|   | 
                  
                       | 
                      | 
                    
                        
                            
                                | 
                                  
                                 | 
                             
                             |  
                            
                                
                                    
                                        
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    ¼¼ÆÄµµÇÁÁÖ»ç1g(¼¼ÆÄÇǸ°³ªÆ®·ý)  [Cephapirin Sodium]  
                    
                 | 
               
              
                | 
                     Àü¹®ÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |                   
                                        | 
                                             | 
                                         
                            
                                
                            
                            
                              
                                                        
                              
                                                
                            
 |   
    | 
      
     | 
 
 |  
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
  
  
    
      
  
    
       |  
      
        
          
            
                | Çã°¡Á¤º¸ | 
             
           
         | 
       
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | Á¤º¸¿ä¾à |         
             
           
         | 
             	    
       |  
      | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
     
   
  
    
       |  
      
        
          
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |         
             
           
         | 
             	    
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
  
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806478030301 | 
   
  
  
  
  
   
    | BIT ¾àÈ¿ºÐ·ù | 
    
      1¼¼´ë ¼¼ÆÈ·Î½ºÆ÷¸°°è (Cephalosporins; First Generation)
     | 
   
  
  
  
  
  
  
  
  
  
 
  
  
   
    | º¹ÁöºÎºÐ·ùÄÚµå | 
    
    618  (ÁÖ·Î ±×¶÷¾ç¼º, À½¼º±Õ¿¡ ÀÛ¿ëÇÏ´Â °Í                             )
      
     | 
   
  
  
  
  
  
  
  
   
    ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä | 
    
      
	[ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä]
     | 
   
   
  
     
  
  
  
  
   
    | Drugs By Indication | 
    
      [Àüüº¸±â]
     | 
   
  
   
    | Drugs By Classification | 
    
      [Àüüº¸±â]
     | 
     
 	 |  
     
   
  
    
       |  
      
        
          
            
                | Á¦Ç°Á¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | º¹¾àÁ¤º¸ |            
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Bµî±Þ 
				        	
					  
					
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
     
   
  
    
       |  
      
        
          
            
                | ½É»çÁ¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
     
  
    
       |  
      
        
          
            
                | ÇмúÁ¤º¸ |          
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Cephapirin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The bactericidal activity of cephapirin results from the inhibition of cell wall synthesis via affinity for penicillin-binding proteins (PBPs). 
     | 
   
  
   
    | Pharmacology | 
     
       Cephapirin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Cephapirin is a first-generation cephalosporin that has a wide spectrum of activity against gram-positive and gram-negative organisms. Cephapirin is more resistant to beta-lactamases than are the penicillins and so is effective against staphylococci, with the exception of methicillin-resistant staphylococci. 
     | 
   
  
   
    | Protein Binding | 
    
       Cephapirin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available 
     | 
   
  
   
    | Half-life | 
    
       Cephapirin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available 
     | 
   
  
   
    | Pharmacokinetics | 
    
       Cephapirin SodiumÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
- ºÐÆ÷ : 
	
	- ´ã³¶, °£, ½ÅÀå, »À, Ÿ¾×, ´ãÁó, ´Á¸·¾×, Ȱ¾×À» Æ÷ÇÔÇÑ ´ëºÎºÐÀÇ Ã¼³» Á¶Á÷°ú ü¾×¿¡ ³Î¸® ºÐÆ÷ÇÑ´Ù.
	
 - ³úô¼ö¾×À¸·ÎÀÇ ºÐÆ÷´Â ¹Ì¹ÌÇÏ´Ù.
	
 - ŹÝÀ» Åë°úÇϸç, À¯ÁóÀ¸·Î ¼Ò·® ºÐºñµÈ´Ù.
	
  
 - ´Ü¹é°áÇÕ : 22-25%
 - ´ë»ç : °£, ½ÅÀå, Ç÷Àå¿¡¼ ´ë»çü (50% Á¤µµÀÇ È°¼ºÀ» Áö´Ô)·Î ÀϺΠ´ë»çµÈ´Ù.
 - ¹Ý°¨±â : 30-60ºÐ
 - Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 
	
	- ±ÙÀ°ÁÖ»ç : 30ºÐ À̳»
	
 - Á¤¸ÆÁÖ»ç : 5ºÐ À̳»
	
  
 - ¼Ò½Ç : 60-85%°¡ ¹Ìº¯Èü·Î ½Å¹è¼³µÈ´Ù.
  
     | 
   
  
   
    | Biotransformation | 
    
       Cephapirin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Major metabolite detected is desacetylcephapirin. 
     | 
   
  
   
    | Toxicity | 
    
       Cephapirin¿¡ ´ëÇÑ Toxicity Á¤º¸ Rats exposed via the oral route to cephapirin displayed low acute toxicity (LD50 = 14000 mg/kg). The most common adverse reactions are hypersensitivity reactions and alterations to liver function. Evidence of white blood cell disorders and anaemia were noted in some subjects. 
     | 
   
  
   
    | Drug Interactions | 
    
       Cephapirin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Cephapirin¿¡ ´ëÇÑ Description Á¤º¸ Cephalosporin antibiotic, partly plasma-bound, that is effective against gram-negative and gram-positive organisms. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Cephapirin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Not Available 
     | 
   
  
   
    | Drug Category | 
    
       Cephapirin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial Agents 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Cephapirin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(=O)OCC1=C(N2C(SC1)C(NC(=O)CSC1=CC=NC=C1)C2=O)C(O)=O 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Cephapirin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(=O)OCC1=C(N2[C@H](SC1)[C@H](NC(=O)CSC1=CC=NC=C1)C2=O)C(O)=O 
     | 
   
  
   
    | InChI Identifier | 
    
       Cephapirin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/t13-,16-/m1/s1/f/h19,24H 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Cephapirin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (6R,7R)-3-(acetyloxymethyl)-8-oxo-7-[(2-pyridin-4-ylsulfanylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid 
     | 
   
    
  |  
     
     
  
    
       |  
      
        
          
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ |           
             
           
         | 
             	  
       |  
       |  
     
         
 
     | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                 º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
  
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |  
                           
                         | 
                       
                      | 
                   |