| |
|
|
|
|
|
 |
| |
|
ÇÁ·ÎÇí½ÅÁ¤ [Bromhexine HCl , Orciprenaline sulfate]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
665504960[A12251841]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2007.03.01)(ÇöÀç¾à°¡)
\44 ¿ø/1Á¤(2005.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| ÁÖ¼ººÐÄÚµå |
265000ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
±âħ, °¡·¡, õ½Ä
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:265000ATB ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
¼ºÀÎ 1ȸ 1Á¤, 1ÀÏ 3-4ȸ ½ÄÈÄ ¹× Ãëħ½Ã¿¡ º¹¿ëÇÑ´Ù.
|
| ±Ý±â |
- °©»ó¼±±â´ÉÇ×ÁøÁõ ȯÀÚ
- ºó¸Æ¼º ºÎÁ¤¸Æ ȯÀÚ
- ºñÈļº ½É±Ùº´Áõ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
- °íÇ÷¾Ð ȯÀÚ
- ½ÉºÎÀüÁõ,ºÎÁ¤¸Æ µî ½ÉÁúȯ ȯÀÚ
- ´ç´¢º´ ȯÀÚ
- µð±âÅ»¸®½ºÁßµ¶ ȯÀÚ
- °üµ¿¸ÆÁúȯ ȯÀÚ
- ÁßÁõ½ÅÀå¾Ö ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
- Á¤½Å½Å°æ°è:
µÎÅë, ÁøÀü, ¾îÁö·¯¿ò, ºÒ¸é, ¹ßÇÑ, ½Å°æ°ú¹Î µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
¼øÈ¯±â°è: ½É°èÇ×Áø, ºó¸Æ, Ç÷¾Ðº¯µ¿, °íÇ÷¾Ð, ¾È¸éÈ«Á¶, â¹é µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
°ú¹ÎÁõ: ¹ßÁø, °¡·Á¿ò, Ç÷°üºÎÁ¾, µÎµå·¯±â, ±â°üÁö°æ·Ã, ÀúÇ÷¾Ð, ÇãÅ» µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
¼Òȱâ°è: ±¸¿ª, ±¸Åä µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
- ÀÌ ¾àÀ» ¿¡Çdz×ÇÁ¸°, À̼ÒÇÁ·ÎÅ×·¹³î µîÀÇ Ä«Å×Äݾƹηù¿Í º´¿ëÇÏ¸é ºÎÁ¤¸Æ ¶Ç´Â ½ÉÁ¤Áö¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
- MAOÀúÇØÁ¦³ª »ïȯ°è Ç׿ì¿ïÁ¦·Î Ä¡·áÁßÀΠȯÀÚ¿¡°Ô ÀÌ ¾àÀ» Åõ¿©Çϸé ÀÌ ¾àÀÇ Ç÷°ü°è¿¡ ´ëÇÑ ÀÛ¿ëÀÌ Áõ°µÉ ¼ö ÀÖÀ¸¹Ç·Î ƯÈ÷ ÁÖÀÇÇÑ´Ù.
- ÀÌ ¾àÀ» ÇÁ·ÎÇÁ¶ó³î·ÑµîÀÇ ºñ¼±ÅÃÀû º£Å¸ Â÷´ÜÁ¦¿Í º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
- ´Ù·®ÀÇ ´Ù¸¥ ±³°¨½Å°æÈïºÐÁ¦¸¦ Åõ¿©¹Þ°í Àִ ȯÀÚ¿¡°Ô ÀÌ ¾àÀ» Åõ¿©½Ã¿¡´Â ÁÖÀÇÇÑ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Orciprenaline¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Orciprenaline is a moderately selective beta(2)-adrenergic agonist that stimulates receptors of the smooth muscle in the lungs, uterus, and vasculature supplying skeletal muscle, with minimal or no effect on alpha-adrenergic receptors. Intracellularly, the actions of orciprenaline are mediated by cAMP, the production of which is augmented by beta stimulation. The drug is believed to work by activating adenylate cyclase, the enzyme responsible for producing the cellular mediator cAMP.
|
| Pharmacology |
Orciprenaline¿¡ ´ëÇÑ Pharmacology Á¤º¸ Orciprenaline (also known as metaproterenol), a synthetic amine, is structurally and pharmacologically similar to isoproterenol. Orciprenaline is used exclusively as a bronchodilator. The pharmacologic effects of beta adrenergic agonist drugs, such as orciprenaline, are at least in part attributable to stimulation through beta adrenergic receptors of intracellular adenyl cyclase, the enzyme which catalyzes the conversion of adenosine triphosphate (ATP) to cyclic- 3',5'- adenosine monophosphate (c-AMP). Increased c-AMP levels are associated with relaxation of bronchial smooth muscle and inhibition of release of mediators of immediate hypersensitivity from cells, especially from mast cells.
|
| Half-life |
Orciprenaline¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 6 hours
|
| Absorption |
Orciprenaline¿¡ ´ëÇÑ Absorption Á¤º¸ 3% (oral bioavailability of 40%)
|
| Pharmacokinetics |
Bromhexine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À§Àå°üÀ¸·ÎºÎÅÍ Àß Èí¼öµÊ.
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : ¾à 1½Ã°£
- ´ë»ç : °£´ë»ç. Àû¾îµµ 10°³ÀÇ ´ë»çü°¡ Á¸ÀçÇϸç ambroxolÀº Ȱ¼ºÇü ´ë»çüÀÌ´Ù.
- °¨±â : ¾à 6.5 ½Ã°£
- ¼Ò½Ç : ´ëºÎºÐÀÌ ´ë»çü·Î¼ ÁÖ·Î ´¢¸¦ ÅëÇØ ¹è¼³µÊ.
Orciprenaline sulfateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- °æ±¸ Åõ¿©
- ±â°üÁö È®Àå È¿°ú ¹ßÇö½Ã°£ : 30ºÐ À̳»
- ÃÖ°íÈ¿°ú ¹ßÇö½Ã°£ : 2-4½Ã°£
- ÀÛ¿ëÁö¼Ó½Ã°£ : ¾à 4½Ã°£
- Èí¼ö : Æò±Õ 40%
- ¼Ò½Ç : Èí¼öµÈ ¿ë·®ÀÇ ´ëºÎºÐÀº ÁÖ·Î ´ë»çü·Î ½Å¹è¼³
- ÈíÀÔ
- ÀÛ¿ëÁö¼Ó½Ã°£ : 1-5 ½Ã°£ (Åõ¿©°æ·Î¿¡ »ó°ü¾øÀÌ À¯»çÇÔ)
|
| Biotransformation |
Orciprenaline¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic and gastric. The major metabolite, orciprenaline-3-0-sulfate, is produced in the gastrointestinal tract. Orciprenaline is not metabolized by catechol-0-methyltransferase nor have glucuronide conjugates been isolated to date.
|
| Toxicity |
Orciprenaline¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose include angina, hypertension or hypotension, arrhythmias, nervousness, headache, tremor, dry mouth, palpitation, nausea, dizziness, fatigue, malaise and insomnia. LD50=42 mg/kg (orally in rat).
|
| Drug Interactions |
Orciprenaline¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Acebutolol AntagonismAtenolol AntagonismBetaxolol AntagonismBevantolol AntagonismBisoprolol AntagonismCarteolol AntagonismCarvedilol AntagonismEsmolol AntagonismLabetalol AntagonismMetoprolol AntagonismNadolol AntagonismOxprenolol AntagonismPenbutolol AntagonismPindolol AntagonismPractolol AntagonismTimolol AntagonismSotalol AntagonismPropranolol AntagonismTrimipramine The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectAmitriptyline The tricyclic increases the sympathomimetic effectNortriptyline The tricyclic increases the sympathomimetic effectMoclobemide Moclobemide increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectDoxepin The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectClomipramine The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectAlseroxylon Increased arterial pressureDeserpidine Increased arterial pressureIsocarboxazid Increased arterial pressureLinezolid Possible increase of arterial pressureMethyldopa Increased arterial pressureMidodrine Increased arterial pressurePargyline Increased arterial pressurePhenelzine Increased arterial pressureRasagiline Increased arterial pressureReserpine Increased arterial pressureTranylcypromine Increased arterial pressure
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Orciprenaline¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals.Avoid high doses of caffeine.
|
| Drug Target |
[Drug Target]
|
| Description |
Orciprenaline¿¡ ´ëÇÑ Description Á¤º¸ A beta-adrenergic agonist used in the treatment of asthma and bronchospasms. [PubChem]
|
| Dosage Form |
Orciprenaline¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Syrup Oral
|
| Drug Category |
Orciprenaline¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic beta-AgonistsBronchodilator AgentsSympathomimeticsTocolytic Agents
|
| Smiles String Canonical |
Orciprenaline¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C)NCC(O)C1=CC(O)=CC(O)=C1
|
| Smiles String Isomeric |
Orciprenaline¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(C)NC[C@H](O)C1=CC(O)=CC(O)=C1
|
| InChI Identifier |
Orciprenaline¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C11H17NO3/c1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8/h3-5,7,11-15H,6H2,1-2H3
|
| Chemical IUPAC Name |
Orciprenaline¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,3-diol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|