드러그인포 약품요약정보

허가정보

항목

내용

청구코드(KD코드)
비급여점검코드
상한금액

[A12252601] [보험코드에 따른 약품기본정보 직접조회]
\0 원/20ml/병(2007.03.01)(현재약가)
\5,299 원/20ml/병(2003.10.01)(변경전약가)
[상병코드조회]
[질병코드조회]

빠른조회


요약정보	[효능] [용법] [금기] [신중투여] [이상반응]

상세정보	[효능] [용법] [경고] [금기] [신중투여] [이상반응] [일반주의] [상호작용] [임산부] [수유부] [소아] [고령자] [신장애환자] [간장애환자] [적용주의] [과량투여] [임상검사치] [보관] [기타]

제품성상

무색 또는 엷은 황색의 액이 든 갈색의 바이알 [제형정보 확인]

효능효과

[적응증 별 검색]

요추경막외마취(외과수술, 분만진통), 미추경막외마취(외과수술, 분만진통), 말초신경차단

약물음식간 상호작용

[조회]

용법용량

* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.

[처방약어]

이 약의 최대 투여용량은 각 환자의 신체조건 등에 따라 다르며, 다음을 참고로 하여 마취부위, 연령 및 전신상태 등에 따라 투여량을 결정한다.

차단형태	각용량(염산부피바카인 1회 투여량		운동차단
차단형태	㎖	㎎	운동차단
요추경막외 외과수술	10-20	50-100	중등-완전
분만진통	6-12	30-60	중등-완전
미추경막외 외과수술	15-30	75-150	중등-완전
분만진통	10-20	50-100	중등-완전
말초신경차단	30까지	150까지	중등-완전
※ 지속(간헐)요법에서는 반복용량으로 운동차단 정도가 증가한다. 0.5%의 첫 회 반복용량으로 복강내 수술을 할 수 있을 정도의 완전운동차단이 일어날 수 있다.
1. 유효한 마취결과를 유발시키기 위해서는 필요한 최소의 용량을 투여 한다. 2. 염산부피바카인의 1회 최고용량은 150㎎이며 1일 총용량은 400㎎이다. 3. 최고용량한계는 환자의 신체상태, 신장 및 적용주사부위에서의 일반적인 전신흡수율을 확인한 후에 개인별로 다르게 정한다. 4. 경막외 마취시에는 먼저 시험용량을 투여하여 그 영향을 확인하고 나서 나머지 전체용량을 투여 하도록 권장하고 있다. 5. 경막외 투여시 고농축액(0.5%)은 의도하지 않는 맥관내 또는 협막내 주사로 인한 독성발현을 확인하기 위한 용량간 시간을 충분히 가지면서 3㎖에서 5㎖의 단계별 중량으로 투여해야 한다. 6. 혈과 사이(맥관내) 또는 지주막하로 주사되는 것을 예방하기 위해 초회용량과 이후 지속용량 모두 주사 전에 혈액 또는(주사부위)뇌척수액에 대한 흡입을 선행하는 것이 필수적이다.

[BMI지수 계산] [Body Surface Area 계산] [Cockcroft-Gault GFR 계산] [MDRD GFR 계산]

주요약물 상호작용

[조회]

금기

1) 이 약의 성분 또는 기타의 아미드계 국소마취제에 과민증 환자

2) 갑상선중독증 또는 중증의 심질환, 특히 빈맥 환자

3) (경막외마취) 수막염, 회색척수염, 두개내출혈, 악성빈혈로 인한 인대의 아급성 복합변성, 뇌종양, 척수종양 환자

4) (경막외마취) 척추결핵 환자

5) (경막외마취) 요추천자 부위 또는 그 주위에 화농성 감염 환자

6) (경막외마취) 심인성 쇽 또는 혈액량감소성 쇽 환자

7) (경막외마취) 혈액응고장애 또는 항응고제를 투여중인 환자

8) 혈관수축제에 과민증 환자

신중투여

1) 쇠약자, 고령자, 급성 질환 환자

2) 간질환 환자

3) 심혈관계 기능 장애 환자

4) 고혈압, 동맥경화성 심질환, 뇌혈관부전 또는 당뇨병 환자

5) 중증의 복수 환자(중증의 저혈압으로 인하여 출혈 또는 탈수에 의한 혈액량감퇴증, 대동맥-대정맥폐색이 나타날 수 있다.)

이상반응

1) 전신 : 드물게 과량 투여시 또는 비의도적인 맥관내주사와 관련되어 혼수, 경련, 호흡억제 또는 호흡발작, 심혈관계 억제 또는 흥분 등이 나타날 수 있다.

2) 중추신경계 : 혀의 무감각, 몽롱함, 어지러움, 시력불선명 등의 시각장애, 근연축 등의 증상이 나타난 후 졸음, 경련, 무의식, 경우에 따라 호흡정지가 나타날 수 있다.

3) 심혈관계 : 심장 및 심근의 전도계가 억제되어 심박출량 감소, 심블록, 저혈압, 서맥, 때때로 심실성 빈맥, 심실성 세동, 심정지를 포함하는 심실성 부정맥 등이 나타날 수 있다. 이러한 증상은 보통 중추신경계의 주된 부작용인 경련이 나타난 후 또는 경련과 같이 나타나지만 드물게 중추신경계 부작용 없이 심정지가 나타나기도 한다.

4) (경막외마취) 교감신경 차단, 혈관미주신경성 실신, 저혈압, 서맥, 심정지가 나타날 수 있다.

5) 알레르기 : 두드러기, 가려움, 흉안, 혈관 신경성 부종(후두 부종 포함), 빈맥, 콧물, 구역, 구토, 졸음, 실신, 발한, 체온상승, 아나필락시스(중증의 고혈압 포함) 등이 나타날 수 있다.

[주요 이상반응정보]

상호작용

1) 이 약과 국소마취 활성이 있는 부정맥용제(예 : 리도카인)를 병용투여하는 경우, 독성이 증강될 수 있으므로 주의한다.

2) 이 약과 혈압변동을 일으키는 약물(MAO 억제제, 삼환계 항우울약, 페노치아진 등)을 병용투여하는 경우, 중증의 지속성 저혈압 또는 고혈압이 나타날 수 있으므로 주의한다.

3) 클로로포름, 할로탄, 시클로프로판, 트리클로르에칠렌 등의 약물과 병용투여하는 경우, 중증의 부정맥이 나타날 수 있다.

Related FDA Approved Drug

기준 성분:EPINEPHRINE BITARTRATE
BRONITIN MIST (EPINEPHRINE BITARTRATE)
BUPIVACAINE HYDROCHLORIDE AND EPINEPHRINE (BUPIVACAINE HYDROCHLORIDE; EPINEPHRINE BITARTRATE)
BUPIVACAINE HYDROCHLORIDE W/EPINEPHRINE (BUPIVACAINE HYDROCHLORIDE; EPINEPHRINE BITARTRATE)
CITANEST FORTE (EPINEPHRINE BITARTRATE; PRILOCAINE HYDROCHLORIDE)
CITANEST FORTE DENTAL (EPINEPHRINE BITARTRATE; PRILOCAINE HYDROCHLORIDE)
DURANEST (EPINEPHRINE BITARTRATE; ETIDOCAINE HYDROCHLORIDE)
LEVOPHED (NOREPINEPHRINE BITARTRATE)
LIGNOSPAN FORTE (EPINEPHRINE BITARTRATE; LIDOCAINE HYDROCHLORIDE)
LIGNOSPAN STANDARD (EPINEPHRINE BITARTRATE; LIDOCAINE HYDROCHLORIDE)
MARCAINE HYDROCHLORIDE W/ EPINEPHRINE (BUPIVACAINE HYDROCHLORIDE; EPINEPHRINE BITARTRATE)
MARCAINE HYDROCHLORIDE W/ EPINEPHRINE PRESERVATIVE FREE (BUPIVACAINE HYDROCHLORIDE; EPINEPHRINE BITARTRATE)
MEDIHALER-EPI (EPINEPHRINE BITARTRATE)
NOREPINEPHRINE BITARTRATE (NOREPINEPHRINE BITARTRATE)
RAVOCAINE AND NOVOCAIN W/ LEVOPHED (NOREPINEPHRINE BITARTRATE; PROCAINE HYDROCHLORIDE; PROPOXYCAINE HYDROCHLORIDE)
SENSORCAINE (BUPIVACAINE HYDROCHLORIDE; EPINEPHRINE BITARTRATE)
SEPTOCAINE (ARTICAINE HYDROCHLORIDE; EPINEPHRINE BITARTRATE)
기준 성분:BUPIVACAINE HYDROCHLORIDE
BUPIVACAINE (BUPIVACAINE HYDROCHLORIDE)
BUPIVACAINE HYDROCHLORIDE (BUPIVACAINE HYDROCHLORIDE)
BUPIVACAINE HYDROCHLORIDE KIT (BUPIVACAINE HYDROCHLORIDE)
BUPIVACAINE HYDROCHLORIDE PRESERVATIVE FREE (BUPIVACAINE HYDROCHLORIDE)
CHIROCAINE (LEVOBUPIVACAINE HYDROCHLORIDE)
DUOCAINE (BUPIVACAINE HYDROCHLORIDE; LIDOCAINE HYDROCHLORIDE)
MARCAINE (BUPIVACAINE HYDROCHLORIDE)
MARCAINE HYDROCHLORIDE (BUPIVACAINE HYDROCHLORIDE)
MARCAINE HYDROCHLORIDE PRESERVATIVE FREE (BUPIVACAINE HYDROCHLORIDE)

정보요약

드럭인포 의약품 요약/상세정보

코드 및 분류정보

항목	내용
BIT 약효분류	국소마취제 (Local Anesthetics)
ATC 코드	Bupivacaine, combinations / N01BB51 [코드분류상세설명] [ATC코드예측]
복지부분류코드	121 (국소마취제 )
주성분코드 분석 및 중복처방 검토	[주성분코드 분석 및 중복처방 검토]
Drugs By Indication	[전체보기]
Drugs By Classification	[전체보기]

제품정보

항목	내용
청구코드(KD코드) 비급여점검코드 상한금액	[A12252601] [보험코드에 따른 약품기본정보 직접조회] \0 원/20ml/병(2007.03.01)(최신약가) \5,299 원/20ml/병(2003.10.01)(변경전약가) [상병코드조회] [질병코드집 다운로드]
제품성상	무색 또는 엷은 황색의 액이 든 갈색의 바이알 [제형정보 확인]
보관방법	차광밀봉용기, 실온(1∼30℃)보관
동일주성분코드 검색순위	유료정보입니다.
특수관리의약품 부가정보	유료정보입니다.
Brandname 정보	Epinephrine Brand Names/Synonyms ADROP Adnephrine Adrenal Adrenalin Adrenalin Chloride Adrenalin in Oil Adrenalin-Medihaler Adrenalina [Dcit] Adrenaline Adrenaline/Epinephrine Adrenalinum Adrenamine Adrenan Adrenapax Adrenasol Adrenatrate Adrenine Adrenodis Adrenohorma Adrenor Adrenosan Adrenutol Adrin Adrine Aktamin Ana-Guard Antiasthmatique Arterenol Asmatane Mist Asthma Meter Mist Asthma-Nefrin Asthmahaler Mist Asthmanefrin Astmahalin Astminhal Balmadren Bernarenin Biorenine Bosmin Brevirenin Bronkaid Bronkaid Mist Bronkaid Suspension Mist Bupivacaine Hcl and Epinephrine Chelafrin Citanest Forte Corisol D-Adrenaline D-Epifrin D-Epinephrine Drenamist Duranest Dylephrin Dyspne-Inhal Epi EZ Pen Jr Epifrin Epiglaufrin Epinefrin Epinefrin [Czech] Epinefrina Epinefrina [Inn-Spanish] Epinephran Epinephrine Bitartrate Epinephrine [Usan:Inn:Jan] Epinephrinum [Inn-Latin] Epipen Epipen Auto-Injector Epipen EZ Pen Epipen Jr. Epipen Jr. Auto-Injector Epirenamine Epirenan Epirenin Epitrate Eppy Esphygmogenina Exadrin Glaucon Glaucosan Glauposine Glycirenan Haemostasin Haemostatin Hektalin Hemisine Hemostasin Hemostatin Hypernephrin Hyporenin IOP Intranefrin Iontocaine Isoptoepinal Kidoline L-Adrenalin L-Adrenaline L-Adrenaline Base L-Adrenaline Gr L-Arterenol L-Epinephine L-Epinephrine L-Epirenamine L-Methylaminoethanolcatechol L-Noradrenaline L-Norepinephrine Levarterenol Levo-Methylaminoethanolcatechol Levoarterenol Levoepinephrine Levonor Levonoradrenaline Levonorepinephrine Levophed Levorenen Levorenin Levorenine Lidocaton Lyophrin Medihaler-Epi Metanephrin Methylaminoethanolcatechol Methylarterenol Micronefrin Mucidrina Myosthenine Mytrate Nephridine Nephron Nieraline Nor-Epirenan Noradrenalin Noradrenaline Norartrinal Norepinephrine Norepinephrine Bitartrate Norepirenamine Octocaine Paranephrin Primatene Mist Renagladin Renaglandin Renaglandulin Renaleptine Renalina Renoform Renostypricin Renostypticin Renostyptin Scurenaline Septocaine Simplene Sindrenina Soladren Sphygmogenin Stryptirenal Styptirenal Supracapsulin Supradin Supranefran Supranephrane Supranephrine Supranol Suprarenaline Suprarenin Suprel Surenine Surrenine Sus-Phrine Susphrine Sympathin E Sympathin I Takamina Takamine Tokamina Tolansin Tolax Tolcil Tolhart Tonogen Twinject Twinject 0.30 Vaponefrin Vasoconstrictine Vasoconstrictor Vasodrine Vasoton Vasotonin Brand Name Mixtures 1% Lidocaine Hydrochloride and Epinephrine 1:100000 Inj Usp (Epinephrine + Lidocaine Hydrochloride) 2% Lidocaine Hydrochloride and Epinephrine 1:100000 Inj Usp (Epinephrine + Lidocaine Hydrochloride) 2% Xylocaine Dental with Epinephrine 1:100,000 (Epinephrine + Lidocaine Hydrochloride) 2% Xylocaine Dental with Epinephrine 1:50,000 (Epinephrine + Lidocaine Hydrochloride) 4% Citanest Forte Dental with Epinephrine 1:200,000 (Epinephrine (Epinephrine Bitartrate) + Prilocaine Hydrochloride) Ad Plex (Celandine + Echinacea Angustifolia + Epinephrine + Lycopodium Clavatum + Milk Thistle + Phosphoric Acid + Propolis + Sodium Chloride) Ad Tonic (Charcoal Activated + Epinephrine + Glycyrrhiza Glabra + Iodine + Lycopodium Clavatum + Oats + Phosphoric Acid + Potassium Phosphate Dibasic + Sarsaparilla + Sodium Chloride) Adaptagen (Capsicum + Charcoal Activated + Conium Maculatum + Copper + Elaeis Guineensis + Epinephrine + Ginkgo Biloba + Ginseng + Glycyrrhiza Glabra + Iodine + Ledum Palustre + Oats + Phosphoric Acid + Picric Acid + Pituitary Posterior + Selenium + Sepia Officinalis L + Silicon Dioxide + Sodium Carbonate (Anhydrous) + Thuja Occidentalis + Vitamin B1 + Vitamin B2) All- I (Charcoal Activated + Epinephrine + Histamine + Liverwort + Lycopodium Clavatum + Phosphorus + Potassium Phosphate Dibasic + Pulsatilla + Silicon Dioxide + Sodium Phosphate Dibasic) All-Ii (Epinephrine + Euphrasia Officinalis + Goldenrod + Histamine + Liverwort + Modified Ragweed Tyrosine Adsorbate + Phosphorus + Potassium Iodide + Pulsatilla + Sulfur) Allforce (Aralia Racemosa + Cantharides + Charcoal Activated + Epinephrine + Ginger + Glycyrrhiza Glabra + Iodine + Onion + Oyster Shells + Phosphorus + Poison Ivy + Sarsaparilla + Sodium Carbonate (Anhydrous)) Alopt (Baptisia Tinctoria + Echinacea Angustifolia + Epinephrine + Euphrasia Officinalis + Garlic + Goldenrod + Histamine + Modified Ragweed Tyrosine Adsorbate + Onion + Phosphorus + Potassium Dichromate + Pulsatilla + Sulfur) Alphacaine Hcl 2% W Epineph 1:100000 (Epinephrine + Lidocaine Hydrochloride) Alphacaine Hcl 2% W Epineph 1:50000 (Epinephrine + Lidocaine Hydrochloride) Ana-Kit (2mg/Tab Orl, 1mg/Ml Liq Sc Im) (Chlorpheniramine Maleate + Epinephrine) Ana-Kit (Chlorpheniramine Maleate + Epinephrine Hcl) Anakit Insect Sting Treatment Kit (Chlorpheniramine Maleate + Epinephrine) Andropt (Astragalus Menziesii + Echinacea Angustifolia + Epinephrine + Juniper Berries + Oats + Phosphoric Acid + Picric Acid + Pulsatilla + Saw Palmetto + Selenium + Sodium Hexafluorosilicate + Thuja Occidentalis + Vitex Agnus Castus) Bac (Astragalus Menziesii + Baptisia Tinctoria + Belladonna + Charcoal Activated + Echinacea Angustifolia + Epinephrine + Ferrum Phosphoricum + Hydrastis Canadensis + Hypericum Perforatum + Iodine + Myrrh + Phosphorus + Phytolacca Decandra + Propolis + Silicon Dioxide + Water Cress) Candopt (Astragalus Menziesii + Echinacea Angustifolia + Epinephrine + Fucus Vesiculosus + Hydrastis Canadensis + Lycopodium Clavatum + Phosphoric Acid + Platanus Occidentalis + Pulsatilla + Sepia Officinalis L + Sodium Chloride) Chemtox (Barberry Root + Belladonna + Burdock + Cascarilla + Charcoal Activated + Couch Grass + Epinephrine + Glycerine + Glycyrrhiza Glabra + Iodine + Liverwort + Lycopodium Clavatum + Nitric Acid + Phosphoric Acid + Phosphorus + Phytolacca Decandra + Pulsatilla + Stillingia + Trifolium Pratense + Xanthoxylum) Crc-Plex (Arnica Montana + Barium Chloride + Calcium Lactate + Charcoal Activated + Cholesterol + Convallaria Majalis + Epinephrine + Iodine + Magnesium Carbonate + Nitroglycerin + Phosphorus + Picric Acid + Potassium Iodide + Strophanthus Hispidus) Cv Tox (Astragalus Menziesii + Barberry Root + Diadem Spider + Echinacea Angustifolia + Epinephrine + Gelsemium Sempervirens + Hydrastis Canadensis + Hydrochloric Acid + Ipecac + Lycopodium Clavatum + Nitric Acid + Phosphoric Acid + Poison Ivy + Scurvy Grass + Silicon Dioxide) E-Pilo 1 Ophthalmic Solution (Epinephrine Bitartrate + Pilocarpine Hydrochloride) E-Pilo 2 Ophthalmic Solution (Epinephrine Bitartrate + Pilocarpine Hydrochloride) E-Pilo 4 Ophthalmic Solution (Epinephrine Bitartrate + Pilocarpine Hydrochloride) E-Pilo 6 Ophthalmic Solution (Epinephrine Bitartrate + Pilocarpine Hydrochloride) E-Pilo-1 Oph Soln (Epinephrine Bitartrate + Pilocarpine Hydrochloride) E-Pilo-2 Oph Soln (Epinephrine Bitartrate + Pilocarpine Hydrochloride) E-Pilo-4 Oph Soln (Epinephrine Bitartrate + Pilocarpine Hydrochloride) E-Pilo-6 Oph Soln (Epinephrine Bitartrate + Pilocarpine Hydrochloride) Endangitin (Aesculus Hippocastanum + Cupric Acetate + Epinephrine + Ergot + Potentilla Anserina + Tobacco + White Hellebore Root) Endoplex F (Bovine Ovaries, Dried + Charcoal Activated + Cimicifuga Racemosa + Epinephrine + Fucus Vesiculosus + Glycyrrhiza Glabra + Iodine + Murex Purpurea + Pituitary Posterior + Pulsatilla + Sabina + Sepia Officinalis L + Xanthoxylum) Endoplex M (Clematis Erecta + Conium Maculatum + Epinephrine + Ginseng + Juniper Berries + Lycopodium Clavatum + Parsley + Picric Acid + Pituitary Posterior + Pulsatilla + Saw Palmetto + Thuja Occidentalis + Uva Ursi + Vitex Agnus Castus + Xanthoxylum) Ev Tox (Astragalus Menziesii + Belladonna + Charcoal Activated + Diadem Spider + Echinacea Angustifolia + Epinephrine + Hydrastis Canadensis + Hydrochloric Acid + Ipecac + Lycopodium Clavatum + Nitric Acid + Poison Ivy + Propolis + Scurvy Grass + Silicon Dioxide) F Alleropt (Aethusa Cynapium + Belladonna + Capsicum + Charcoal Activated + Comfrey + Echinacea Angustifolia + Epinephrine + Gentiana Cruciata + Histamine + Lycopodium Clavatum + Phosphorus + Potassium Dichromate + Pulsatilla) Fml-Tox (Angelicae Sinensis Radix + Beechwood Creosote + Boric Acid + Cimicifuga Racemosa + Epinephrine + Iodine + Oophorinum + Oyster Shells + Placenta + Pulsatilla + Sepia Officinalis L + Sodium Chloride + Sulfur + Zinc) Fng I (Astragalus Menziesii + Condurango + Echinacea Angustifolia + Epinephrine + Ginkgo Biloba + Hydrastis Canadensis + Lycopodium Clavatum + Phosphoric Acid + Phosphorus + Phytolacca Decandra + Propolis + Sepia Officinalis L + Sodium Chloride + Water Cress) Fng Ii (Astragalus Menziesii + Candida Parapsilosis + Charcoal Activated + Echinacea Angustifolia + Epinephrine + Hydrastis Canadensis + Iodine + Lycopodium Clavatum + Phosphoric Acid + Pulsatilla + Sepia Officinalis L + Silver + Sodium Chloride + Water Cress) Gingibraid W Alum Pot Sulf and Epin 0e (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Gingibraid W Epineph and Alum 1e (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Gingibraid W Epineph and Alum 2e (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Gingibraid W Epineph and Alum 3e (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Gingicord W Epineph and Alum Size No 1 (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Gingicord W Epineph and Alum Size No 3 (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Gingicord W/Epineph and Alum Size 2 (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Gynopt (Angelica + Beechwood Creosote + Boric Acid + Bovine Ovaries, Dried + Charcoal Activated + Cimicifuga Racemosa + Epinephrine + Iodine + Nitric Acid + Placenta + Potassium Acetate + Pulsatilla + Sepia Officinalis L + Sodium Chloride + Sulfur) Immplex (Astragalus Menziesii + Calcium Sulfide Crude + Echinacea Angustifolia + Epinephrine + Eupatorium Perfoliatum + Ferrum Phosphoricum + Hydrastis Canadensis + Myrrh + Phosphoric Acid + Propolis + Silicon Dioxide + Water Cress) Lido-2 Liq (Epinephrine Hcl + Lidocaine Hydrochloride) Lidocaine 2% Sterile Injectable Solution (Epinephrine Racemic + Lidocaine Hydrochloride) Lidocaine 2% with Epinephrine 1:100000 (Epinephrine + Lidocaine Hydrochloride) Lidocaine Hcl 2% (Epinephrine + Lidocaine Hydrochloride) Lidocaine Hcl 2% Epinephrine Inj (Epinephrine + Lidocaine Hydrochloride) Lidocaine Hcl 2% W Epineph 1:100000inj (Epinephrine + Lidocaine Hydrochloride) Lidocaine Hcl 2% W Epinephrine (Epinephrine + Lidocaine Hydrochloride) Lidocaine Hcl 2% W Epinephrine 1:100000 (Epinephrine + Lidocaine Hydrochloride) Lidocaine Hcl 2% W Epinephrine 1:50000 (Epinephrine + Lidocaine Hydrochloride) Lidocaine Inj 2% (Epinephrine Hcl + Lidocaine Hydrochloride) Lidocaine and Epinephrine Inj.Usp2% 1:100000 (Epinephrine + Lidocaine Hydrochloride) Lignospan Forte (Epinephrine + Lidocaine Hydrochloride) Lignospan Speciale Inj (Epinephrine + Lidocaine Hydrochloride) Lignospan Standard (Epinephrine + Lidocaine Hydrochloride) Marcaine E 0.25% Liq Prt (Bupivacaine Hydrochloride + Epinephrine Bitartrate) Marcaine E 2.5 Mg/Ml (Bupivacaine Hydrochloride + Epinephrine Bitartrate) Marcaine E 5.0 Mg/Ml (Bupivacaine Hydrochloride + Epinephrine Bitartrate) Marcaine E Liq Prt 0.50% (Bupivacaine Hydrochloride + Epinephrine Bitartrate) Nasal Spray (Echinacea Angustifolia + Epinephrine + Gelsemium Sempervirens + Modified Ragweed Tyrosine Adsorbate + Onion + Potassium Iodide + Sanguinaria Canadensis + Sticta Pulmonaria) Neuplex (Agaricus Muscarius + Arnica Montana + Charcoal Activated + Diadem Spider + Epinephrine + Hypericum Perforatum + Iodine + Passion Flower + Plumbum Metallicum + Trifolium Pratense) Octocaine 100 Needleject Inj (Epinephrine + Lidocaine Hydrochloride) Octocaine Hcl 2% Epinephrine 1:100000inj (Epinephrine Hcl + Lidocaine Hydrochloride) Octocaine Hcl 2% Epinephrine 1:50000inj (Epinephrine Hcl + Lidocaine Hydrochloride) Panplex (Celandine + Charcoal Activated + Common Bean Garden + Epinephrine + Eugenia Jambolana + Ginger + Glycyrrhiza Glabra + Hydrastis Canadensis + Iodine + Liverwort + Nux Moschata + Pancreas + Phosphoric Acid + Phosphorus + Pituitary Posterior + Rhubarb + Taraxacum Officinale Weber) Prilocaine Hcl 4% Epineph 1:200000inj (Epinephrine + Prilocaine Hydrochloride) R63 (Aesculus Hippocastanum + Cupric Acetate + Epinephrine + Potentilla Anserina + Tobacco) Racord Two 7 (Racemic Epinephrine Hydrochloride + Zinc Phenolsulphonate) Racord Two No 10 (Racemic Epinephrine Hydrochloride + Zinc Phenolsulphonate) Racord Two No 8 (Racemic Epinephrine Hydrochloride + Zinc Phenolsulphonate) Racord Two No 9 (Racemic Epinephrine Hydrochloride + Zinc Phenolsulphonate) Radopt (Brassica Napus + Cadmium Iodatum + Cadmium Sulphuricum + Capsicum + Charcoal Activated + Diadem Spider + Epinephrine + Fucus Vesiculosus + Goldenrod + Iodine + Ipecac + Iridium Metallicum + Phosphoric Acid + Phosphorus + Uranium Nitrate + X-Ray) Rdn-Tox (Cadmium Iodatum + Cadmium Sulphuricum + Capsicum + Cetraria Islandica + Charcoal Activated + Epinephrine + Fucus Vesiculosus + Hydrangea Arborescens + Iodine + Phosphoric Acid + Phosphorus + Pulsatilla + Strontium Carbonate + Uranium Nitrate + X-Ray) Scandonest 2% Special Inj (Epinephrine + Mepivacaine Hydrochloride) Sensorcaine 0.25% with Epinephrine (Bupivacaine Hydrochloride + Epinephrine (Epinephrine Bitartrate)) Sensorcaine 0.5% with Epinephrine (Bupivacaine Hydrochloride + Epinephrine (Epinephrine Bitartrate)) Sensorcaine Forte (Bupivacaine Hydrochloride + Epinephrine (Epinephrine Bitartrate)) Septanest N (Articaine Hydrochloride + Epinephrine (Epinephrine Bitartrate)) Septanest Sp (Articaine Hydrochloride + Epinephrine (Epinephrine Bitartrate)) Sil Trax Plus No 10 (Racemic Epinephrine Hydrochloride + Zinc Phenolsulphonate) Sil Trax Plus No 8 (Racemic Epinephrine Hydrochloride + Zinc Phenolsulphonate) Sil Trax Plus No 9 (Racemic Epinephrine Hydrochloride + Zinc Phenolsulphonate) Siltrax Plus 7 (Racemic Epinephrine Hydrochloride + Zinc Phenolsulphonate) Spinal Anaesthesia Tray (Dextrose + Epinephrine + Iodine (Povidone-Iodine) + Lidocaine Hydrochloride + Tetracaine Hydrochloride) Spinal Anaesthesia Tray (Dextrose + Epinephrine + Lidocaine Hydrochloride + Povidone-Iodine + Tetracaine Hydrochloride) Spinal Anesthesia Tray (Dextrose + Ephedrine Sulfate + Epinephrine + Lidocaine Hydrochloride + Tetracaine Hydrochloride) Spinal Anesthesia Tray (Dextrose + Epinephrine + Lidocaine Hydrochloride + Tetracaine Hydrochloride) Super Sulpak R 44 (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Super Sulpak R 45 (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Super Sulpak R 46 (Aluminum Potassium Sulfate + Racemic Epinephrine Hydrochloride) Systopt (Barberry Root + Burdock + Calcium Sulfide Crude + Celandine + Charcoal Activated + Conium Maculatum + Diadem Spider + Epinephrine + Glycyrrhiza Glabra + Goldenrod + Hydrastis Canadensis + Lycopodium Clavatum + Tarentula Cubensis + Thuja Occidentalis + Trifolium Pratense) Systox (Barberry Root + Boldo + Burdock + Calcium Sulfide Crude + Celandine + Charcoal Activated + Conium Maculatum + Diadem Spider + Epinephrine + Hydrastis Canadensis + Lycopodium Clavatum + Sarsaparilla + Taraxacum Officinale Weber + Tarentula Cubensis + Thuja Occidentalis + Trifolium Pratense) Tyd-Plex (Charcoal Activated + Epinephrine + Ferrous Iodide + Fucus Vesiculosus + Iodine + Oyster Shells + Phosphoric Acid + Pituitary Posterior + Potassium Iodide + Spongia Tosta) Ultracaine D-S Forte Injection (Articaine Hydrochloride + Epinephrine) Ultracaine D-S Injection (Articaine Hydrochloride + Epinephrine) Ultracaine Ds Forte Inj (Articaine Hydrochloride + Epinephrine) Ultracaine Ds Inj (Articaine Hydrochloride + Epinephrine) Universaltox (Alfalfa + Buckthorn + Charcoal Activated + Coffea Tosta + Comfrey + Epinephrine + Fucus Vesiculosus + Iodine + Liverwort + Lycopodium Clavatum + Manganese + Oats + Oyster Shells + Poison Ivy + Pulsatilla + Sepia Officinalis L + Sodium Chloride + Spigelia Anthelmia + Water Cress) Vactox (Arnica Montana + Astragalus Menziesii + Baptisia Tinctoria + Belladonna + Calendula + Celandine + Echinacea Angustifolia + Epinephrine + Gelsemium Sempervirens + German Chamomile + Hydrastis Canadensis + Lycopodium Clavatum + Phytolacca Decandra + Poison Ivy + Propolis + Silicon Dioxide + Taraxacum Officinale Weber + Thuja Occidentalis + Trifolium Pratense + Urtica Urens + Water Cress) Virotox (Astragalus Menziesii + Belladonna + Echinacea Angustifolia + Epinephrine + Eupatorium Perfoliatum + Gelsemium Sempervirens + Hydrastis Canadensis + Lycopodium Clavatum + Myrrh + Phytolacca Decandra + Water Cress) Xylocaine 0.5% W Epinephrine 1:100000 (Epinephrine + Lidocaine Hydrochloride) Xylocaine 0.5% W Epinephrine 1:200000 (Epinephrine + Lidocaine Hydrochloride) Xylocaine 1% W Epinephrine 1:100000 (Epinephrine + Lidocaine Hydrochloride) Xylocaine 1% W Epinephrine 1:200000 (Epinephrine + Lidocaine Hydrochloride) Xylocaine 1.5% W Epinephrine 1:200000 (Epinephrine + Lidocaine Hydrochloride) Xylocaine 1.5% W Epinephrine 1:200000 Test Dose (Epinephrine + Lidocaine Hydrochloride) Xylocaine 2% W Epinephrine 1:100000 (Epinephrine + Lidocaine Hydrochloride) Xylocaine 2% W Epinephrine 1:200000 (Epinephrine + Lidocaine Hydrochloride) Xylocaine Mpf 1.5% with Epinephrine (Epinephrine + Lidocaine Hydrochloride) Zorcaine (Articaine Hydrochloride + Epinephrine (Epinephrine Bitartrate)) Chemical IUPAC Name 4-(1-hydroxy-2-methylamino-ethyl)benzene-1,2-diol Bupivacaine Brand Names/Synonyms Chirocaine Brand Name Mixtures Not Available Chemical IUPAC Name 1-butyl-N-(2,6-dimethylphenyl)-piperidine-2-carboxamide

복약정보

항목

내용

LACTmed 바로가기

[바로가기]

약리작용

유료정보입니다.

복약지도

유료정보입니다.

임부에대한투여

*	전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.

FDA : C등급
(bupivacaine;epinephrine; )

*	상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
*	반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.

Pharmacokinetics

유료정보입니다.

병용금기 및 연령대금기 근거조회

[병용금기 및 연령대금기 근거조회]

보관상 주의

조제시 주의

심사정보

항목	내용
DUR 관련 고시	[병용연령금기 의약품 / 임부금기 의약품 / 비용효과적 함량 의약품 / 안전성 관련 급여중지 의약품]

학술정보

항목	내용
DUR (의약품사용평가)	병용금기 : 고시된 병용금기 내용은 없습니다. [상호작용/병용금기검색] 연령대금기 : 고시된 연령금기 내용은 없습니다. [연령대금기상세검색]
Mechanism of Action	Bupivacaine에 대한 Mechanism_Of_Action 정보 Local anesthetics such as bupivacaine block the generation and the conduction of nerve impulses, presumably by increasing the threshold for electrical excitation in the nerve, by slowing the propagation of the nerve impulse, and by reducing the rate of rise of the action potential. In general, the progression of anesthesia is related to the diameter, myelination and conduction velocity of affected nerve fibers. Clinically, the order of loss of nerve function is as follows: (1) pain, (2) temperature, (3) touch, (4) proprioception, and (5) skeletal muscle tone. The analgesic effects of Bupivicaine are thought to be due to its binding to the prostaglandin E2 receptors, subtype EP1 (PGE2EP1), which inhibits the production of prostaglandins, thereby reducing fever, inflammation, and hyperalgesia. Epinephrine에 대한 Mechanism_Of_Action 정보 Epinephrine works via the stimulation of alpha and beta-1 adrenergic receptors, and a moderate activity at beta-2 adrenergic receptors.
Pharmacology	Bupivacaine에 대한 Pharmacology 정보 Bupivacaine is a widely used local anesthetic agent. Bupivacaine is often administered by spinal injection prior to total hip arthroplasty. It is also commonly injected into surgical wound sites to reduce pain for up to 20 hours after surgery. In comparison to other local anesthetics it has a long duration of action. It is also the most toxic to the heart when administered in large doses. This problem has led to the use of other long-acting local anaesthetics:ropivacaine and levobupivacaine. Levobupivacaine is a derivative, specifically an enantiomer, of bupivacaine. Systemic absorption of local anesthetics produces effects on the cardiovascular and central nervous systems. At blood concentrations achieved with therapeutic doses, changes in cardiac conduction, excitability, refractoriness, contractility, and peripheral vascular resistance are minimal. However, toxic blood concentrations depress cardiac conduction and excitability, which may lead to atrioventricular block, ventricular arrhythmias and to cardiac arrest, sometimes resulting in fatalities. In addition, myocardial contractility is depressed and peripheral vasodilation occurs, leading to decreased cardiac output and arterial blood pressure. Following systemic absorption, local anesthetics can produce central nervous system stimulation, depression or both. Epinephrine에 대한 Pharmacology 정보 Epinephrine is indicated for intravenous injection in treatment of acute hypersensitivity, treatment of acute asthmatic attacks to relieve bronchospasm, and treatment and prophylaxis of cardiac arrest and attacks of transitory atrioventricular heart block with syncopal seizures (Stokes-Adams Syndrome). The actions of epinephrine resemble the effects of stimulation of adrenergic nerves. To a variable degree it acts on both alpha and beta receptor sites of sympathetic effector cells. Its most prominent actions are on the beta receptors of the heart, vascular and other smooth muscle. When given by rapid intravenous injection, it produces a rapid rise in blood pressure, mainly systolic, by (1) direct stimulation of cardiac muscle which increases the strength of ventricular contraction, (2) increasing the heart rate and (3) constriction of the arterioles in the skin, mucosa and splanchnic areas of the circulation. When given by slow intravenous injection, epinephrine usually produces only a moderate rise in systolic and a fall in diastolic pressure. Although some increase in pulse pressure occurs, there is usually no great elevation in mean blood pressure. Accordingly, the compensatory reflex mechanisms that come into play with a pronounced increase in blood pressure do not antagonize the direct cardiac actions of epinephrine as much as with catecholamines that have a predominant action on alpha receptors.
Metabolism	Bupivacaine에 대한 Metabolism 정보 # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4) Epinephrine에 대한 Metabolism 정보 # Phase_1_Metabolizing_Enzyme:Not Available
Protein Binding	Bupivacaine에 대한 단백결합 정보 95%
Half-life	Bupivacaine에 대한 반감기 정보 2.7 hours in adults and 8.1 hours in neonates Epinephrine에 대한 반감기 정보 2 minutes
Absorption	Bupivacaine에 대한 Absorption 정보 The rate of systemic absorption of local anesthetics is dependent upon the total dose and concentration of drug administered, the route of administration, the vascularity of the administration site, and the presence or absence of epinephrine in the anesthetic solution. Epinephrine에 대한 Absorption 정보 Usually this vasodilator effect of the drug on the circulation predominates so that the modest rise in systolic pressure which follows slow injection or absorption is mainly the result of direct cardiac stimulation and increase in cardiac output.
Pharmacokinetics	Bupivacaine HCl의 약물동력학자료 마취효과 발현시간 (투여경로에 의존적) : 일반적으로 4-10분 이내 작용지속시간 : 1.5-8.5 시간 대사 : 간대사 반감기 : 나이에 의존적 신생아 : 8.1 시간 성인 : 1.5-5.5 시간 소실 : 소량(약 6%)이 신배설 Epinephrine bitartrate의 약물동력학자료 기관지 이완 효과의 발현시간 피하주사 : 5-10분 이내 흡입 : 1분 이내 결막 점적 효과발현시간 (안압 감소) : 1시간 이내 최고효과 발현시간 : 4-8시간 이내 눈에 대한 작용지속시간 : 12-24 시간 흡수 : 경구 투여시 위장관, 간에서 신속히 대사되므로 약리작용을 나타내는 혈중농도에 도달하지 못함 분포 : 태반 통과, 유즙 분비 대사 : 투여 후 아드레날린성 신경세포에 uptake되어 monoamine oxidase와 catechol-o-methyltransferase에 의해 대사됨. 순환 약물은 간에서 대사됨 소실 : 비활성형 대사체 (metanephrine, mandelic acid의 황산 또는 수산화 유도체)와 소량은 미변화체로 뇨를 통해 배설됨
Biotransformation	Bupivacaine에 대한 Biotransformation 정보 Amide-type local anesthetics such as bupivacaine are metabolized primarily in the liver via conjugation with glucuronic acid. The major metabolite of bupivacaine is 2,6-pipecoloxylidine, which is mainly catalyzed via cytochrome P450 3A4. Epinephrine에 대한 Biotransformation 정보 Epinephrine is rapidly inactivated in the body and is degraded by enzymes in the liver and other tissues. The larger portion of injected doses is excreted in the urine as inactivated compounds and the remainder either partly unchanged or conjugated. The drug becomes fixed in the tissues and is inactivated chiefly by enzymatic transformation to metanephrine or normetanephrine either of which is subsequently conjugated and excreted in the urine in the form of sulfates and glucuronides. Either sequence results in the formation of 3-methoxy-4-hydroxy-mandelic acid which also is detectable in the urine.
Toxicity	Bupivacaine에 대한 Toxicity 정보 The mean seizure dosage of bupivacaine in rhesus monkeys was found to be 4.4 mg/kg with mean arterial plasma concentration of 4.5 mcg/mL. The intravenous and subcutaneous LD 50 in mice is 6 to 8 mg/kg and 38 to 54 mg/kg respectively. Recent clinical data from patients experiencing local anesthetic induced convulsions demonstrated rapid development of hypoxia, hypercarbia, and acidosis with bupivacaine within a minute of the onset of convulsions. These observations suggest that oxygen consumption and carbon dioxide production are greatly increased during local anesthetic convulsions and emphasize the importance of immediate and effective ventilation with oxygen which may avoid cardiac arrest. Epinephrine에 대한 Toxicity 정보 Skin, LD₅₀ = 62 mg/kg (rat)
Drug Interactions	Bupivacaine에 대한 Drug_Interactions 정보 Not Available Epinephrine에 대한 Drug_Interactions 정보 Acebutolol Hypertension, then bradycardiaAlseroxylon Increased arterial pressureAmitriptyline The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectAtenolol Hypertension, then bradycardiaBetaxolol Hypertension, then bradycardiaBevantolol Hypertension, then bradycardiaBisoprolol Hypertension, then bradycardiaCarteolol Hypertension, then bradycardiaCarvedilol Hypertension, then bradycardiaClomipramine The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectDeserpidine Increased arterial pressureDoxepin The tricyclic increases the sympathomimetic effectEntacapone Entacapone increases the effect and toxicity of sympathomimeticsMethylergonovine Possible marked increase of arterial pressureNortriptyline The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectEsmolol Hypertension, then bradycardiaGuanethidine The agent decreases the effect of guanethidineIsocarboxazid Increased arterial pressureLabetalol Hypertension, then bradycardiaLinezolid Possible increase of arterial pressureMethyldopa Increased arterial pressureMetoprolol Hypertension, then bradycardiaMidodrine Increased arterial pressureMoclobemide Moclobemide increases the sympathomimetic effectNadolol Hypertension, then bradycardiaPenbutolol Hypertension, then bradycardiaOxytocin Possible marked increase of arterial pressurePhenelzine Increased arterial pressurePindolol Hypertension, then bradycardiaPractolol Hypertension, then bradycardiaPropranolol Hypertension, then bradycardiaRasagiline Increased arterial pressureReserpine Increased arterial pressureSotalol Hypertension, then bradycardiaTimolol Hypertension, then bradycardiaTranylcypromine Increased arterial pressureTrimipramine The tricyclic increases the sympathomimetic effectErgonovine Possible marked increase of arterial pressureOxprenolol Hypertension, then bradycardiaPargyline Increased arterial pressure
CYP450 Drug Interaction	[CYP450 Table직접조회]
Drug Target	[Drug Target]
Description	Bupivacaine에 대한 Description 정보 A widely used local anesthetic agent. [PubChem] Epinephrine에 대한 Description 정보 The active sympathomimetic hormone from the adrenal medulla in most species. It stimulates both the alpha- and beta- adrenergic systems, causes systemic vasoconstriction and gastrointestinal relaxation, stimulates the heart, and dilates bronchi and cerebral vessels. It is used in asthma and cardiac failure and to delay absorption of local anesthetics. [PubChem]
Dosage Form	Bupivacaine에 대한 Dosage_Form 정보 Liquid InfiltrationSolution EpiduralSolution InfiltrationSolution Intraspinal Epinephrine에 대한 Dosage_Form 정보 Liquid IntramuscularLiquid OralSolution IntramuscularSolution IntravenousSolution NasalSolution Respiratory (inhalation)Solution / drops OphthalmicSolution / drops Oral
Drug Category	Bupivacaine에 대한 Drug_Category 정보 Anesthetics, Local Epinephrine에 대한 Drug_Category 정보 Adrenergic AgonistsAdrenergic alpha-AgonistsAdrenergic beta-AgonistsBronchodilator AgentsMydriaticsSympathomimeticsVasoconstrictor Agents
Smiles String Canonical	Bupivacaine에 대한 Smiles_String_canonical 정보 CCCCN1CCCCC1C(=O)NC1=C(C)C=CC=C1C Epinephrine에 대한 Smiles_String_canonical 정보 CNCC(O)C1=CC(O)=C(O)C=C1
Smiles String Isomeric	Bupivacaine에 대한 Smiles_String_isomeric 정보 CCCCN1CCCC[C@@H]1C(=O)NC1=C(C)C=CC=C1C Epinephrine에 대한 Smiles_String_isomeric 정보 CNC[C@H](O)C1=CC(O)=C(O)C=C1
InChI Identifier	Bupivacaine에 대한 InChI_Identifier 정보 InChI=1/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21)/f/h19H Epinephrine에 대한 InChI_Identifier 정보 InChI=1/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1
Chemical IUPAC Name	Bupivacaine에 대한 Chemical_IUPAC_Name 정보 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide Epinephrine에 대한 Chemical_IUPAC_Name 정보 4-[(1R)-1-hydroxy-2-methylaminoethyl]benzene-1,2-diol
Drug-Induced Toxicity Related Proteins	EPINEPHRINE 의 Drug-Induced Toxicity Related Protein정보 Replated Protein:Interleukin-8 Drug:epinephrine Toxicity:inflammation. [바로가기] Replated Protein:Leptin Drug:epinephrine Toxicity:epinephrine-induced suppression in human obesity. [바로가기] Replated Protein:Glutathione reductase Drug:epinephrine Toxicity:cytotoxic. [바로가기] Replated Protein:Alpha-2A adrenergic receptor Drug:epinephrine Toxicity:platelet aggregation. [바로가기]

사용자컨텐츠

항목

내용

핵심 요약 정보

Epinephrine

Brand Names/Synonyms

Brand Name Mixtures

Chemical IUPAC Name

Bupivacaine

Brand Names/Synonyms

Brand Name Mixtures

Chemical IUPAC Name