| |
|
|
|
|
|
 |
| |
|
액티피드정 Actifed Tab.
|
|
일반의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
 |
제품별 임부금기 고시 |
|
|
|
1등급: 원칙적 사용금기 / 2등급: 명확한 임상적 근거 또는 사유가 있는 경우 부득이하게 사용 / M등급: 임상적상황에 따라 1등급 또는 2등급으로 분류되는 성분
| 성분명 |
성분코드 |
금기등급 |
고시번호 |
고시일자 |
비고 |
| Pseudoephedrine |
260300ATB |
2 |
20200061 |
20200710 |
임부에 대한 안전성 미확립. |
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
| 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
643900900[A05000681]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1정(2006.11.01)(현재약가)
\30 원/1정(2003.10.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
흰색의 원형 정제 [제형정보 확인] |
| 포장·유통단위 |
10정, 100정, 500정 |
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 60밀리그램 |
60 정 |
병 |
8806439009001 |
8806439009056 |
|
| 60밀리그램 |
20 정 |
PTP |
8806439009001 |
8806439009049 |
|
| 60밀리그램 |
500 정 |
병 |
8806439009001 |
8806439009032 |
|
| 60밀리그램 |
100 정 |
PTP |
8806439009001 |
8806439009025 |
|
| 60밀리그램 |
10 정 |
PTP |
8806439009001 |
8806439009018 |
|
|
| 주성분코드 |
260300ATB
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
코감기, 알레르기 및 혈관운동성 코염에 의한 다음 증상의 완화 : 재채기, 콧물, 코막힘, 눈물
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
성인 : 1회 1정
소아(12 〜 14세) : 1회 1/2정
1일 3회 식후에 복용한다.
|
| 금기 |
1) 이 약에 과민반응 병력이 있는 환자
2) 중증(심한 증상)의 간 및 신기능 장애 환자
3) 중증(심한 증상)의 관상 심장 질환 환자
4) 잔뇨 형성을 수반하는 배뇨(소변을 눔)장애 환자
5) 고혈압 및 관상동맥(심장동맥)질환 환자
6) 임부 또는 임신하고 있을 가능성이 있는 여성, 수유부
7) 2세 이하의 영아(갓난아기)
8) MAO 억제제를 투여중인 환자
9) 파라옥시안식향산메칠에 과민반응 환자(파라옥시안식향산메칠 함유제제에 한함)
10) 이 약은 유당을 함유하고 있으므로, 갈락토오스 불내성(galactose intolerance), Lapp 유당분해효소 결핍증(Lapp lactase deficiency) 또는 포도당-갈락토오스 흡수장애(glucose-galactose malabsorption)등의 유전적인 문제가 있는 환자에게는 투여하면 안 된다.(함유제품에 한함)
|
| 신중투여 |
1) 천식 환자
2) 녹내장 환자
3) 심질환 및 부정맥 환자
4) 당뇨병, 갑상샘기능항진증 환자
5) 전립샘비대로 인한 배뇨(소변을 눔)곤란 환자
6) 12세 미만의 소아 |
| 이상반응 |
다음과 같은 경우 이 약의 복용을 즉각 중지하고 의사, 치과의사, 약사와 상의할 것. 상담 시 가능한 한 이 첨부문서를 소지할 것.
1) 7일 이내에 증상의 개선이 나타나지 않거나 고열을 동반할 경우
2) 진정, 졸음, 중추 신경 쇠약, 중추 흥분, 불안, 발한(땀이 남), 경미한(가벼운) 혈압강하, 시력장애, 산동(동공확대), 헛소리, 환각, 흥분, 근육경련, 경직(굳음), 아테토시스, 간대상 및 강직성 경련, 고열, 호흡마비, 혼수, 순환기 마비 등의 중추신경계 이상이 나타날 경우
3) 피부반응, 일시적인 자극통, 작열감(화끈감) 등의 과민반응이 나타날 경우
4) 구갈, 구역, 구토 등의 소화기계 이상이 나타날 경우
5) 배뇨(소변을 눔)곤란 등의 이상이 나타날 경우
6) 소아에서 특히 흥분이 나타날 수 있다.
7) 급성 전신성 발진성 농포증(AGEP), 발열, 홍반, 다수의 작은 농포와 같은 중증 피부 이상반응이 나타날 경우
8) 슈도에페드린 성분과 관련하여 허혈성 대장염의 증상(급격한 복통, 직장 출혈 등)이 발현될 경우
9) 슈도에페드린 성분과 관련하여 가역적 후뇌 병증 증후군 및 가역적 뇌혈관 수축 증후군 증상(갑작스러운 심한 두통, 번개 두통, 구역, 구토, 혼돈, 발작, 시각 장애 등)이 발현되는 경우
|
| 상호작용 |
이 약을 복용하는 동안 다음의 약을 복용하지 말 것.
1) 혈압강하제, 알코올, 중추신경억제제(수면제, 진정제, 안정제), MAO 억제제, 교감신경흥분제, 삼환계 항우울약, 구아네티딘, 브레틸리움, 베타나이드, 데브리소퀸, 메칠도파, 교감신경성약(충혈제거제, 식욕억제제, 암페타민류의 신경자극제), α 및 β 아드레날린 저해제(억제제)와 병용(함께 복용)투여하지 않는다.
2) MAO억제제의 긴 작용시간 때문에 MAO억제제 투여 최소 15일 후 이 약을 투여한다. |
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| 항목 |
내용 |
| 성분코드 |
M050833/염산슈도에페드린 60밀리그램 /
M051642/염산트리프롤리딘 2.5밀리그램 /
|
| 주성분코드 |
260300ATB
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 대표코드 |
8806439009001 |
| BIT 약효분류 |
비염 & 콧물약 (Decongestants & Nasal Prep.)
|
| ATC 코드 |
Pseudoephedrine, combinations / R01BA52
[코드분류상세설명]
[ATC코드예측]
|
| 복지부분류코드 |
141 (항히스타민제 )
|
| 의약품 바코드정보 |
내용보기
8806038100697//PTP//1 단위/수량: 100
8806038100703//병//1 단위/수량: 500
8806038100710//병//1 단위/수량: 1000
8806038101380//PTP//1 단위/수량: 20
|
| Drugs By Indication |
[전체보기]
|
| Drugs By Classification |
[전체보기]
|
|
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
(pseudoephedrine, triprolidine )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Pseudoephedrine에 대한 Mechanism_Of_Action 정보
Pseudoephedrine acts directly on both alpha- and, to a lesser degree, beta-adrenergic receptors. Through direct action on alpha-adrenergic receptors in the mucosa of the respiratory tract, pseudoephedrine produces vasoconstriction. Pseudoephedrine relaxes bronchial smooth muscle by stimulating beta2-adrenergic receptors. Like ephedrine, pseudoephedrine releasing norepinephrine from its storage sites, an indirect effect.
Triprolidine에 대한 Mechanism_Of_Action 정보
Triprolidine binds to the histamine H1 receptor. This blocks the action of endogenous histamine, which subsequently leads to temporary relief of the negative symptoms brought on by histamine.
|
| Pharmacology |
Pseudoephedrine에 대한 Pharmacology 정보
Pseudoephedrine is a sympathomimetic agent, structurally similar to ephedrine, used to relieve nasal and sinus congestion and reduce air-travel-related otalgia in adults. The salts pseudoephedrine hydrochloride and pseudoephedrine sulfate are found in many over-the-counter preparations either as single-ingredient preparations, or more commonly in combination with antihistamines and/or paracetamol/ibuprofen. Unlike antihistamines, which modify the systemic histamine-mediated allergic response, pseudoephedrine only serves to relieve nasal congestion commonly associated with colds or allergies. The advantage of oral pseudoephedrine over topical nasal preparations, such as oxymetazoline, is that it does not cause rebound congestion (rhinitis medicamentosa).
Triprolidine에 대한 Pharmacology 정보
In allergic reactions an allergen interacts with and cross-links surface IgE antibodies on mast cells and basophils. Once the mast cell-antibody-antigen complex is formed, a complex series of events occurs that eventually leads to cell-degranulation and the release of histamine (and other chemical mediators) from the mast cell or basophil. Once released, histamine can react with local or widespread tissues through histamine receptors. Histamine, acting on H1-receptors, produces pruritis, vasodilatation, hypotension, flushing, headache, tachycardia, and bronchoconstriction. Histamine also increases vascular permeability and potentiates pain. Triprolidine, is a histamine H1 antagonist that competes with histamine for the normal H1-receptor sites on effector cells of the gastrointestinal tract, blood vessels and respiratory tract. It provides effective, temporary relief of sneezing, watery and itchy eyes, and runny nose due to hay fever and other upper respiratory allergies.
|
| Metabolism |
Pseudoephedrine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Monoamine oxidase type A (MAO-A)
Triprolidine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Pseudoephedrine에 대한 단백결합 정보
Pseudoephedrine does not bind to human plasma proteins over the concentration range of 50 to 2000 ng/mL
Triprolidine에 대한 단백결합 정보
Not Available
|
| Half-life |
Pseudoephedrine에 대한 반감기 정보
9-16 hours
Triprolidine에 대한 반감기 정보
4 to 6 hours.
|
| Absorption |
Pseudoephedrine에 대한 Absorption 정보
Pseudoephedrine is readily and almost completely absorbed from the GI tract and there is no evidence of first-pass metabolism.
Triprolidine에 대한 Absorption 정보
Rapidly absorbed in the intestinal tract.
|
| Pharmacokinetics |
Pseudoephedrine HCl의 약물동력학자료
- 비충혈제거 효과의 발현시간 (경구투여시) : 15-30분
- 작용지속시간 : 4-6 시간 (서방형 제제는 12시간 지속)
- 대사 : 간에서 일부 대사
- 반감기 : 9-16 시간
- 소실 : 투여량의 70-90%가 미변화체로, 1-6%가 norpseudoephedrine으로 소변으로 배설됨. 신배설은 뇨 pH와 뇨량에 의해 변화되며 알칼리뇨는 pseudoephedrine의 신배설을 감소시킴.
|
| Biotransformation |
Pseudoephedrine에 대한 Biotransformation 정보
Hepatic.
Triprolidine에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
Pseudoephedrine에 대한 Toxicity 정보
Common adverse reactions include nervousness, restlessness, and insomnia. Rare adverse reactions include difficult/painful urination, dizziness/lightheadedness, heart palpitations, headache, increased sweating, nausea/vomiting, trembling, troubled breathing, unusual paleness, and weakness.
Triprolidine에 대한 Toxicity 정보
Symptoms of overdose include drowsiness, weakness, inco-ordination, difficulty with micturition, respiratory depression, hypotension, agitation, irritability, convulsions, hypertension, palpitation and tachycardia.
|
| Drug Interactions |
Pseudoephedrine에 대한 Drug_Interactions 정보
Alseroxylon Increased arterial pressureIsocarboxazid Increased arterial pressureLinezolid Possible increase of arterial pressureMethyldopa Increased arterial pressureBromocriptine The sympathomimetic increases the toxicity of bromocriptineTranylcypromine Increased arterial pressureMidodrine Increased arterial pressureMoclobemide Moclobemide increases the sympathomimetic effectPargyline Increased arterial pressurePhenelzine Increased arterial pressureRasagiline Increased arterial pressureReserpine Increased arterial pressureTrimipramine The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectNortriptyline The tricyclic increases the sympathomimetic effectAmitriptyline The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectClomipramine The tricyclic increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectDoxepin The tricyclic increases the sympathomimetic effectDeserpidine Increased arterial pressureGuanethidine The agent decreases the effect of guanethidine
Triprolidine에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Pseudoephedrine에 대한 Food Interaction 정보
Take without regard to meals.
Triprolidine에 대한 Food Interaction 정보
Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Pseudoephedrine에 대한 Description 정보
An alpha- and beta-adrenergic agonist that may also enhance release of norepinephrine. It has been used in the treatment of several disorders including asthma, heart failure, rhinitis, and urinary incontinence, and for its central nervous system stimulatory effects in the treatment of narcolepsy and depression. It has become less extensively used with the advent of more selective agonists. [PubChem]
Triprolidine에 대한 Description 정보
Histamine H1 antagonist used in allergic rhinitis; asthma; and urticaria. It is a component of cough and COLD medicines. It may cause drowsiness. [PubChem]
|
| Drug Category |
Pseudoephedrine에 대한 Drug_Category 정보
Adrenergic AgentsBronchodilator AgentsCentral Nervous System AgentsNasal DecongestantsSympathomimeticsVasoconstrictor Agents
Triprolidine에 대한 Drug_Category 정보
Anti-Allergic AgentsHistamine H1 Antagonists
|
| Smiles String Canonical |
Pseudoephedrine에 대한 Smiles_String_canonical 정보
CNC(C)C(O)C1=CC=CC=C1
Triprolidine에 대한 Smiles_String_canonical 정보
CC1=CC=C(C=C1)C(=CCN1CCCC1)C1=CC=CC=N1
|
| Smiles String Isomeric |
Pseudoephedrine에 대한 Smiles_String_isomeric 정보
CN[C@@H](C)[C@@H](O)C1=CC=CC=C1
Triprolidine에 대한 Smiles_String_isomeric 정보
CC1=CC=C(C=C1)C(=C/CN1CCCC1)\C1=CC=CC=N1
|
| InChI Identifier |
Pseudoephedrine에 대한 InChI_Identifier 정보
InChI=1/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1
Triprolidine에 대한 InChI_Identifier 정보
InChI=1/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/b18-11+
|
| Chemical IUPAC Name |
Pseudoephedrine에 대한 Chemical_IUPAC_Name 정보
(1S,2S)-2-methylamino-1-phenylpropan-1-ol
Triprolidine에 대한 Chemical_IUPAC_Name 정보
2-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]pyridine
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-01-03
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
