  | 
   
  
    
        
          |   | 
          
              
                | 
                    ¾ËÅ©·Î¹ÝÅ©¸²0.1%(µðÇÁ·ÎÇǿ»ê¾ËŬ·Î¸ÞŸ¼Õ)  ALCROVAN CREAM.[Alclometasone Dipropionate]  
                    
                 | 
               
              
                | 
                     Àü¹®ÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |                   
                                        | 
                                             | 
                                         
                            
                            
                                         |  
                                        
                                          
                                            
                                              | º´¿ë±Ý±â |  
                                                                  
                                           | 
                                         
                                         |  
                                        
                                          | 
                                            
                                           | 
                                                                               
                                         |  
                                        
                                
                            
                            
                              
                                                        
                              
                                                
                            
 |   
    | 
      
     | 
 
 |  
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
  
  
    
      
  
    
       |  
      
        
          
            
                | Çã°¡Á¤º¸ | 
             
           
         | 
       
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        642000760[A30603511]  
	    
	    
            [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \0 ¿ø/1g(2016.10.01)(ÇöÀç¾à°¡)
            \145 ¿ø/1g(2014.02.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
      [Áúº´ÄÚµåÁ¶È¸]
     
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
  
   
    | Á¦Ç°¼º»ó | 
    ¹é»öÀÇ Å©¸²Á¦  [Á¦ÇüÁ¤º¸ È®ÀÎ] |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    1mg/g¡¿10g¡¿1EA | 
   
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            Æ÷ÀåÇüÅ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 10±×·¥ | 
            1 °³ | 
            Æ©ºê | 
            8806420007603 | 
            8806420007610 | 
             | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      103402CCM  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
 
  
  
    
  
  
  
  
  
  
  
  
  
  
 
  
  
  
 
  
  
  
  
  
  
   
    | Çã°¡»çÇ× ¿ø¹®Á¶È¸ | 
    
      
	    [Çã°¡»çÇ× ¿ø¹®Á¶È¸] 
     | 
   
  
  
  
  
     
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      ½ÀÁø¡¤ÇǺο°±º(ÁøÇ༺ÁöÀå°¢ÇÇÁõÆ÷ÇÔ),°Ç¼±,¾çÁø±º(±¸ÁøµÎµå·¯±â¸¦ Æ÷ÇÔ),¹ú·¹¹°¸°µ¥,¼Õ¡¤¹ß¹Ù´Ú ³óÆ÷Áõ,ÆíÆòż±,Àå¹Ì»öºñ°Áø,È«¹ÝÁõ(´ÙÇüħÃ⼺ȫ¹Ý,¸ð³¶°¢ÈÁõ),¾àÁø,Áßµ¶Áø,È«ÇÇÁõ,ÁøÇ༺ »ö¼Ò¼ºÀڹݼºÇǺκ´,¸¸¼º¿øÆÇ»óÈ«¹Ý¼º·çǪ½º
      
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
    
  
  
  
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
      [󹿾à¾î] 
      [ÁÖ¼ººÐÄÚµå:103402CCM ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]   
[Á¦Çüº°º¹¾àÁöµµ]     
      	
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    1) ¼¼±Õ(°áÇÙ, ¸Åµ¶ µî)¡¤Áø±Õ(ĵð´ÙÁõ, ¹é¼± µî)¡¤¹ÙÀÌ·¯½º(´ë»óÆ÷Áø, ´Ü¼øÆ÷Áø, ¼öµÎ, Á¾µÎÁõ µî)¡¤µ¿¹°(¿È, »ç¸é¹ßÀÌ µî)¼º ÇǺΰ¨¿°Áõ ȯÀÚ(Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)   
2) ÀÌ ¾à ¶Ç´Â ÀÌ ¾à ¼ººÐ¿¡ ÀÇÇÑ °ú¹ÎÁõ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ  
3) °í¸· õ°øÀÌ ÀÖ´Â ½ÀÁø¼º ¿ÜÀ̵µ¿° ȯÀÚ(õ°øºÎÀ§ÀÇ Ä¡À¯Áö¿¬ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)  
4) ±Ë¾ç(º£Ã¼Æ®º´Àº Á¦¿Ü), Á¦2µµ ½ÉÀ缺 ÀÌ»óÀÇ È»ó¡¤µ¿»ó ȯÀÚ(ÇǺÎÀç»ýÀÌ ¾ï Á¦µÇ¾î Ä¡À¯°¡ Áö¿¬µÉ ¼ö ÀÖ´Ù)  
5) ÀÔÁÖÀ§ ÇǺο°, º¸Åë ¿©µå¸§, ÁÖ»çȯÀÚ  
6) 1¼¼ ÀÌÇÏÀÇ ¿µ¾Æ  | 
   
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
    1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ  
2) À¯¡¤¼Ò¾Æ  
3) °í·ÉÀÚ  
4) ÀÌ ¾àÀº ÇÁ·ÎÇÊ·»±Û¸®ÄÝÀ» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î ÀÌ ¼ººÐ¿¡ °ú¹ÎÇϰųª ¾Ë·¹¸£ ±â º´·ÂÀÌ Àִ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. 
 | 
   
  
    
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      1) ÇǺΠ 
¨ç °¨¿°Áõ : ÇǺÎÀÇ ¼¼±Õ¼º(Àü¿°¼º ³ó°¡Áø, ¸ð³¶¿° µî) ¹× Áø±Õ¼º(ĵð´ÙÁõ, ¹é ¼± µî), ¹ÙÀÌ·¯½º¼º °¨¿°ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù[¹ÐºÀºØ´ë¹ý(ODT)ÀÇ °æ¿ì ³ªÅ¸³ª ±â ½±´Ù]. ÀÌ¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â ÀûÀýÇÑ Ç×±ÕÁ¦³ª Ç×Áø±ÕÁ¦ µîÀ» º´¿ëÇϰí Áõ»óÀÌ ½Å¼ÓÈ÷ °³¼±µÇÁö ¾ÊÀ» °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.  
¨è ÀϹÝÀû ÇǺÎÁõ»ó : ¸ð³¶¿°, ºÎ½º·³, ÇǺÎÀÚ±Ø, ÀÚÅë, ¹ß¿, ÀÛ¿°¨, ¹ßÁø, ¹ßÀû, È«Á¶, °¡·Á¿ò, ÇǺΰÇÁ¶, ³óÆ÷¼º ÇǺο°, ¾Ë·¹¸£±â¼º Á¢ÃËÇǺο°, ¶¡¶ì, ÇÑÁø, »óó¾ÇÈ, ¿åâ, ³óÆ÷Áõ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.  
¨é Àå±â ¿¬¿ë : ½ºÅ×·ÎÀ̵强 ¿©µå¸§, ½ºÅ×·ÎÀ̵强 ÇǺÎ(ÇǺÎÀ§Ãà, ¸ð¼¼Ç÷°ü È®Àå, ÀÚ¹Ý), ½ºÅ×·ÎÀ̵强 ÁÖ»ç, ÀÔÁÖÀ§ ÇǺο°(ÀÔÁÖÀ§¡¤¾È¸é Àüü¿¡ È«¹Ý, ±¸Áø, ¸ð¼¼Ç÷°ü È®Àå, µüÁö, Àμ³), ¾î¸°¼±¾ç ÇǺκ¯È, ´Ù¸ð, »ö¼ÒÅ»½Ç, ¼±Á¶, ¼öÆ÷¼º ÇǺο°, ¾ÆÅäÇÇ ÇǺο°, ÇǺÎÃâÇ÷ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â õõÈ÷ »ç¿ë·®À» ÁÙ¿© ÄÚ¸£Æ¼ÄÚÀ̵带 ÇÔÀ¯ÇÏÁö ¾ÊÀº ¾àÀ¸·Î ¹Ù²Ù¾î »ç¿ëÇÑ´Ù.  
2) ³»ºÐºñ°è : ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ¹ÐºÀºØ´ë¹ý¿¡ ÀÇÇØ ÄÚ¸£ ƼÄÚÀ̵å Àü½ÅÅõ¿©¿Í °°Àº ³úÇϼöü¡¤ºÎ½ÅÇÇÁú°è ±â´ÉÀÇ ¾ïÁ¦¸¦ °¡Á®¿Ã ¼ö ÀÖ À¸¹Ç·Î ÁÖÀÇÇÑ´Ù.  
3) ´« : ¾È°Ë ÇǺο¡ »ç¿ë½Ã ¾È¾Ð »ó½Â, ³ì³»ÀåÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ƯÈ÷ ¹ÐºÀºØ´ë¹ýÀ» »ç¿ëÇÒ °æ¿ì Èij¶ÇϹ鳻Àå, ³ì³»Àå µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. 
      
     | 
   
        
  
  
  
    
  
  
       	
  
     
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
       
     | 
      
  
  
  |  
     
   
  
    
       |  
      
        
          
            
                | Á¤º¸¿ä¾à |         
             
           
         | 
             	    
       |  
      | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
     
   
  
    
       |  
      
        
          
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |         
             
           
         | 
             	    
       |  
      | 	 |  
     
   
  
    
       |  
      
        
          
            
                | Á¦Ç°Á¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | º¹¾àÁ¤º¸ |            
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        	
					  
					
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  	
  
  
   
    | Á¦Çüº° º¹¾àÁöµµ | 
    [Å©¸²] | 
   
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
     
   
  
    
       |  
      
        
          
            
                | ½É»çÁ¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
     
  
    
       |  
      
        
          
            
                | ÇмúÁ¤º¸ |          
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      Á¦ÇÑ¿¬·É±¸ºÐ (1¼¼¹Ì¸¸)
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Alclometasone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The mechanism of the anti-inflammatory activity of the topical steroids, in general, is unclear. However, corticosteroids are thought to act by the induction of phospholipase A2 inhibitory proteins, collectively called lipocortins. It is postulated that these proteins control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes by inhibiting the release of their common precursor, arachidonic acid. Arachidonic acid is released from membrane phospholipids by phospholipase A2. Alclometasone also binds the corticosteroid receptor. 
     | 
   
  
   
    | Pharmacology | 
     
       Alclometasone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Alclometasone is a synthetic corticosteroid for topical dermatologic use. The corticosteroids constitute a class of primarily synthetic steroids used topically as anti-inflammatory and antipruritic agents. Alclometasone is a selective glucocorticoid receptor agonist. 
     | 
   
  
   
    | Absorption | 
    
       Alclometasone¿¡ ´ëÇÑ Absorption Á¤º¸ Topical corticosteroids can be absorbed from normal intact skin. Studies have shown that approximately 3% of steroid is absorbed during 8 hours of contact with intact skin of normal volunteers. 
     | 
   
  
   
    | Toxicity | 
    
       Alclometasone¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose include suppression of adrenal glands, temporary decrease in white blood cell counts, symptoms of hypersensitivity (such as skin rash, hives, itching, and difficulty breathing), and increased susceptibility to infection. 
     | 
   
  
   
    | Drug Interactions | 
    
       Alclometasone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Alclometasone¿¡ ´ëÇÑ Description Á¤º¸ Alclometasone is synthetic glucocorticoid steroid for topical use in dermatology as anti-inflammatory, antipruritic, antiallergic, antiproliferative and vasoconstrictive agent. [Wikipedia] 
     | 
   
  
   
    | Dosage Form | 
    
       Alclometasone¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream	TopicalOintment	Topical 
     | 
   
  
   
    | Drug Category | 
    
       Alclometasone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-inflammatory AgentsAntipruritic AgentsCorticosteroidsGlucocorticoids 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Alclometasone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCC(=O)OCC(=O)C1(OC(=O)CC)C(C)CC2C3C(Cl)CC4=CC(=O)C=CC4(C)C3C(O)CC12C 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Alclometasone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCC(=O)OCC(=O)[C@@]1(OC(=O)CC)[C@H](C)C[C@H]2[C@@H]3[C@H](Cl)CC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@]12C 
     | 
   
  
   
    | InChI Identifier | 
    
       Alclometasone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C28H37ClO7/c1-6-22(33)35-14-21(32)28(36-23(34)7-2)15(3)10-18-24-19(29)12-16-11-17(30)8-9-26(16,4)25(24)20(31)13-27(18,28)5/h8-9,11,15,18-20,24-25,31H,6-7,10,12-14H2,1-5H3/t15-,18+,19-,20+,24-,25+,26+,27+,28+/m1/s1 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Alclometasone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ [(7R,8S,9S,10R,11S,13S,14S,16R,17R)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-(2-propanoyloxyacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate 
     | 
   
    
  |  
     
     
  
    
       |  
      
        
          
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ |           
             
           
         | 
             	  
       |  
       |  
     
         
 
     | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-06-05
              
 
              - 
                
                 º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
  
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    1¼¼¹Ì¸¸/2008005620080401 
 
 
 
   
  |  
                           
                         |