| |
|
|
|
|
|
 |
| |
|
¾ËÄɶõÁ¤(¸áÆÄ¶õ) ALKERAN TAB.
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
650000790[W00890011]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2012.02.01)(ÇöÀç¾à°¡)
\1,192 ¿ø/1Á¤(2003.10.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»ö-ȸ¹é»öÀÇ ¾ç¸éÀÌ º¼·ÏÇÑ ¿øÇü Çʸ§ÄÚÆÃÁ¤ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
25,50Á¤ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 2¹Ð¸®±×·¥ |
25 Á¤ |
º´ |
8806500007905 |
8806500007912 |
|
|
| ÁÖ¼ººÐÄÚµå |
189901ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. ´Ù¹ß¼º°ñ¼öÁ¾
2. ³¼Ò¼±¾Ï
3. ÁøÇ༺À¯¹æ¾Ï
4. Áø¼ºÀûÇ÷±¸Áõ°¡Áõ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¡Û ¼ºÀÎ
Ä¡·á ³óµµ¿¡ µµ´ÞÇÑ °ÍÀ» È®ÀÎÇϱâ À§ÇØ °ñ¼ö¾ïÁ¦°¡ °üÂûµÉ ¶§±îÁö ÁÖÀÇÇÏ¿© Áõ·®ÇÑ´Ù.
1. ´Ù¹ß¼º°ñ¼öÁ¾
ÇÁ·¹µå´Ï¼Õ°ú º´¿ëÅõ¿© ½Ã ´õ À¯È¿Çϸç, º¸Åë ¸áÆÄ¶õÀ¸·Î¼ 1ÀÏ Ã¼Áß kg´ç 0.15 mg°ú ÇÁ·¹µå´Ï¼Õ 40 mgÀ» ºÐÇÒÇÏ¿© 4Àϰ£ °æ±¸Åõ¿©Çϸç, 6ÁÖ °£°ÝÀ¸·Î ¹Ýº¹ÇÑ´Ù.
2. ³¼Ò¼±¾Ï
º¸Åë ÀÌ ¾àÀ¸·Î¼ 1ÀÏ Ã¼Áß kg´ç 0.2 mgÀ» 3ȸ·Î ºÐÇÒÇÏ¿© 5Àϰ£ °æ±¸Åõ¿©Çϸç, °ñ¼ö Àç»ýÀ» °í·ÁÇÏ¿© 4¢¦8ÁÖ °£°ÝÀ¸·Î ¹Ýº¹ÇÑ´Ù.
3. ÁøÇ༺À¯¹æ¾Ï
ÀÌ ¾àÀ¸·Î¼ 1ÀÏ Ã¼Áß kg´ç 0.15 mg ¶Ç´Â 6 mg/§³À» 4¢¦6Àϰ£ °æ±¸Åõ¿©Çϸç, 3¢¦6ÁÖ °£°ÝÀ¸·Î ¹Ýº¹ÇÑ´Ù. °ñ¼öµ¶¼ºÀÌ °üÂûµÇ¸é °¨·®ÇÑ´Ù.
4. Áø¼ºÀûÇ÷±¸Áõ°¡Áõ
¿ÏÈÀ¯µµ¸¦ À§ÇØ Ãʱ⿡ ÀÌ ¾àÀ¸·Î¼ 1ÀÏ 6¢¦10 mgÀ» 5¢¦7Àϰ£ °æ±¸Åõ¿©Çϸç, ÀÌÈÄ ¸¸Á·½º·¯¿î Áúº´ÅëÁ¦°¡ ÀÌ·ç¾îÁú ¶§±îÁö 1ÀÏ 2¢¦4 mgÀ» Åõ¿©ÇÑ´Ù. À¯Áö¿ä¹ýÀº 2¢¦6 mgÀ¸·Î ¸ÅÁÖ Åõ¿©ÇÑ´Ù. À¯Áö¿ä¹ý ½Ã ºó¹øÇÑ Ç÷±¸¼ö ÃøÁ¤ °á°ú¿¡ µû¸¥ ¿ë·®Á¶Àý°ú ÇÔ²² ¸é¹ÐÇÑ Ç÷¾×ÇÐÀû Á¶ÀýÀÌ ÇʼöÀûÀ¸·Î ¿ä±¸µÈ´Ù.
|
| ±Ý±â |
1) ¹éÇ÷±¸¼ö°¡ 2,000/§§ ÀÌÇÏ ¶Ç´Â Ç÷¼ÒÆÇ¼ö°¡ 50,000/§§ ÀÌÇÏ·Î °¨¼ÒµÈ ȯÀÚ
2) ÀÌ ¾à¿¡ ´ëÇØ ³»¼ºÀ» ³ªÅ¸³Â´ø ÁúȯÀÌ Àִ ȯÀÚ
3) ÀÌ ¾à ¹× ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) °¨¿°Áõ ȯÀÚ
2) ½ÅÀå¾Ö ¹× ¿äµ¶Áõ ȯÀÚ : ½Åû¼ÒÀ²ÀÇ °¨¼Ò·Î ÀÌ ¾àÀÇ µ¶¼ºÀÌ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î °üÂûÀ» ÃæºÐÈ÷ ÇÏ¿© ÀûÀýÈ÷ °¨·®ÇÑ´Ù. ÁßµîÁõ ¹× ÁßÁõ ½ÅºÎÀü ȯÀÚ¿¡¼´Â Ãʱâ Åõ¿©¿ë·®À» °¨·®ÇÑ´Ù. ¿äµ¶¼º °ñ¼ö¾ïÁ¦¸¦ µ¿¹ÝÇÑ ½ÅÀå¾Ö ȯÀÚÀÇ °æ¿ì¿¡µµ ÀÌ ¾àÀÇ Ã»¼ÒÀ²ÀÌ °¨¼ÒµÉ ¼ö ÀÖÀ¸¹Ç·Î °¨·®ÀÌ ÇÊ¿äÇÏ¸ç ¸é¹ÐÇÑ °üÂûÀÌ ¿ä±¸µÈ´Ù.
3) ÃÖ±Ù¿¡ ¹æ»ç¼±¿ä¹ýÀ̳ª ÈÇпä¹ýÀ» ½Ç½ÃÇÑ È¯ÀÚ : ÀÌ·¯ÇÑ È¯ÀÚµéÀº °ñ¼öµ¶¼ºÀÌ Áõ°¡µÇ¾î ÀÖÀ¸¹Ç·Î ½ÅÁßÈ÷ Åõ¿©ÇØ¾ß ÇÑ´Ù.
|
| ÀÌ»ó¹ÝÀÀ |
ÀÌ ¾à¿¡ ÀÇÇÑ ÀÌ»ó¹ÝÀÀÀÇ ¹ßÇöºóµµ¸¦ µÞ¹ÞħÇÒ ¼ö ÀÖ´Â ºñ±³Àû ÃÖ±ÙÀÇ ÀÓ»ó ÀÚ·á´Â ¾øÀ¸³ª, ´ÙÀ½ÀÇ ¿ë¾î¸¦ »ç¿ëÇÏ¿© ¹ßÇöºóµµ¸¦ ±¸ºÐÇÏ¿´´Ù. ; ¸Å¿ì ÀÚÁÖ(¡Ã10%), ÀÚÁÖ(¡Ã1%, <10%), ¶§¶§·Î(¡Ã0.1%, <1%), µå¹°°Ô(¡Ã0.01%, <0.1%), ¸Å¿ì µå¹°°Ô(<0.01%)
1) Ç÷¾×°è
¸Å¿ì ÀÚÁÖ ¹éÇ÷±¸°¨¼ÒÁõ, Ç÷¼ÒÆÇ°¨¼ÒÁõ, ºóÇ÷ µîÀ» À¯¹ßÇÏ´Â °ñ¼ö¾ïÁ¦, µå¹°°Ô ¿ëÇ÷¼ººóÇ÷ÀÌ ³ªÅ¸³ª´Â °æ¿ì°¡ ÀÖÀ¸¹Ç·Î, ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Ç÷±¸¼ö°¡ ȸº¹µÇ¸é ÀçÅõ¿©ÇÑ´Ù. ºñ°¡¿ªÀûÀÎ °ñ¼ö¼Õ½Çµµ º¸°íµÇ¾ú´Ù.
2) ¼Òȱâ°è
½Ä¿åºÎÁø, ¸Å¿ì ÀÚÁÖ ±¸¿ª, ±¸Åä, ¼³»ç, ±¸³»¿°(°í¿ë·®), µå¹°°Ô À§Àå¿°, ±¸³»¿°(»ó¿ë·®) µîÀÌ ³ªÅ¸³ª´Â °æ¿ì°¡ ÀÖÀ¸¹Ç·Î Áõ»ó¿¡ µû¶ó °¨·® ¶Ç´Â ÈÞ¾àÇÑ´Ù.
±¸¿ª, ±¸Åä¿Í °°Àº ÀÌ»ó¹ÝÀÀÀÌ ÀÌ ¾àÀ» »ó¿ë·®À¸·Î °æ±¸Åõ¿© ¹ÞÀº ȯÀÚÀÇ 30%±îÁö¿¡¼ º¸°íµÇ¾ú´Ù.
3) °£ ¹× ´ãµµ°è
°£±â´É°Ë»ç ÀÌ»ó(Æ®·£½º¾Æ¹Ì³ªÁ¦ »ó½Â)¿¡¼ºÎÅÍ °£¿°, Ȳ´Þ°ú °°Àº ÀÓ»óÁõ»óÀ» ³ªÅ¸³»´Â °£Àå¾Ö°¡ ¹ß»ýÇÒ ¼ö ÀÖÀ¸¹Ç·Î Áõ»ó¿¡ µû¶ó °¨·® ¶Ç´Â ÈÞ¾àÇÑ´Ù.
4) ÇǺÎ
ÇǺΰú¹Î¹ÝÀÀ, Ç÷°ü¿°, ¸Å¿ì ÀÚÁÖ Å»¸ð(°í¿ë·®), ÀÚÁÖ Å»¸ð(»ó¿ë·®), ¶§¶§·Î °¡·Á¿ò, µå¹°°Ô ¹Ý±¸Áø¼º¹ßÁø µîÀÌ ³ªÅ¸³ª´Â °æ¿ì°¡ ÀÖÀ¸¹Ç·Î Áõ»ó¿¡ µû¶ó °¨·® ¶Ç´Â ÈÞ¾àÇÑ´Ù.
5) È£Èí±â°è
µå¹°°Ô °£Áú¼ºÆó·Å, Æó¼¶À¯Áõ(Ä¡¸íÀûÀÎ »ç·Ê Æ÷ÇÔ)ÀÌ ³ªÅ¸³ª´Â °æ¿ì°¡ ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
6) ¸é¿ª°è
ÀÌ ¾àÀÇ ÃÊȸ ¶Ç´Â ±× ´ÙÀ½ Åõ¿© ÈÄ ¶§¶§·Î µÎµå·¯±â, ºÎÁ¾, ÇǺιßÁø ¹× ¾Æ³ªÇʶô½Ã ¼ï µîÀÇ ¾Ë·¹¸£±â ¹ÝÀÀÀÌ º¸°íµÇ¾úÀ¸¸ç, ÀÌ·¯ÇÑ Áõ»óµé°ú °ü·ÃµÇ¾î µå¹°°Ô ½ÉÁ¤Áö°¡ º¸°íµÇ¾ú´Ù. ÀÌ·¯ÇÑ °ú¹Î¹ÝÀÀÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
¶§¶§·Î °¨¿°À¯¹ßÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Áõ»ó¿¡ µû¶ó °¨·® ¶Ç´Â ÈÞ¾àÇÑ´Ù.
7) ½ÅÀå
½ÅÀå¾Ö°¡ ÀÖ´Â °ñ¼öÁ¾ ȯÀÚ¿¡°Ô Åõ¿© ½Ã Ä¡·á Ãʱâ´Ü°è¿¡¼ ÀϽÃÀûÀÎ Ç÷Áß ¿ä¼ÒÀÇ À¯ÀÇÀûÀÎ »ó½ÂÀÌ ÀÚÁÖ °üÂûµÇ¾ú´Ù.
8) ÀǾàǰ ½ÃÆÇ ÈÄ ÀÌ»ó»ç·Ê º¸°íÀÚ·á(1989-2018³â12¿ù)¸¦ Åä´ë·Î ½Ç¸¶¸®Á¤º¸ ºÐ¼®¡¤Æò°¡ °á°ú »õ·Î È®ÀÎµÈ ÀÌ»ó»ç·Ê´Â ´ÙÀ½°ú °°´Ù. ´Ù¸¸, À̷μ °ð ÇØ´ç¼ººÐ°ú ´ÙÀ½ÀÇ ÀÌ»ó»ç·Ê °£¿¡ Àΰú°ü°è°¡ ÀÔÁõµÈ °ÍÀ» ÀǹÌÇÏ´Â °ÍÀº ¾Æ´Ï´Ù.
⦁ °¨¿°-ÆÐÇ÷Áõ
|
| »óÈ£ÀÛ¿ë |
1) ³¯¸®µñ½º»ê°ú ÀÌ ¾à °í¿ë·®ÀÇ Á¤¸ÆÅõ¿©·Î ¼Ò¾Æ¿¡¼ ÃâÇ÷¼º ¼ÒÀå°áÀå¿°À¸·Î ÀÎÇÑ »ç¸Á·Ê°¡ º¸°íµÇ¾úÀ¸¹Ç·Î ÀÌ ¾àÀ» ³¯¸®µñ½º»ê°ú µ¿½Ã Åõ¿©ÇÏ´Â °ÍÀº ÇÇÇØ¾ß ÇÑ´Ù.
2) ÀÌ ¾à °í¿ë·®°ú »çÀÌŬ·Î½ºÆ÷¸°ÀÇ º´¿ëÀº ½Å±â´ÉÀå¾Ö¸¦ ÀÏÀ¸Å°¸ç ¸Å¿ì À§ÇèÇÒ ¼ö ÀÖ´Ù. ÀÌ ¾à °í¿ë·®À» Á¤¸ÆÅõ¿©Çϰí, À̽Ĵë¼÷ÁÖº´(graft-versus-host disease)ÀÇ ¿¹¹æÀ» À§ÇØ »çÀÌŬ·Î½ºÆ÷¸°À» ¿¬¼ÓÇÏ¿© Åõ¿©ÇÑ Á¶Ç÷¸ð¼¼Æ÷ÀÌ½Ä È¯Àڵ鿡¼ ½ÅÀå¾Ö°¡ ³ªÅ¸³µ´Ù.
3) ¸é¿ª¼Õ»ó ȯÀÚ¿¡°Ô »ý¹é½Å ¿¹¹æÁ¢Á¾Àº °¨¿°À» ÀÏÀ¸Å³ °¡´É¼ºÀÌ ÀÖÀ¸¹Ç·Î ±ÇÀåµÇÁö ¾Ê´Â´Ù.
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
(ÀӽŠ1±â Åõ¿© ±Ý±â )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Melphalan¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Alkylating agents work by three different mechanisms: 1) attachment of alkyl groups to DNA bases, resulting in the DNA being fragmented by repair enzymes in their attempts to replace the alkylated bases, preventing DNA synthesis and RNA transcription from the affected DNA, 2) DNA damage via the formation of cross-links (bonds between atoms in the DNA) which prevents DNA from being separated for synthesis or transcription, and 3) the induction of mispairing of the nucleotides leading to mutations.
|
| Pharmacology |
Melphalan¿¡ ´ëÇÑ Pharmacology Á¤º¸ Melphalan is an antineoplastic in the class of alkylating agents and is used to treat various forms of cancer. Alkylating agents are so named because of their ability to add alkyl groups to many electronegative groups under conditions present in cells. They stop tumor growth by cross-linking guanine bases in DNA double-helix strands - directly attacking DNA. This makes the strands unable to uncoil and separate. As this is necessary in DNA replication, the cells can no longer divide. In addition, these drugs add methyl or other alkyl groups onto molecules where they do not belong which in turn inhibits their correct utilization by base pairing and causes a miscoding of DNA. Alkylating agents are cell cycle-nonspecific. Alkylating agents work by three different mechanisms all of which achieve the same end result - disruption of DNA function and cell death.
|
| Metabolism |
Melphalan¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Melphalan¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Moderate to high (60 to 90%), primarily to albumin and alpha 1-acid glycoprotein, while 30% is irreversibly bound to plasma proteins.
|
| Half-life |
Melphalan¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 1.5 (¡¾0.83) hours
|
| Absorption |
Melphalan¿¡ ´ëÇÑ Absorption Á¤º¸ Incomplete, variable, 25-89% post oral dose
|
| Pharmacokinetics |
MelphalanÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ :
ºÒ±ÔÄ¢ÀûÀÎ Èí¼ö : À½½Ä¹°ÀÌ Èí¼ö ¹æÇØ
»ýü³»ÀÌ¿ë·ü : 58-85 %
- ºÐÆ÷ : Vd : 0.5-0.6 L/kg
- ¹Ý°¨±â : 90½Ã°£ (38-108 ºÐ)
- ´ë»ç : ÀÚ°¡ ºÐÇØµÊ
- ¼Ò½Ç : ´¢¹è¼³ (¹Ìº¯Èü 10-15 %), ´ëº¯¹è¼³ (20-50 %)
- ÃÖ°í Ç÷Áß³óµµ µµ´Þ : °æ±¸ : 2½Ã°£ À̳»
|
| Biotransformation |
Melphalan¿¡ ´ëÇÑ Biotransformation Á¤º¸ Melphalan is not actively metabolised, it spontaneously degrades to mono and dihydroxy products.
|
| Toxicity |
Melphalan¿¡ ´ëÇÑ Toxicity Á¤º¸ Vomiting, ulceration of the mouth, diarrhea, and hemorrhage of the gastrointestinal tract; The principal toxic effect is bone marrow suppression. LD50=11.2 mg/kg (orally in rat)
|
| Drug Interactions |
Melphalan¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Cyclosporine Melphalan increases toxicity of cyclosporine
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Melphalan¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take on an empty stomach. Food decreases bioavailabilty. Increase liquid intake.
|
| Drug Target |
[Drug Target]
|
| Description |
Melphalan¿¡ ´ëÇÑ Description Á¤º¸ An alkylating nitrogen mustard that is used as an antineoplastic in the form of the levo isomer - melphalan, the racemic mixture - merphalan, and the dextro isomer - medphalan; toxic to bone marrow, but little vesicant action; potential carcinogen. [PubChem]
|
| Dosage Form |
Melphalan¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Tablet Oral
|
| Drug Category |
Melphalan¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antineoplastic Agents, AlkylatingMyeloablative Agonists
|
| Smiles String Canonical |
Melphalan¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ NC(CC1=CC=C(C=C1)N(CCCl)CCCl)C(O)=O
|
| Smiles String Isomeric |
Melphalan¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ N[C@H](CC1=CC=C(C=C1)N(CCCl)CCCl)C(O)=O
|
| InChI Identifier |
Melphalan¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19)/f/h18H
|
| Chemical IUPAC Name |
Melphalan¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid
|
| Drug-Induced Toxicity Related Proteins |
MELPHALAN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:NF-kappaB Drug:melphalan Toxicity:expose P815 tumor cells to oxidative stress . [¹Ù·Î°¡±â] Replated Protein:IkappaB kinase complex-associated protein Drug:melphalan Toxicity:expose P815 tumor cells to oxidative stress . [¹Ù·Î°¡±â] Replated Protein:T-lymphocyte activation antigen CD80 Drug:melphalan Toxicity:expose P815 tumor cells to oxidative stress . [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-11-03
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ¡Ã4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. MELPHALAN[GGT Increase][Composite Activity](Score) NA(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGOT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGPT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[LDH Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[GGT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|