| |
|
|
|
|
|
 |
| |
|
»ïÀÏºÎ·çÆæÁÂÁ¦100mg(À̺ÎÇÁ·ÎÆæ) BRUFEN SUPPOSITORIES 100MG[Ibuprofen]
|
|
ÀϹÝÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
643902480[A05002201]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1°³(2007.11.15)(ÇöÀç¾à°¡)
\292 ¿ø/1°³(2006.06.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ Æ÷źÇü ÁÂÁ¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
10, 20, 50, 100°³ |
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
O È¿´ÉÈ¿°ú
(ÁÂÁ¦)
1. ÁÖÈ¿´É È¿°ú
¾î¸°ÀÌ ±Þ¼º »ó±âµµ¿°ÀÇ ¹ß¿
|
| ¾à¹°À½½Ä°£ »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
O ¿ë¹ý¿ë·®
(ÁÂÁ¦)
¾î¸°ÀÌ : À̺ÎÇÁ·ÎÆæÀ¸·Î¼ 1ȸ üÁß kg´ç 3.0-6.0mg1ÀÏ 2ȸ Á÷Àå³» ±íÀÌ »ðÀÔ
ÇÑ´Ù.
¿¬·É, Áõ»ó¿¡µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
1) ¼Òȼº ±Ë¾ç ȯÀÚ
2) ½ÉÇÑ Ç÷¾×ÀÌ»ó ȯÀÚ
3) ½ÉÇÑ °£Àå¾Ö ȯÀÚ
4) ½ÉÇÑ ½ÅÀå¾Ö ȯÀÚ
5) ½ÉÇÑ ½É±â´ÉºÎÀü ȯÀÚ
6) ½ÉÇÑ °íÇ÷¾Ð ȯÀÚ
7) ±â°üÁöõ½Ä ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
8) Á÷Àå¿°, Á÷ÀåÃâÇ÷ ¶Ç´Â Ä¡Áú ȯÀÚ
9) ÀÌ ¾àÀÇ ¼ººÐ¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ
10) ¾Æ½ºÇǸ°À̳ª ´Ù¸¥ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦(COX-2 ÀúÇØÁ¦ Æ÷ÇÔ)¿¡ ´ëÇÏ¿© õ½Ä, µÎµå·¯±â, ¾Ë·¹¸£±â ¹ÝÀÀ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ(ÀÌ·¯ÇÑ È¯ÀÚ¿¡¼ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦ Åõ¿©ÈÄ Ä¡¸íÀûÀÎ ÁßÁõÀÇ ¾Æ³ªÇʶô½Ã¾ç ¹ÝÀÀÀÌ µå¹°°Ô º¸°íµÇ¾ú´Ù.)
11) °ü»óµ¿¸Æ ¿ìȸ·Î¼ú(CABG) ÀüÈÄ¿¡¹ß»ýÇÏ´Â ÅëÁõÀÇ Ä¡·á
|
| ½ÅÁßÅõ¿© |
1) ¼Òȼº±Ë¾çÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) Ç÷¾×ÀÌ»ó ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
3) °£Àå¾Ö ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
4) ½ÅÀå¾Ö ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
5) ½É±â´ÉºÎÀü ȯÀÚ
6) °íÇ÷¾Ð ȯÀÚ
7) °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
8) Àü½Å¼º È«¹Ý¼º ·çǪ½º(SLE) ȯÀÚ ¹× È¥ÇÕ°áÇÕÁ¶Á÷Áúȯ(MCTD) ȯÀÚ
9) ±Ë¾ç¼º ´ëÀå¿° ȯÀÚ
10) Å©·Ðº´ ȯÀÚ
11) ½Å»ý¾Æ ¹× À¯¾Æ
|
| ÀÌ»ó¹ÝÀÀ |
1) ¼ï : µå¹°°Ô ¼ï Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î°üÂûÀ» ÃæºÐÈ÷ Çϰí Èä³»°í¹Î, ¿ÀÇÑ, È£Èí°ï¶õ, Ç÷¾ÐÀúÇÏ µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Á¶Ä¡¸¦ ÇÑ´Ù.
2) Ç÷¾× : µå¹°°Ô Àç»ýºÒ·®¼º ºóÇ÷, ¿ëÇ÷¼ººóÇ÷, °ú¸³±¸°¨¼Ò, Ç÷¼ÒÆÇ°¨¼Ò, È£»ê±¸Áõ´Ù µîÀÇ Ç÷¾×Àå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Ç÷¾×°Ë»ç¸¦ ÇÏ´Â µî °üÂûÀ» ÃæºÐÈ÷ Çϰí ÀÌ»óÀÌ ÀÖÀ» °æ¿ì¿¡´ÂÁï½Ã Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
3) ¼Òȱâ°è : µå¹°°Ô ¼Òȼº±Ë¾ç, À§ÀåÃâÇ÷, Ç×¹®ÃâÇ÷, ±Ë¾ç¼º´ëÀå¿°, Ç÷º¯, ÃéÀå¿° µîÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù. ¶ÇÇÑ ¶§¶§·Î º¯ÀÇ, ±¸¿ª, ±¸Åä, º¹Åë, ¼³»ç, ¹èº¯, º¹ºÎºÒÄè°¨, Á÷ÀåÁ¡¸·ÀÇ ÀÚ±Ø µå¹°°Ô ½Ä¿åºÎÁø, ¼ÒȺҷ®, À§ºÎºÒÄè°¨, ±¸°¥, ±¸³»¿°, º¯ºñ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) ÇǺΠ: µå¹°°Ô ½ºÆ¼ºì½º-Á¸½¼ÁõÈıº(ÇǺÎÁ¡¸·¾ÈÁõÈıº) ¶Ç´Â¸®¿¤ÁõÈıº(Áßµ¶¼ºÇ¥ÇDZ«»çÁõ)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇѰæ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
5) °£Àå : µå¹°°Ô Ȳ´Þ, GOT, GPT, AL-P, Ç÷Àå¹ß¸®·çºóÀÇ »ó½Â µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
6) °ú¹ÎÁõ : µå¹°°Ô õ½Ä ¹ßÀÛÀÇ À¯¹ß, µÎµå·¯±â, ½ÀÁø, Àڹݶ§¶§·Î ¹ßÁø, °¡·Á¿òÁõ, ¹ßÇÑÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇѰæ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
7) °¨°¢±â°è : µå¹°°Ô ¹«½Ã, ¾ÏÁ¡ µîÀÇ ½Ã°¢Àå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù. ¶ÇÇѵ幰°Ô ³Ã», À̸í, ¹Ì°¢ÀÌ»ó µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
8) Á¤½Å½Å°æ°è : µå¹°°Ô ¹«±Õ¼º ¼ö¸·¿°ÀÌ º¸°íµÇ¾îÀÖÀ¸¹Ç·Î ½ÉÇÑ µÎÅë, ±¸¿ª, ±¸Åä, ºÒ¸é, ¸ñÀÌ »»»»ÇÔ, ¹ß¿¶Ç´Â ÀǽÄÀå¾Ö µîÀÇ Áõ»óÀÌ ³ªÅ¸³ª¸é Áï½Ã Åõ¿©¸¦ Áß´ÜÇϰí ÀÇ»ç¿Í »óÀÇÇϸç, ƯÈ÷ ÀÚ°¡¸é¿ªÁúȯ(SLE, MCTD) ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. ¶ÇÇÑ ¶§¶§·Î Á¹À½, Çö±â, ¿ì¿ï µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
9) ¼øÈ¯±â°è : µå¹°°Ô Ç÷¾ÐÀúÇÏ, Ç÷¾Ð»ó½Â, ½É°èÇ×Áø µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
10) ½ÅÀå : µå¹°°Ô ±Þ¼º½ÅºÎÀüÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·ÎÇÌ´¢, Ç÷´¢ µîÀÇ Áõ»ó ¹× ¿ä´Ü¹é, BUN, Ç÷ÁßÅ©·¹¾ÆÆ¼´ÑÀÇ»ó½Â, °íÄ®·ýÇ÷ÁõÀÌ °Ë»ç¼Ò°ß¿¡¼ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Á¶Ä¡¸¦ ÇÑ´Ù. ¿ä·® °¨¼Ò, Àü½ÅºÎÁ¾ ¹× ÀÌ¿¡ ¼ö¹ÝÇÏ´Â ¼û°¡»Ý, ´Ï¸¥ÇÔ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
11) ±âŸ : ¶§¶§·Î ¾È¿ÍÁÖÀ§ºÎÁ¾, ¾È¸éºÎÁ¾ ¶ÇÇÑ ¸Å¿ì µå¹°°Ô ±Çۨ, ¹ß¿, ü¿°¨, ºñÃâÇ÷, ½É¿ÍºÎÅë, ¿äÅë, °üÀýÅë µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ´Ù¸¥ ¼Ò¿°ÁøÅëÁ¦¿Í º´¿ëÀº ÇÇÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
2) ACE ÀúÇØÁ¦ : ºñ½ºÅ×·ÎÀ̵强¼Ò¿°ÁøÅëÁ¦¿¡ ÀÇÇØ ACE ÀúÇØÁ¦ÀÇ Ç×°íÇ÷¾ÐÈ¿°ú°¡ °¨¼ÒµÉ ¼ö ÀÖ´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î ÀÌ ¾à°ú ACE ÀúÇØÁ¦¸¦ º´¿ëÅõ¿©ÇÏ´Â °æ¿ì ÀÌ·¯ÇÑ »óÈ£ÀÛ¿ëÀ» ¿°µÎ¿¡ µÎ¾î¾ß ÇÑ´Ù.
3) ¾Æ½ºÇǸ°
¨ç ¾Æ½ºÇǸ°°úÀÇ º´¿ëÀÌ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦ÀÇ »ç¿ë°ú °ü·ÃµÈ Áß´ëÇÑ ½ÉÇ÷°ü°è Ç÷Àü¹ÝÀÀÀÇÀ§ÇèÀ» °¨¼Ò½Ãų ¼ö ÀÖ´Ù´Â ÀϰüµÈ Áõ°Å´Â ¾ø´Ù. ´Ù¸¥ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦¿Í ¸¶Âù°¡Áö·Î ÀÌ ¾à°ú¾Æ½ºÇǸ°ÀÇ º´¿ë¿¡ ÀÇÇØ ÁßÁõÀÇ À§Àå°ü°è ÀÌ»ó¹ÝÀÀÀÇ ¹ß»ý À§ÇèÀÌ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î µÎ ¾à¹°ÀÇ º´¿ëÀº ÀϹÝÀûÀ¸·Î ±ÇÀåµÇÁö ¾Ê´Â´Ù.
¨è ¾Æ½ºÇǸ°°ú º´¿ëÅõ¿©½Ã ÀÌ ¾à ¹× ´Ù¸¥ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦ÀÇ ÀÛ¿ëÀ» ÀúÇϽÃų ¼ö ÀÖ´Ù.
4) Ǫ·Î¼¼¹Ìµå ¹× Ä¡¾ÆÁþ°è ÀÌ´¢Á¦
¨ç ÀÓ»ó½ÃÇè ¹× ½ÃÆÇÈÄ Á¶»ç °á°ú ÀÌ ¾àÀÇ ½ÅÀå¿¡¼ÀÇ ÇÁ·Î½ºÅ¸±Û¶õµò ÇÕ¼º ¾ïÁ¦¿¡ ÀÇÇØ ÀϺÎȯÀÚ¿¡¼ Ǫ·Î¼¼¹Ìµå ¹× Ä¡¾ÆÁþ°è ÀÌ´¢Á¦ÀÇ ³ªÆ®·ý´¢¹è¼³ È¿°ú°¡ °¨¼ÒÇÒ ¼ö ÀÖÀ½ÀÌ È®ÀεǾú´Ù. ÀÌµé ¾à¹°°úºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦¸¦ º´¿ëÅõ¿©ÇÏ´Â µ¿¾È ½ÅÀå¾Ö Áõ»ó ¹× ½ÅºÎÀü ¡Èĸ¦ ¸é¹ÐÈ÷ °üÂûÇØ¾ß ÇÑ´Ù.
¨è Ǫ·Î¼¼¹Ìµå¿Í º´¿ëÅõ¿©½Ã ±× ÀÛ¿ëÀ» ÀúÇϽÃų ¼ö ÀÖÀ¸¹Ç·Î ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
5) ¸®Æ¬ : ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦´Â½ÅÀå¿¡¼ÀÇ ÇÁ·Î½ºÅ¸±Û¶õµò ÇÕ¼º ¾ïÁ¦¿¡ ÀÇÇØ Ç÷û ¸®Æ¬ÀÇ ³óµµ¸¦ Áõ°¡½ÃŰ°í ¸®Æ¬ÀÇ ½ÅŬ¸®¾î·±½º¸¦ °¨¼Ò½Ãų ¼ö ÀÖ´Ù.µû¶ó¼ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦¿Í ¸®Æ¬ÀÇ º´¿ë Åõ¿© ½Ã ¸®Æ¬ÀÇ µ¶¼º ¡Èĸ¦ ÁÖÀDZí°Ô °üÂûÇØ¾ß ÇÑ´Ù.
6) ¸ÞÅ䯮·º¼¼ÀÌÆ® : ºñ½ºÅ×·ÎÀ̵强¼Ò¿°ÁøÅëÁ¦¿ÍÀÇ º´¿ëÅõ¿©·Î ¸ÞÅ䯮·º¼¼ÀÌÆ®ÀÇ Ç÷¾×ÇÐÀû µ¶¼ºÀÌ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î µÎ ¾à¹°Àº º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
7) Äí¸¶¸°°è Ç×ÀÀÇ÷Á¦(¿ÍÆÄ¸° µî)
¨ç À§Àå°ü°è ÃâÇ÷¿¡ ´ëÇÏ¿© ¿ÍÆÄ¸°°ú ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦´Â »ó½ÂÀÛ¿ëÀ» ³ªÅ¸³¾ ¼ö ÀÖÀ¸¹Ç·ÎµÎ ¾à¹°À» ÇÔ²² »ç¿ëÇϴ ȯÀÚ´Â ´Üµ¶À¸·Î Åõ¿©ÇÏ´Â °æ¿ì¿¡ ºñÇØ ÁßÁõÀÇ À§Àå°ü°è ÃâÇ÷ÀÇ À§ÇèÀÌ ³ô¾ÆÁú ¼ö ÀÖ´Ù.
¨è Äí¸¶¸°°è Ç×ÀÀÇ÷Á¦¿Í º´¿ëÅõ¿©½Ã ±× ÀÛ¿ëÀ» Áõ°½Ãų ¼ö ÀÖÀ¸¹Ç·Î °¨·®ÇÏ´Â µî ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
(ÀӽŠ3±â¿¡ Åõ¿©½Ã )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[ÁÂÁ¦] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Ibuprofen¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Ibuprofen¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The exact mechanisms of action of Ibuprofen is unknown. Its antiinflammatory effects are believed to be due to inhibition of both cylooxygenase-1 (COX-1) and cylooxygenase-2 (COX-2) which leads to the inhibition of prostaglandin synthesis, and results in the inhibition of prostaglandin synthesis. Antipyretic effects may be due to action on the hypothalamus, resulting in an increased peripheral blood flow, vasodilation, and subsequent heat dissipation.
|
| Pharmacology |
Ibuprofen¿¡ ´ëÇÑ Pharmacology Á¤º¸ Ibuprofen is a nonsteroidal antiinflammatory drug (NSAID) with analgesic and antipyretic properties. Ibuprofen has pharmacologic actions similar to those of other prototypical NSAIAs, that is thought to be associated with the inhibition of prostaglandin synthesis. Ibuprofen is used to treat rheumatoid arthritis, osteoarthritis, dysmenorrhea, and to alleviate moderate pain.
|
| Metabolism |
Ibuprofen¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2C9 (CYP2C9)Monoamine oxidase type B (MAO-B)
|
| Protein Binding |
Ibuprofen¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 99%
|
| Half-life |
Ibuprofen¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 1.8-2.0 hours
|
| Absorption |
Ibuprofen¿¡ ´ëÇÑ Absorption Á¤º¸ rapidly absorbed
|
| Biotransformation |
Ibuprofen¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Ibuprofen¿¡ ´ëÇÑ Toxicity Á¤º¸ Abdominal pain, breathing difficulties, coma, drowsiness, headache, irregular heartbeat, kidney failure, low blood pressure, nausea, ringing in the ears, seizures, sluggishness, vomiting; LD50=1255mg/kg(orally in mice)
|
| Drug Interactions |
Ibuprofen¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Acebutolol Risk of inhibition of renal prostaglandinsAtenolol Risk of inhibition of renal prostaglandinsBetaxolol Risk of inhibition of renal prostaglandinsBevantolol Risk of inhibition of renal prostaglandinsBisoprolol Risk of inhibition of renal prostaglandinsCarteolol Risk of inhibition of renal prostaglandinsCarvedilol Risk of inhibition of renal prostaglandinsEsmolol Risk of inhibition of renal prostaglandinsLabetalol Risk of inhibition of renal prostaglandinsNadolol Risk of inhibition of renal prostaglandinsMetoprolol Risk of inhibition of renal prostaglandinsOxprenolol Risk of inhibition of renal prostaglandinsPenbutolol Risk of inhibition of renal prostaglandinsPindolol Risk of inhibition of renal prostaglandinsPractolol Risk of inhibition of renal prostaglandinsPropranolol Risk of inhibition of renal prostaglandinsSotalol Risk of inhibition of renal prostaglandinsTimolol Risk of inhibition of renal prostaglandinsWarfarin The NSAID increases the anticoagulant effectAcenocoumarol The NSAID increases the anticoagulant effectDicumarol The NSAID increases the anticoagulant effectAnisindione The NSAID increases the anticoagulant effectEthacrynic acid The NSAID decreases the diuretic and antihypertensive effect of the loop diureticFurosemide The NSAID decreases the diuretic and antihypertensive effect of the loop diureticTorasemide The NSAID decreases the diuretic and antihypertensive effect of the loop diureticBumetanide The NSAID decreases the diuretic and antihypertensive effect of the loop diureticAspirin Ibuprofen reduces ASA cardioprotective effectsMethotrexate The NSAID increases the effect and toxicity of methotrexateAlendronate Increased risk of gastric toxicityCyclosporine Monitor for nephrotoxicityLithium The NSAID increases serum levels of lithium
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸] Ibuprofen¿¡ ´ëÇÑ P450 table
SUBSTRATES
CYP 2C9
NSAIDs:
diclofenac
**ibuprofen**
piroxicam
Oral Hypoglycemic Agents:
tolbutamide
glipizide
Angiotensin II Blockers:
NOT candesartan
irbesartan
losartan
NOT valsartan
celecoxib
fluvastatin naproxen
phenytoin
sulfamethoxazole
tamoxifen
tolbutamide
torsemide
warfarin
INHIBITORS
CYP 2C9
amiodarone
fluconazole
isoniazid
INDUCERS
CYP 2C9
rifampin
secobarbital
|
| Food Interaction |
Ibuprofen¿¡ ´ëÇÑ Food Interaction Á¤º¸ Avoid alcohol.Take with food to reduce irritation.
|
| Drug Target |
[Drug Target]
|
| Description |
Ibuprofen¿¡ ´ëÇÑ Description Á¤º¸ A nonsteroidal anti-inflammatory agent with analgesic properties used in the therapy of rheumatism and arthritis. [PubChem]
|
| Dosage Form |
Ibuprofen¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralSuspension OralTablet OralTablet, chewable Oral
|
| Drug Category |
Ibuprofen¿¡ ´ëÇÑ Drug_Category Á¤º¸ AnalgesicsAnalgesics, Non-NarcoticAnti-Inflammatory Agents, Non-SteroidalAnti-inflammatory AgentsCyclooxygenase InhibitorsNonsteroidal Antiinflammatory Agents (NSAIDs)
|
| Smiles String Canonical |
Ibuprofen¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C)CC1=CC=C(C=C1)C(C)C(O)=O
|
| Smiles String Isomeric |
Ibuprofen¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(C)CC1=CC=C(C=C1)[C@@H](C)C(O)=O
|
| InChI Identifier |
Ibuprofen¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/f/h14H
|
| Chemical IUPAC Name |
Ibuprofen¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-[4-(2-methylpropyl)phenyl]propanoic acid
|
| Drug-Induced Toxicity Related Proteins |
IBUPROFEN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Myeloperoxidase Drug:ibuprofen Toxicity:increase the incidence of ventricular fibrillation. [¹Ù·Î°¡±â] Replated Protein:Myeloperoxidase Drug:ibuprofen Toxicity:increase the incidence of haemorrhagic infarction. [¹Ù·Î°¡±â] Replated Protein:Arylamine N-acetyltransferase 2 Drug:ibuprofen Toxicity:ibuprofen inhibition. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-07-15
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|