| |
|
|
|
|
|
 |
| |
|
메소린정50mg(메소리다진베실레이트) [Mesoridazine Besylate]
|
|
전문의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
651902620[A09202121]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1정(2007.03.01)(현재약가)
\181 원/1정(2006.03.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
1. 정신분열증
2. 저능과 만성뇌질환으로 인한 행동장애
3. 급만성 알코올중독
4. 정신신경증
[Drugbank 의 성분정보열람]
[Mesoridazine]
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
[주성분코드:191004ATB 에 따른 심사지침열람]
1. 정신분열증 : 초회 투여량은 1회 50밀리그람 1일 3회 경구투여.
이후 최적 1일 투여량은 100∼400밀리그람이다.
2. 저능과 만성뇌질환으로 인한 행동장애 : 초회 투여량은 1회 25밀리그람, 1일 3회 경구투여. 이후 최적 1일 투여량은 75∼300밀리그람이다.
3. 알코올중독 : 초회 투여량은 1회 25밀리그람, 1일 2회 경구투여.
이후 최적1일 투여량은 50∼200밀리그람이다.
4. 정신신경증 : 초회 투여량은 1회 10밀리그람, 1일 3회 경구투여. 이후 최적 1일 투여량은 30∼150밀리그람이다.
|
| 금기 |
- 중증의 중추신경계 억제상태 또는 혼수상태에 있는 환자
- 페노티아진류 약물에 과민증의 기왕력이 있는 환자
|
| 이상반응 |
- 중추신경계 :
졸리움, 파킨슨씨증후군, 현기, 쇠약, 진전, 불안, 운동실조, 근긴장이상, 경축, 언어불명(slurring), 정좌불능, 반궁긴장이 보고된 바 있다.
자율신경계 : 일부예에서 구갈, 구역 및 구토, 졸도, 코막힘, 광선공포증, 변비 및 시력 불선명이 발생하였다.
비뇨생식기계 : 사정억제, 음위, 야뇨중, 뇨실금이 보고된 바 있다.
피부 : 소양증, 발진, 혀의 유두비후 및 혈관신경성부종이 보고된 바 있다.
심혈관계 : 저혈압 및 빈맥이 보고된 바 있다. 일부예에서 심전도 변화가 발생하였다.
기타 : 이외에도 페노티아진 유도체류의 일반적인 부작용은 다음과 같다.
- 자율신경계 :
축동, 변비, 식욕부진, 마비성장폐색
피부반응 : 홍반, 박탈성피부염, 접촉성피부염
혈액계 : 무과립구증, 백혈구감소증, 호산구증다증, 혈소판감소증, 빈혈, 재생불량성빈혈, 범혈구 감소증
알러지반응 : 발열, 후두부종, 혈관신경성부종, 천식
간독성 : 황달, 담즙저류
심혈관계 : 심전도 변화(QT간격의 연장, T파의 평저화나 역전, 이봉성 T파내지 U파의 출현 등), 저혈압에 이은 돌연사가 보고된 바 있다.
추체외로증상 : 정좌불능, 초조, 운동불안, 장력부전반응, 개구불능, 반궁긴장, 사경(torticollis), 안추운동발작, 진전, 근경축, 운동불능
지발성 운동장애 : 혀, 얼굴, 입, 입술 또는 턱, 몸체 및 사지에 나타나는 불수의적 무도병 , 아테토제증.
내분비장애 : 월경이상, 성욕이상, 여성형유방, 유즙분비, 체중증가, 부종, 임신반응 검사이상이 보고된 바 있다.
비뇨기장애 : 뇨저류, 뇨실금
기타 : 이상고열증, 모순반응으로 추정되는 행동적반응(흥분, 악몽, 정신이상의 악화 및 중독성 착란상태 등)이 보고되었으며, 최근에는 페노티아진류 장기연용으로 특이성 피부-안증상이 발견되었습니다. 이 반응은 피부나 결막부위의 진행성 색소침착으로 나타나거나 또는 노출공막이나 각막의 탈색을 나타낸다. 각막·수정체 혼탁도 보고된 바 있다. 전신 홍반성 루푸스양 증후군
|
| 상호작용 |
페노티아진류 약물은 중추신경억제제(예 : 마취제, 아편류, 알코올 등), 아트로핀, 유기인 살충제에 대해 상호적으로 작용을 증강시킬 수 있으므로 감량하는 등 신중히 투여한다. |
| Related FDA Approved Drug |
기준 성분: MESORIDAZINE BESYLATESERENTIL (MESORIDAZINE BESYLATE)
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
(mesoridazine; )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
변비가 생길수 있습니다. |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Mesoridazine에 대한 Mechanism_Of_Action 정보
Based upon animal studies, mesoridazine, as with other phenothiazines, acts indirectly on reticular formation, whereby neuronal activity into reticular formation is reduced without affecting its intrinsic ability to activate the cerebral cortex. In addition, the phenothiazines exhibit at least part of their activities through depression of hypothalamic centers. Neurochemically, the phenothiazines are thought to exert their effects by a central adrenergic blocking action.
|
| Pharmacology |
Mesoridazine에 대한 Pharmacology 정보
Mesoridazine, the besylate salt of a metabolite of thioridazine, is a phenothiazine tranquilizer. Pharmacological studies in laboratory animals have established that mesoridazine has a spectrum of pharmacodynamic actions typical of a major tranquilizer. In common with other tranquilizers it inhibits spontaneous motor activity in mice, prolongs thiopental and hexobarbital sleeping time in mice and produces spindles and block of arousal reaction in the EEG of rabbits. It is effective in blocking spinal reflexes in the cut and antagonizes d-amphetamine excitation and toxicity in grouped mice. It shows a moderate adrenergic blocking activity in vitro and in vivo and antagonizes 5-hydroxytryptamine in vivo. Intravenously administered, it lowers the blood pressure of anesthetized dogs. It has a weak antiacetylcholine effect in vitro.
|
| Metabolism |
Mesoridazine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 2D6 (CYP2D6)
|
| Protein Binding |
Mesoridazine에 대한 단백결합 정보
4%
|
| Half-life |
Mesoridazine에 대한 반감기 정보
24 to 48 hours
|
| Absorption |
Mesoridazine에 대한 Absorption 정보
Well absorbed from the gastrointestinal tract.
|
| Pharmacokinetics |
Mesoridazine Besylate의 약물동력학자료
- 작용지속시간 : 4-6 시간
- 흡수 : 경구 : 정제는 불규칙적으로 흡수되며, 액제가 정제보다 잘 흡수됨
- 단백결합 : 91-99%
- 반감기 : 24-48 시간
- 혈중최고농도 도달시간 : 2-4 시간
- 정상상태 도달시간 : 4-7일
- 소실 : 신배설
|
| Biotransformation |
Mesoridazine에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
Mesoridazine에 대한 Toxicity 정보
Oral LD50 is 560 ± 62.5 mg/kg and 644 ± 48 mg/kg in mouse and rat, respectively. Symptoms of overdose may include emesis, muscle tremors, decreased food intake and death associated with aspiration of oral-gastric contents into the respiratory system.
|
| Drug Interactions |
Mesoridazine에 대한 Drug_Interactions 정보
Amiodarone Increased risk of cardiotoxicity and arrhythmiasAmitriptyline Increased risk of cardiotoxicity and arrhythmiasAstemizole Increased risk of cardiotoxicity and arrhythmiasBretylium Increased risk of cardiotoxicity and arrhythmiasChloroquine Increased risk of cardiotoxicity and arrhythmiasChlorpromazine Increased risk of cardiotoxicity and arrhythmiasCisapride Increased risk of cardiotoxicity and arrhythmiasDiltiazem Increased risk of cardiotoxicity and arrhythmiasDiphenhydramine Increased risk of cardiotoxicity and arrhythmiasDisopyramide Increased risk of cardiotoxicity and arrhythmiasDofetilide Increased risk of cardiotoxicity and arrhythmiasDoxepin Increased risk of cardiotoxicity and arrhythmiasErythromycin Increased risk of cardiotoxicity and arrhythmiasFlecainide Increased risk of cardiotoxicity and arrhythmiasFluoxetine Increased risk of cardiotoxicity and arrhythmiasFluvoxamine Increased risk of cardiotoxicity and arrhythmiasGatifloxacin Increased risk of cardiotoxicity and arrhythmiasGrepafloxacin Increased risk of cardiotoxicity and arrhythmiasHalofantrine Increased risk of cardiotoxicity and arrhythmiasHaloperidol Increased risk of cardiotoxicity and arrhythmiasImipramine Increased risk of cardiotoxicity and arrhythmiasJosamycin Increased risk of cardiotoxicity and arrhythmiasLevofloxacin Increased risk of cardiotoxicity and arrhythmiasMaprotiline Increased risk of cardiotoxicity and arrhythmiasMetrizamide Increased risk of cardiotoxicity and arrhythmiasParoxetine Increased risk of cardiotoxicity and arrhythmiasPenicillin G Increased risk of cardiotoxicity and arrhythmiasPentamidine Increased risk of cardiotoxicity and arrhythmiasPimozide Increased risk of cardiotoxicity and arrhythmiasPindolol Increased risk of cardiotoxicity and arrhythmiasProcainamide Increased risk of cardiotoxicity and arrhythmiasPropafenone Increased risk of cardiotoxicity and arrhythmiasPropranolol Increased risk of cardiotoxicity and arrhythmiasQuinidine Increased risk of cardiotoxicity and arrhythmiasQuinidine barbiturate Increased risk of cardiotoxicity and arrhythmiasQuinine Increased risk of cardiotoxicity and arrhythmiasSotalol Increased risk of cardiotoxicity and arrhythmiasSertindole Increased risk of cardiotoxicity and arrhythmiasSparfloxacin Increased risk of cardiotoxicity and arrhythmiasTerfenadine Increased risk of cardiotoxicity and arrhythmiasZiprasidone Increased risk of cardiotoxicity and arrhythmiasSpiramycin Increased risk of cardiotoxicity and arrhythmiasRivastigmine Possible antagonism of actionBromocriptine The phenothiazine decreases the effect of bromocriptineDonepezil Possible antagonism of actionGalantamine Possible antagonism of actionGuanethidine The agent decreases the effect of guanethidineAmphetamine Decreased anorexic effect, may increase psychotic symptomsBenzphetamine Decreased anorexic effect, may increase psychotic symptomsDexfenfluramine Decreased anorexic effect, may increase psychotic symptomsDiethylpropion Decreased anorexic effect, may increase psychotic symptomsDextroamphetamine Decreased anorexic effect, may increase psychotic symptomsFenfluramine Decreased anorexic effect, may increase psychotic symptomsMazindol Decreased anorexic effect, may increase psychotic symptomsMethamphetamine Decreased anorexic effect, may increase psychotic symptomsPhenylpropanolamine Decreased anorexic effect, may increase psychotic symptomsPhentermine Decreased anorexic effect, may increase psychotic symptomsPhenmetrazine Decreased anorexic effect, may increase psychotic symptomsPhendimetrazine Decreased anorexic effect, may increase psychotic symptoms
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Mesoridazine에 대한 Food Interaction 정보
Take with food to reduce irritation.
|
| Drug Target |
[Drug Target]
|
| Description |
Mesoridazine에 대한 Description 정보
A phenothiazine antipsychotic with effects similar to chlorpromazine. [PubChem]
|
| Dosage Form |
Mesoridazine에 대한 Dosage_Form 정보
Injection, solution IntramuscularTablet Oral
|
| Drug Category |
Mesoridazine에 대한 Drug_Category 정보
Antipsychotic AgentsAntipsychoticsDopamine AntagonistsPhenothiazines
|
| Smiles String Canonical |
Mesoridazine에 대한 Smiles_String_canonical 정보
CN1CCCCC1CCN1C2=CC=CC=C2SC2=C1C=C(C=C2)S(C)=O
|
| Smiles String Isomeric |
Mesoridazine에 대한 Smiles_String_isomeric 정보
CN1CCCC[C@@H]1CCN1C2=CC=CC=C2SC2=C1C=C(C=C2)[S@@](C)=O
|
| InChI Identifier |
Mesoridazine에 대한 InChI_Identifier 정보
InChI=1/C21H26N2OS2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3
|
| Chemical IUPAC Name |
Mesoridazine에 대한 Chemical_IUPAC_Name 정보
10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfinylphenothiazine
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2021-12-09
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
