| |
|
|
|
|
|
 |
| |
|
³×ºñµµÁÖ»ç(Å×½ºÅ佺Å׷пī³ë¿¡ÀÌÆ®) NEBIDO INJ.
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
641100431[641100430]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
°¥»öÀ¯¸®¾ÚÇÿ¡ µç ¸¼Àº Ȳ»öÀÇ À¯¼º¿ë¾× [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
1¡¿4mL (ÀÚ»çÆ÷Àå´ÜÀ§) |
| ÁÖ¼ººÐÄÚµå |
236330BIJ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
³²¼ºÀÇ ÀÏÂ÷¼º ¹× ÀÌÂ÷¼º ¼º¼±±â´ÉÀúÇÏÁõ¿¡ Å×½ºÅ佺Å×·Ð ´ëġġ·á
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
ÀÌ ¾àÀº ü³» ÃàÀû¾øÀÌ ÃæºÐÇÑ Å×½ºÅ佺Å×·Ð ³óµµ¸¦ À¯ÁöÇϱâ À§ÇØ Å×½ºÅ佺Å׷пī³ë¿¡ÀÌÆ®·Î¼ 1,000 mgÀ» ¸Å 10 ¢¦ 14 ÁÖ¸¶´Ù ÁÖ»çÇÑ´Ù. ÁÖ»ç´Â ¸Å¿ì õõÈ÷ ±×¸®°í ±ÙÀ° ³»·Î¸¸ Åõ¿©ÇÏ¿©¾ß ÇÑ´Ù. Ç÷°ü ³» Åõ¿©¸¦ ÇÇÇϱâ À§ÇØ Æ¯º°ÇÑ ÁÖÀǸ¦ ±â¿ï¿©¾ß ÇÑ´Ù.
Ä¡·á½ÃÀÛ :
Ä¡·á¸¦ ½ÃÀÛÇϱâ Àü¿¡ Ç÷Áß Å×½ºÅ佺Å×·Ð ³óµµ¸¦ ÃøÁ¤ÇØ¾ß ÇÑ´Ù. óÀ½ ÁÖ»ç ½Ã¿¡´Â ÃÖ¼Ò 6ÁÖ±îÁö °£°ÝÀ» ÁÙÀÏ ¼ö ÀÖ´Ù. ÀÌ·± ¹æ¹ýÀ¸·Î Ä¡·á¸¦ ½ÃÀÛÇÏ´Â °ÍÀº Á¤»ó»óÅÂ(steady state) ¾à¹° ¼öÁØ¿¡ »¡¸® µµ´ÞÇϵµ·Ï ÇØ ÁØ´Ù.
Ä¡·áÀ¯Áö :
Ãß°¡·Î ÁÖ»çÇϱâ Àü¿¡ ¶§¶§·Î Ç÷Áß Å×½ºÅ佺Å×·Ð ³óµµ¸¦ ÃøÁ¤ÇÏ´Â °ÍÀÌ ±ÇÀåµÈ´Ù. ³óµµ°¡ Á¤»ó ¼öÁغ¸´Ù ³·À¸¸é ÁÖ»ç °£°ÝÀ» ÁÙ¿©¾ß ÇÑ´Ù. Ç÷Áß ³óµµ°¡ ³ôÀº °æ¿ì, °£°ÝÀ» ¿¬ÀåÇÏ´Â °ÍÀÌ °í·ÁµÉ ¼ö ÀÖ´Ù. ±×·¯³ª, ÁÖ»ç °£°ÝÀº ±ÇÀå ¹üÀ§(10 ¢¦ 14 ÁÖ)³»¿¡ ÀÖ¾î¾ß ÇÑ´Ù.
|
| ±Ý±â |
1) ¾Èµå·Î°Õ-ÀÇÁ¸¼º Á¾¾ç ȯÀÚ(¿¹, Àü¸³»ù¾Ï, ³²¼º À¯¼±¾Ï)
2) ¾Ç¼º Á¾¾ç°ú °ü·ÃµÈ °íÄ®½·Ç÷Áõ ȯÀÚ
3) ÁßÁõÀÇ ½É, °£ ¶Ç´Â ½ÅºÎÀü ȯÀÚ
4) ÀÌ ¾à ¶Ç´Â ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ
5) ¿©¼º
6) °£ Á¾¾çÀÌ Àְųª ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) °£Áúȯ, ½ÉÁúȯ, ½ÅÁúȯ ȯÀÚ(³ªÆ®·ý°ú ü¾×ÀÇ Àú·ù¿¡ ÀÇÇØ ÀÌ·¯ÇÑ ÁúȯÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù.)
2) ¾ÏÀÇ °ñÀüÀÌ È¯ÀÚ(°íÄ®½·Ç÷Áõ°ú °íÄ®½·´¢ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.)
3) ºÎÁ¾ÀÌ »ý±â±â ½¬¿î ȯÀÚ
4) °íÇ÷¾Ð, °£Áú, ÆíµÎÅë ȯÀÚ(Ç÷¾ÐÀ» Áõ°¡½ÃÄÑ ÀÌ·¯ÇÑ ÁúȯÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù.)
5) °í·ÉÀÚ
6) Àü¸³»ù ºñ´ëÁõ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ÀÌ ¾àÀÇ Åõ¿© ½Ã °¡Àå ºó¹øÇÏ°Ô ³ªÅ¸³ª´Â ÀÌ»ó¹ÝÀÀÀº ¿©µå¸§°ú ÁÖ»çºÎÀ§ ÅëÁõÀÌ´Ù.
2) ´ÙÀ½ÀÇ Ç¥´Â 6°³ÀÇ ÀÓ»ó½ÃÇè(n=422)¿¡¼ ÀÌ ¾àÀ» Åõ¿©¹ÞÀº ȯÀڷκÎÅÍ º¸°íµÈ ÀÌ»ó¹ÝÀÀÀ̸ç ÀÌ ¾àÀÇ Åõ¿©¿Í »ó°ü°ü°è°¡ ÀÖÀ» °ÍÀ¸·Î °í·ÁµÈ´Ù. ¹ß»ý ºóµµ¸¦ ÀÚÁÖ (1/100 ¡Â ¹ß»ýºóµµ < 1/10) ¹× ¶§¶§·Î (1/1,000 ¡Â ¹ß»ýºóµµ < 1/100)·Î ³ª´©¾î Ç¥±âÇÏ¿´´Ù. ÀÓ»ó½ÃÇèÀº ¼º¼±±â´ÉÀúÇÏÁõÀ» °¡Áø ³²¼ºÀ» ´ë»óÀ¸·Î 4 mL Å×½ºÅ佺Å׷пī³ë¿¡ÀÌÆ® 250 mg/mL¸¦ 302¸í¿¡°Ô, 3 mL Å×½ºÅ佺Å׷пī³ë¿¡ÀÌÆ® 250 mg/mL¸¦ 120¸í¿¡°Ô ±ÙÀ°ÁÖ»ç ÇÑ ½ÃÇèÀ̾ú´Ù.

3) ÀÌ ¿Ü¿¡µµ ´ÙÀ½°ú °°Àº ÀÌ»ó¹ÝÀÀÀÌ ÀÖ´Ù.
(1) ¼Òȱâ°è : ´ãÁó¿ïü¼º Ȳ´Þ
(2) ±Ù°ñ°Ý°è : ÇÏÁöÅë
(3) ½Å°æ°è : ¾îÁö·³, ¹ßÇÑ Áõ°¡
(4) ÇǺΰè : ÇǺÎÀÚ±Ø
(5) ºñ´¢»ý½Ä±â°è : Á¤¾×ÀúÇÏÁõ ¹× »çÁ¤·®°¨¼Ò, Áö¼Ó¼º¹ß±âÁõ
(6) ±âŸ : °íÄ®½·Ç÷Áõ(ƯÈ÷ ÀüÀ̼º À¯¹æ¾ÏÀ» °¡Áø ȯÀÚ¿¡ ÀÖ¾î¼), ³ªÆ®·ý ¹× ü¾×Àú·ù, ºÎÁ¾ µî
4) À¯¼º¿ë¾×¿¡ ÀÇÇÑ ¹Ì¼¼ Æó»öÀüÁõÀº µå¹°°Ô ±âħ, È£Èí°ï¶õ, ±Çۨ, ´ÙÇÑÁõ, ÈäÅë, ¾îÁö·³Áõ, °¨°¢ÀÌ»ó, ½Ç½Å°ú °°Àº ¡ÈÄ¿Í Áõ»óÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. ÀÌ Áõ»óµéÀº Åõ¿©ÇÏ´Â µ¿¾È ¶Ç´Â Åõ¿© Áï½Ã ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç °¡¿ªÀûÀÌ´Ù. ȸ»ç ¶Ç´Â º¸°íÀÚ°¡ À¯¼º¿ë¾×¿¡ ÀÇÇÑ ¹Ì¼¼ Æó»öÀüÁõÀ̶ó°í ÃßÃøÇÑ ¿¹µéÀº ½ÃÆÇ ÈÄ ½ÃÇè »Ó¸¸ ¾Æ´Ï¶ó ÀÓ»ó½ÃÇè¿¡¼µµ ¸Å¿ì µå¹°°Ô º¸°íµÇ¾ú´Ù.
5) ¶ÇÇÑ À§¿¡ ¾ð±ÞµÈ ÀÌ»ó¹ÝÀÀ À̿ܿ¡, ½Å°æ°ú¹Î, Àû´ë°¨, ¼ö¸é¹«È£ÈíÁõ, Áö·ç¸¦ Æ÷ÇÔÇÑ ¿©·¯ ÇǺΠÀÌ»ó, ¹ß±â Ƚ¼ö Áõ°¡¿Í ¾ÆÁÖ µå¹°°Ô´Â Ȳ´ÞÀÌ Å×½ºÅ佺Å×·ÐÀ» Æ÷ÇÔÇÏ´Â Á¦Á¦ Åõ¿© ½Ã º¸°íµÇ¾ú´Ù.
6) ¿Ü±¹ÀÇ ½ÃÆÇ ÈÄ Á¶»ç¿¡¼ ½ÉºÎÁ¤¸ÆÇ÷ÀüÁõ°ú Æó»öÀüÁõÀ» Æ÷ÇÔÇÑ Á¤¸ÆÇ÷Àü»öÀüÁõÀÌ º¸°íµÇ¾ú´Ù.(¡®ÀϹÝÀûÁÖÀÇ Çס¯ ÂüÁ¶)
|
| »óÈ£ÀÛ¿ë |
1) ¾Èµå·Î°ÕÀº Àν¶¸°ÀÇ Ç÷´ç °¨¼Ò È¿°ú¸¦ Áõ°¡½Ãų ¼ö ÀÖ´Ù. µû¶ó¼ Ç÷´ç ¼öÁØ¿¡ ¿µÇâÀ» ÁÙ ¼ö ÀÖ´Â ¾àÀÇ ¿ë·®Àº °¨¼Ò½ÃÄÑ¾ß ÇÑ´Ù.
2) °£È¿¼ÒÀ¯µµ¾à¹°µé(¸®ÆÊÇǽÅ, ¹Ù¸£ºñÅ»°è¾à¹°, Ä«¸£¹Ù¸¶Á¦ÇÉ, µðŬ·Î¸£¾ËÆäÀÚ³í, Æä´ÒºÎŸÁ¸, Æä´ÏÅäÀÎ, ÇÁ¸®¹Ìµ· µî)°ú º´¿ë ½Ã Å×½ºÅ佺Å×·ÐÀÇ Ã»¼ÒÀ²À» Áõ°¡½Ã۰í, ¹Ý´ë·Î °£È¿¼Ò¾ïÁ¦¾à¹°Àº °¨¼Ò½Ãų ¼ö ÀÖ´Ù. µû¶ó¼, ÀÌ·¯ÇÑ ¾à¹°ÀÇ Åõ¿©½Ã ¿ë·®ÀÇ Á¶ÀýÀÌ ¿ä±¸µÈ´Ù.
3) ¾Èµå·Î°ÕÀº ´Ù¸¥ ¾àÀÇ ´ë»ç¸¦ ¹æÇØÇÏ¿© Ç÷Àå°ú Á¶Á÷¿¡¼ °ËÃâµÇ´Â ¾à¹°ÀÇ ³óµµ¿¡ ¿µÇâÀ» ¹ÌÄ¥ ¼ö ÀÖ´Ù. ¿¹·Î½á Ç÷û¿¡¼ ¿Á½ÃÆæºÎŸÁ¸ÀÇ ³óµµ°¡ Áõ°¡µÈ °ÍÀÌ º¸°íµÇ¾ú´Ù. ½ÃŬ·Î½ºÆ÷¸°ÀÇ ´ë»ç°¡ °¨¼ÒµÉ ¼ö ÀÖ´Ù.
4) Å×½ºÅ佺Å׷аú ±× À¯µµÃ¼´Â °æ±¸¿ë Ç×ÀÀ°íÁ¦ÀÇ È¿°ú¸¦ Áõ°¡½ÃŰ´Â °ÍÀ¸·Î ³ªÅ¸³ª ¿ë·® Á¶ÀýÀÌ ÇÊ¿äÇÒ ¼ö ÀÖ´Ù.
5) ºÎ½ÅÇÇÁúÀÚ±ØÈ£¸£¸ó(ACTH) ¹× ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å¿Í º´¿ë ½Ã ºÎÁ¾ °¡´É¼ºÀ» Áõ°¡½ÃŲ´Ù. µû¶ó¼ ½ÉÀå, ½ÅÀå, °£ ÁúȯÀÌ Àִ ȯÀÚ¿¡°Ô ƯÈ÷ ÁÖÀÇÇÏ¿© º´¿ëÅõ¿©ÇØ¾ß ÇÑ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
(ÀӺο¡ »ç¿ë ±Ý±â. )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Testosterone¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Testosterone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The effects of testosterone in humans and other vertebrates occur by way of two main mechanisms: by activation of the androgen receptor (directly or as DHT), and by conversion to estradiol and activation of certain estrogen receptors. Free testosterone (T) is transported into the cytoplasm of target tissue cells, where it can bind to the androgen receptor, or can be reduced to 5¥á-dihydrotestosterone (DHT) by the cytoplasmic enzyme 5¥á-reductase. DHT binds to the same androgen receptor even more strongly than T, so that its androgenic potency is about 2.5 times that of T. The T-receptor or DHT-receptor complex undergoes a structural change that allows it to move into the cell nucleus and bind directly to specific nucleotide sequences of the chromosomal DNA. The areas of binding are called hormone response elements (HREs), and influence transcriptional activity of certain genes, producing the androgen effects.
|
| Pharmacology |
Testosterone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Testosterone is a steroid hormone from the androgen group. Testosterone is primarily secreted in the testes of males and the ovaries of females although small amounts are secreted by the adrenal glands. It is the principal male sex hormone and an anabolic steroid. In both males and females, it plays key roles in health and well-being. Examples include enhanced libido, energy, immune function, and protection against osteoporosis. On average, the adult male body produces about twenty times the amount of testosterone than an adult female's body does.
|
| Absorption |
Testosterone¿¡ ´ëÇÑ Absorption Á¤º¸ Approximately 10% of the testosterone dose applied on the skin surface is absorbed into systemic circulation
|
| Pharmacokinetics |
Testosterone undecanoateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£ :
- ÀÛ¿ëÁö¼Ó½Ã°£ : Åõ¿© °æ·Î ¹× ¿° Á¾·ù¿¡ µû¶ó ´Ù¸£´Ù.
- Testosterone cypionate, Testosterone enanthate : ±ÙÀ°ÁÖ»ç : 2-4ÁÖ
- Èí¼ö :
- °æ±¸ : À§Àå°ü, ±¸° Á¡¸·À¸·ÎºÎÅÍ Èí¼öµÇ³ª ÃÊȸÅë°úÈ¿°ú°¡ ¸Å¿ì Å©´Ù.
- ±ÙÀ°ÁÖ»ç : ¼¼È÷ Èí¼öµÈ´Ù.
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ
- ´Ü¹é°áÇÕ : 98% (transcortin ¹× albumin¿¡ °áÇÕÇÑ´Ù.)
- ´ë»ç :
- °æ±¸ Åõ¿©½Ã °ÅÀÇ ´ëºÎºÐÀÌ ÃÊȸÅë°ú ´ë»ç¸¦ ¹Þ´Â´Ù.
- °£¿¡¼ ´Ù¾çÇÑ 17-ketosteroids ¹× Æ÷ÇÕü·Î ´ë»çµÈ´Ù.
- ¹Ý°¨±â : 10-100ºÐ
- À¯¸®Çü testosteroneÀÇ ¾ç¿¡ µû¶ó ¹Ý°¨±â°¡ º¯ÇϹǷΠÅõ¿© °æ·Î ¹× ¿° Á¾·ù¿¡ µû¶ó ´Ù¸£´Ù.
- Testosterone cypionate : ±ÙÀ°ÁÖ»ç : ¹Ý°¨±â°¡ ¾à 8ÀÏÀ̶ó°í º¸°íµÇ¾ú´Ù.
- ¼Ò½Ç : 90%´Â ÁÖ·Î ´ë»çü·Î¼ ´¢¸¦ ÅëÇØ, ¾à 10%´Â ´ãÁóÀ» °ÅÃÄ ´ëº¯À» ÅëÇØ ¹è¼³µÈ´Ù.
|
| Toxicity |
Testosterone¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects include amnesia, anxiety, discolored hair, dizziness, dry skin, hirsutism, hostility, impaired urination, paresthesia, penis disorder, peripheral edema, sweating, and vasodilation.
|
| Drug Interactions |
Testosterone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Testosterone¿¡ ´ëÇÑ Description Á¤º¸ A potent androgenic steroid and major product secreted by the leydig cells of the testis. Its production is stimulated by luteinizing hormone from the pituitary gland. In turn, testosterone exerts feedback control of the pituitary LH and FSH secretion. Depending on the tissues, testosterone can be further converted to dihydrotestosterone or estradiol. [PubChem]
|
| Drug Category |
Testosterone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Androgens
|
| Smiles String Canonical |
Testosterone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=CC(=O)CCC34C)C1CCC2O
|
| Smiles String Isomeric |
Testosterone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2O
|
| InChI Identifier |
Testosterone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1
|
| Chemical IUPAC Name |
Testosterone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-11-03
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|