| |
|
|
|
|
|
 |
| |
|
엘트릭스정 L-TRIX TABS.[Levothyroxine Sodium , Liothyronine Sodium]
|
|
전문의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
653701030[A11800951]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1정(2018.03.01)(현재약가)
\40 원/1정(2017.02.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
백색의 원형정제 [제형정보 확인] |
| 포장·유통단위 |
1000TABS |
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 0.05밀리그램 |
1000 정 |
병 |
8806537010305 |
8806537010329 |
|
| 0.05밀리그램 |
30 정 |
병 |
8806537010305 |
8806537010312 |
|
|
| 주성분코드 |
296800ATB
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
1. 갑상선기능저하증, 점액부종, 크레틴병
2. 단순성 갑상선종, 아급성 또는 만성 림프구성 갑상선염(하시모토병)
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
성인 : 보통 초회량은 1일 1회 1/2정으로 하며 2-3주 간격으로 1/4정씩 증량한다. 특히 협심증 등 심혈관계 장애가 의심되는 장기간 지속된 점액부종 환자는 1/4정의 낮은 용량으로 투여를 시작하는 것이 권장된다.
유지량은 1일 1회 1-2정으로 한다.
단, 연령 및 증상에 따라 적절히 증감한다.
|
| 금기 |
1) 급성 심근경색, 급성 심근염, 급성 전층 심장염 환자
2) 부신피질부전 환자
3) 갑상선중독증 환자
4) 이 약에 과민증 환자 |
| 신중투여 |
1) 협심증 환자 또는 심질환 잠재 가능성이 큰 노인 환자를 포함한 심혈관계 이상 환자
(투여를 저용량 1/4-1/2정으로 시작한다)
2) 당뇨병 및 요붕증 환자 |
| 이상반응 |
1) 투여중 흉통, 맥박수 증가, 심계항진, 발한 과다, 열에 대한 불내성, 신경질 및 기타 다른 갑상선 호르몬 중독 증상이 나타나면 투여를 중지한다.
2) 과량투여 또는 급격한 용량 증가에 의해 월경이상, 신경과민, 부정맥, 협심증 등의 갑상선기능항진 증상이 나타날 수 있다.
|
| 상호작용 |
1) 갑상선호르몬은 비타민K의존성 응고인자의 이화작용을 증가시키므로 경구용 항응고제를 투여중인 환자는 항응고제의 용량을 감량한다.
2) 갑상선호르몬 요법 초기에는 인슐린 또는 경구용 혈당강하제의 요구량이 증가될 수 있다.
3) 콜레스티라민 또는 콜레스티폴은 장관 내에서 T4 및 T3와 결합하므로 콜레스티라민 또는 이와 유사한 콜레스테롤을 투여할 경우 갑상선호르몬과 4-5시간의 투여 간격을 둔다.
4) 에스트로겐은 혈청 티록신결합글로불린(TBG)을 증가시키므로 에스트로겐 또는 에스트로겐을 함유한 경구피임제를 투여하고 있는 유리형 티록신치의 조절이 불가능한 무기능성 갑상선 환자는 갑상선호르몬 용량을 증가시킬 필요가 있다.
5) 칼슘제제, 세벨라머, 란타늄 등의 인산염과 결합하는 약물을 병용투여시 이 약의 흡수가 지연 또는 감소될 수 있으므로 투여간격에 주의하여 신중히 투여한다.(최소 4시간 간격)
6) 레보티록신과 오르리스타트 동시 복용 시 갑상선 저하증 및/또는 갑상선 저하증 조절 저하가 발생할 수 있다.
7) 비오틴은 비오틴/스트렙타비딘 상호작용을 기반으로 하는 갑상선 면역분석법을 방해하여 검사 결과가 감소하거나 증가할 수 있다.
8) 세인트존스워트가 포함된 제품과 같은 효소 유도 약물은 레보티록신의 간 청소율을 증가시켜 갑상선 호르몬의 혈청 농도를 감소시킬 수 있다. 갑상선 대체 요법을 받는 환자는 이러한 제품을 동시 투여 시 갑상선 호르몬 용량을 늘려야 할 수 있다.
9) 프로톤 펌프 억제제(PPI)와의 병용투여는 갑상선 호르몬의 흡수를 감소시킬 수 있다. 병용 치료 동안 갑상선 기능의 정기적 모니터링 및 임상 모니터링이 권장되며, 갑상선 호르몬의 용량을 늘려야 할 수도 있다. PPI 치료가 끝날 때도 주의를 기울여야 한다. |
| Off-label Usage |
[조회]
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : A등급
(levothyroxine, liothyronine )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Thyroxin에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Levothyroxine에 대한 Mechanism_Of_Action 정보
Levothyroxine acts like the endogenous thyroid hormone thyroxine (T4, a tetra-iodinated tyrosine derivative). In the liver and kidney, T4 is converted to T3, the active metabolite. In order to increase solubility, the thyroid hormones attach to thyroid hormone binding proteins, thyroxin-binding globulin, and thyroxin-binding prealbumin (transthyretin). Transport and binding to thyroid hormone receptors in the cytoplasm and nucleus then takes place. Thus by acting as a replacement for natural thyroxine, symptoms of thyroxine deficiency are relieved.
Liothyronine에 대한 Mechanism_Of_Action 정보
The thyroid hormones, thyroxine (T4) and triiodothyronine (liothyronine or T3), are tyrosine-based hormones produced by the thyroid gland. An important component in the synthesis is iodine. The major form of thyroid hormone in the blood is thyroxine (T4). This is converted to the active liothyronine within cells by deiodinases. liothyronine acts on the body to increase the basal metabolic rate, affect protein synthesis and increase the body's sensitivity to catecholamines (such as adrenaline). The thyroid hormones are essential to proper development and differentiation of all cells of the human body. To various extents they regulate protein, fat and carbohydrate metabolism. But they have their most pronounced effects on how human cells use energetic compounds.
|
| Pharmacology |
Levothyroxine에 대한 Pharmacology 정보
Levothyroxine (T4) is a synthetically prepared levo isomer of thyroxine, the major hormone secreted from the thyroid gland. Thyroxine is released from thyroglobulin by proteolysis and secreted into the blood. Thyroxine is peripherally deiodinated to form triiodothyronine which exerts a broad spectrum of stimulatory effects on cell metabolism. Thyroid hormone increases the metabolic rate of cells of all tissues in the body. In the fetus and newborn, thyroid hormone is important for the growth and development of all tissues including bones and the brain. In adults, thyroid hormone helps to maintain brain function, food metabolism, and body temperature, among other effects. The symptoms of thyroid deficiency relieved by levothyroxine include slow speech, lack of energy, weight gain, hair loss, dry thick skin and unusual sensitivity to cold.
Liothyronine에 대한 Pharmacology 정보
Thyroid hormone drugs are natural or synthetic preparations containing tetraiodothyronine (T4, levothyroxine) or triiodothyronine (T3, liothyronine) or both. T4 and T3 are produced in the human thyroid gland by the iodination and coupling of the amino acid tyrosine. Liothyronine (T3) contains three atoms of iodine and is formed by the coupling of one molecule of diiodotyrosine (DIT) with one molecule of monoiodotyrosine (MIT). These hormones enhance oxygen consumption by most tissues of the body and increase the basal metabolic rate and the metabolism of carbohydrates, lipids and proteins. Thus, they exert a profound influence on every organ system in the body and are of particular importance in the development of the central nervous system.
|
| Metabolism |
Levothyroxine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Levothyroxine에 대한 단백결합 정보
> 99%
Liothyronine에 대한 단백결합 정보
99.7%
|
| Half-life |
Levothyroxine에 대한 반감기 정보
6 to 7 days
Liothyronine에 대한 반감기 정보
2.5 days
|
| Absorption |
Levothyroxine에 대한 Absorption 정보
Bioavailability varies from 48% to 80%. Human studies have confirmed the importance of an intact jejunum and ileum for levothyroxine absorption and have shown some absorption from the duodenum.
Liothyronine에 대한 Absorption 정보
Almost totally absorbed, 95 percent in 4 hours.
|
| Pharmacokinetics |
Levothyroxine Sodium의 약물동력학자료
- T4와 T3 비교
|
갑상선에서 분비되는 비율 |
생물학적 효력 |
단백결합 |
반감기 |
| Levothyroxine (T4) |
20 |
1 |
99.97% |
7일* |
| Liothyronine (T3) |
1 |
4 |
99.70% |
38시간* |
* 갑상선 기능항진증의 경우 반감기가 감소함
|
흡수 |
대사 및 소실 |
작용발현시간 |
작용지속시간 |
| Levothyroxine (T4) |
BA 74-93%
음식물에 의해 감소 |
30%는 탈요오드화
20%는 간대사 후 대변 배설 |
3-5일 |
7-10일 |
| Liothyronine (T3) |
BA >95%
울혈성 심부전 시 감소 |
대부분이 탈요오드화되어 대사체로 뇨배설 |
1-3일 |
3-5일 |
- 작용발현시간 :
- 경구 : 3-5 일
- 정맥주사 : 6-8 시간
- Myxedema coma : 정맥주사 : 6-12 시간
- 갑상선 기능저하증의 완화 : 2-4 주
- 최대효과 발현시간 :
-
갑상선 기능저하증 : 경구 : 4-6 주
myxedema coma : 정맥주사 : 24 시간
- 작용지속시간 : 갑상선 기능저하증 : 수주
- 생체내이용률 : 경구 : 정제 : 50-80 %
- 분포용적 : 8.7-9.7 L
- 대사 :
- 혈중 : 85 % : 50%가 활성형인 T3(triiodothyronine)으로 전환
- 간 : 간경변환자의 경우 T4의 증가와 T3의 감소를 보임
- 반감기 : 5.3-9.5 일(7 일)
- 혈중최고농도 도달시간 : 2-4 시간
- 소실 :
- 뇨와 변으로 배설
- total body clearance : 0.84-1.37 L/day
- 변으로 50% 배설
Liothyronine Sodium의 약물동력학자료
- T4와 T3 비교
|
갑상선에서 분비되는 비율 |
생물학적 효력 |
단백결합 |
반감기 |
| Levothyroxine (T4) |
20 |
1 |
99.97% |
7일* |
| Liothyronine (T3) |
1 |
4 |
99.70% |
38시간* |
* 갑상선 기능항진증의 경우 반감기가 감소함
|
흡수 |
대사 및 소실 |
작용발현시간 |
작용지속시간 |
| Levothyroxine (T4) |
BA 74-93%
음식물에 의해 감소 |
30%는 탈요오드화
20%는 간대사 후 대변 배설 |
3-5일 |
7-10일 |
| Liothyronine (T3) |
BA >95%
울혈성 심부전 시 감소 |
대부분이 탈요오드화되어 대사체로 뇨배설 |
1-3일 |
3-5일 |
- 작용발현시간 :
- 최대약효발현시간 : 2-3 일
- 최대혈중농도도달시간 : 경구 : 1-2 시간
- 생체내이용률 : 85-90 %
- 대사 : 간에서 비활성형으로 대사
- 분포용적 : 41-45 L
- 반감기 : 25 시간
- 소실 : 뇨로 배설
|
| Biotransformation |
Levothyroxine에 대한 Biotransformation 정보
Hepatic (primarily via cytochrome P450 isozyme 3A4).
Liothyronine에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
Levothyroxine에 대한 Toxicity 정보
LD50=20 mg/kg (orally in rat). Hypermetabolic state indistinguishable from thyrotoxicosis of endogenous origin. Symptoms of thyrotoxicosis include weight loss, increased appetite, palpitations, nervousness, diarrhea, abdominal cramps, sweating, tachycardia, increased pulse and blood pressure, cardiac arrhythmias, tremors, insomnia, heat intolerance, fever, and menstrual irregularities.
|
| Drug Interactions |
Levothyroxine에 대한 Drug_Interactions 정보
Anisindione Thyroid hormones increase the anticoagulant effectAcenocoumarol Thyroid hormones increase the anticoagulant effectDicumarol Thyroid hormones increase the anticoagulant effectWarfarin Thyroid hormones increase the anticoagulant effectCalcium Calcium decreases absorption of levothyroxineIron Iron decreases absorption of levothyroxineColestipol The resin decreases the absorption of thyroid hormonesCholestyramine The resin decreases the absorption of thyroid hormonesDigoxin The thyroid hormone decreases the effect of digoxinRaloxifene Raloxifene decreases absorption of levothyroxineSucralfate Sucralfate decreases the effect of levothyroxine
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Levothyroxine에 대한 Food Interaction 정보
No iron within 4 hours of taking this medication.Take 30-60 minutes before breakfast.Consistent administration in relation to meals is recommended.
|
| Drug Target |
[Drug Target]
|
| Description |
Levothyroxine에 대한 Description 정보
The major hormone derived from the thyroid gland. Thyroxine is synthesized via the iodination of tyrosines (monoiodotyrosine) and the coupling of iodotyrosines (diiodotyrosine) in the thyroglobulin. Thyroxine is released from thyroglobulin by proteolysis and secreted into the blood. Thyroxine is peripherally deiodinated to form triiodothyronine which exerts a broad spectrum of stimulatory effects on cell metabolism. [PubChem]
Liothyronine에 대한 Description 정보
A T3 thyroid hormone normally synthesized and secreted by the thyroid gland in much smaller quantities than thyroxine (T4). Most T3 is derived from peripheral monodeiodination of T4 at the 5&
|
| Dosage Form |
Levothyroxine에 대한 Dosage_Form 정보
Powder, for solution IntravenousTablet Oral
Liothyronine에 대한 Dosage_Form 정보
Tablet Oral
|
| Drug Category |
Levothyroxine에 대한 Drug_Category 정보
AnticoagulantsAntithyroid Agents
Liothyronine에 대한 Drug_Category 정보
Hormone Replacement Agents
|
| Smiles String Canonical |
Levothyroxine에 대한 Smiles_String_canonical 정보
NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O
Liothyronine에 대한 Smiles_String_canonical 정보
NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C=C2)C(I)=C1)C(O)=O
|
| Smiles String Isomeric |
Levothyroxine에 대한 Smiles_String_isomeric 정보
N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O
Liothyronine에 대한 Smiles_String_isomeric 정보
N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C=C2)C(I)=C1)C(O)=O
|
| InChI Identifier |
Levothyroxine에 대한 InChI_Identifier 정보
InChI=1/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1/f/h22H
Liothyronine에 대한 InChI_Identifier 정보
InChI=1/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1/f/h21H
|
| Chemical IUPAC Name |
Levothyroxine에 대한 Chemical_IUPAC_Name 정보
(2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid
Liothyronine에 대한 Chemical_IUPAC_Name 정보
(2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-11-03
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
내용보기
