| |
|
|
|
|
|
 |
| |
|
Ÿ¹ÚŽÁÖ4.5g(ÇÇÆä¶ó½Ç¸°³ªÆ®·ý¡¤Å¸Á¶¹Ú޳ªÆ®·ý) Tabactam inj.
|
Àü¹®ÀǾàǰ | ±Þ¿©
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
645902890[A01306831]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\6,923 ¿ø/1º´(2024.07.01)(ÇöÀç¾à°¡)
\7,044 ¿ø/1º´(2022.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö - À¯¹é»öÀÇ µ¿°á°ÇÁ¶Á¦°¡ µé¾îÀÖ´Â ¹«»öÅõ¸íÇÑ ¹ÙÀÌ¾Ë [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
10¹ÙÀÌ¾Ë |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 4.5±×·¥ |
10 ¹ÙÀÌ¾Ë |
Vial |
8806459028907 |
8806459028921 |
|
| 4.5±×·¥ |
1 ¹ÙÀÌ¾Ë |
Vial |
8806459028907 |
8806459028914 |
|
|
| ÁÖ¼ººÐÄÚµå |
329600BIJ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¡Û À¯È¿±ÕÁ¾
1) ÇÇÆä¶ó½Ç¸°¿¡ °¨¼ö¼ºÀÌ ÀÖ´Â Æä´Ï½Ç¸®³×À̽º ºñ»ý¼º±Õ
¤ý ±×¶÷¾ç¼º±¸±Õ : Æä´Ï½Ç¸° °¨¼ö¼º ¿¬¼â±¸±Õ, Æó·Å¿¬¼â±¸±Õ, ´ëº¯ Àå³»±¸±Õ, Æä´Ï½Ç¸®³×À̽º ºñ»ý¼º Æ÷µµ±¸±Õ
¤ý ±×¶÷À½¼º±¸±Õ : ¼ö¸·¿°±Õ, º£Å¸¶ôŸ¸¶Á¦ ºñ»ý¼º ÀÓ±Õ
¤ý ±×¶÷¾ç¼º°£±Õ : ´Ü±¸¼º ¸®½ºÅ׸®¾Æ, ´Üµ¶±Õ, ÄÚ¸®³×¹ÚÅ×·ý¼Ó
¤ý ±×¶÷À½¼º°£±Õ : Àå³»°£±Õ-Æä´Ï½Ç¸®³×À̽º ºñ»ý¼º ´ëÀå±Õ, »ì¸ð³Ú¶ó±Õ, ÀÌÁú±Õ, ÇÁ·ÎÅ׿콺 ¹Ì¶óºô¸®½º, ¿£Å׷ιÚÅͱÕ, ½ÃÆ®·Î¹ÚÅͱÕ, ¼¼¶óƼ¾Æ±Õ
2) Æä´Ï½Ç¸®³×À̽º ºñ»ý¼º Çì¸ðÇʷ罺
3) º£Å¸¶ôŸ¸¶Á¦ ºñ»ý¼º±Õ
¤ý ±×¶÷¾ç¼º Çø±â¼º±Õ : ÆéÅ䱸±Õ, ÆéÅ俬¼â±¸±Õ, Ŭ·Î½ºÆ®¸®µã, ¹æ¼±±Õ, ÇÁ·ÎÇÇ¿À´Ï¹ÚÅ×·ý, À¯¹ÚÅ×·ý¼Ó
¤ý ±×¶÷À½¼º Çø±â¼º±Õ : º£ÀϷγڶó
4) ÇÇÆä¶ó½Ç¸° ´Üµ¶¿¡ ³»¼ºÀ» ³ªÅ¸³»´Â Æä´Ï½Ç¸®³×À̽º »ý¼º±Õ
¤ý¸ÞƼ½Ç¸° °¨¼ö¼º Æ÷µµ»ó±¸±Õ, ÀÎÇ÷翣ÀÚ±Õ, īŸ¸£¼º ¸ð¶ô¼¿¶ó, ÀÓ±Õ, ¹ÚÅ×·ÎÀ̵ðÁî ÇöóÁú¸®½º, ¿£Å׷ιÚÅͱÕ
¡Û ÀûÀÀÁõ
¼ºÀÎ
- Æó·Å
- Àü¸³¼±¿°À» Á¦¿ÜÇÑ ºñ´¢±â °¨¿°
- º¹°³» °¨¿° ¹× ´ã³¶¿°
- ÇǺΰ¨¿°
- È£Áß±¸°¨¼ÒÁõ ȯÀÚÀÇ ¹ß¿ ¹× °¨¿°Áõ
- ¼¼±Õ¼º ÆÐÇ÷Áõ
¼Ò¾Æ
- È£Áß±¸°¨¼ÒÁõ ȯÀÚÀÇ ¹ß¿ ¹× °¨¿°Áõ
- º¹¸·¿°, ³ó¾ç µîÀÇ ÇÕº´ÁõÀÌ µ¿¹ÝµÈ Ãæ¼ö¿°
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¡Û 12¼¼ ÀÌ»óÀÇ ¼Ò¾Æ ¹× ¼ºÀÎ - Åë»ó 4.5 gÀ» 8½Ã°£¸¶´Ù 1ÀÏ 3ȸ Åõ¿©ÇÑ´Ù.
°¨¿°Á¤µµ ¹× °¨¿°ºÎÀ§¿¡ µû¶ó Áõ°¨ÇÑ´Ù. 1ÀÏ 18 g±îÁö Áõ·®ÇÒ ¼ö ÀÖ´Ù.
È£Áß±¸°¨¼ÒÁõ ȯÀÚÀÇ °æ¿ì, ÀÌ ¾à 4.5 gÀ» 6½Ã°£¸¶´Ù 1ÀÏ 4ȸ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å¿Í º´¿ë Åõ¿©ÇÏ´Â °ÍÀÌ ±ÇÀåµÈ´Ù.
¡Û ½ÅºÎÀü ȯÀÚÀÇ °æ¿ì´Â ´ÙÀ½ Ç¥¿Í °°´Ù.
| Å©·¹¾ÆÆ¼´Ñ û¼ÒÀ²(mL/min) |
1ÀÏ ±ÇÀå·® |
| > 40 |
Áõ°¨ ¾øÀ½ |
| 20 ¢¦ 40 |
4.5 gÀ» 8½Ã°£¸¶´Ù 1ÀÏ 3ȸ |
| < 20 ¹× Ç÷¾× Åõ¼® |
4.5 gÀ» 12½Ã°£¸¶´Ù 1ÀÏ 2ȸ |
¡Û Ç÷¾×Åõ¼® ȯÀÚ´Â 4.5 gÀ» 1ÀÏ 2ȸ 12½Ã°£ °£°ÝÀ¸·Î Åõ¿©ÇÑ´Ù. °¢ Ç÷¾×Åõ¼®ÀÌ ³¡³ ÈÄ 2.25 gÀ» º¸Ãæ Åõ¿©ÇÏ¿©¾ß ÇÑ´Ù.
¡Û °í·ÉÀÚ¿¡ À־Â, Å©·¹¾ÆÆ¼´Ñû¼ÒÀ²ÀÌ 40 mL/min ÀÌ»óÀÏ °æ¿ì¿¡´Â ¿ë·® Áõ°¨ÀÌ ¾øÀ¸¸ç, 40 mL/min ¹Ì¸¸ÀÎ °æ¿ì¿¡´Â ½ÅºÎÀü ȯÀÚÀÇ °æ¿ì¿Í µ¿ÀÏÇÏ°Ô Á¶ÀýÇÑ´Ù.
¡Û 12¼¼ ÀÌÇÏÀÎ ¼Ò¾ÆÀÇ °æ¿ì, È£Áß±¸°¨¼ÒÁõ ¹× ÇÕº´ÁõÀÌ µ¿¹ÝµÈ Ãæ¼ö¿°¿¡¸¸ ÀÌ ¾àÀ» »ç¿ëÇÒ ¼ö ÀÖ´Ù.
È£Áß±¸°¨¼ÒÁõ - Á¤»óÀûÀÎ ½Å±â´ÉÀ» °¡Áø 50 kg ÀÌÇÏÀÇ ¼Ò¾ÆÀÇ °æ¿ì, 6½Ã°£¸¶´Ù ÀÌ ¾à 90 mg/kgÀ» ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å¿Í º´¿ë Åõ¿©ÇÑ´Ù. 50 kg ÀÌ»óÀÇ ¼Ò¾ÆÀÇ °æ¿ì´Â ¼ºÀΰú °°´Ù.
ÇÕº´ÁõÀÌ µ¿¹ÝµÈ Ãæ¼ö¿° - Á¤»óÀûÀÎ ½Å±â´ÉÀ» °¡Áø 2 ¢¦ 12¼¼ ¼Ò¾ÆÀÇ °æ¿ì, 40 kgÀÌÇÏÀÏ ¶§´Â 112.5 mg/kgÀ» 8½Ã°£¸¶´Ù Åõ¿©ÇÑ´Ù.
´õ ¸¹Àº ÀÓ»óÀû °æÇèÀÌ À¯È¿ÇÒ ¶§±îÁö, ÀÌ ¾àÀº È£Áß±¸°¨¼ÒÁõ ¹× ÇÕº´ÁõÀÌ µ¿¹ÝµÈ Ãæ¼ö¿° ÀÌ¿ÜÀÇ ¼Ò¾Æ¿¡´Â »ç¿ëÇØ¼´Â ¾ÈµÈ´Ù.
¡Û ½ÅºÎÀü ¼Ò¾Æ ȯÀÚ(12¼¼ ÀÌÇÏ)
50 kg ÀÌÇÏÀÇ ½ÅºÎÀü ¼Ò¾Æ ȯÀÚÀÇ °æ¿ì, ½ÇÁúÀûÀÎ ½Å±â´É ¼Õ»óÀÇ Á¤µµ¿¡ µû¶ó ´ÙÀ½°ú °°ÀÌ ¿ë·®À» Á¶ÀýÇÏ¿©¾ß ÇÑ´Ù.
| Å©·¹¾ÆÆ¼´Ñû¼ÒÀ²(mL/min) |
1ÀÏ ±ÇÀå·® |
| 40 ¢¦ 80 |
6½Ã°£¸¶´Ù 90 mg/kg |
| 20 ¢¦ 40 |
8½Ã°£¸¶´Ù 90 mg/kg |
| < 20 |
12½Ã°£¸¶´Ù 90 mg/kg |
¡Û Ç÷¾×Åõ¼® ÁßÀÎ 50 kg ÀÌÇÏÀÇ ¼Ò¾ÆÀÇ °æ¿ì, 8½Ã°£¸¶´Ù ÀÌ ¾à 45 mg/kgÀÇ Åõ¿©°¡ ±ÇÀåµÈ´Ù.
¡Û Åõ¿©¹ý
»ç¿ë°¡´ÉÇÑ À籸¼º Èñ¼®¿ëÁ¦(12. Àû¿ë»óÀÇ ÁÖÀÇ Âü°í)¿¡ ³ì¿© »ç¿ëÇÑ´Ù. 2.25 g ÁÖ»ç´Â 10 mL¿¡ ³ìÀ̰í, 4.5 g ÁÖ»ç´Â 20 mL¿¡ ³ìÀδÙ. ÀÌ ¿ë¾×À» »ç¿ë°¡´ÉÇÑ Á¤¸ÆÁÖ»ç¿ë¾×(12. Àû¿ë»óÀÇ ÁÖÀÇ Âü°í)À¸·Î Èñ¼®½ÃÄÑ 50 mL ¢¦ 150 mL·Î ÇÑ ÈÄ 30ºÐ°£ Á¡Àû Á¤¸Æ ÁÖ»çÇÑ´Ù.
|
| ±Ý±â |
1) Æä´Ï½Ç¸°°è, ¼¼ÆÈ·Î½ºÆ÷¸°°è ¶Ç´Â º£Å¸¶ôŸ¸¶Á¦ ÀúÇØÁ¦¿¡ ±Þ¼º ÁßÁõ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ(¾Ë·¹¸£±â ¹ÝÀÀÀÌ ³ªÅ¸³ª¸é Åõ¿©¸¦ ÁßÁöÇÑ´Ù. ÇÇÆä¶ó½Ç¸° Åõ¿©·Î ¾Æ³ªÇʶô½Ã½º ¹ÝÀÀÀÌ À¯µµµÈ ÀûÀÌ ÀÖÀ¸¹Ç·Î ÇÇÆä¶ó½Ç¸°ÀÇ Åõ¿©Àü¿¡ ȯÀÚÀÇ º´·ÂÀ» °ËÅäÇÏ¿©¾ß Çϸç, º´·ÂÀÌ Àִ ȯÀÚ¿¡´Â Åõ¿©±Ý±âÀÌ´Ù. Æä´Ï½Ç¸°Àº ¼¼ÆÈ·Î½ºÆ÷¸°°ú 5¡©¢¦ 10 % ±³Â÷ ¾Ë·¹¸£±â¸¦ À¯¹ßÇϹǷΠ¼¼ÆÈ·Î½ºÆ÷¸°¿¡ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ¿¡µµ ÇÇÆä¶ó½Ç¸°À» Åõ¿©Çؼ´Â ¾ÈµÈ´Ù)
2) ÀÌ ¾à ¶Ç´Â Æä´Ï½Ç¸°°è Ç×»ý¹°Áú¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ
3) Àü¿°´ÜÇÙ±¸Áõ ȯÀÚ(Æä´Ï½Ç¸°°è Ç×»ý¹°Áú Åõ¿©·Î ¹ßÁøÀÌ ³ªÅ¸³µ´Ù´Â º¸°í°¡ ÀÖ´Ù) |
| ½ÅÁßÅõ¿© |
1) ½ÅÀå¾Ö ȯÀÚ(Ç÷¾×Åõ¼® ȯÀÚ Æ÷ÇÔ)(Å©·¹¾ÆÆ¼´Ñû¼ÒÀ² ¹× ½Å±â´ÉÀå¾Ö Á¤µµ¸¦ Âü°íÇÏ¿© ¿ë·®À» Á¶ÀýÇÏ¿©¾ß Çϸç ÀÀÇ÷ ÀÌ»óÀÌ ÀÖÀ¸¸é Ä¡·á¸¦ Áß´ÜÇØ¾ß ÇÑ´Ù)
2) ¼¼Æè°è Ç×»ý¹°Áú¿¡ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ
3) °£Àå¾Ö ȯÀÚ(Ç÷Áß³óµµ°¡ Áö¼ÓµÉ ¿ì·Á°¡ ÀÖ´Ù)
4) º»ÀÎ ¶Ç´Â ºÎ¸ð, ÇüÁ¦°¡ ±â°üÁöõ½Ä, ¹ßÁø, µÎµå·¯±â µî ¾Ë·¹¸£±â Áõ»óÀ» ÀÏÀ¸Å°±â ½¬¿î üÁúÀΠȯÀÚ
5) °æ±¸ ¼·Ãë°¡ ºÒ·®ÇÑ È¯ÀÚ, ºñ°æ±¸Àû ¿µ¾ç ȯÀÚ, Àü½Å»óŰ¡ ³ª»Û ȯÀÚ(ºñŸ¹Î K °áÇÌÁõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
6) ÃâÇ÷¼ÒÀÎÀÌ Àִ ȯÀÚ(ÃâÇ÷°æÇâÀ» Á¶ÀåÇÒ ¿ì·Á°¡ ÀÖ´Ù) |
| ÀÌ»ó¹ÝÀÀ |
1) ÀÌ ¾à¿¡ ÀÇÇÑ ÀÌ»ó¹ÝÀÀÀ» ¾Æ·¡ Ç¥¿¡ ³ª¿ÇÏ¿´´Ù.
| ±â°ü°è |
¸Å¿ì ÈçÇÏ°Ô ¡Ã 1/10 |
ÈçÇÏ°Ô ¡Ã 1/100, < 1/10 |
ÈçÇÏÁö ¾Ê°Ô ¡Ã 1/1,000, < 1/100 |
µå¹°°Ô ¡Ã 1/10,000, < 1/1,000 |
ºóµµºÒ¸í(±âÁ¸ÀÇ ÀÚ·á·Î Æò°¡ ÇÒ ¼ö ¾øÀ½) |
| °¨¿° |
|
ĵð´ÙÁõ* |
|
À§¸·¼º´ëÀå¿° |
|
| Ç÷¾× ¹× ¸²ÇÁ°è |
|
Ç÷¼ÒÆÇ °¨¼ÒÁõ, ºóÇ÷* |
¹éÇ÷±¸°¨¼ÒÁõ |
¹«°ú¸³±¸Áõ, |
¹üÇ÷±¸°¨¼ÒÁõ*, Áß¼º±¸°¨¼ÒÁõ, ¿ëÇ÷¼ººóÇ÷*, È£»ê±¸Áõ°¡Áõ*, Ç÷¼ÒÆÇÁõ°¡Áõ* |
| ¸é¿ª°è |
|
|
|
|
¾Æ³ªÇʶô½Ã½º¸ð¾ç ¹ÝÀÀ * , ¾Æ³ªÇʶô½Ã½º¹ÝÀÀ*, ¾Æ³ªÇʶô½Ã½º¸ð¾ç¼îÅ©*, ¾Æ³ªÇʶô½Ã½º¼îÅ©*, °ú¹Î¼º* |
| ´ë»ç ¹× ¿µ¾ç |
|
|
ÀúÄ®·ýÇ÷Áõ |
|
|
| Á¤½Å°è |
|
ºÒ¸éÁõ |
|
|
|
| ½Å°æ°è |
|
µÎÅë |
|
|
|
| Ç÷°ü |
|
|
ÀúÇ÷¾Ð, Á¤¸Æ¿°, Ç÷ÀüÁ¤¸Æ¿°, È«Á¶ |
|
|
| È£Èí±â, ÈäºÎ ¹× Á¾°Ý |
|
|
|
ÄÚÇÇ |
È£»ê±¸¼ºÆó·Å* |
| À§Àå°ü°è |
¼³»ç |
º¹Åë, ±¸¿ª, ±¸Åä, º¯ºñ, ¼ÒȺҷ® |
|
±¸³»¿° |
|
| °£´ãµµ |
|
|
|
|
°£¿°*, Ȳ´Þ |
| ÇǺΠ¹× ÇÇÇÏÁ¶Á÷ |
|
¹ßÁø, °¡·Á¿ò |
´ÙÇüÈ«¹Ý*, µÎµå·¯±â, ¹ÝÁ¡±¸Áø¹ßÁø* |
µ¶ ¼º Ç¥ ÇÇ ±« »ç¿ëÇØ* |
ÇǺÎÁ¡¸·¾ÈÁõÈıº(½ºÆ¼ºì½º-¡©Á¸½¼ ÁõÈıº*), È£»ê±¸Áõ°¡Áõ°ú Àü½ÅÁõ»óÀ» µ¿¹ÝÇÑ ¾à¹°¹ÝÀÀ(DRESS)*, ±Þ¼º Àü½Å¼º ¹ßÁø¼º °í¸§¹°ÁýÁõ(AGEP)*, Å»¶ôÇǺο°, ¼öÆ÷¼º ÇǺο°, ÀÚ»ö¹Ý |
| ±Ù °ñ °Ý °è , °áÇÕÁ¶Á÷ |
|
|
°üÀýÅë, ±ÙÀ°Åë |
|
Ⱦ¹®±Ù À¶ÇØ* |
| ½ÅÀå ¹× ºñ´¢±â°è |
|
|
|
|
½ÅºÎÀü, ¼¼´¢°ü°£Áú¼º ½Å¿°* |
| Àü½ÅÀÌ»ó ¹× Åõ¿©ºÎÀ§ Áõ»ó |
|
¹ß¿, ÁÖ»çºÎÀ§¹ÝÀÀ |
¿ÀÇÑ |
|
|
| °Ë»ç |
|
¾Ë¶ó´Ñ¾Æ¹Ì³ëÀüÀÌÈ¿¼Ò(ALT)Áõ°¡, ¾Æ½ºÆÄ¸£Å×ÀÌÆ®¾Æ¹Ì³ëÀüÀÌÈ¿¼Ò(AST)Áõ °¡, ÃѴܹéÁú°¨¼Ò, Ç÷Á߾˺ιΰ¨¼Ò, Á÷Á¢ ÄñÁî¹ÝÀÀ ¾ç¼º, Ç÷ÁßÅ©·¹¾ÆÆ¼´ÑÁõ°¡, Ç÷Áß¾ËÄ«¸®ÀλêºÐÇØÈ¿¼Ò Áõ°¡, Ç÷Áß¿ä¼ÒÁõ°¡, Ȱ¼ºÈ ºÎºÐÆ®·Òº¸ÇÃ¶ó½ºÆ¾ ½Ã°£ Áö¿¬ |
Ç÷´ç°¨¼Ò,Ç÷ Áß ºô ¸® ·ç ºó Áõ°¡, ÇÁ ·Î Æ® ·Ò ºó ½Ã°£Áö¿¬ |
|
ÃâÇ÷½Ã°£¿¬Àå, °¨¸¶±Û·çŸ¹ÐÀüÀÌÈ¿¼Ò Áõ°¡ |
* ½ÃÆÇÈÄ¿¡ È®ÀÎµÈ ÀÌ»ó¹ÝÀÀ
2) ±âŸ
(1) ¶ÇÇÑ, ÇÇÆä¶ó½Ç¸° Ä¡·á´Â ³¶¼º ¼¶À¯Áõ ȯÀÚÀÇ ¹ß¿ ¹× ¹ßÁø Áõ°¡¿Í °ü·ÃµÇ¾î ÀÖ´Ù.
(2) ±¹³» ½ÃÆÇ ÈÄ Á¶»ç°á°ú(Á¶»çÁõ·Ê¼ö : 831¸í) º¸°íµÈ ÀÌ»ó¹ÝÀÀÀº ´ÙÀ½°ú °°À¸¸ç, ÀÌ ¾à°ú °ü·Ã ¿©ºÎ´Â È®½ÇÇÏÁö ¾Ê´Ù: ESR°ú CRPÁõ°¡, ÀûÇ÷±¸ ħ° Áõ°¡, ¹éÇ÷±¸Áõ°¡Áõ, ÇÁ·ÎÆ®·Òºó °áÇÌ, È£Èí°ï¶õ, ±âħ, Æó¿ïÇ÷, ÈäÅë
3) ±¹³» ÀÚ¹ßÀû ÀÌ»ó»ç·Ê º¸°íÀÚ·á(1989 ¢¦ 2014.6¿ù)¸¦ ºÐ¼®ÇÑ °á°ú, ÀÌ»ó»ç·Ê°¡ º¸°íµÈ ´Ù¸¥ ÀǾàǰ¿¡¼ ¹ß»ýÇÑ ÀÌ»ó»ç·Ê¿¡ ºñÇØ Åë°èÀûÀ¸·Î À¯ÀÇÇÏ°Ô ¸¹ÀÌ º¸°íµÈ ÀÌ»ó»ç·Ê´Â ´ÙÀ½°ú °°ÀÌ ³ªÅ¸³µ´Ù. ´Ù¸¸, À̷μ °ð ÇØ´ç¼ººÐ°ú ´ÙÀ½ÀÇ ÀÌ»ó»ç·Ê °£¿¡ Àΰú°ü°è°¡ ÀÔÁõµÈ °ÍÀ» ÀǹÌÇÏ´Â °ÍÀº ¾Æ´Ï´Ù.
⦁ ½ÉÀå°è : ºó¸Æ
|
| »óÈ£ÀÛ¿ë |
1) °æ±¸ Ç×ÀÀ°íÁ¦ : ÀÌ ¾àÀ» °í¿ë·®ÀÇ ÇìÆÄ¸°, °æ±¸ Ç×ÀÀ°íÁ¦ ¶Ç´Â Ç÷¼ÒÆÇ ±â´ÉÀ» Æ÷ÇÔÇÑ Ç÷¾×ÀÀ°í°è¿¡ ¿µÇâÀ» ¹ÌÄ¡´Â ¾à¹°°ú º´¿ëÅõ¿©½Ã Ç÷¾×ÀÀ°í °Ë»ç¸¦ ´õ¿í ÀÚÁÖ ½Ç½ÃÇϰí, Á¤±âÀûÀ¸·Î ¸ð´ÏÅ͸µÇÏ¿©¾ß ÇÑ´Ù.
2) ºñÅ»ºÐ±Ø¼º ±ÙÀÌ¿ÏÁ¦ : º£Å¥·Î´½°ú ÇÇÆä¶ó½Ç¸°ÀÇ º´¿ëÅõ¿©½Ã º£Å¥·Î´½ÀÇ ½Å°æ±Ù Â÷´ÜÀÛ¿ëÀÌ ¿¬ÀåµÇ¾ú´Ù. À¯»çÇÑ ÀÛ¿ë±âÀüÀ¸·Î ÀÎÇØ ºñÅ»ºÐ±Ø¼º ±ÙÀÌ¿ÏÁ¦¿¡ ÀÇÇÑ ½Å°æ±Ù Â÷´ÜÀÌ ÇÇÆä¶ó½Ç¸°¿¡ ÀÇÇØ ¿¬ÀåµÉ ¼ö ÀÖ´Ù.
3) ¸ÞÅ䯮·º¼¼ÀÌÆ® : ÇÇÆä¶ó½Ç¸°Àº ¸ÞÅ䯮·º¼¼ÀÌÆ®ÀÇ ¹è¼³À» °¨¼Ò½Ãų ¼ö ÀÖ´Ù. µû¶ó¼, ¾à¹° µ¶¼ºÀ» ¹æÁöÇϱâ À§Çؼ´Â ¸ÞÅ䯮·º¼¼ÀÌÆ®ÀÇ Ç÷Áß ³óµµ¸¦ ¸ð´ÏÅ͸µÇØ¾ß ÇÑ´Ù.
4) ÇÁ·Îº£³×½Ãµå : ´Ù¸¥ Æä´Ï½Ç¸°°è Ç×»ýÁ¦¿Í ¸¶Âù°¡Áö·Î, ÀÌ ¾à°ú ÇÁ·Îº£³×½ÃµåÀÇ º´¿ëÅõ¿©½Ã ÇÇÆä¶ó½Ç¸°°ú ŸÁ¶¹ÚŽ ¸ðµÎ °¢°¢ÀÇ ¹Ý°¨±â´Â Áõ°¡ÇÏ°í ½ÅÀåû¼ÒÀ²Àº °¨¼ÒÇÑ´Ù. ±×·¯³ª µÎ ¼ººÐÀÇ Ç÷Áß ÃÖ°í ³óµµ¿¡´Â ¿µÇâÀ» ¹ÌÄ¡Áö ¾Ê´Â´Ù.
5) Åäºê¶ó¸¶À̽Š: ÀÌ ¾àÀ» Åäºê¶ó¸¶À̽Űú º´¿ëÅõ¿©½Ã Åäºê¶ó¸¶À̽ÅÀÇ ½ÅÀå û¼ÒÀ², Ç÷¾×Ä¡, AUC ¹× ºÐÆ÷¿ëÀûÀº °¨¼ÒÇϳª ÀÌ ¾àÀÇ ¾à¹°µ¿·ÂÇÐÀû ¼öÄ¡¿¡´Â º¯È°¡ ¾ø´Ù. ÇÊ¿ä½Ã ¿ë·®À» Á¶ÀýÇÑ´Ù.
6) ¹ÝÄÚ¸¶À̽Š: ÀÌ ¾àÀº ¹ÝÄÚ¸¶À̽Űú º´¿ëÅõ¿©½Ã ¾àµ¿ÇÐÀû »óÈ£ÀÛ¿ëÀ» ³ªÅ¸³»Áö ¾Ê¾Ò´Ù. ±×·¯³ª Á¦ÇÑµÈ ¼öÀÇ ÈÄÇâÀû ¿¬±¸¿¡¼ ¹ÝÄÚ¸¶À̽Š´ÜÀÏ¿ä¹ý¿¡ ºñÇØ ÀÌ ¾à°ú ¹ÝÄÚ¸¶À̽Šº´¿ëÅõ¿© ȯÀÚ±º¿¡¼ ±Þ¼º ½ÅÀå¼Õ»óÀÇ ¹ß»ý·ü Áõ°¡°¡ °üÂûµÇ¾ú´Ù. |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
(piperacillin; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Piperacillin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ By binding to specific penicillin-binding proteins (PBPs) located inside the bacterial cell wall, Piperacillin inhibits the third and last stage of bacterial cell wall synthesis. Cell lysis is then mediated by bacterial cell wall autolytic enzymes such as autolysins; it is possible that Piperacillin interferes with an autolysin inhibitor.
Tazobactam¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Tazobactam broadens the spectrum of piperacillin by making it effective against organisms that express beta-lactamase and would normally degrade piperacillin.
|
| Pharmacology |
Piperacillin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Piperacillin is a penicillin beta-lactam antibiotic used in the treatment of bacterial infections caused by susceptible, usually gram-positive, organisms. The name "penicillin" can either refer to several variants of penicillin available, or to the group of antibiotics derived from the penicillins. Piperacillin has in vitro activity against gram-positive and gram-negative aerobic and anaerobic bacteria. The bactericidal activity of Piperacillin results from the inhibition of cell wall synthesis and is mediated through Piperacillin binding to penicillin binding proteins (PBPs). Piperacillin is stable against hydrolysis by a variety of beta-lactamases, including penicillinases, and cephalosporinases and extended spectrum beta-lactamases.
Tazobactam¿¡ ´ëÇÑ Pharmacology Á¤º¸ Tazobactam is a compound which inhibits the action of bacterial beta-lactamases. It is added to the extended spectrum beta-lactam antibiotic piperacillin.
|
| Metabolism |
Piperacillin¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Piperacillin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Piperacillin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 36-72 minutes
|
| Absorption |
Piperacillin¿¡ ´ëÇÑ Absorption Á¤º¸ Not absorbed following oral administration.
Tazobactam¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
|
| Biotransformation |
Piperacillin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Largely not metabolized.
|
| Toxicity |
Piperacillin¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Piperacillin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Methotrexate The penicillin increases the effect and toxicity of methotrexateAnisindione The IV penicillin increases the anticoagulant effectDicumarol The IV penicillin increases the anticoagulant effectAcenocoumarol The IV penicillin increases the anticoagulant effectWarfarin The IV penicillin increases the anticoagulant effectAtracurium The agent increases the effect of the muscle relaxantGallamine Triethiodide The agent increases the effect of the muscle relaxantMetocurine The agent increases the effect of the muscle relaxantMivacurium The agent increases the effect of the muscle relaxantPancuronium The agent increases the effect of the muscle relaxantPipecuronium The agent increases the effect of the muscle relaxantRocuronium The agent increases the effect of the muscle relaxantSuccinylcholine The agent increases the effect of the muscle relaxantTubocurarine The agent increases the effect of the muscle relaxantVecuronium The agent increases the effect of the muscle relaxantTetracycline Possible antagonism of actionRolitetracycline Possible antagonism of actionOxytetracycline Possible antagonism of actionMinocycline Possible antagonism of actionMethacycline Possible antagonism of actionDoxacurium The agent increases the effect of the muscle relaxantDemeclocycline Possible antagonism of actionDoxycycline Possible antagonism of actionEthinyl Estradiol This anti-infectious agent could decrease the effect of the oral contraceptiveMestranol This anti-infectious agent could decrease the effect of the oral contraceptive
Tazobactam¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Demeclocycline Possible antagonism of actionDoxycycline Possible antagonism of actionMethacycline Possible antagonism of actionMinocycline Possible antagonism of actionOxytetracycline Possible antagonism of actionRolitetracycline Possible antagonism of actionTetracycline Possible antagonism of action
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Piperacillin¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available
Tazobactam¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Piperacillin¿¡ ´ëÇÑ Description Á¤º¸ Semisynthetic, broad-spectrum, ampicillin derived ureidopenicillin antibiotic proposed for pseudomonas infections. It is also used in combination with other antibiotics. [PubChem]
Tazobactam¿¡ ´ëÇÑ Description Á¤º¸ Tazobactam is a antibacterial penicillin derivative which inhibits the action of bacterial beta-lactamases.
|
| Drug Category |
Piperacillin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsPenicillins
Tazobactam¿¡ ´ëÇÑ Drug_Category Á¤º¸ Enzyme Inhibitors
|
| Smiles String Canonical |
Piperacillin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCN1CCN(C(=O)NC(C(=O)NC2C3SC(C)(C)C(N3C2=O)C(O)=O)C2=CC=CC=C2)C(=O)C1=O
Tazobactam¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1(CN2C=CN=N2)C(N2C(CC2=O)S1(=O)=O)C(O)=O
|
| Smiles String Isomeric |
Piperacillin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN1CCN(C(=O)N[C@@H](C(=O)N[C@H]2[C@H]3SC(C)(C)[C@@H](N3C2=O)C(O)=O)C2=CC=CC=C2)C(=O)C1=O
Tazobactam¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@@]1(CN2C=CN=N2)[C@H](N2[C@H](CC2=O)S1(=O)=O)C(O)=O
|
| InChI Identifier |
Piperacillin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C23H27N5O7S/c1-4-26-10-11-27(19(32)18(26)31)22(35)25-13(12-8-6-5-7-9-12)16(29)24-14-17(30)28-15(21(33)34)23(2,3)36-20(14)28/h5-9,13-15,20H,4,10-11H2,1-3H3,(H,24,29)(H,25,35)(H,33,34)/t13-,14-,15+,20-/m1/s1/f/h24-25,33H
Tazobactam¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/f/h16H
|
| Chemical IUPAC Name |
Piperacillin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (2S,5R,6R)-6-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
Tazobactam¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (2S,3S,5R)-3-methyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4$l^{6}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-08-21
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|