| |
|
|
|
|
|
 |
| |
|
옵타란점안액(초산프레드니솔론) OPTALAN EYE.[Prednisolone acetate]
|
|
전문의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
649501960[A50700031]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1ml(2016.10.01)(현재약가)
\28 원/1ml(2014.02.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
백색의 현탁액 [제형정보 확인] |
| 포장·유통단위 |
10ML
|
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 5밀리리터 |
1 점안액 |
병 |
8806495019600 |
8806495019631 |
|
| 10밀리리터 |
1 개 |
병 |
8806495019600 |
8806495019624 |
군납용 |
| 10밀리리터 |
1 개 |
병 |
8806495019600 |
8806495019617 |
|
|
| 주성분코드 |
217102COS
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
안검염, 결막염, 각막염, 공막염
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
사용 전 잘 흔들어 섞은 후 1회 1-2방울 1일 2-4회 점안한다.
처음 1-2일간은 필요시 매시간 사용할 수 있다.
증상에 따라 적절히 증감한다.
|
| 금기 |
1) 표재성 단순포진 각막염(수지상 각막염), 우두, 수두를 포함하는 바이러스성 각막․결막질환 환자
2) 진균성 안질환 환자
3) 결핵성 안질환 환자
4) 치료되지 않은 화농성 감염 환자
5) 이 약에 과민증의 병력이 있는 환자
6) 각막상피박리 및 궤양환자(각막 천공이 생길 수 있다.)
|
| 신중투여 |
1) 녹내장 환자
2) 2세 미만의 영아
|
| 이상반응 |
1) 눈
① 연용시 때때로 수주일 후에 안압 상승 또는 드물게 시신경 손상, 시력저하 및 시야결손을 동반한 녹내장이 나타날 수 있으므로 정기적으로 안압 검사를 한다.
② 각막포진, 각막진균증, 녹농균 감염증 등을 유발할 수 있다. 이러한 경우에는 적절한 처치를 한다.
③ 각막포진, 각막궤양 또는 외상등에 사용할 경우 천공을 일으킬 수 있다.
④ 장기간 사용으로 드물게 후낭하백내장, 각막연화가 나타날 수 있다.
⑤ 급성 전방 포도막염, 각막염, 결막염, 각막궤양, 산동, 결막충혈, 안검하수 및 조절마비가 나타날 수 있다.
⑥ 첨가제 : 이 약은 인산염을 포함하고 있다.
상당한 각막 손상이 있는 일부 환자에서 인산염 함유 점안액의 사용과 연관되어 각막 석회화의 사례가 매우 드물게(0.01% 미만) 보고된 바 있다.
⑦빈도불명의 시야흐림이 나타날 수 있다.
2) 피부 : 장기사용에 의해 창상치유가 지연될 수 있다.
3) 내분비계 : 장기간 사용으로 하수체․부신피질계 기능의 억제가 나타날 수 있다.
4) 과민증 : 드물게 자극감 등이 나타나는 경우에는 투여를 중지한다.
5) 드물게 전신 사용시와 같은 증상이 나타날 수 있으므로 장기간 연용을 피한다.
6) 장기연용시 면역 억제로 인한 2차 안감염의 위험이 증가한다.
|
| 상호작용 |
아트로핀과 같은 콜린 억제제와 병용시 안압 상승이 나타난다. |
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
(prednisolone; )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 제형별 복약지도 |
[점안액] |
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Prednisolone에 대한 Mechanism_Of_Action 정보
Glucocorticoids such as Prednisolone can inhibit leukocyte infiltration at the site of inflammation, interfere with mediators of inflammatory response, and suppress humoral immune responses. The antiinflammatory actions of glucocorticoids are thought to involve phospholipase A2 inhibitory proteins, lipocortins, which control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes. Prednisolone reduces inflammatory reaction by limiting the capillary dilatation and permeability of the vascular structures. These compounds restrict the accumulation of polymorphonuclear leukocytes and macrophages and reduce the release of vasoactive kinins. Recent research suggests that corticosteroids may inhibit the release of arachidonic acid from phospholipids, thereby reducing the formation of prostaglandins. Prednisolone is a glucocorticoid receptor agonist. On binding, the corticoreceptor-ligand complex translocates itself into the cell nucleus, where it binds to many glucocorticoid response elements (GRE) in the promoter region of the target genes. The DNA bound receptor then interacts with basic transcription factors, causing an increase or decrease in expression of specific target genes, including suppression of IL2 (interleukin 2) expression.
|
| Pharmacology |
Prednisolone에 대한 Pharmacology 정보
Prednisolone is a synthetic glucocorticoid used as antiinflammatory or immunosuppressive agent. Prednisolone is indicated in the treatment of various conditions, including congenital adrenal hyperplasia, psoriatic arthritis, systemic lupus erythematosus, bullous dermatitis herpetiformis, seasonal or perennial allergic rhinitis, allergic corneal marginal ulcers, symptomatic sarcoidosis, idiopathic thrombocytopenic purpura in adults, leukemias and lymphomas in adults, and ulcerative colitis. Glucocorticoids are adrenocortical steroids and cause profound and varied metabolic effects. In addition, they modify the body's immune responses to diverse stimuli.
|
| Metabolism |
Prednisolone에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Prednisolone에 대한 단백결합 정보
Very high (>90%)
|
| Half-life |
Prednisolone에 대한 반감기 정보
2-3 hours
|
| Absorption |
Prednisolone에 대한 Absorption 정보
Readily absorbed by gastrointestinal tract, peak plasma concentration is reached 1-2 hours after administration.
|
| Pharmacokinetics |
Prednisolone acetate의 약물동력학자료
- 단백결합 : 65∼91% (용량 의존적)
- 대사 : 일차적으로 간에서 대사되나 대부분의 조직에서도 대사가 일어나며 비활성형 대사체가 생성된다.
- 반감기 : 3.6시간
- 생리적 반감기 : 18-36시간
- 말기 신질환 환자에서의 반감기 : 3∼5시간
- 소실 : 대부분 glucuronides, sulfates 포합체나 비포합 대사체로 신배설 된다.
|
| Biotransformation |
Prednisolone에 대한 Biotransformation 정보
Excreted in the urine as either free or glucoconjugate.
|
| Toxicity |
Prednisolone에 대한 Toxicity 정보
LD50=500 mg/kg (oral, rat), short-term side effects include high blood glucose levels and fluid retention. Long term side effects include Cushing's syndrome, weight gain, osteoporosis, glaucoma, type II diabetes and adrenal suppression.
|
| Drug Interactions |
Prednisolone에 대한 Drug_Interactions 정보
Ambenonium The corticosteroid decreases the effect of anticholinesterasesEdrophonium The corticosteroid decreases the effect of anticholinesterasesNeostigmine The corticosteroid decreases the effect of anticholinesterasesPyridostigmine The corticosteroid decreases the effect of anticholinesterasesWarfarin The corticosteroid alters the anticoagulant effectAcenocoumarol The corticosteroid alters the anticoagulant effectDicumarol The corticosteroid alters the anticoagulant effectAnisindione The corticosteroid alters the anticoagulant effectMidodrine Increased arterial pressureAspirin The corticosteroid decreases the effect of salicylatesBismuth Subsalicylate The corticosteroid decreases the effect of salicylatesSalicylate-magnesium The corticosteroid decreases the effect of salicylatesSalicylate-sodium The corticosteroid decreases the effect of salicylatesSalsalate The corticosteroid decreases the effect of salicylatesTrisalicylate-choline The corticosteroid decreases the effect of salicylatesTalbutal The barbiturate decreases the effect of the corticosteroidSecobarbital The barbiturate decreases the effect of the corticosteroidQuinidine barbiturate The barbiturate decreases the effect of the corticosteroidPrimidone The barbiturate decreases the effect of the corticosteroidPhenobarbital The barbiturate decreases the effect of the corticosteroidPentobarbital The barbiturate decreases the effect of the corticosteroidMethylphenobarbital The barbiturate decreases the effect of the corticosteroidMethohexital The barbiturate decreases the effect of the corticosteroidHexobarbital The barbiturate decreases the effect of the corticosteroidHeptabarbital The barbiturate decreases the effect of the corticosteroidDihydroquinidine barbiturate The barbiturate decreases the effect of the corticosteroidButethal The barbiturate decreases the effect of the corticosteroidButalbital The barbiturate decreases the effect of the corticosteroidButabarbital The barbiturate decreases the effect of the corticosteroidAprobarbital The barbiturate decreases the effect of the corticosteroidAmobarbital The barbiturate decreases the effect of the corticosteroidChlorotrianisene The estrogenic agent increases the effect of the corticosteroidClomifene The estrogenic agent increases the effect of the corticosteroidDiethylstilbestrol The estrogenic agent increases the effect of the corticosteroidEstradiol The estrogenic agent increases the effect of the corticosteroidEstriol The estrogenic agent increases the effect of the corticosteroidConjugated Estrogens The estrogenic agent increases the effect of the corticosteroidEstrone The estrogenic agent increases the effect of the corticosteroidEstropipate The estrogenic agent increases the effect of the corticosteroidEthinyl Estradiol The estrogenic agent increases the effect of the corticosteroidMestranol The estrogenic agent increases the effect of the corticosteroidQuinestrol The estrogenic agent increases the effect of the corticosteroidEthotoin The enzyme inducer decreases the effect of the corticosteroidFosphenytoin The enzyme inducer decreases the effect of the corticosteroidMephenytoin The enzyme inducer decreases the effect of the corticosteroidPhenytoin The enzyme inducer decreases the effect of the corticosteroidRifampin The enzyme inducer decreases the effect of the corticosteroidItraconazole The imidazole increases the effect and toxicity of the corticosteroidKetoconazole The imidazole increases the effect and toxicity of the corticosteroid
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Prednisolone에 대한 Food Interaction 정보
Take with food to reduce gastric irritation.Avoid alcohol. Avoid caffeine.
|
| Drug Target |
[Drug Target]
|
| Description |
Prednisolone에 대한 Description 정보
A glucocorticoid with the general properties of the corticosteroids. It is the drug of choice for all conditions in which routine systemic corticosteroid therapy is indicated, except adrenal deficiency states. [PubChem]
|
| Dosage Form |
Prednisolone에 대한 Dosage_Form 정보
Liquid OralSolution OralSolution / drops OphthalmicSuspension OphthalmicTablet Oral
|
| Drug Category |
Prednisolone에 대한 Drug_Category 정보
Adrenergic AgentsAnti-inflammatory AgentsAntineoplastic AgentsAntineoplastic Agents, HormonalGlucocorticoids
|
| Smiles String Canonical |
Prednisolone에 대한 Smiles_String_canonical 정보
CC12CC(O)C3C(CCC4=CC(=O)C=CC34C)C1CCC2(O)C(=O)CO
|
| Smiles String Isomeric |
Prednisolone에 대한 Smiles_String_isomeric 정보
C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)C=C[C@]34C)[C@@H]1CC[C@]2(O)C(=O)CO
|
| InChI Identifier |
Prednisolone에 대한 InChI_Identifier 정보
InChI=1/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-16,18,22,24,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1
|
| Chemical IUPAC Name |
Prednisolone에 대한 Chemical_IUPAC_Name 정보
(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one
|
| Drug-Induced Toxicity Related Proteins |
PREDNISOLONE 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:DNA topoisomerase 1
Drug:prednisolone
Toxicity:appearance of apoptotic cells.
[바로가기]
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2023-02-15
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
내용보기
