| |
|
|
|
|
|
 |
| |
|
ÇÏÀÌ·ÎÆæÁ¤ [Flurbiprofen][Flurbiprofen][Flurbiprofen]
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[A10601111]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2002.05.11)(ÇöÀç¾à°¡)
\101 ¿ø/1Á¤(2001.08.31)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. ÁÖÈ¿´É È¿°ú : ·ù¸¶Æ¼¾ç °üÀý¿°, °ñ°üÀý¿°(ÅðÇ༺ °üÀýÁúȯ)
2. ´ÙÀ½ Áúȯ¿¡µµ »ç¿ëÇÒ ¼ö ÀÖ´Ù : ¹ßÄ¡ ¹× Ä¡°ú¿µ¿ª¿¡¼ÀÇ ¼Ò¼ö¼úÈÄ ¿°Áõ ¹× µ¿Åë
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : Ç÷縣ºñÇÁ·ÎÆæÀ¸·Î¼ 1ȸ 40-50mg 1ÀÏ 3ȸ °æ±¸Åõ¿©ÇÑ´Ù.
1ȸ¿ä¹ý(µ·º¹)À¸·Î´Â 1ȸ 40-100mgÀ» Åõ¿©ÇÑ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
1) ¼Òȼº±Ë¾ç ȯÀÚ
2) ½ÉÇÑ Ç÷¾×ÀÌ»ó ȯÀÚ
3) ½ÉÇÑ °£Àå¾Ö ȯÀÚ
4) ½ÉÇÑ ½ÅÀå¾Ö ȯÀÚ
5) ½ÉÇÑ ½É±â´ÉºÎÀü ȯÀÚ
6) ÀÌ ¾àÀÇ ¼ººÐ¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ
7) ¾Æ½ºÇǸ°À̳ª ´Ù¸¥ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦(COX-2 ÀúÇØÁ¦ Æ÷ÇÔ)¿¡ ÀÇÇÑ Ãµ½Ä(õ½Ä¹ßÀÛ Æ÷ÇÔ), µÎµå·¯±â, ¾Ë·¹¸£±â ¹ÝÀÀ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ(ÀÌ·¯ÇÑ È¯ÀÚ¿¡¼ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦ Åõ¿©ÈÄ Ä¡¸íÀûÀÎ ÁßÁõÀÇ ¾Æ³ªÇʶô½Ã¾ç ¹ÝÀÀÀÌ µå¹°°Ô º¸°íµÇ¾ú´Ù.)
8) °ü»óµ¿¸Æ ¿ìȸ·Î¼ú(CABG) ÀüÈÄ¿¡ ¹ß»ýÇÏ´Â ÅëÁõÀÇ Ä¡·á
|
| ½ÅÁßÅõ¿© |
1) ¼Òȼº±Ë¾çÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) Ç÷¾×ÀÌ»ó ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
3) ÃâÇ÷°æÇâÀÌ Àִ ȯÀÚ (Ç÷¼ÒÆÇ±â´ÉÀÌ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.)
4) °£Àå¾Ö ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
5) ½ÅÀå¾Ö ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
6) ½É±â´ÉºÎÀü ȯÀÚ
7) °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
8) ±â°üÁöõ½Ä ȯÀÚ
9) °í·ÉÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ¼Òȱâ°è
µå¹°°Ô À§ÀåÃâÇ÷, ¶§¶§·Î ½Ä¿åºÎÁø, ±¸¿ª, ±¸Åä, À§Åë, º¹Åë, À§ºÎºÒÄè°¨, À§º¹ºÎÆØ¸¸°¨, º¯ºñ, ¼³»ç, ±¸°¥, ±¸³»¿° µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
2) ¼ï
µå¹°°Ô ¼ïÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î °üÂûÀ» ÃæºÐÈ÷ ÇÏ¿© Èä³»°í¹Î, È£Èí°ï¶õ, Ç÷¾ÐÀúÇÏ, û»öÁõ µîÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Á¶Ä¡¸¦ ÇÑ´Ù.
3) °ú¹ÎÁõ
¶§¶§·Î ¹ßÁø, °¡·Á¿òÁõ, µå¹°°Ô õ½Ä¹ßÀÛÀÇ À¯¹ßÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Á¤±âÀûÀ¸·Î °Ë»ç¸¦ ÇÏ´Â µî °üÂûÀ» ÃæºÐÈ÷ ÇÏ¿© ÀÌ»óÀÌ ÀÖÀ» °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Á¶Ä¡¸¦ ÇÑ´Ù.
4) °£Àå
µå¹°°Ô GOT, GPT, ALPÀÇ »ó½ÂÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) ½ÅÀå
µå¹°°Ô ±Þ¼º½ÅºÎÀü, ³×ÇÁ·ÎÁ¦ÁõÈıº µîÀÇ ½ÉÇÑ ½ÅÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Á¤±âÀûÀ¸·Î °Ë»ç¸¦ ÇÏ´Â µî °üÂûÀ» ÃæºÐÈ÷ ÇÏ¿© ÀÌ»óÀÌ ÀÖÀ» °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Á¶Ä¡¸¦ ÇÑ´Ù.
6) Á¤½Å½Å°æ°è
¶§¶§·Î µÎÅë, Çö±â, µ¿¿ä, Á¹À½ µå¹°°Ô ±Çۨ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) ±Í
µå¹°°Ô À̸íÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
8) Ç÷¾×
µå¹°°Ô Ç÷¼ÒÆÇ±â´ÉÀúÇÏ(ÃâÇ÷½Ã°£ ¿¬Àå)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
9) ±âŸ
¶§¶§·Î ºÎÁ¾, µå¹°°Ô ½É°èÇ×ÁøÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ´Ù¸¥ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦(NSAIDs)¿Í º´¿ëÅõ¿©ÇÒ °æ¿ì ÀÌ»ó¹ÝÀÀÀÇ À§ÇèÀÌ Áõ°¡ÇÒ ¼ö ÀÖÀ¸¹Ç·Î º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
2) À¯»çÈÇÕ¹°(ÆæºÎÆæ µî)¿¡¼, ¿¡³ì»ç½Å µîÀÇ ºÒÈÄû³î·Ð°è Ç×±ÕÁ¦¿Í º´¿ë Åõ¿©½Ã µå¹°°Ô °æ·ÃÀÌ ÀϾ´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î À̵é Ç×±ÕÁ¦¿ÍÀÇ º´¿ëÀº ÇÇÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
3) À§Àå°ü°è ÃâÇ÷¿¡ ´ëÇÏ¿© °æ±¸¿ë Ç×ÀÀÇ÷Á¦(¿ÍÆÄ¸° µî)°ú ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦´Â »ó½ÂÀÛ¿ëÀ» ³ªÅ¸³¾ ¼ö ÀÖÀ¸¹Ç·Î µÎ ¾à¹°À» ÇÔ²² »ç¿ëÇϴ ȯÀÚ´Â ´Üµ¶À¸·Î Åõ¿©ÇÏ´Â °æ¿ì¿¡ ºñÇØ ÁßÁõÀÇ À§Àå°ü°è ÃâÇ÷ÀÇ À§ÇèÀÌ ³ô¾ÆÁú ¼ö ÀÖ´Ù. °æ±¸¿ë Ç×ÀÀÇ÷Á¦¿Í º´¿ëÅõ¿©½Ã ±× ÀÛ¿ëÀ» Áõ°½Ãų ¼ö ÀÖÀ¸¹Ç·Î °¨·®ÇÏ´Â µî ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
4) ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦´Â ½ÅÀå¿¡¼ÀÇ ÇÁ·Î½ºÅ¸±Û¶õµò ÇÕ¼º ¾ïÁ¦¿¡ ÀÇÇØ Ç÷û ¸®Æ¬ÀÇ ³óµµ¸¦ Áõ°¡½ÃŰ°í ¸®Æ¬ÀÇ ½ÅŬ¸®¾î·±½º¸¦ °¨¼Ò½Ãų ¼ö ÀÖ´Ù. ¸®Æ¬°úÀÇ º´¿ë¿¡ ÀÇÇØ ¸®Æ¬ÀÇ Ç÷Á߳󵵸¦ »ó½Â½ÃÄÑ ¸®Æ¬Áßµ¶À» ÀÏÀ¸Ä×´Ù´Â º¸°í°¡ ÀÖ´Ù. µû¶ó¼ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦¿Í ¸®Æ¬ÀÇ º´¿ë Åõ¿© ½Ã ¸®Æ¬ÀÇ µ¶¼º ¡Èĸ¦ ÁÖÀÇ ±í°Ô °üÂûÇÏ¿© ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
5) ACE ÀúÇØÁ¦¿Í º´¿ëÅõ¿© ½Ã, ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦¿¡ ÀÇÇØ ACE ÀúÇØÁ¦ÀÇ Ç×°íÇ÷¾ÐÈ¿°ú°¡ °¨¼ÒµÉ ¼ö ÀÖ´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î ÀÌ ¾à°ú ACE ÀúÇØÁ¦¸¦ º´¿ëÅõ¿©ÇÏ´Â °æ¿ì ÀÌ·¯ÇÑ »óÈ£ÀÛ¿ëÀ» ¿°µÎ¿¡ µÎ¾î¾ß ÇÑ´Ù.
6) ¾Æ½ºÇǸ°°úÀÇ º´¿ëÀÌ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦ÀÇ »ç¿ë°ú °ü·ÃµÈ Áß´ëÇÑ ½ÉÇ÷°ü°è Ç÷Àü¹ÝÀÀÀÇ À§ÇèÀ» °¨¼Ò½Ãų ¼ö ÀÖ´Ù´Â ÀϰüµÈ Áõ°Å´Â ¾ø´Ù. ´Ù¸¥ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦¿Í ¸¶Âù°¡Áö·Î ÀÌ ¾à°ú ¾Æ½ºÇǸ°ÀÇ º´¿ë¿¡ ÀÇÇØ ÁßÁõÀÇ À§Àå°ü°è ÀÌ»ó¹ÝÀÀÀÇ ¹ß»ý À§ÇèÀÌ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î µÎ ¾à¹°ÀÇ º´¿ëÀº ÀϹÝÀûÀ¸·Î ±ÇÀåµÇÁö ¾Ê´Â´Ù.
7) ÀÓ»ó½ÃÇè ¹× ½ÃÆÇÈÄ Á¶»ç °á°ú, ÀÌ ¾àÀÇ ½ÅÀå¿¡¼ÀÇ ÇÁ·Î½ºÅ¸±Û¶õµò ÇÕ¼º ¾ïÁ¦¿¡ ÀÇÇØ ÀϺΠȯÀÚ¿¡¼ Ǫ·Î¼¼¹Ìµå ¹× Ä¡¾ÆÁþ°è ÀÌ´¢Á¦ÀÇ ³ªÆ®·ý´¢¹è¼³ È¿°ú°¡ °¨¼ÒÇÒ ¼ö ÀÖÀ½ÀÌ È®ÀεǾú´Ù. ÀÌµé ¾à¹°°ú ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦¸¦ º´¿ëÅõ¿©ÇÏ´Â µ¿¾È ½ÅºÎÀü ¡Èĸ¦ ¸é¹ÐÈ÷ °üÂûÇØ¾ß ÇÑ´Ù. ÀÌ ¾àÀº Ä¡¾ÆÁþ°è ÀÌ´¢Á¦ÀÇ ÀÛ¿ëÀ» °¨¼Ò½Ãų ¼ö ÀÖ´Ù.
8) ¸ÞÅ䯮·º¼¼ÀÌÆ® : ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦(NSAIDs)¿ÍÀÇ º´¿ëÅõ¿©·Î ½Å¼¼´¢°ü¿¡¼ ¸ÞÅ䯮·º¼¼ÀÌÆ®ÀÇ ¹è¼³ÀÌ Áö¿¬µÇ¾î Ä¡¸íÀûÀÎ ¸ÞÅ䯮·º¼¼ÀÌÆ®ÀÇ Ç÷¾×ÇÐÀû µ¶¼ºÀÌ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î Ç׾Ͽä¹ýÀ¸·Î »ç¿ëÇÏ´Â °í¿ë·®ÀÇ ¸ÞÅ䯮·º¼¼ÀÌÆ®¿Í´Â º´¿ëÅõ¿©ÇÏÁö ¾ÊÀ¸¸ç, Àú¿ë·®ÀÇ ¸ÞÅ䯮·º¼¼ÀÌÆ®¿Í º´¿ëÅõ¿©½Ã ½ÅÁßÈ÷ Åõ¿©ÇÏ¿©¾ß ÇÑ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
(ÀÓ½Å3±â )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Flurbiprofen¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The antiinflammatory effect of flurbiprofen may result from the reversible inhibition of cyclooxygenase, causing the peripheral inhibition of prostaglandin synthesis. Flurbiprofen also inhibits the migration of leukocytes into sites of inflammation and prevents the formation of thromboxane A2, an aggregating agent, by the platelets.
|
| Pharmacology |
Flurbiprofen¿¡ ´ëÇÑ Pharmacology Á¤º¸ Flurbiprofen, a nonsteroidal antiinflammatory drug (NSAID) of the propionic acid class, is used for the relief of pain and inflammation associated with rheumatoid arthritis and osteoarthritis and for the inhibition of intraoperative miosis. Flurbiprofen exhibits antiinflammatory, analgesic, and antipyretic activities.
|
| Metabolism |
Flurbiprofen¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2C9 (CYP2C9)
|
| Protein Binding |
Flurbiprofen¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ > 99%
|
| Half-life |
Flurbiprofen¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 4.7-5.7 hours
|
| Absorption |
Flurbiprofen¿¡ ´ëÇÑ Absorption Á¤º¸ The mean oral bioavailability of flurbiprofen from tablets is 96% relative to an oral solution.
|
| Pharmacokinetics |
FlurbiprofenÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ : 1-2 ½Ã°£ À̳»
|
| Biotransformation |
Flurbiprofen¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic. Cytochrome P450 2C9 plays an important role in the metabolism of flurbiprofen to its major metabolite, 4¡¯-hydroxy-flurbiprofen. The 4¡¯-hydroxy-flurbiprofen metabolite showed little anti-inflammatory activity in animal models of inflammation.
|
| Toxicity |
Flurbiprofen¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=10 mg/kg (orally in dogs).
|
| Drug Interactions |
Flurbiprofen¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Alendronate Increased risk of gastric toxicityMethotrexate The NSAID increases the effect and toxicity of methotrexateAnisindione The NSAID increases the anticoagulant effectDicumarol The NSAID increases the anticoagulant effectAcenocoumarol The NSAID increases the anticoagulant effectWarfarin The NSAID increases the anticoagulant effectCyclosporine Monitor for nephrotoxicity
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Flurbiprofen¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food to reduce irritation.Avoid alcohol.
|
| Drug Target |
[Drug Target]
|
| Description |
Flurbiprofen¿¡ ´ëÇÑ Description Á¤º¸ An anti-inflammatory analgesic and antipyretic of the phenylalkynoic acid series. It has been shown to reduce bone resorption in periodontal disease by inhibiting carbonic anhydrase. [PubChem]
|
| Dosage Form |
Flurbiprofen¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule, extended release OralLiquid OphthalmicTablet Oral
|
| Drug Category |
Flurbiprofen¿¡ ´ëÇÑ Drug_Category Á¤º¸ AnalgesicsAnti-Inflammatory Agents, Non-SteroidalAnti-inflammatory AgentsCarbonic Anhydrase InhibitorsCyclooxygenase InhibitorsNonsteroidal Antiinflammatory Agents (NSAIDs)
|
| Smiles String Canonical |
Flurbiprofen¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C(O)=O)C1=CC(F)=C(C=C1)C1=CC=CC=C1
|
| Smiles String Isomeric |
Flurbiprofen¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@@H](C(O)=O)C1=CC(F)=C(C=C1)C1=CC=CC=C1
|
| InChI Identifier |
Flurbiprofen¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18)/f/h17H
|
| Chemical IUPAC Name |
Flurbiprofen¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-(3-fluoro-4-phenylphenyl)propanoic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-09-27
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ¡Ã4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. FLURBIPROFEN[GGT Increase][Composite Activity](Score) I(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) I(Number of Rpts) ¡Ã4(Index value) 0.9[SGOT Increase](Activity Score) I(Number of Rpts) ¡Ã4(Index value) 0.9[SGPT Increase](Activity Score) I(Number of Rpts) ¡Ã4(Index value) 0.9[LDH Increase](Activity Score) I(Number of Rpts) <4(Index value) 0.2[GGT Increase](Activity Score) I(Number of Rpts) ¡Ã4(Index value) 0.9
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|