| |
|
|
|
|
|
 |
| |
|
ÇÁ·Î¶ó½ÇÁ¤100mg(ÇÁ·ÎÇÊÄ¡¿À¿ì¶ó½Ç) PRORACIL TAB. 100MG[Propylthiouracil]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
664601080[A11204251]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2017.07.01)(ÇöÀç¾à°¡)
\36 ¿ø/1Á¤(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»öÀÇ ¿øÇü Á¤Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| ÁÖ¼ººÐÄÚµå |
220102ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
°©»ó¼±±â´ÉÇ×ÁøÁõ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:220102ATB ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
1. ¼ºÀÎ
ÃʱⷮÀ¸·Î ÇÁ·ÎÇÊÄ¡¿À¿ì¶ó½Ç·Î¼ 1ÀÏ 100-300mgÀ» 3-4ȸ ºÐÇÒ °æ±¸Åõ¿©Çϸç, ÁßÁõ¿¡´Â 1ÀÏ 400-600mg±îÁö Åõ¿©ÇÒ ¼ö ÀÖ´Ù. °©»ó¼±±â´ÉÇ×ÁøÁõÀÌ ¼Ò½ÇµÇ¸é 1-4ÁÖ°£ Á¡ÁøÀûÀ¸·Î °¨·®ÇÏ¿© À¯Áö·®À¸·Î¼ 1ÀÏ 25-100mgÀ» 1-2ȸ ºÐÇÒ Åõ¿©ÇÑ´Ù.
2. ¼Ò¾Æ
ÃʱⷮÀº 5-9¼¼´Â 1ÀÏ 100-200mgÀ», 10-14¼¼´Â 1ÀÏ 200-300mgÀ», 1ÀÏ 2-4ȸ ºÐÇÒ Åõ¿©ÇÑ´Ù. °©»ó¼±±â´ÉÇ×ÁøÁõÀÌ ¼Ò½ÇµÇ¸é 1-4ÁÖ°£ Á¡ÁøÀûÀ¸·Î °¨·®ÇÏ¿©, À¯Áö·®À¸·Î¼ 1ÀÏ 50-100mgÀ» 1-2ȸ ºÐÇÒ Åõ¿©ÇÑ´Ù.
3. ÀÓºÎ
Ãʱⷮ 1ÀÏ 150-300mgÀ» 3-4ȸ ºÐÇÒ Åõ¿©ÇÑ´Ù. °©»ó¼±±â´ÉÇ×ÁøÁõÀÌ ¼Ò½ÇµÇ¸é 1-4ÁÖ°£ Á¡ÁøÀûÀ¸·Î °¨·®Çؼ, À¯Áö·®À¸·Î¼ 1ÀÏ 50-100mgÀ» 1-2ȸ ºÐÇÒÅõ¿©ÇÑ´Ù. Á¤»ó ÀӽŽà °©»ó¼± ±â´É °Ë»çÄ¡°¡ ÀúÇϵÇÁö ¾ÊÀ¸¸é 2ÁÖ¸¶´Ù °Ë»ç¸¦ ½Ç½ÃÇÏ¿© ÇÊ¿äÃÖÀú¿ë·®À» Åõ¿©ÇÑ´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à¿¡ °ú¹ÎÁõ ȯÀÚ
2) ÀÌ ¾à »ç¿ë ÈÄ °£±â´ÉÀÌ ¾ÇÈµÈ È¯ÀÚ(¿¬¼Ó Åõ¿© Áß ÁßÁõ °£¿°ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
3) Áßµ¶¼º °©»ó¼±Á¾ ȯÀÚ
4) ÁßÁõ Ç÷¾×Àå¾Ö ȯÀÚ(°ú¸³±¸°¨¼ÒÁõ Æ÷ÇÔ)
5) ¼öÀ¯ºÎ
|
| ½ÅÁßÅõ¿© |
1) °£Àå¾Ö ȯÀÚ
2) Áߵ ÀÌ»óÀÇ ¹éÇ÷±¸ °¨¼Ò ¶Ç´Â ±âŸ Ç÷¾×Àå¾Ö ȯÀÚ
3) Æ®¶õ½º¾Æ¹Ì³ªÁ¦ ¶Ç´Â ´ãÁó¿ïü À¯µµÈ¿¼Ò ¼öÄ¡°¡ ³ôÀº ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ÁßÃ߽Űæ°è : ¶§¶§·Î µÎÅë, ¸»ÃʽŰæÀÌ»ó, ÁßÃ߽ŰæÀå¾Ö(¾îÁö·¯¿ò, ½Å°æ¿°, ´Ù¹ß½Å°æº´Áõ µî)°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) ¼Òȱâ°è : ¶§¶§·Î ±¸¿ª, ±¸Åä, ¼³»ç, ½Ä¿åºÎÁø µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) Ç÷¾×°è : ¶§¶§·Î ¹«°ú¸³±¸ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ¹ß¿, Àü½Å±ÇÅÂ, ÀÎÈÄÅëÀÌ ³ªÅ¸³ª¸é Áï½Ã Åõ¿©¸¦ ÁßÁöÇÏ°í ¹éÇ÷±¸ °Ë»ç¸¦ ÇÑ´Ù. À̶§ ¹«°ú¸³±¸ÁõÀÌ ³ªÅ¸³¯ °æ¿ì Ç×»ý¹°Áú ¹× ÄÚ¸£Æ¼ÄÚÀ̵带 Åõ¿©ÇÏ´Â µî ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù. ¶ÇÇÑ ¶§¶§·Î ¹éÇ÷±¸°¨¼ÒÁõ, ÀúÇÁ·ÎÆ®·ÒºóÇ÷Áõ, Ç÷¼ÒÆÇ°¨¼ÒÁõ, Á¦ 7ÀÎÀÚ °áÇÌÁõ, Ç÷¼ÒÆÇ°¨¼Ò¼º Àڹݺ´, Àç»ýºÒ·®¼º ºóÇ÷, ¿ëÇ÷¼º ºóÇ÷ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇϰí ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
4) ÇǺΠ:
¶§¶§·Î ¸ð¹ß Å»¶ô, ÇǺΠ»ö¼ÒÄ§Âø, °¡·Á¿ò, È«¹Ý µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) °£Àå : µå¹°°Ô °£Àå¾Ö, °£¿°, °£±«»ç, Ȳ´Þ, ƯÈ÷ °í¿ë·®¿¡¼ °£¿° ¹× ÀϽÃÀûÀÎ ´ãÁó¿ïü µî °£¼Õ»ó µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î °£±â´É ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
6) °ú¹ÎÁõ : ¶§¶§·Î ¹ßÁø, µÎµå·¯±â, ¹ß¿ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì ´Ù¸¥ ¾àÀ¸·Î ´ëüÇÑ´Ù. Áõ»óÀÌ °¡º¿î °æ¿ì¿¡´Â Ç×È÷½ºÅ¸¹ÎÁ¦¸¦ º´¿ëÇÏ°í ±× °æ°ú¸¦ °üÂûÇÏ¸ç ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
7) Àü½Å¼º È«¹Ý¼º ·çǪ½º(SLE) Áõ»ó (¹ß¿, È«¹Ý, ±ÙÀ°Åë, °üÀýÅë, ¸²ÇÁÀý Á¾´ë, ºñÁ¾ µî)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î °üÂûÀ» ÃæºÐÈ÷ Çϰí ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
8) °ú·®Åõ¿© : °©»ó¼±Á¾, °©»ó¼±±â´ÉÀúÇϰ¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
9) ±âŸ :
¶§¶§·Î ±Çۨ, µå¹°°Ô ¸²ÇÁÀý Á¾¾ç, °üÀýÅë, ±ÙÀ°Åë, Ÿ¾×¼± ºñ´ë, ºÎÁ¾, ¹Ì°¢°¨Åð, Èİ¢Àå¾Ö, °áÀý¼º µ¿¸Æ ÁÖÀ§¿°, °©»ó¼±Á¾ÀÇ È®´ë, ¸»ÃʺÎÁ¾, ¸Æ°ü¿°, °£Áú¼º Æó·Å, Á¹À½, ³»ºÐºñ ¾È°ú ÁúȯÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) Äí¸¶¸°°è Ç×ÀÀ°íÁ¦¿Í º´¿ëÅõ¿©½Ã Ç×ÀÀ°íÁ¦ÀÇ ÀÛ¿ë¿¡ ¿µÇâÀ» ¹ÌÄ¥ ¼ö ÀÖÀ¸¹Ç·Î ÇÁ·ÎÆ®·Òºó ½Ã°£À» ÃøÁ¤ÇÏ´Â µî ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
2) µð°î½Å µî µð±âÅ»¸®½ºÁ¦Á¦¿Í º´¿ëÅõ¿©½Ã µð±âÅ»¸®½ºÁ¦Á¦ÀÇ ÀÛ¿ë¿¡ ¿µÇâÀ» ¹ÌÄ¥ ¼ö ÀÖÀ¸¹Ç·Î Ç÷Áß ³óµµ¸¦ ¸ð´ÏÅ͸µÇÏ´Â µî ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
3) ¿ä¿Àµå, ¿ä¿Àµå ÇÔÀ¯ ¾à¹°Àº X-¼± Á¶¿µÁ¦¿Í º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ È¿·ÂÀÌ °¨¼ÒÇÒ ¼ö ÀÖ´Ù.
4) Ƽ·Ï½Å°ú º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ È¿·ÂÀÌ °¨¼ÒÇÒ ¼ö ÀÖ´Ù.
5) ÇÁ·ÎÇÁ¶ó³î·Ñ°ú º´¿ëÅõ¿©½Ã ÇÁ·ÎÇÁ¶ó³î·ÑÀÇ È¿·ÂÀÌ Áõ°¡ÇÑ´Ù.
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
(»ê¸ð¿¡ ´ëÇÑ Ä¡·áÀÌÀÍÀÌ Å¾ƿ¡ ´ëÇÑ À§Ç輺À» Å©°Ô »óȸÇÒ °æ¿ì¿¡ ÇÑÇØ »ç¿ë )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Propylthiouracil¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Propylthiouracil binds to thyroid peroxidase and thereby inhibits the conversion of iodide to iodine. Thyroid peroxidase normally converts iodide to iodine (via hydrogen peroxide as a cofactor) and also catalyzes the incorporation of the resulting iodide molecule onto both the 3 and/or 5 positions of the phenol rings of tyrosines found in thyroglobulin. Thyroglobulin is degraded to produce thyroxine (T4) and tri-iodothyronine (T3), which are the main hormones produced by the thyroid gland. Therefore propylthiouracil effectively inhibits the production of new thyroid hormones.
|
| Pharmacology |
Propylthiouracil¿¡ ´ëÇÑ Pharmacology Á¤º¸ Propylthiouracil is a thiourea antithyroid agent. Grave's disease is the most common cause of hyperthyroidism. It is an autoimmune disease where an individual's own antibodies attach to thyroid stimulating hormone receptors within cells of the thyroid gland and then trigger overproduction of thyroid hormone. The two thyroid hormones manufactured by the thyroid gland, thyroxine (T4) and triiodothyronine (T3), are formed by combining iodine and a protein called thyroglobulin with the assistance of an enzyme called peroxidase. PTU inhibits iodine and peroxidase from their normal interactions with thyroglobulin to form T4 and T3. This action decreases thyroid hormone production. PTU also interferes with the conversion of T4 to T3, and, since T3 is more potent than T4, this also reduces the activity of thyroid hormones. The actions and use of propylthiouracil are similar to those of methimazole.
|
| Absorption |
Propylthiouracil¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed following oral administration.
|
| Pharmacokinetics |
PropylthiouracilÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ : °æ±¸ : 24-36 ½Ã°£
- ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£ : 4 °³¿ù ÈÄ
- ÀÛ¿ëÁö¼Ó½Ã°£ : °æ±¸ : 2-3 ½Ã°£
- »ýü³»ÀÌ¿ë·ü : °æ±¸ : Á¤Á¦ : 55-75 %
- ºÐÆ÷ :
ŹÝÅë°úÇϳª ¾çÀº methimazole¿¡ ºñÇØ ¼Ò·®ÀÓ
°ñ¼ö, ºÎ½Å, Ç÷¾×, °£, ºñÀå¿¡ ³ôÀº ³óµµ·Î ºÐÆ÷
- ºÐÆ÷ ¿ëÀû : 0.3-0.4 L/kg
- ´Ü¹é°áÇÕ : 80 %
- ´ë»ç : °£´ë»ç
- ¹Ý°¨±â : 0.9-4.3 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : °æ±¸ : 1 ½Ã°£
- ¼Ò½Ç : 35 % ´¢¹è¼³
|
| Toxicity |
Propylthiouracil¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral, rat: LD50 = 1250 mg/kg.
|
| Drug Interactions |
Propylthiouracil¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Anisindione The anti-thyroid agent causes variations in the anticoagulant effectAcenocoumarol The anti-thyroid agent causes variations in the anticoagulant effectDicumarol The anti-thyroid agent causes variations in the anticoagulant effectWarfarin The anti-thyroid agent causes variations in the anticoagulant effectDigoxin The anti-thyroid agent increases the effect of digoxin
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Propylthiouracil¿¡ ´ëÇÑ Description Á¤º¸ A thiourea antithyroid agent. Propythiouracil inhibits the synthesis of thyroxine and inhibits the peripheral conversion of throxine to tri-iodothyronine. It is used in the treatment of hyperthyroidism. (From Martindale, The Extra Pharmacopeoia, 30th ed, p534)
|
| Drug Category |
Propylthiouracil¿¡ ´ëÇÑ Drug_Category Á¤º¸ AntimetabolitesAntithyroid Agents
|
| Smiles String Canonical |
Propylthiouracil¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCCC1=CC(=O)NC(=S)N1
|
| Smiles String Isomeric |
Propylthiouracil¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCCC1=CC(=O)NC(=S)N1
|
| InChI Identifier |
Propylthiouracil¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C7H10N2OS/c1-2-3-5-4-6(10)9-7(11)8-5/h4H,2-3H2,1H3,(H2,8,9,10,11)/f/h8-9H
|
| Chemical IUPAC Name |
Propylthiouracil¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 6-propyl-2-sulfanylidene-1H-pyrimidin-4-one
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-12-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|