| |
|
|
|
|
|
 |
| |
|
·¹Ä«½Å¾×(¿°»ê¸®µµÄ«ÀÎ) LECASIN VIAL.[Lidocaine Hydrochloride]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
Àü¹®/ÀÏ¹Ý |
Àü¹®
|
|
Á¦Á¶È¸»ç |
(ÁÖ)Çѱ¹ÆÄ¸¶
|
ÆÇ¸Åȸ»ç |
(ÁÖ)Çѱ¹È£³Ø½º
|
Çã°¡Á¤º¸ |
ÃëÇÏ
(2020.02.19)
|
BIT ¾àÈ¿ºÐ·ù |
±¹¼Ò¸¶ÃëÁ¦ (Local Anesthetics)
|
º¹ÁöºÎºÐ·ù |
121[±¹¼Ò¸¶ÃëÁ¦ ] |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå |
653000450[A12650071] \0 ¿ø/1ml(2016.10.01)(ÇöÀç¾à°¡)\25 ¿ø/1ml(2014.02.01) (º¯°æÀü¾à°¡)
|
|
|
ATCÄÚµå |
Lidocaine / R02AD02 |
NDCÄÚµå |
[Proprietary Name Search _ ƯÇãµî·Ï¸í,»óÇ¥¸íÀ¸·Î °Ë»ö]
[Active Ingredient Search _ ÁÖ¼ººÐÀ¸·Î °Ë»ö]
[NDC Number Search _ NDCÄÚµå·Î °Ë»ö]
|
¼ººÐ / ÇÔ·® |
[½ÉÆò¿ø ÁÖ¼ººÐÄÚµå ±âÁØ ¼ººÐÇÔ·®Á¤º¸ Á¶È¸]

|
÷°¡Á¦ |
º£Å¸µ¦½º,
½ºÅ׺ñ¿À»çÀ̵å,
½ÃÆ®¸£»ê³ªÆ®·ý¼öȹ°,
¿¡Åº¿Ã,
À̼ºÈ´ç,
Á¤Á¦¼ö,
ÆÄ¶ó¿Á½Ãº¥Á¶»ê¸ÞÆ¿,
ÆÄ¶ó¿Á½Ãº¥Á¶»êÇÁ·ÎÇÊ,
ÆÄÀξÖÇÃÇâ,
È÷ÇÁ·Î¸á·Î¿À½º2910
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
653000450[A12650071]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2016.10.01)(ÇöÀç¾à°¡)
\25 ¿ø/1ml(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»öÅõ¸íÇÑ ¾×Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
100ml
|
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 100¹Ð¸®¸®ÅÍ |
1 °³ |
º´ |
8806530004509 |
8806530004516 |
|
|
| ÁÖ¼ººÐÄÚµå |
183902CLQ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. À̺ñÀÎÈİú ¿µ¿ª : ±¸°¤ýÀεΠÁ¡¸·ÀÇ ÀÚ±Ø, ¿°Áõ½Ã ±¹¼Ò¸¶Ãë
2. Ä¡°ú ¿µ¿ª : X-¼± ÃÔ¿µ ¶Ç´Â Ä¡°ú Àλó(dental impressions)½ÃÀÇ ±¸¿ª ¾ïÁ¦
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : °Ç°ÇÑ ¼ºÀο¡ ´ëÇÑ Ãßõ 1ȸ ÃÖ´ë¿ë·®Àº ¸®µµÄ«Àο°»ê¿°À¸·Î¼ üÁß §¸´ç 4.5§·À» ÃʰúÇÏÁö ¾ÊÀ¸¸ç ¾î¶°ÇÑ °æ¿ì¿¡µµ ÃÑ Åõ¿©·®Àº ¸®µµÄ«Àο°»ê¿°À¸·Î¼ 300§·(ÀÌ ¾àÀ¸·Î¼ 15§¢)À» ÃʰúÇÏÁö ¾Ê´Â´Ù. ±¸°¤ýÀεΠÁ¡¸·ÀÇ ÀÚ±Ø, ¿°Áõ½ÃÀÇ ´ëÁõ¿ä¹ýÀ¸·Î´Â ¸®µµÄ«Àο°»ê¿°À¸·Î¼ 300§·(ÀÌ ¾àÀ¸·Î¼ 15§¢)À» Åõ¿©ÇÑ´Ù. ±¸° »ç¿ë½Ã¿¡´Â ÀÌ ¾àÀ» ¸Ó±ÝÀº ÈÄ ¹ñÀ¸¸ç ÀÎÈÄ »ç¿ë½Ã¿¡´Â ÀÌ ¾àÀ» ¸Ó±ÝÀº ÈÄ ¿¬ÇϽÃų ¼ö ÀÖ´Ù. 3½Ã°£ À̳»¿¡ Àç»ç¿ëÇÏÁö ¾ÊÀ¸¸ç 24½Ã°£ À̳»¿¡ 8ȸ ÀÌ»ó »ç¿ëÇÏÁö ¾Ê´Â´Ù.
¿¬·É, ¸¶Ã뿵¿ª, ºÎÀ§, Á¶Á÷, Áõ»ó, üÁú, Àü½Å»óÅ¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
ÀÌ ¾à ¶Ç´Â ±âŸÀÇ ¾Æ¹Ìµå°è ±¹¼Ò¸¶ÃëÁ¦¿¡ °ú¹ÎÁõ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
Àû¿ëºÎÀ§¿¡ Á¡¸·ÀÇ ¿Ü»ó ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ¼ï : ¼ïÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇϰí Ç÷¾ÐÀúÇÏ, ¾È¸éâ¹é, ¸Æ¹ÚÀÇ ÀÌ»ó, È£Èí¾ïÁ¦ µîÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Áï½Ã Åõ¿©ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
2) ÁßÃ߽Űæ°è
¨ç ÁøÀü, °æ·Ã µîÀÇ Áßµ¶ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇϰí ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Áï½Ã Åõ¿©¸¦ ÁßÁöÇÏ°í µð¾ÆÁ¦ÆÊ ¶Ç´Â Ãʴܽð£Çü ¹Ù¸£ºñÅ»»ê Á¦Á¦(Ä¡¿ÀÆæÅ»³ªÆ®·ý) Åõ¿© µî ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
¨è Á¹À½, ºÒ¾È, ÈïºÐ, ¹«½Ã, ¾îÁö·¯¿ò, ±¸¿ª¤ý±¸Åä, °æ¹ÌÇÑ µÎÅë, ½Å°æ°ú¹Î, ´ÙÇàÁõ, Âø¶õ, À̸í, ¿°¨, ³Ã°¨, ¹«°¨°¢, ¿¬Ãà, ¹«ÀǽÄ, È£Èí¾ïÁ¦, È£ÈíÁ¤Áö µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ¿© ¼ï ¶Ç´Â Áßµ¶ÇÑ Áõ»óÀ¸·Î ÀÌÇàÇÏ´Â °Í¿¡ ÁÖÀÇÇϰí Çʿ信 µû¶ó ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
3) ½ÉÇ÷°ü°è : ¼¸Æ, ÀúÇ÷¾Ð, ¼øÈ¯ÇãÅ»ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç ½ÉÁ¤Áö·Î ÀÌÇàµÉ ¼ö ÀÖ´Ù.
4) ÇǺΠ: ÇǺÎÁ¶Á÷Àå¾Ö, µÎµå·¯±â, ºÎÁ¾, ¾Æ³ªÇʶô½Ã¾ç ¹ÝÀÀ, ¾Ë·¯Áö ¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
(lidocaine topical )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Lidocaine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Lidocaine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Lidocaine stabilizes the neuronal membrane by inhibiting the ionic fluxes required for the initiation and conduction of impulses thereby effecting local anesthetic action.
|
| Pharmacology |
Lidocaine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Lidocaine is an anesthetic agent indicated for production of local or regional anesthesia and in the treatment of ventricular tachycardia occurring during cardiac manipulation, such as surgery or catheterization, or which may occur during acute myocardial infarction, digitalis toxicity, or other cardiac diseases. The mode of action of the antiarrhythmic effect of Lidocaine appears to be similar to that of procaine, procainamide and quinidine. Ventricular excitability is depressed and the stimulation threshold of the ventricle is increased during diastole. The sinoatrial node is, however, unaffected. In contrast to the latter 3 drugs, Lidocaine in therapeutic doses does not produce a significant decrease in arterial pressure or in cardiac contractile force. In larger doses, lidocaine may produce circulatory depression, but the magnitude of the change is less than that found with comparable doses of procainamide.
|
| Metabolism |
Lidocaine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 1A2 (CYP1A2)Cytochrome P450 2D6 (CYP2D6)
|
| Protein Binding |
Lidocaine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 60-80%
|
| Half-life |
Lidocaine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 109 minutes
|
| Absorption |
Lidocaine¿¡ ´ëÇÑ Absorption Á¤º¸ Information derived from diverse formulations, concentrations and usages reveals that lidocaine is completely absorbed following parenteral administration, its rate of absorption depending, for example, upon various factors such as the site of administration and the presence or absence of a vasoconstrictor agent.
|
| Pharmacokinetics |
Lidocaine HydrochlorideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- È¿°ú¹ßÇö½Ã°£ (1ȸ bolus ¿ë·®À¸·Î¼) : 45-90ÃÊ
- ÀÛ¿ëÁö¼Ó½Ã°£ : 10-25ºÐ
- ºÐÆ÷ (Vd) : ¸¹Àº ¿äÀο¡ µû¶ó º¯ÈµÇ¸ç, ¿ïÇ÷¼º ½ÉºÎÀü°ú °£Áúȯ¿¡¼´Â ºÐÆ÷¿ëÀûÀÌ °¨¼ÒµÊ
- ´Ü¹é°áÇÕ : 60-80%, ¥á1-acid glycoprotein°ú °áÇÕ
- ´ë»ç : °£¿¡¼ 90% ´ë»ç
- Ȱ¼ºÇü ´ë»çüÀÎ monoethylglycinexylidide(MEGX)¿Í glycinexylidide(GX)°¡ ÃàÀûµÇ¾î ÁßÃ߽Űæ°è µ¶¼ºÀ» À¯¹ßÇÒ ¼ö ÀÖ´Ù.
- ¹Ý°¨±â (biphasic) : ¿ïÇ÷¼º ½ÉºÎÀü, °£Áúȯ, ¼îÅ©, ÁßÁõÀÇ ½ÅÁúȯ¿¡¼ Áõ°¡
- Ãʱâ : 7-30ºÐ
- ¸»±â : ¿µ¾Æ, ¹Ì¼÷¾Æ : 3.2½Ã°£, ¼ºÀÎ : 1.5-2½Ã°£
|
| Biotransformation |
Lidocaine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Primarily hepatic.
|
| Toxicity |
Lidocaine¿¡ ´ëÇÑ Toxicity Á¤º¸ The oral LD 50 of lidocaine HCl in non-fasted female rats is 459 (346-773) mg/kg (as the salt) and 214 (159-324) mg/kg (as the salt) in fasted female rats. Symptoms of overdose include convulsions, hypoxia, acidosis, bradycardia, arrhythmias and cardiac arrest.
|
| Drug Interactions |
Lidocaine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Lidocaine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Lidocaine¿¡ ´ëÇÑ Description Á¤º¸ A local anesthetic and cardiac depressant used as an antiarrhythmia agent. Its actions are more intense and its effects more prolonged than those of procaine but its duration of action is shorter than that of bupivacaine or prilocaine. [PubChem]
|
| Dosage Form |
Lidocaine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Aerosol TopicalAerosol, metered TopicalCream TopicalGel TopicalJelly TopicalJelly UrethralLiquid BuccalLiquid DentalLiquid InfiltrationLiquid IntravenousLiquid OralLiquid TopicalLotion TopicalOintment TopicalSolution InfiltrationSolution IntramuscularSolution IntravenousSolution OralSolution TopicalSpray TopicalSwab Topical
|
| Drug Category |
Lidocaine¿¡ ´ëÇÑ Drug_Category Á¤º¸ AnestheticsAnesthetics, LocalAnti-Arrhythmia AgentsAntiarrhythmic Agents
|
| Smiles String Canonical |
Lidocaine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCN(CC)CC(=O)NC1=C(C)C=CC=C1C
|
| Smiles String Isomeric |
Lidocaine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN(CC)CC(=O)NC1=C(C)C=CC=C1C
|
| InChI Identifier |
Lidocaine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17)/f/h15H
|
| Chemical IUPAC Name |
Lidocaine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-diethylamino-N-(2,6-dimethylphenyl)acetamide
|
| Drug-Induced Toxicity Related Proteins |
DOCA ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Aquaporin-2 Drug:DOCA Toxicity:hypertension. [¹Ù·Î°¡±â] LIDOCAINE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:glucose-regulated protein Drug:lidocaine Toxicity:intestinal disorder. [¹Ù·Î°¡±â] Replated Protein:Alkaline phosphatase Drug:lidocaine Toxicity:lidocaine induced hepatitis. [¹Ù·Î°¡±â] Replated Protein:C-reactive protein Drug:lidocaine Toxicity:fever. [¹Ù·Î°¡±â] Replated Protein:C-reactive protein Drug:lidocaine Toxicity:lidocaine induced hepatitis. [¹Ù·Î°¡±â] Replated Protein:Alpha-1-acid glycoprotein Drug:lidocaine Toxicity:lidocaine tolerance. [¹Ù·Î°¡±â] Replated Protein:Gamma-glutamyltranspeptidase Drug:lidocaine Toxicity:fever. [¹Ù·Î°¡±â] Replated Protein:Alkaline phosphatase Drug:lidocaine Toxicity:fever. [¹Ù·Î°¡±â] Replated Protein:Gamma-glutamyltranspeptidase Drug:lidocaine Toxicity:lidocaine induced hepatitis. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-09-30
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|