
| Absorption |
Aminophylline¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
|
| Pharmacokinetics |
AminophyllineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
1.ºÐÆ÷ Vd = 0.45L/kg
2.¸ðÀ¯·Î °ÅÀÇ Ç÷Áß³óµµ¿Í °°Àº Á¤µµ·Î ºÐÆ÷Çϸç Źݵµ Åë°ú
3.´ë»ç : °£¿¡¼ demethylation, oxidation
4.¹Ý°¨±â : ³ªÀÌ, °£ ±â´É, ½É ±â´É, Æó Áúȯ, Èí¿¬·Â¿¡ µû¶ó ¸Å¿ì ´Ù¾ç
¡á AminophyllineÀÇ ¹Ý°¨±â
|
ȯÀÚ±º |
¹Ý°¨±â(hr) |
|
½Å»ý¾Æ |
|
|
¹Ì¼÷¾Æ |
30 |
|
Á¤»óºÐ¸¸ |
24 |
|
¿µ¾Æ |
|
|
4-52ÁÖ |
4-30 |
|
¼Ò¾Æ/û¼Ò³â |
|
|
1-9¼¼ |
2-10 (Æò±Õ4) |
|
9-16¼¼ |
4-16 |
|
¼ºÀÎ |
|
|
ºñÈí¿¬ÀÚ |
|
|
Èí¿¬ÀÚ |
4.4 |
|
½ÉÁúȯ,°£ºÎÀü |
20-30 |
¡á AminophyllineÀÇ ¿ªµ¿ÇÐ/¾à·ÂÇÐ
|
Á¦Çü |
ÃÖ°íÇ÷Áß³óµµ µµ´Þ½Ã°£ |
Åõ¿© °£°Ý |
|
³ªÁ¤/½Ã·´ |
2½Ã°£ |
6½Ã°£ |
|
Àå¿ëÁ¤ |
5½Ã°£ |
12½Ã°£ |
|
ÃòÀ×Á¤ |
1-1.5½Ã°£ |
6½Ã°£ |
|
¼¹æÁ¤ |
4-7½Ã°£ |
12½Ã°£ |
|
ÁÖ»çÁ¦ |
30ºÐÀÌÇÏ |
|
5.¼Ò½Ç : ¼Òº¯
6.¼ºÀÎÀº 10%°¡ ¹Ìº¯Èü·Î ¹è¼³µÇ°í ½Å»ý¾Æ´Â ´õ ¸¹Àº ¾ç(50%±îÁö)ÀÌ ¹Ìº¯Èü·Î ½Å¹è¼³µÈ´Ù.
|
| Biotransformation |
Aminophylline¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
| Toxicity |
Aminophylline¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Aminophylline¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aciclovir Acyclovir increases the effect and toxicity of theophyllineAdenosine This xanthine decreases the effect of adenosineButabarbital The barbiturate decreases the effect of theophyllineButalbital The barbiturate decreases the effect of theophyllineDihydroquinidine barbiturate The barbiturate decreases the effect of theophyllineAtracurium Theophylline decreases the effect of muscle relaxantCarbamazepine Carbamazepine increases or decreases the effect of theophyllineCarteolol Antagonism of action and increased effect of theophyllineCimetidine Cimetidine increases the effect of theophyllineCiprofloxacin The quinolone increases the effect of theophyllineClarithromycin Clarithromycin increases the effect amd toxicity of theophyllineDisulfiram Disulfiram increases the effect and toxicity of theophyllineDoxacurium Theophylline decreases the effect of muscle relaxantEnoxacin The quinolone increases the effect of theophyllineErythromycin The macrolide increases the effect and toxicity of theophyllineEthinyl Estradiol The contraceptive increases the effect and toxicity of theophyllineEthotoin Decreased effect of both productsFluvoxamine Fluvoxamine increases the effect and toxicity of theophyllineFosphenytoin Decreased effect of both productsGallamine Triethiodide Theophylline decreases the effect of muscle relaxantGrepafloxacin The quinolone increases the effect of theophyllineHalothane Increased risk of cardiac arrhythmiaInterferon Alfa-2a, Recombinant Interferon increases the effect and toxicity of theophyllineInterferon Alfa-2b, Recombinant Interferon increases the effect and toxicity of theophyllineInterferon alfa-n1 Interferon increases the effect and toxicity of theophyllineIsoniazid Isoniazid increases the effect and toxicity of theophhyllineJosamycin The macrolide increases the effect and toxicity of theophyllineMephenytoin Decreased effect of both productsMethohexital The barbiturate decreases the effect of theophyllineMetocurine Theophylline decreases the effect of muscle relaxantMexiletine Mexiletine increases the effect and toxicity of theophyllineMivacurium Theophylline decreases the effect of muscle relaxantNadolol Antagonism of action and increased effect of theophyllineNorfloxacin The quinolone increases the effect of theophyllinePancuronium Theophylline decreases the effect of muscle relaxantPefloxacin The quinolone increases the effect of theophyllinePeginterferon alfa-2a Interferon increases the effect and toxicity of theophyllinePeginterferon alfa-2b Interferon increases the effect and toxicity of theophyllinePentobarbital The barbiturate decreases the effect of theophyllinePentoxifylline Pentoxyfylline increases the effect and toxicity of theophyllinePhenytoin Decreased effect of both productsPindolol Antagonism of action and increased effect of theophyllinePrimidone The barbiturate decreases the effect of theophyllinePropafenone Propafenone increases the effect of theophyllinePropranolol Antagonism of action and increased effect of theophyllineQuinidine barbiturate The barbiturate decreases the effect of theophyllineRifampin Rifampin decreases the effect of theophyllineRitonavir Ritonavir decreases the effect of theophyllineRofecoxib Rofecoxib increases the effect and toxicity of theophyllineSecobarbital The barbiturate decreases the effect of theophyllineSotalol Antagonism of action and increased effect of theophyllineSt. John's Wort St. John's Wort decreases the effect of theophyllineTacrine Tacrine increases the effect and toxicity of theophyllineTalbutal The barbiturate decreases the effect of theophyllineTerbinafine Terbinafine increases the effect and toxicity of theophyllineThiabendazole Thiabendazole increases the effect and toxicity of theophyllineTiclopidine Ticlopidine increases the effect and toxicity of theophyllineTimolol Antagonism of action and increased effect of theophyllineTubocurarine Theophylline decreases the effect of muscle relaxantVecuronium Theophylline decreases the effect of muscle relaxantZileuton Zileuton increases the effect and toxicity of theophyllineVerapamil Verapamil increases the effect of theophyllineAmobarbital The barbiturate decreases the effect of theophyllineAprobarbital The barbiturate decreases the effect of theophyllineButethal The barbiturate decreases the effect of theophyllineHeptabarbital The barbiturate decreases the effect of theophyllineHexobarbital The barbiturate decreases the effect of theophyllineLithium Theophylline decreases serum levels of lithiumMestranol The contraceptive increases the effect and toxicity of theophyllineMethylphenobarbital The barbiturate decreases the effect of theophyllinePenbutolol Antagonism of action and increased effect of theophyllinePhenobarbital The barbiturate decreases the effect of theophyllineTroleandomycin The macrolide increases the effect and toxicity of theophylline
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Aminophylline¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food.Limit caffeine intake.Vitamin B6 needs increased, supplement recommended.
|
| Drug Target |
[Drug Target]
|
| Description |
Aminophylline¿¡ ´ëÇÑ Description Á¤º¸ Aminophylline is a drug combination that contains theophylline and ethylenediamine in 2:1 ratio. [Wikipedia]
|
| Drug Category |
Aminophylline¿¡ ´ëÇÑ Drug_Category Á¤º¸ Bronchodilator AgentsCardiotonic AgentsPhosphodiesterase InhibitorsRespiratory Smooth Muscle Relaxants
|
| Smiles String Canonical |
Aminophylline¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ NCCN.CN1C(=O)N(C)C2=C(NC=N2)C1=O.CN1C(=O)N(C)C2=C(NC=N2)C1=O
|
| Smiles String Isomeric |
Aminophylline¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ NCCN.CN1C(=O)N(C)C2=C(NC=N2)C1=O.CN1C(=O)N(C)C2=C(NC=N2)C1=O
|
| InChI Identifier |
Aminophylline¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/2C7H8N4O2.C2H8N2/c2*1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h2*3H,1-2H3,(H,8,9);1-4H2/f/h2*8H;
|
| Chemical IUPAC Name |
Aminophylline¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1,3-dimethyl-7H-purine-2,6-dione; 1,3-dimethyl-7H-purine-2,6-dione; ethane-1,2-diamine
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-12-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|