| |
|
|
|
|
|
 |
| |
|
코러스메실산벤즈트로핀정1mg [Benztropine Mesylate]
|
|
전문의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
647202260[A50650061]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1정(2002.05.11)(현재약가)
\19 원/1정(2002.01.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
1. 특발성 파킨슨증
2. 기타의 파킨슨증(뇌염후, 동맥경화성)
3. 항정신병약 투여로 인한 파킨슨증
|
| 1일 최대 투여량 |
유료정보입니다.
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
성인 : 초기량은 메실산벤즈트로핀으로서 1일 0.5-1㎎을 경구투여한다. 그 후 5-6일 간격으로 1일 0.5㎎씩 점차 증량하여 유지량으로 한다. 이 때 유지량은 증상의 개선과 부작용 발현 등을 고려하여 결정하며 1일 6㎎을 초과하지 않는다.
연령, 증상에 따라 적절히 증감한다.
|
| 금기 |
1) 녹내장 환자
2) 이 약에 과민증 환자
3) 중증 근무력증 환자
4) 3세 미만의 유아 |
| 신중투여 |
1) 전립선 비대 등 요로 폐쇄성 질환 환자
2) 부정맥 또는 빈맥 환자
3) 간․신장애 환자
4) 고령자
5) 3세 이상의 유․소아
6) 고온 환경에 있는 자(발한 억제가 나타나기 쉬운 환자) |
| 이상반응 |
1) 정신신경계 : 운동실조 또는 정신착란, 환각, 의식장애, 헛소리, 신경과민, 흥분, 불안, 우울증, 권태감, 수족의 지각이상 등이 나타날 수 있다.
2) 소화기계 : 구갈, 구역, 구토, 변비 등의 증상이 나타날 수 있다.
3) 비뇨기계 : 때때로 배뇨곤란, 요폐 등이 나타날 수 있다.
4) 과민증 : 때때로 발진 등이 나타날 수 있으며 이러한 경우에는 투여를 중지한다.
5) 눈 : 조절장애 등이 나타날 수 있다.
|
| 상호작용 |
1) 페노치아진계 약물, 삼환계 항우울약, MAO저해제, 레세르핀 유도체와 병용시 이 약의 작용이 증강될 수 있으므로 신중히 투여한다.
2) 항콜린성 약물(페노치아진계 약물, 삼환계 항울약 등)과 병용시 장관마비(식욕부진, 구역·구토, 심한 변비, 복부팽만 또는 이완 및 장내용물 울체 등의 증상)가 나타나 마비성 장폐색으로 이행될 수 있으므로 장관마비가 나타나는 경우에는 투여를 중지한다. 또한 이러한 구역, 구토는 진토작용에 의하여 은폐될 수 있으므로 주의한다.
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
647202260[A50650061]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1정(2002.05.11)(최신약가)
\19 원/1정(2002.01.01)(변경전약가)
[상병코드조회]
[질병코드집 다운로드]
|
동일주성분코드
검색순위 |
유료정보입니다.
|
| Brandname 정보 |
Benztropine
Brand Names/Synonyms
- Akitan
- Apo-Benztropine
- Benzatropina [Inn-Spanish]
- Benzatropine
- Benzatropinum [Inn-Latin]
- Benztropine Mesylate
- Benztropinum
- Cobrentin
- Cogentin
- Cogentine
- Cogentinol
- Pms Benztropine
- Tropine Benzohydryl Ether
Brand Name MixturesNot Available
Chemical IUPAC Name3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
변비가 생길수 있습니다. |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Benztropine에 대한 Mechanism_Of_Action 정보
Benztropine is a selective M1 muscarinic acetylcholine receptor antagonist. It is able to discriminate between the M1 (cortical or neuronal) and the peripheral muscarinic subtypes (cardiac and glandular). Benztropine partially blocks cholinergic activity in the CNS, which is responsible for the symptoms of Parkinson's disease. It is also thought to increase the availability of dopamine, a brain chemical that is critical in the initiation and smooth control of voluntary muscle movement.
|
| Pharmacology |
Benztropine에 대한 Pharmacology 정보
Benztropine is an anticholinergic used in the symptomatic treatment of all etiologic groups of parkinsonism and drug induced extrapyramidal reactions (except tardive dyskinesia). Benztropine possesses both anticholinergic and antihistaminic effects, although only the former has been established as therapeutically significant in the management of parkinsonism. Benztropine's anticholinergic activity is about equal to that of atropine.
|
| Protein Binding |
Benztropine에 대한 단백결합 정보
Not Available
|
| Half-life |
Benztropine에 대한 반감기 정보
Not Available
|
| Absorption |
Benztropine에 대한 Absorption 정보
Not Available
|
| Pharmacokinetics |
Benztropine Mesylate의 약물동력학자료
|
| Biotransformation |
Benztropine에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
Benztropine에 대한 Toxicity 정보
Signs of overdose include confusion, nervousness, listlessness, hallucinations, dizziness; muscle weakness, ataxia, dry mouth, mydriasis, blurred vision, palpitations, tachycardia, elevated blood pressure, nausea, vomiting, dysuria, numbness of fingers, headache, delirium, coma, shock, convulsions, respiratory arrest, anhidrosis, hyperthermia, glaucoma, and constipation.
|
| Drug Interactions |
Benztropine에 대한 Drug_Interactions 정보
Donepezil Possible antagonism of actionGalantamine Possible antagonism of actionHaloperidol The anticholinergic increases the risk of psychosis and tardive dyskinesiaRivastigmine Possible antagonism of action
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Benztropine에 대한 Food Interaction 정보
Take with food to reduce irritation.Avoid alcohol.
|
| Drug Target |
[Drug Target]
|
| Description |
Benztropine에 대한 Description 정보
A centrally active muscarinic antagonist that has been used in the symptomatic treatment of parkinson disease. Benztropine also inhibits the uptake of dopamine. [PubChem]
|
| Dosage Form |
Benztropine에 대한 Dosage_Form 정보
Liquid IntravenousSolution OralTablet Oral
|
| Drug Category |
Benztropine에 대한 Drug_Category 정보
AntidyskineticsAntiparkinson AgentsDopamine Uptake InhibitorsMuscarinic AntagonistsParasympatholytics
|
| Smiles String Canonical |
Benztropine에 대한 Smiles_String_canonical 정보
CN1C2CCC1CC(C2)OC(C1=CC=CC=C1)C1=CC=CC=C1
|
| Smiles String Isomeric |
Benztropine에 대한 Smiles_String_isomeric 정보
CN1[C@@H]2CC[C@@H]1CC(C2)OC(C1=CC=CC=C1)C1=CC=CC=C1
|
| InChI Identifier |
Benztropine에 대한 InChI_Identifier 정보
InChI=1/C21H25NO/c1-22-18-12-13-19(22)15-20(14-18)23-21(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-21H,12-15H2,1H3/t18-,19-/m1/s1
|
| Chemical IUPAC Name |
Benztropine에 대한 Chemical_IUPAC_Name 정보
(1R,5R)-3-[di(phenyl)methoxy]-8-methyl-8-azabicyclo[3.2.1]octane
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-11-03
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ≥4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. BENZTROPINE[GGT Increase][Composite Activity](Score) NA(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGOT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGPT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[LDH Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[GGT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
