|   | 
                  
                       | 
                      | 
                    
                        
                            
                                | 
                                  
                                 | 
                             
                             |  
                            
                                
                                    
                                        
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    ¸Þ¼Ò¸°Á¤100mg(º£½Ç»ê¸Þ¼Ò¸®´ÙÁø)  [Mesoridazine Besylate]  
                    
                 | 
               
              
                | 
                     Àü¹®ÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |                   
                                        | 
                                             | 
                                         
                            
                                
                            
                            
                              
                                                        
                              
                                                
                            
 |   
    | 
      
     | 
 
 |  
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
  
  
    
      
  
    
       |  
      
        
          
            
                | Çã°¡Á¤º¸ | 
             
           
         | 
       
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        651902630[A09202131]  
	    
	    
            [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \0 ¿ø/1Á¤(2007.03.01)(ÇöÀç¾à°¡)
            \193 ¿ø/1Á¤(2006.03.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
      [Áúº´ÄÚµåÁ¶È¸]
     
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
  
  
  
  
  
  
  
  
  
  
  
 
  
  
    
  
  
  
  
  
  
  
  
  
  
 
  
  
  
 
  
  
  
  
  
  
   
    | Çã°¡»çÇ× ¿ø¹®Á¶È¸ | 
    
      
	    [Çã°¡»çÇ× ¿ø¹®Á¶È¸] 
     | 
   
  
  
  
  
     
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      1. Á¤½ÅºÐ¿Áõ 
2. Àú´É°ú ¸¸¼º³úÁúȯÀ¸·Î ÀÎÇÑ ÇൿÀå¾Ö 
3. ±Þ¸¸¼º ¾ËÄÚ¿ÃÁßµ¶ 
4. Á¤½Å½Å°æÁõ 
[Drugbank ÀÇ ¼ººÐÁ¤º¸¿¶÷] [Mesoridazine]
      
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
    
  
  
  
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
      [󹿾à¾î] 
      [ÁÖ¼ººÐÄÚµå:191001ATB ¿¡ µû¸¥ ½É»çÁöħ¿¶÷] 
1. Á¤½ÅºÐ¿Áõ : ÃÊȸ Åõ¿©·®Àº 1ȸ 50¹Ð¸®±×¶÷ 1ÀÏ 3ȸ °æ±¸Åõ¿©.
ÀÌÈÄ ÃÖÀû 1ÀÏ Åõ¿©·®Àº 100¡400¹Ð¸®±×¶÷ÀÌ´Ù.
  
2. Àú´É°ú ¸¸¼º³úÁúȯÀ¸·Î ÀÎÇÑ ÇൿÀå¾Ö : ÃÊȸ Åõ¿©·®Àº 1ȸ 25¹Ð¸®±×¶÷, 1ÀÏ 3ȸ °æ±¸Åõ¿©. ÀÌÈÄ ÃÖÀû 1ÀÏ Åõ¿©·®Àº 75¡300¹Ð¸®±×¶÷ÀÌ´Ù.
  
3. ¾ËÄÚ¿ÃÁßµ¶ : ÃÊȸ Åõ¿©·®Àº 1ȸ 25¹Ð¸®±×¶÷, 1ÀÏ 2ȸ °æ±¸Åõ¿©. 
ÀÌÈÄ ÃÖÀû1ÀÏ Åõ¿©·®Àº 50¡200¹Ð¸®±×¶÷ÀÌ´Ù.
  
4. Á¤½Å½Å°æÁõ : ÃÊȸ Åõ¿©·®Àº 1ȸ 10¹Ð¸®±×¶÷, 1ÀÏ 3ȸ °æ±¸Åõ¿©. ÀÌÈÄ ÃÖÀû 1ÀÏ Åõ¿©·®Àº 30¡150¹Ð¸®±×¶÷ÀÌ´Ù.     
      	
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    - ÁßÁõÀÇ ÁßÃ߽Űæ°è ¾ïÁ¦»óÅ ¶Ç´Â È¥¼ö»óÅ¿¡ Àִ ȯÀÚ
 - Æä³ëƼ¾ÆÁø·ù ¾à¹°¿¡ °ú¹ÎÁõÀÇ ±â¿Õ·ÂÀÌ Àִ ȯÀÚ
 
  | 
   
  
  
  
  
    
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      - ÁßÃ߽Űæ°è :
   Á¹¸®¿ò, ÆÄŲ½¼¾¾ÁõÈıº, Çö±â, ¼è¾à, ÁøÀü, ºÒ¾È, ¿îµ¿½ÇÁ¶, ±Ù±äÀåÀÌ»ó, °æÃà, ¾ð¾îºÒ¸í(slurring), Á¤ÁºҴÉ, ¹Ý±Ã±äÀåÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù.
ÀÚÀ²½Å°æ°è : ÀϺο¹¿¡¼ ±¸°¥, ±¸¿ª ¹× ±¸Åä, Á¹µµ, ÄÚ¸·Èû, ±¤¼±°øÆ÷Áõ, º¯ºñ ¹× ½Ã·Â ºÒ¼±¸íÀÌ ¹ß»ýÇÏ¿´´Ù.
ºñ´¢»ý½Ä±â°è : »çÁ¤¾ïÁ¦, À½À§, ¾ß´¢Áß, ´¢½Ç±ÝÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù.
ÇǺΠ: ¼Ò¾çÁõ, ¹ßÁø, ÇôÀÇ À¯µÎºñÈÄ ¹× Ç÷°ü½Å°æ¼ººÎÁ¾ÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù.
 ½ÉÇ÷°ü°è : ÀúÇ÷¾Ð ¹× ºó¸ÆÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù. ÀϺο¹¿¡¼ ½ÉÀüµµ º¯È°¡ ¹ß»ýÇÏ¿´´Ù.
±âŸ : À̿ܿ¡µµ Æä³ëƼ¾ÆÁø À¯µµÃ¼·ùÀÇ ÀϹÝÀûÀÎ ºÎÀÛ¿ëÀº ´ÙÀ½°ú °°´Ù.
- ÀÚÀ²½Å°æ°è :
   Ãൿ, º¯ºñ, ½Ä¿åºÎÁø, ¸¶ºñ¼ºÀåÆó»ö
ÇǺιÝÀÀ : È«¹Ý, ¹ÚÅ»¼ºÇǺο°, Á¢Ã˼ºÇǺο°
 Ç÷¾×°è  : ¹«°ú¸³±¸Áõ, ¹éÇ÷±¸°¨¼ÒÁõ, È£»ê±¸Áõ´ÙÁõ, Ç÷¼ÒÆÇ°¨¼ÒÁõ, ºóÇ÷, Àç»ýºÒ·®¼ººóÇ÷, ¹üÇ÷±¸ °¨¼ÒÁõ
¾Ë·¯Áö¹ÝÀÀ : ¹ß¿, ÈĵκÎÁ¾, Ç÷°ü½Å°æ¼ººÎÁ¾, õ½Ä
°£µ¶¼º : Ȳ´Þ, ´ãÁóÀú·ù
½ÉÇ÷°ü°è : ½ÉÀüµµ º¯È(QT°£°ÝÀÇ ¿¬Àå, TÆÄÀÇ ÆòÀúȳª ¿ªÀü, À̺À¼º TÆÄ³»Áö UÆÄÀÇ ÃâÇö µî), ÀúÇ÷¾Ð¿¡ ÀÌÀº µ¹¿¬»ç°¡ º¸°íµÈ ¹Ù ÀÖ´Ù.
 Ãßü¿Ü·ÎÁõ»ó : Á¤ÁºҴÉ, ÃÊÁ¶, ¿îµ¿ºÒ¾È, Àå·ÂºÎÀü¹ÝÀÀ, °³±¸ºÒ´É, ¹Ý±Ã±äÀå, »ç°æ(torticollis), ¾ÈÃ߿¹ßÀÛ, ÁøÀü, ±Ù°æÃà, ¿îµ¿ºÒ´É
Áö¹ß¼º ¿îµ¿Àå¾Ö : Çô, ¾ó±¼, ÀÔ, ÀÔ¼ú ¶Ç´Â ÅÎ, ¸öü ¹× »çÁö¿¡ ³ªÅ¸³ª´Â ºÒ¼öÀÇÀû ¹«µµº´ , ¾ÆÅ×ÅäÁ¦Áõ.
³»ºÐºñÀå¾Ö : ¿ù°æÀÌ»ó, ¼º¿åÀÌ»ó, ¿©¼ºÇüÀ¯¹æ, À¯ÁóºÐºñ, üÁßÁõ°¡, ºÎÁ¾, ÀӽŹÝÀÀ °Ë»çÀÌ»óÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù.
ºñ´¢±âÀå¾Ö : ´¢Àú·ù, ´¢½Ç±Ý
±âŸ : ÀÌ»ó°í¿Áõ, ¸ð¼ø¹ÝÀÀÀ¸·Î ÃßÁ¤µÇ´Â ÇൿÀû¹ÝÀÀ(ÈïºÐ, ¾Ç¸ù, Á¤½ÅÀÌ»óÀÇ ¾ÇÈ ¹× Áßµ¶¼º Âø¶õ»óÅ µî)ÀÌ º¸°íµÇ¾úÀ¸¸ç, ÃÖ±Ù¿¡´Â Æä³ëƼ¾ÆÁø·ù Àå±â¿¬¿ëÀ¸·Î ƯÀ̼º ÇǺÎ-¾ÈÁõ»óÀÌ ¹ß°ßµÇ¾ú½À´Ï´Ù. ÀÌ ¹ÝÀÀÀº ÇǺγª °á¸·ºÎÀ§ÀÇ ÁøÇ༺ »ö¼ÒÄ§ÂøÀ¸·Î ³ªÅ¸³ª°Å³ª ¶Ç´Â ³ëÃâ°ø¸·À̳ª °¢¸·ÀÇ Å»»öÀ» ³ªÅ¸³½´Ù. °¢¸·¡¤¼öÁ¤Ã¼ ȥʵµ º¸°íµÈ ¹Ù ÀÖ´Ù. Àü½Å È«¹Ý¼º ·çǪ½º¾ç ÁõÈıº
      
     | 
   
        
  
  
    
   
    | »óÈ£ÀÛ¿ë | 
    Æä³ëƼ¾ÆÁø·ù ¾à¹°Àº ÁßÃ߽Űæ¾ïÁ¦Á¦(¿¹ : ¸¶ÃëÁ¦, ¾ÆÆí·ù, ¾ËÄÚ¿Ã µî), ¾ÆÆ®·ÎÇÉ, À¯±âÀÎ »ìÃæÁ¦¿¡ ´ëÇØ »óÈ£ÀûÀ¸·Î ÀÛ¿ëÀ» Áõ°½Ãų ¼ö ÀÖÀ¸¹Ç·Î °¨·®ÇÏ´Â µî ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. | 
   
  
    
  
  
       	
  
     
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
      
      ±âÁØ ¼ººÐ: MESORIDAZINE BESYLATESERENTIL (MESORIDAZINE BESYLATE) 
        
     | 
      
  
  
  |  
     
   
  
    
       |  
      
        
          
            
                | Á¤º¸¿ä¾à |         
             
           
         | 
             	    
       |  
      | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
     
   
  
    
       |  
      
        
          
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |         
             
           
         | 
             	    
       |  
      | 	 |  
     
   
  
    
       |  
      
        
          
            
                | Á¦Ç°Á¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | º¹¾àÁ¤º¸ |            
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        
				         (mesoridazine; )
				        
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  
   
    | º¹¾à¶óº§ | 
    
    
    
      | À̹ÌÁö | 
      º¹¾à¼³¸í | 
     
    
    
        | 
      º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
     |  
    
      
	
	  
            | *  | 
	    º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. | 
	   
	  
            | *  | 
	    º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. | 
	   
	  
            | *  | 
	    ±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. | 
	   
	   
     |   
     | 
   
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
     
   
  
    
       |  
      
        
          
            
                | ½É»çÁ¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
     
  
    
       |  
      
        
          
            
                | ÇмúÁ¤º¸ |          
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Mesoridazine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Based upon animal studies, mesoridazine, as with other phenothiazines, acts indirectly on reticular formation, whereby neuronal activity into reticular formation is reduced without affecting its intrinsic ability to activate the cerebral cortex. In addition, the phenothiazines exhibit at least part of their activities through depression of hypothalamic centers. Neurochemically, the phenothiazines are thought to exert their effects by a central adrenergic blocking action. 
     | 
   
  
   
    | Pharmacology | 
     
       Mesoridazine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Mesoridazine, the besylate salt of a metabolite of thioridazine, is a phenothiazine tranquilizer. Pharmacological studies in laboratory animals have established that mesoridazine has a spectrum of pharmacodynamic actions typical of a major tranquilizer. In common with other tranquilizers it inhibits spontaneous motor activity in mice, prolongs thiopental and hexobarbital sleeping time in mice and produces spindles and block of arousal reaction in the EEG of rabbits. It is effective in blocking spinal reflexes in the cut and antagonizes d-amphetamine excitation and toxicity in grouped mice. It shows a moderate adrenergic blocking activity in vitro and in vivo and antagonizes 5-hydroxytryptamine in vivo. Intravenously administered, it lowers the blood pressure of anesthetized dogs. It has a weak antiacetylcholine effect in vitro. 
     | 
   
  
   
    | Metabolism | 
    
       Mesoridazine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2D6 (CYP2D6) 
     | 
   
  
   
    | Protein Binding | 
    
       Mesoridazine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 4% 
     | 
   
  
   
    | Half-life | 
    
       Mesoridazine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 24 to 48 hours 
     | 
   
  
   
    | Absorption | 
    
       Mesoridazine¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed from the gastrointestinal tract. 
     | 
   
  
   
    | Pharmacokinetics | 
    
       Mesoridazine BesylateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
- ÀÛ¿ëÁö¼Ó½Ã°£ : 4-6 ½Ã°£
 
 - Èí¼ö : °æ±¸ : Á¤Á¦´Â ºÒ±ÔÄ¢ÀûÀ¸·Î Èí¼öµÇ¸ç, ¾×Á¦°¡ Á¤Á¦º¸´Ù Àß Èí¼öµÊ
 
 - ´Ü¹é°áÇÕ : 91-99%
 
 - ¹Ý°¨±â : 24-48 ½Ã°£
 
 - Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 2-4 ½Ã°£
 
 - Á¤»ó»óÅ µµ´Þ½Ã°£ : 4-7ÀÏ
 
 - ¼Ò½Ç : ½Å¹è¼³
   
     | 
   
  
   
    | Biotransformation | 
    
       Mesoridazine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available 
     | 
   
  
   
    | Toxicity | 
    
       Mesoridazine¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral LD50 is 560 ¡¾ 62.5 mg/kg and 644 ¡¾ 48 mg/kg in mouse and rat, respectively. Symptoms of overdose may include emesis, muscle tremors, decreased food intake and death associated with aspiration of oral-gastric contents into the respiratory system. 
     | 
   
  
   
    | Drug Interactions | 
    
       Mesoridazine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amiodarone	Increased risk of cardiotoxicity and arrhythmiasAmitriptyline	Increased risk of cardiotoxicity and arrhythmiasAstemizole	Increased risk of cardiotoxicity and arrhythmiasBretylium	Increased risk of cardiotoxicity and arrhythmiasChloroquine	Increased risk of cardiotoxicity and arrhythmiasChlorpromazine	Increased risk of cardiotoxicity and arrhythmiasCisapride	Increased risk of cardiotoxicity and arrhythmiasDiltiazem	Increased risk of cardiotoxicity and arrhythmiasDiphenhydramine	Increased risk of cardiotoxicity and arrhythmiasDisopyramide	Increased risk of cardiotoxicity and arrhythmiasDofetilide	Increased risk of cardiotoxicity and arrhythmiasDoxepin	Increased risk of cardiotoxicity and arrhythmiasErythromycin	Increased risk of cardiotoxicity and arrhythmiasFlecainide	Increased risk of cardiotoxicity and arrhythmiasFluoxetine	Increased risk of cardiotoxicity and arrhythmiasFluvoxamine	Increased risk of cardiotoxicity and arrhythmiasGatifloxacin	Increased risk of cardiotoxicity and arrhythmiasGrepafloxacin	Increased risk of cardiotoxicity and arrhythmiasHalofantrine	Increased risk of cardiotoxicity and arrhythmiasHaloperidol	Increased risk of cardiotoxicity and arrhythmiasImipramine	Increased risk of cardiotoxicity and arrhythmiasJosamycin	Increased risk of cardiotoxicity and arrhythmiasLevofloxacin	Increased risk of cardiotoxicity and arrhythmiasMaprotiline	Increased risk of cardiotoxicity and arrhythmiasMetrizamide	Increased risk of cardiotoxicity and arrhythmiasParoxetine	Increased risk of cardiotoxicity and arrhythmiasPenicillin G	Increased risk of cardiotoxicity and arrhythmiasPentamidine	Increased risk of cardiotoxicity and arrhythmiasPimozide	Increased risk of cardiotoxicity and arrhythmiasPindolol	Increased risk of cardiotoxicity and arrhythmiasProcainamide	Increased risk of cardiotoxicity and arrhythmiasPropafenone	Increased risk of cardiotoxicity and arrhythmiasPropranolol	Increased risk of cardiotoxicity and arrhythmiasQuinidine	Increased risk of cardiotoxicity and arrhythmiasQuinidine barbiturate	Increased risk of cardiotoxicity and arrhythmiasQuinine	Increased risk of cardiotoxicity and arrhythmiasSotalol	Increased risk of cardiotoxicity and arrhythmiasSertindole	Increased risk of cardiotoxicity and arrhythmiasSparfloxacin	Increased risk of cardiotoxicity and arrhythmiasTerfenadine	Increased risk of cardiotoxicity and arrhythmiasZiprasidone	Increased risk of cardiotoxicity and arrhythmiasSpiramycin	Increased risk of cardiotoxicity and arrhythmiasRivastigmine	Possible antagonism of actionBromocriptine	The phenothiazine decreases the effect of bromocriptineDonepezil	Possible antagonism of actionGalantamine	Possible antagonism of actionGuanethidine	The agent decreases the effect of guanethidineAmphetamine	Decreased anorexic effect, may increase psychotic symptomsBenzphetamine	Decreased anorexic effect, may increase psychotic symptomsDexfenfluramine	Decreased anorexic effect, may increase psychotic symptomsDiethylpropion	Decreased anorexic effect, may increase psychotic symptomsDextroamphetamine	Decreased anorexic effect, may increase psychotic symptomsFenfluramine	Decreased anorexic effect, may increase psychotic symptomsMazindol	Decreased anorexic effect, may increase psychotic symptomsMethamphetamine	Decreased anorexic effect, may increase psychotic symptomsPhenylpropanolamine	Decreased anorexic effect, may increase psychotic symptomsPhentermine	Decreased anorexic effect, may increase psychotic symptomsPhenmetrazine	Decreased anorexic effect, may increase psychotic symptomsPhendimetrazine	Decreased anorexic effect, may increase psychotic symptoms 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Food Interaction | 
    
       Mesoridazine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food to reduce irritation. 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Mesoridazine¿¡ ´ëÇÑ Description Á¤º¸ A phenothiazine antipsychotic with effects similar to chlorpromazine. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Mesoridazine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Injection, solution	IntramuscularTablet	Oral 
     | 
   
  
   
    | Drug Category | 
    
       Mesoridazine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antipsychotic AgentsAntipsychoticsDopamine AntagonistsPhenothiazines 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Mesoridazine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1CCCCC1CCN1C2=CC=CC=C2SC2=C1C=C(C=C2)S(C)=O 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Mesoridazine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN1CCCC[C@@H]1CCN1C2=CC=CC=C2SC2=C1C=C(C=C2)[S@@](C)=O 
     | 
   
  
   
    | InChI Identifier | 
    
       Mesoridazine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H26N2OS2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Mesoridazine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfinylphenothiazine 
     | 
   
    
  |  
     
     
  
    
       |  
      
        
          
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ |           
             
           
         | 
             	  
       |  
       |  
     
         
 
     | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                 º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
  
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |  
                           
                         | 
                       
                      | 
                   |