| |
|
|
|
|
|
 |
| |
|
에스펜겔(디클로페낙나트륨) 50g
|
|
일반의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
 전문/일반 |
일반
|
|
|
제조회사 |
삼성제약(주)
|
|
판매회사 |
삼성제약(주)
|
|
허가정보 |
정상
(2004.12.10)
|
|
BIT 약효분류 |
외용 소염진통제 (NSAIDs : Skin & Mucous Membrane)
|
|
복지부분류 |
264[진통·진양·수렴·소염제 ] |
청구코드(KD코드)
비급여점검코드 |
|
642302871[642302870] [비급여]
|
|
|
| ATC코드 |
Diclofenac / M02AA15 |
| NDC코드 |
[Proprietary Name Search _ 특허등록명,상표명으로 검색]
[Active Ingredient Search _ 주성분으로 검색]
[NDC Number Search _ NDC코드로 검색]
|
|
성분 / 함량 |
[심평원 주성분코드 기준 성분함량정보 조회]
|
|
첨가제 |
농글리세린,
에탄올,
엘 멘톨,
정제수,
카르보머940,
트롤아민,
파라옥시벤조산메틸,
파라옥시벤조산프로필,
폴리에틸렌글리콜400,
프로필렌글리콜
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
642302871[642302870]
[보험코드에 따른 약품기본정보 직접조회]
[비급여]
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
무색 투명한 겔제 [제형정보 확인] |
| 포장·유통단위 |
50g/튜브 |
| 주성분코드 |
143537CCM
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
다음 질환 및 증상의 진통ㆍ소염(항염) :
1. 건(힘줄), 인대, 근육 및 관절의 외상(상처)성 염증(삠, 타박상 등)
2. 연조직 류마티스의 국소형(건초염(힘줄윤활막염), 어깨손증후군, 점액낭염, 관절주위염 등)
3. 류마티스 질환의 국소형(말초관절 및 척추의 골(뼈)관절증 등)
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
통증 부위의 면적에 따라 2 - 4g을 1일 3-4회 환부(질환부위)에 바르고 잘 스며들도록 가볍게 문지른다.
|
| 금기 |
1) 이 약 및 이 약 성분에 과민증 또는 그 병력이 있는 환자
2) 아스피린 또는 기타의 비스테로이드성 소염(항염)진통제에 과민증이 있는 환자
3) 아스피린 또는 기타의 비스테로이드성 소염(항염)진통제에 대한 천식(비스테로이드성 소염(항염)진통제등에의한천식발작을유발) 또는 그 병력이 있는 환자(천식 발작을 일으킬 수 있다.)
4) 6세 이하의 유아
5) 임신 3기 |
| 신중투여 |
1) 기관지 천식 환자(중증(심한증상) 천식발작을 일으킬 수 있다)
2) 이 약은 프로필렌글리콜을 함유하고 있으므로 이 성분에 과민하거나 알레르기 병력이 있는 환자에는 신중히 투여한다. |
| 이상반응 |
1) 이 약은 탈락성 피부염, 스티븐스-존슨 증후군 및 독성 표피괴사 같은 중대한 피부 이상반응을 일으킬 수 있으며, 이는 치명적일 수 있다. 이러한 중대한 이상반응은 경고 증상 없이 발생할 수 있다. 대부분의 경우 이러한 이상반응은 투여 초기 1개월 이내에 발생한다. 환자는 중대한 피부 발현 증상 및 증후에 대해 알고 있어야 하며 때때로 가려움, 발적(충혈되어 붉어짐), 쓰라림, 피부염(발진, 습진, 피진(피부 발진), 구진, 접촉성 피부염, 부종(부기)), 피부박탈 및 거칠어짐, 자극감 및 수포형성, 드물게 색소침착이 나타날 수 있다. 특히 접촉성 피부염은 발적(충혈되어 붉어짐), 붉은 반점, 발진, 소양감(가려움), 동통(통증) 등이 나타나고 종창(부기), 부종(부기), 수포, 미란(짓무름) 등으로 악화될 수 있으며, 이와 같은 증상이 전신으로 확대될 수 있으므로 이상이 인정되는 경우에는 즉시 사용을 중지하고 적절한 처치를 해야 한다.
2) 넓은 부위에 또는 장기간 사용할 경우 범발성 피부발진, 광과민증, 호흡곤란, 천식, 맥관 부종(혈관부종) 등의 전신 이상반응이 나타날 수 있다.
|
| Off-label Usage |
[조회]
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : B등급
(diclofenac topical )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Diclofenac에 대한 Mechanism_Of_Action 정보
The antiinflammatory effects of diclofenac are believed to be due to inhibition of both leukocyte migration and the enzyme cylooxygenase (COX-1 and COX-2), leading to the peripheral inhibition of prostaglandin synthesis. As prostaglandins sensitize pain receptors, inhibition of their synthesis is responsible for the analgesic effects of ketoprofen. Antipyretic effects may be due to action on the hypothalamus, resulting in peripheral dilation, increased cutaneous blood flow, and subsequent heat dissipation.
|
| Pharmacology |
Diclofenac에 대한 Pharmacology 정보
Diclofenac is an acetic acid nonsteroidal antiinflammatory drug (NSAID) with analgesic and antipyretic properties. Diclofenac is used to treat pain, dysmenorrhea, ocular inflammation, osteoarthritis, rheumatoid arthritis, ankylosing spondylitis, and actinic keratosis
|
| Metabolism |
Diclofenac에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 2C9 (CYP2C9)Cytochrome P450 2C19 (CYP2C19)Cytochrome P450 1A2 (CYP1A2)Cytochrome P450 2C8 (CYP2C8)Cytochrome P450 2D6 (CYP2D6)Glucuronosyltransferase
|
| Protein Binding |
Diclofenac에 대한 단백결합 정보
More than 99%
|
| Half-life |
Diclofenac에 대한 반감기 정보
2 hours
|
| Absorption |
Diclofenac에 대한 Absorption 정보
Completely absorbed from the gastrointestinal tract.
|
| Pharmacokinetics |
Diclofenac sodium의 약물동력학자료
- 단백결합 : 99%
- 대사 : 간에서 비활성형 대사체로 대사됨
- 반감기 : 2시간
- 혈중최고농도 도달시간 : 1-2 시간 이내
- 소실 : 주로 신배설
|
| Biotransformation |
Diclofenac에 대한 Biotransformation 정보
Hepatic
|
| Toxicity |
Diclofenac에 대한 Toxicity 정보
Symptoms of overdose include loss of consciousness, increased intracranial pressure, and aspiration pneumonitis. LD50=390mg/kg (orally in mice)
|
| Drug Interactions |
Diclofenac에 대한 Drug_Interactions 정보
Alendronate Increased risk of gastric toxicityAnisindione The NSAID increases the anticoagulant effectCyclosporine Monitor for nephrotoxicityDicumarol The NSAID increases the anticoagulant effectWarfarin The NSAID increases the anticoagulant effectRifampin Decreased levels/effect of the NSAID
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
Diclofenac에 대한 P450 table
SUBSTRATES
CYP 2C9
NSAIDs:
**diclofenac**
ibuprofen
piroxicam
Oral Hypoglycemic Agents:
tolbutamide
glipizide
Angiotensin II Blockers:
NOT candesartan
irbesartan
losartan
NOT valsartan
celecoxib
fluvastatin naproxen
phenytoin
sulfamethoxazole
tamoxifen
tolbutamide
torsemide
warfarin
INHIBITORS
CYP 2C9
amiodarone
fluconazole
isoniazid
INDUCERS
CYP 2C9
rifampin
secobarbital
|
| Food Interaction |
Diclofenac에 대한 Food Interaction 정보
Take with food to reduce irritation.Avoid alcohol.
|
| Drug Target |
[Drug Target]
|
| Description |
Diclofenac에 대한 Description 정보
A non-steroidal anti-inflammatory agent (NSAID) with antipyretic and analgesic actions. It is primarily available as the sodium salt. [PubChem]
|
| Dosage Form |
Diclofenac에 대한 Dosage_Form 정보
Solution OphthalmicSolution TopicalSuppository RectalTablet OralTablet, coated OralTablet, extended release Oral
|
| Drug Category |
Diclofenac에 대한 Drug_Category 정보
Anti-Inflammatory Agents, Non-SteroidalCyclooxygenase InhibitorsNonsteroidal Antiinflammatory Agents (NSAIDs)
|
| Smiles String Canonical |
Diclofenac에 대한 Smiles_String_canonical 정보
OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl
|
| Smiles String Isomeric |
Diclofenac에 대한 Smiles_String_isomeric 정보
OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl
|
| InChI Identifier |
Diclofenac에 대한 InChI_Identifier 정보
InChI=1/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)/f/h18H
|
| Chemical IUPAC Name |
Diclofenac에 대한 Chemical_IUPAC_Name 정보
2-[2-[(2,6-dichlorophenyl)amino]phenyl]acetic acid
|
| Drug-Induced Toxicity Related Proteins |
DICLOFENAC 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:CYP3A4
Drug:Diclofenac
Toxicity:idiosyncratic hepatotoxicity.
[바로가기]
Replated Protein:CYP2C9
Drug:Diclofenac
Toxicity:idiosyncratic hepatotoxicity.
[바로가기]
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2024-12-13
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ≥4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. DICLOFENAC[GGT Increase][Composite Activity](Score) A(Marginal) 1(Active) 3[Alkaline Phosphatase Increase](Activity Score) A(Number of Rpts) ≥4(Index value) 9.2[SGOT Increase](Activity Score) A(Number of Rpts) ≥4(Index value) 11.4[SGPT Increase](Activity Score) A(Number of Rpts) ≥4(Index value) 11.1[LDH Increase](Activity Score) I(Number of Rpts) ≥4(Index value) 2[GGT Increase](Activity Score) M(Number of Rpts) ≥4(Index value) 3.8
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
내용보기
