|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
626200050
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö ¶Ç´Â °ÅÀÇ ¹é»öÀÇ Å¸¿øÇü (Æ÷źÇü) ÁúÁÂÁ¦ÀÓ. (ÇÑÂʸéÀº ÆòÆòÇϰí ÇÔ¸ôµÊ) [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
12°³ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 200¹Ð¸®±×·¥ |
12 °³ |
PTP |
8806262000503 |
8806262000510 |
25¡ÉÀÌÇϺ¸°ü |
|
| ÁÖ¼ººÐÄÚµå |
218504CSP
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ÇÁ·Î°Ô½ºÅ×·Ð °áÇÌ¿¡ ÀÇÇÑ Àå¾Ö: ¿ù°æÀü ÁõÈıº
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¿ù°æÁÖ±â Á¦ 14ÀϺÎÅÍ Á¦26ÀϱîÁö Àú³á¿¡ 1°³¸¦ Áú³» ±í¼÷ÀÌ »ðÀÔÇÑ´Ù.
|
| ±Ý±â |
1) ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ ´ëÇÑ °ú¹ÎÁõ ¹× ƯÀÌüÁúȯÀÚ
2) ÁßÁõ °£±â´É Àå¾Ö ȯÀÚ
3) °£Á¾¾ç, ´ãÁó¿ïü¼º Ȳ´Þ ȯÀÚ
4) Áø´ÜµÇÁö ¾ÊÀº ºñÁ¤»óÀûÀÎ »ý½Ä±â ÃâÇ÷ ȯÀÚ
5) ±âÁö ¶Ç´Â ÀǽɵǴ À¯¹æ¾Ï ¶Ç´Â »ý½Ä±âÀÇ ¾Ç¼ºÁ¾¾ç
6) °è·ùÀ¯»ê ¶Ç´Â ºÒ¿ÏÀüÀ¯»ê ȯÀÚ
7) Ç÷Àü¼º Á¤¸Æ¿°, Ç÷Àü»öÀüÁõ, ³úÇ÷°ü¼º Áúȯ, Æó»öÀüÁõ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
8) µÎºó-Á¸½¼ ÁõÈıº(Dubin-Johnsonsyndrome) ¶Ç´Â ·ÎÅÍ ÁõÈıº(Roter syndrome)ȯÀÚ
9) Àú¼º¼±ÀÚ±ØÈ£¸£¸ó¼º ¹«¿ù°æ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ±â¸é ¹× Çö±âÁõÀº ƯÈ÷ ¿¡½ºÆ®·Î°Õ ¼öÄ¡°¡ ³·Àº °æ¿ì¿¡ ¼ö¹ÝµÈ´Ù. ÀÌ·¯ÇÑÇö»óÀº ¿ë·®À» ÁÙÀ̰ųª Á¤»óÀûÀÎ ¿¡½ºÆ®·Î°Õ ¼öÄ¡·Î º¹±ÍÇÏ´Â °æ¿ì, Ä¡·áÇÐÀû À¯Àͼº°ú´Â ¹«°üÇÏ°Ô Áï°¢ÀûÀ¸·Î»ç¶óÁø´Ù.
2) Áֱ⠻ó ³Ê¹« À̸¥ ½Ã±â, ƯÈ÷ ÁÖ±â15Àϰ Àü¿¡ óġ¸¦ ½ÃÀÛÇÑ °æ¿ì, ÁֱⰡ ´ÜÃàµÇ°Å³ª µ¹¹ß¼º ÃâÇ÷ÀÌ ¹ß»ýÇÒ ¼ö ÀÖ´Ù.
3) ÀϹÝÀûÀ¸·Î ȲüȰ¼º¾à¹°À» »ç¿ëÇÏ´Â °æ¿ì, ¿ù°æÁֱ⠺¯È, ¹«¿ù°æ, µ¹¹ß¼º ÃâÇ÷ÀÌ ¹ß»ýÇÒ ¼ö ÀÖ´Ù.
4) °æ±¸Åõ¿©½Ã ¹ß»ýÇÒ ¼ö ÀÖ´Â ÀϹÝÀûÀÎ ºÎÀÛ¿ë, ƯÈ÷ Á¹À½ ¶Ç´Â Çö±âÁõÀº ±ÇÀåµÈ¿ë·®ÀÌ Áú³» Åõ¿©µÈ ÀÓ»ó½ÃÇè Áß¿¡´Â °ÅÀÇ °üÂûµÇÁö ¾Ê¾Ò´Ù. ¸¸¾à ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì, Ãëħ Àü¿¡ Åõ¿©ÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) °£ È¿¼Ò À¯µµ ¾à¹°µé(¹Ù¸£ºñÅ»°è ¾à¹°, Ä«¸£¹Ù¸¶Á¦ÇÉ, È÷´ÜÅäÀÎ, ¸ÞÇÁ·Î¹Ù¸ÞÀÌÆ®, Æä´ÒºÎŸÁ¸µî)Àº ÇÁ·Î°Ô½ºÅ×·ÐÀÇ ´ë»ç¸¦ ÃËÁø½ÃŰ¹Ç·Î ÀÌ ¾àÀÇ È¿°ú°¡ °¨¼ÒÇÒ ¼ö ÀÖ´Ù.
2) ¾ÏÇǽǸ°, Åׯ®¶ó»çÀÌŬ¸°, ±×¸®¼¼¿ÀÇ®ºóµî Ç×»ý¹°ÁúÀÇ º´¿ëÀº Àå³» ¼¼±ÕÃÑÀÇ º¯È¸¦ °¡Á®¿Í ÀÌ ¾àÀÇ È¿°ú¸¦ °¨¼Ò½ÃŲ´Ù.
3) ÀÌ ¾àÀº »çÀÌŬ·Î½ºÆ÷¸° ¹× Å׿ÀÇʸ°°ú °°Àº ¾à¹°ÀÇ ¾à¸®Àû ¹× µ¶¹°ÇÐÀû È¿´ÉÀ» Áõ°¡½Ãų ¼ö ÀÖ´Ù.
4) °úµµÇÑ Èí¿¬¿¡ ÀÇÇÏ¿© ÀÌ ¾àÀÇ »ýü ÀÌ¿ëÀ²ÀÌ °¨¼ÒÇÒ ¼ö ÀÖÀ¸¸ç ¾ËÄÝ ³²¿ë¿¡ ÀÇÇÏ¿© »ýüÀÌ¿ëÀ²ÀÌ Áõ°¡ÇÒ ¼ö ÀÖ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[ÁÂÁ¦] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Progesterone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Binds to the progesterone and estrogen receptors. Target cells include the female reproductive tract, the mammary gland, the hypothalamus, and the pituitary. Once bound to the receptor, progestins like Progesterone will slow the frequency of release of gonadotropin releasing hormone (GnRH) from the hypothalamus and blunt the pre-ovulatory LH (luteinizing hormone) surge.
|
| Pharmacology |
Progesterone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Progesterone is a progestin or a synthetic form of the naturally occurring female sex hormone, progesterone. In a woman's normal menstrual cycle, an egg matures and is released from the ovaries (ovulation). The ovary then produces progesterone, preventing the release of further eggs and priming the lining of the womb for a possible pregnancy. If pregnancy occurs, progesterone levels in the body remain high, maintaining the womb lining. If pregnancy does not occur, progesterone levels in the body fall, resulting in a menstrual period. Progesterone tricks the body processes into thinking that ovulation has already occurred, by maintaining high levels of the synthetic progesterone. This prevents the release of eggs from the ovaries.
|
| Metabolism |
Progesterone¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2C19 (CYP2C19)Cytochrome P450 11A1 (CYP11A1)Nucleoside kinase
|
| Absorption |
Progesterone¿¡ ´ëÇÑ Absorption Á¤º¸ Progesterone absorption is prolonged with an absorption half-life of approximately 25-50 hours.
|
| Toxicity |
Progesterone¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Progesterone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸] Progesterone¿¡ ´ëÇÑ P450 table
SUBSTRATES
CYP 2C19
Proton Pump Inhibitors:
omeprazole
lansoprazole
pantoprazole
rabeprazole
Anti-epileptics:
diazepam
phenytoin
phenobarbitone
amitriptyline
clomipramine
clopidogrel
cyclophosphamide
**progesterone**
INHIBITORS
CYP 2C19
fluoxetine
fluvoxamine
ketoconazole
lansoprazole
omeprazole
ticlopidine
INDUCERS
CYP 2C19
N/A
|
| Food Interaction |
Progesterone¿¡ ´ëÇÑ Food Interaction Á¤º¸ Avoid alcohol.Take with food.Avoid excessive quantities of coffee or tea (Caffeine).Increase dietary intake of magnesium, folate, vitamin B6, B12, and/or consider taking a multivitamin.Take at the same time everyday.
|
| Drug Target |
[Drug Target]
|
| Description |
Progesterone¿¡ ´ëÇÑ Description Á¤º¸ The major progestational steroid that is secreted primarily by the corpus luteum and the placenta. Progesterone acts on the uterus, the mammary glands and the brain. It is required in embryo implantation; pregnancy maintenance, and the development of mammary tissue for milk production. Progesterone, converted from pregnenolone, also serves as an intermediate in the biosynthesis of gonadal steroid hormones and adrenal corticosteroids. [PubChem]
|
| Dosage Form |
Progesterone¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralGel IntravaginalLiquid Intramuscular
|
| Drug Category |
Progesterone¿¡ ´ëÇÑ Drug_Category Á¤º¸ ContraceptivesProgestins
|
| Smiles String Canonical |
Progesterone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(=O)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C
|
| Smiles String Isomeric |
Progesterone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C
|
| InChI Identifier |
Progesterone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1
|
| Chemical IUPAC Name |
Progesterone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
|
| Drug-Induced Toxicity Related Proteins |
PROGESTERONE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Mitogen-activated protein kinase Drug:progesterone Toxicity:progesterone-induced oocyte maturation . [¹Ù·Î°¡±â] Replated Protein:Angiotensinogen Drug:progesterone Toxicity:rogesterone-induced luteinizing hormone surge. [¹Ù·Î°¡±â] Replated Protein:Retinol-binding protein, cellular Drug:progesterone Toxicity:increase luteal cell progesterone accumulation. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-01-20
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|