 |
| |
|
´Ù¿À´ÒÁ¤(±Û¸®º¥Å¬¶ó¹Ìµå) Daonil Tab.
|
Àü¹®ÀǾàǰ | ±Þ¿©
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
 | º´¿ë±Ý±â |
|
|
|
|
|
|
 |
Á¦Ç°º° ÀӺαݱ⠰í½Ã |
|
|
|
1µî±Þ: ¿øÄ¢Àû »ç¿ë±Ý±â / 2µî±Þ: ¸íÈ®ÇÑ ÀÓ»óÀû ±Ù°Å ¶Ç´Â »çÀ¯°¡ ÀÖ´Â °æ¿ì ºÎµæÀÌÇÏ°Ô »ç¿ë / Mµî±Þ: ÀÓ»óÀû»óȲ¿¡ µû¶ó 1µî±Þ ¶Ç´Â 2µî±ÞÀ¸·Î ºÐ·ùµÇ´Â ¼ººÐ
| ¼ººÐ¸í |
¼ººÐÄÚµå |
±Ý±âµî±Þ |
°í½Ã¹øÈ£ |
°í½ÃÀÏÀÚ |
ºñ°í |
| glibenclamide |
165402ATB |
2 |
20160155 |
20161230 |
½Å»ý¾Æ¿¡¼ ÀúÇ÷´ç ¶Ç´Â °Å´ë¾Æ È®ÀÎ.µ¿¹°½ÇÇè¿¡¼ ±âÇü¹ß»ý ÀÛ¿ë º¸°í. |
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
652100130[A07401221]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\68 ¿ø/1Á¤(2017.02.01)(ÇöÀç¾à°¡)
\68 ¿ø/1Á¤(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
À广Çü ¹é»ö Á¤Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
100Á¤/º´, 100Á¤(10Á¤/PTP X 10) |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 5¹Ð¸®±×·¥ |
100 Á¤ |
PTP |
8806521001302 |
8806521001333 |
¼öÃâ¿ë |
| 5¹Ð¸®±×·¥ |
100 Á¤ |
PTP |
8806521001302 |
8806521001326 |
|
| 5¹Ð¸®±×·¥ |
100 Á¤ |
º´ |
8806521001302 |
8806521001319 |
|
|
| ÁÖ¼ººÐÄÚµå |
165402ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
Á¦ 2Çü ´ç´¢º´(½Ä»ç¿ä¹ý, ¿îµ¿¿ä¹ýÀ¸·Î ÃæºÐÇÑ È¿°ú¸¦ ¾òÀ» ¼ö ¾ø´Â °æ¿ì¿¡ ÇÑÇÔ)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
-±Û¸®º¥Å¬¶ó¹ÌµåÀÇ ±ÇÀå °³½Ã ¿ë·®Àº º¸Åë ¼ºÀÎ 1ÀÏ 2.5mgÀÌ´Ù.
- ÃÖÀûÀÇ ´çÁ¶Àý»óŰ¡ µÉ ¶§±îÁö 1ÁÖ °£°ÝÀ¸·Î 2.5mg¾¿ Áõ·®ÇÑ´Ù.
-Ç÷´ç°ÇÏÁ¦¿¡ ¹Î°¨ÇÑ È¯ÀÚÀÇ °æ¿ì¿¡´Â 1ÀÏ 1.25mgÀ¸·Î °³½ÃµÇ¾î¾ß ÇÑ´Ù(»ç¿ë»óÀÇ ÁÖÀÇ»çÇ× Áß ½ÅÁßÅõ¿©Ç× ÂüÁ¶).
-1ÀÏ ÃÑÅõ¿©·®ÀÌ 15mgÀ» ³ÑÁö ¾Êµµ·Ï ÇÑ´Ù. 1ÀÏ ¿ë·® 10mg±îÁö´Â 1ȸ, ±× ÀÌ»óÀÎ °æ¿ì´Â 2ȸ ºÐÇÒ °æ±¸Åõ¿© ÇÑ´Ù. 1ÀÏ 1ȸÀÎ °æ¿ì´Â ¾ÆÄ§½ÄÈÄ, 2ȸÀÎ °æ¿ì´Â ¾ÆÄ§, Àú³á ½ÄÈÄ¿¡ °æ±¸Åõ¿© ÇÑ´Ù.
-º¸Åë À¯Áö¿ë·®Àº 1ÀÏ 2.5~5mgÀÌ´Ù.
-¿¬·É ¹× Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
1) ÁßÁõ ÄÉÅæÁõ, ´ç´¢º´¼º È¥¼ö ¶Ç´Â ÀüÈ¥¼ö(Àν¶¸°À» Åõ¿©ÇÑ´Ù.)
2) Á¦1Çü ´ç´¢º´ ȯÀÚ(Àν¶¸°À» Åõ¿©ÇÑ´Ù.)
3) ÁßÁõÀÇ °£, ½ÅÀå, ºÎ½Å±â´É Àå¾Ö ȯÀÚ(´ë»ç³ª ¹è¼³ÀÌ ÀúÇϵǾî, ÀúÇ÷´çÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù.)
4) ÁßÁõÀÇ °¨¿°Áõ, ÁßÁõÀÇ ¿Ü»ó, ¼ö¼ú Àü¡¤ÈÄÀÇ È¯ÀÚ(Àν¶¸°À» Åõ¿©ÇÑ´Ù.)
5) ¼³»ç, ±¸Åä µî À§ÀåÀå¾Ö ȯÀÚ(½Ä»ç·®ÀÌ ÁÙ¾î ÀúÇ÷´çÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù.)
6) ÀÌ ¾àÀÇ ¼ººÐ, ¼³Æù¿ä¼Ò°è, ¼³Æù¾Æ¹Ìµå°è ¾à¹°, ÇÁ·Îº£³×½Ãµå¿¡ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ
7) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º, ¼öÀ¯ºÎ
8) ¹ÌÄÚ³ªÁ¹À» Åõ¿©¹Þ´Â ȯÀÚ
9) ÃéÀåÀýÁ¦ ȯÀÚ
10) Æ÷¸£ÇǸ°Áõ ȯÀÚ
11) º¸¼¾ÅºÀ» Åõ¿©¹Þ´Â ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) °£À̳ª ½Å±â´É Àå¾Ö ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ(´ë»ç³ª ¹è¼³ÀÌ ÀúÇϵǾî, ÀúÇ÷´çÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î Åõ¿©·®, Åõ¿©°£°Ý¿¡ ÁÖÀÇÇÑ´Ù.)
2) ³úÇϼöü, ºÎ½Å±â´É ºÎÀü ȯÀÚ
3) ¿µ¾çºÒ·®»óÅÂ, ±â¾Æ»óÅÂ, ºÒ±ÔÄ¢ÇÑ ½Ä»ç¼·Ãë, ½Ä»ç¼·Ãë·®ÀÇ ºÎÁ· ¶Ç´Â Çã¾à»óÅÂÀΠȯÀÚ
4) °Ý·ÄÇϰųª Àå½Ã°£ ¿îµ¿À» Çϴ ȯÀÚ
5) °úµµÇÑ ¾ËÄÚ¿Ã ¼·ÃëÀÚ
6) °í·ÉÀÚ
7) ÀÌ ¾àÀÇ È¿°ú¸¦ Áõ°½Ãų ¼ö ÀÖ´Â ¾à¹°°úÀÇ º´¿ë |
| ÀÌ»ó¹ÝÀÀ |
1) ÀúÇ÷´ç : ¹«·Â°¨, ½ÉÇÑ °øº¹°¨, ¹ßÇÑ, ½É°èÇ×Áø, ÁøÀü, µÎÅë, Áö°¢ÀÌ»ó, ºÒ¾È, ÈïºÐ, ½Å°æ°ú¹Î, ÁýÁß·Â ÀúÇÏ, Á¤½ÅÀå¾Ö, ÀǽÄÀå¾Ö, °æ·Ã µîÀÇ Áõ»óÀÌ ÀϾ ¼ö ÀÖÀ¸¸ç, õõÈ÷ ÁøÇàµÇ´Â ÀúÇ÷´çÁõÀÇ °æ¿ì¿¡´Â Á¤½ÅÀå¾Ö, ÀǽÄÀå¾Ö µîÀÌ ÁÖ·Î ÀϾÙ.
2) Ç÷¾×°è : ¹«°ú¸³±¸Áõ, ¿ëÇ÷¼ººóÇ÷, Àç»ýºÒ·®¼ººóÇ÷ÀÌ ³ªÅ¸³ª´Â °æ¿ì°¡ ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇϰí ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ´Â µî ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù. Ç÷¼ÒÆÇ°¨¼Ò, µå¹°°Ô ¹éÇ÷±¸ °¨¼Ò, ¹üÇ÷±¸ °¨¼Ò, °ñ¼öÇü¼ººÎÀüÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) °£Àå : ¶§¶§·Î AST, ALT »ó½Â, °£±â´É Àå¾Ö°¡ ÀϾ ¼ö ÀÖ´Ù. µå¹°°Ô ´ãÁó¿ïü¼º Ȳ´Þ, °£¿°ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ÀÌ °æ¿ì¿¡´Â ÀÌ ¾à Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
4) À§Àå°ü°è : º¹Åë, Æ÷¸¸°¨, µå¹°°Ô ±¸¿ª, »óº¹ºÎÆØ¸¸°¨, °¡½¿¾²¸², ÈäºÎºÒÄè°¨, ½Ä¿åºÎÁø, ¼³»ç, º¯ºñ µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) °ú¹Î¹ÝÀÀ : ¶§¶§·Î È«¹Ý, µÎµå·¯±â, µå¹°°Ô °¡·Á¿ò, ´ÙÇü¼º ¶Ç´Â ¹Ý±¸Áø¼º ¹ßÁø, Áö¿¬¼º ÇÇºÎÆ÷¸£ÇǸ°Áõ, ±¤°ú¹Î¹ÝÀÀ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
6) ºñ´¢±â°è : ¾àÇÑ ÀÌ´¢ÀÛ¿ëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) ±âŸ : µå¹°°Ô ±Çۨ, ¾îÁö·¯¿ò, Á¹À½, ¿¡Åº¿Ã³»¼ºÀúÇÏ, Å»¸ð, Àú³ªÆ®·ýÇ÷Áõ ¶§¶§·Î À¯·ç, ½Ã·ÂÀúÇÏ, ºÎÁ¾ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ÀÌ ¾à°ú º¸¼¾ÅºÀ» µ¿½Ã¿¡ Åõ¿©¹Þ´Â ȯÀÚ¿¡¼ °£È¿¼ÒÄ¡ »ó½Â »ç·Ê Áõ°¡°¡ °üÂûµÇ¾ú´Ù. ÀÌ ¾à°ú º¸¼¾ÅºÀº ´ãÁó»ê¿° ºÐºñ ÆßÇÁ¸¦ ¾ïÁ¦ÇÏ¿© ¼¼Æ÷ µ¶¼ºÀÌ ÀÖ´Â ´ãÁó»ê¿°ÀÇ ¼¼Æ÷³» ÃàÀûÀ» À¯¹ßÇÑ´Ù. µû¶ó¼ µÎ ¾à¹°À» ÇÔ²² Åõ¿©Çؼ´Â ¾ÈµÈ´Ù.
2) ±Û¸®º¥Å¬¶ó¹Ìµå´Â ´ëºÎºÐ CYP2C9¿¡ ÀÇÇØ ´ë»çµÇ¸ç ÀϺΠ¼Ò·®Àº CYP3A4¿¡ ÀÇÇØ ´ë»çµÈ´Ù. CYP2C9ÀÇ À¯µµÁ¦³ª ÀúÇØÁ¦¿Í °°ÀÌ Åõ¿©ÇÒ ¶§ À̰ÍÀ» °í·ÁÇØ¾ß ÇÑ´Ù.
3) ´ÙÀ½ ¾à¹°°ú º´¿ëÅõ¿©Çϸé Ç÷´ç°ÇÏÀÛ¿ëÀÌ Áõ° ¶Ç´Â °¨¼ÒµÇ´Â ÀÏÀÌ ÀÖÀ¸¹Ç·Î ÀÌµé ¾à¹°°ú º´¿ëÅõ¿©ÇÒ ¶§¿¡´Â ȯÀÚÀÇ »óÅÂ¿Í Ç÷´çÄ¡¸¦ Àß °üÂûÇÏ¸é¼ Åõ¿©ÇÑ´Ù.
¨ç ÀÌ ¾àÀÇ È¿°ú¸¦ Áõ°½ÃŰ´Â ¾à¹°
: ¥á-±Û·çÄڽôÙÁ¦ ÀúÇØÁ¦(¾ÆÄ«º¸½º, º¸±Û¸®º¸½º), Àν¶¸° Á¦Á¦(ÈÞ¸ÕÀν¶¸° µî), ºñ±¸¾Æ´Ïµå°è ¾à¹°(¿°»ê¸ÞÆ®Æ÷¸£¹Î, ¿°»êºÎÆ÷¸£¹Î), ÇǶóÁ¹·Ð°è ¾à¹°(Æä´ÒºÎŸÁ¸), ÇÁ·Îº£³×½Ãµå, Äí¸¶¸°°è ¾à¹°(¿ÍÆÄ¸°), »ì¸®½Ç»ê°è ¾à¹°(¾Æ½ºÇǸ° µî), ¥â-Â÷´ÜÁ¦(ÇÁ·ÎÇÁ¶ó³î·Ñ, ¸ÞÅäÇÁ·Ñ·Ñ µî), MAO ÀúÇØÁ¦, ¼³ÆÄÁ¦(¼³ÆÄ¸ÞÅå»çÁ¹, ¼³ÆÄ¸ÞÅå½Å µî), ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°Á¦(³ªÇÁ·Ï¼¾, ·Ï¼ÒÇÁ·ÎÆæ³ªÆ®·ý, ³ªºÎ¸ÞÅæ µî), Ŭ·Î¶÷Æä´ÏÄÝ, Àν¶¸°ÀúÇ×¼º°³¼±Á¦(¿°»êÇÇ¿À±Û¸®Å¸Á¸, Æ®·Î±Û¸®Å¸Á¸), Åׯ®¶ó»çÀÌŬ¸°°è Ç×»ý¹°Áú(¿°»êÅׯ®¶ó»çÀÌŬ¸°, ¿°»ê¹Ì³ë»çÀÌŬ¸° µî), ÇǺ극ÀÌÆ®°è ¾à¹°(º¥ÀÚÇǺ극ÀÌÆ®, Ŭ·ÎÇǺ극ÀÌÆ®), ±¸¾Æ³×Ƽµò, ¾ÆÁ¹°è Ç×Áø±ÕÁ¦(¹ÌÄÚ³ªÁ¹, Ç÷çÄÚ³ªÁ¹ µî), ACE ¾ïÁ¦Á¦, ½ÃŬ·ÎÆ÷½ºÆÄ¹Ìµå, ÆæÇ÷ç¶ó¹Î, ÆæÅå½ÃÇʸ°, ·¹¼¼¸£ÇÉ, ½ÃÇÁ·ÎÇ÷ϻç½Å, Äû³î·Ð°è ¾à¹°(Ç÷ç¿À·ÎÄû³î·Ð), Ŭ·¡¸®½º·Î¸¶À̽Å
¨è ÀÌ ¾àÀÇ È¿°ú¸¦ °¨¼Ò½ÃŰ´Â ¾à¹°
: ¿¡Çdz×ÇÁ¸°, ÄÚ¸£Æ¼ÄÚÀ̵åÁ¦(ÃÊ»êÄÚ¸£Æ¼¼Õ, È÷µå·ÎÄÚ¸£Æ¼¼Õ µî), °©»ó¼±È£¸£¸óÁ¦(·¹º¸Æ¼·Ï½Å³ªÆ®·ý, °ÇÁ¶°©»ó¼± µî), ³Æ÷È£¸£¸óÁ¦(¾È½ÄÇâ»ê¿¡½ºÆ®¶óµð¿Ã, ¿¡½ºÆ®¶óµð¿Ã µî), ÀÌ´¢Á¦(Ä¡¾ÆÁþÁ¦, Ŭ·Î¸£Å»¸®µ·, ¿¡Å¸Å©¸°»ê, ¾Æ¼¼Å¸Á¹¾Æ¹Ìµå, Æ®¸®¾ÏÅ×·», Ǫ·Î¼¼¹Ìµå µî), ÇǶóÁø¾Æ¹Ìµå, À̼ҴϾÆÁþ, ´ÏÄÚÆ¾»ê, È¿¼ÒÀ¯µµÁ¦(¹Ù¸£ºñÆ©·¹ÀÌÆ®, ¸®ÆÊÇǽÅ, Æä´ÏÅäÀÎ), Æä³ëÄ¡¾ÆÁø, ÃÊ»êºÎ¼¼·¹¸°, ±³°¨½Å°æÈïºÐÁ¦, Ä®½·Â÷´ÜÁ¦, µð¾ÆÁ·½Ãµå, ±Û·çÄ«°ï, °æ±¸ÇÇÀÓÁ¦(¿¡½ºÆ®·ÎÁ¨, Á¦½ºÅ¸Á¨À» Æ÷ÇÔ), ´Ù³ªÁ¹, Ŭ·Î¸£ÇÁ·Î¸¶Áø(1ÀÏ 100mg ÀÌ»ó)
¨é Áõ° ¶Ç´Â °¨¼Ò½ÃŰ´Â ¾à¹°
: H2-¼ö¿ëü Â÷´ÜÁ¦, ¾ËÄÚ¿Ã, ÆæÅ¸¹Ìµò, Ŭ·Î´Ïµò
4) ÀÌ ¾à°ú »çÀÌŬ·Î½ºÆ÷¸°À» ÇÔ²² Åõ¿© ¹Þ´Â ȯÀÚ¿¡¼ Ç÷Àå ³» »çÀÌŬ·Î½ºÆ÷¸° ³óµµ°¡ »ó½ÂÇÒ ¼ö ÀÖÀ¸¸ç ÀÌ·Î ÀÎÇØ µ¶¼ºÀÌ Áõ°¡ÇÒ ¼ö ÀÖ´Ù. ÇÔ²² Åõ¿©ÇØ¾ß ÇÒ °æ¿ì¿¡´Â »çÀÌŬ·Î½ºÆ÷¸°ÀÇ ¿ë·®Á¶Àý°ú ¸ð´ÏÅ͸µÀÌ ÇÊ¿äÇÏ´Ù.
5) ÄÝ·¹¼¼ºêÀ̶÷(Colesevelam)Àº ±Û¸®º¥Å¬¶ó¹Ìµå¿¡ °áÇÕÇÏ¿© À§Àå°ü°è¿¡¼ ±Û¸®º¥Å¬¶ó¹ÌµåÀÇ Èí¼ö¸¦ °¨¼Ò½ÃŲ´Ù. ÄÝ·¹¼¼ºêÀ̶÷(Colesevelam)¸¦ Åõ¿©Çϱâ ÃÖ¼Ò 4½Ã°£ Àü¿¡ ±Û¸®º¥Å¬¶ó¹Ìµå¸¦ º¹¿ëÇßÀ» ¶§´Â »óÈ£ÀÛ¿ëÀÌ °üÂûµÇÁö ¾Ê¾Ò´Ù. ±×·¯¹Ç·Î ±Û¸®º¥Å¬¶ó¹Ìµå´Â ÄÝ·¹¼¼ºêÀ̶÷(Colesevelam)À» Åõ¿©Çϱâ ÃÖ¼Ò 4½Ã°£ Àü¿¡ º¹¿ëÇØ¾ß ÇÑ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
(Glyburide. ÀӽŠ±â°£ µ¿¾È Ç÷´ç ·¹º§À» À¯ÁöÇϱâ À§Çؼ´Â Àν¶¸°ÀÌ ÃßõµÊ. Ãâ»ê½Ã¿¡ sulfonylurea°¡ Åõ¿©µÉ °æ¿ì Àå±â°£ÀÇ ÁßÁõ ½Å»ý ÀúÇ÷´çÁõÀÌ ¹ß»ýÇÒ ¼ö ÀÖ´Ù. )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
[bosentan hydrate (as bosentan)]
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Glibenclamide¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Sulfonylureas such as glibenclamide likely bind to ATP-sensitive potassium-channel receptors on the pancreatic cell surface, reducing potassium conductance and causing depolarization of the membrane. Depolarization stimulates calcium ion influx through voltage-sensitive calcium channels, raising intracellular concentrations of calcium ions, which induces the secretion, or exocytosis, of insulin.
|
| Pharmacology |
Glibenclamide¿¡ ´ëÇÑ Pharmacology Á¤º¸ Glibenclamide (INN), also known as glyburide (USAN), a second-generation sulfonylurea antidiabetic agent, appears to lower the blood glucose acutely by stimulating the release of insulin from the pancreas, an effect dependent upon functioning beta cells in the pancreatic islets. With chronic administration in Type II diabetic patients, the blood glucose lowering effect persists despite a gradual decline in the insulin secretory response to the drug. Extrapancreatic effects may be involved in the mechanism of action of oral sulfonyl-urea hypoglycemic drugs. The combination of glibenclamide and metformin may have a synergistic effect, since both agents act to improve glucose tolerance by different but complementary mechanisms. In addition to its blood glucose lowering actions, glibenclamide produces a mild diuresis by enhancement of renal free water clearance. Glibenclamide is twice as potent as the related second-generation agent glipizide.
|
| Protein Binding |
Glibenclamide¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Extensively bound to serum proteins
|
| Absorption |
Glibenclamide¿¡ ´ëÇÑ Absorption Á¤º¸ Significant absorption within 1 hour and peak plasma levels are reached within 4 hours.
|
| Pharmacokinetics |
GlibenclamideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë ¹ßÇö ½Ã°£ : 15-60 ºÐ À̳»
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : ¼ºÀÎ : 2-4 ½Ã°£ À̳»
- ÀÛ¿ë Áö¼Ó ½Ã°£ : 18-24½Ã°£
- ´Ü¹é°áÇÕ : 99% ÀÌ»ó
- ´ë»ç : 80% ÀÌ»óÀÌ °£¿¡¼ ÇѰ¡Áö Ȱ¼º ´ë»çü¿Í ¸î°¡Áö ºñȰ¼º ´ë»çü·Î ´ë»çµÈ´Ù.
- ¹è¼³ : 50%°¡ ¸ð¾à¹° ȤÀº ´ë»çü·Î ½ÅÀåÀ» ÅëÇØ ¹è¼³µÊ
- ¹Ý°¨±â : 5-16 ½Ã°£, ½ÅÀå¾Ö³ª °£Àå¾Ö½Ã ¿¬ÀåµÈ´Ù.
|
| Biotransformation |
Glibenclamide¿¡ ´ëÇÑ Biotransformation Á¤º¸ Primarily hepatic (mainly cytochrome P450 3A4). The major metabolite is the 4-trans-hydroxy derivative. A second metabolite, the 3-cis-hydroxy derivative, also occurs. These metabolites contribute no significant hypoglycemic action in humans as they are only weakly active.
|
| Toxicity |
Glibenclamide¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral rat LD50: > 20,000 mg/kg. Oral mouse LD50: 3250 mg/kg.
|
| Drug Interactions |
Glibenclamide¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Acebutolol The beta-blocker decreases the symptoms of hypoglycemiaAtenolol The beta-blocker decreases the symptoms of hypoglycemiaBevantolol The beta-blocker decreases the symptoms of hypoglycemiaBetaxolol The beta-blocker decreases the symptoms of hypoglycemiaBisoprolol The beta-blocker decreases the symptoms of hypoglycemiaCarteolol The beta-blocker decreases the symptoms of hypoglycemiaCarvedilol The beta-blocker decreases the symptoms of hypoglycemiaEsmolol The beta-blocker decreases the symptoms of hypoglycemiaLabetalol The beta-blocker decreases the symptoms of hypoglycemiaMetoprolol The beta-blocker decreases the symptoms of hypoglycemiaNadolol The beta-blocker decreases the symptoms of hypoglycemiaOxprenolol The beta-blocker decreases the symptoms of hypoglycemiaPenbutolol The beta-blocker decreases the symptoms of hypoglycemiaPindolol The beta-blocker decreases the symptoms of hypoglycemiaPractolol The beta-blocker decreases the symptoms of hypoglycemiaPropranolol The beta-blocker decreases the symptoms of hypoglycemiaSotalol The beta-blocker decreases the symptoms of hypoglycemiaTimolol The beta-blocker decreases the symptoms of hypoglycemiaTrisalicylate-choline The salicylate increases the effect of sulfonylureaSalsalate The salicylate increases the effect of sulfonylureaSalicylate-magnesium The salicylate increases the effect of sulfonylureaSalicylate-sodium The salicylate increases the effect of sulfonylureaBismuth Subsalicylate The salicylate increases the effect of sulfonylureaAspirin The salicylate increases the effect of sulfonylureaBosentan Increased risk of hepatic toxicityDicumarol The agent increases the effect of sulfonylureaChloramphenicol The agent increases the effect of sulfonylureaClofibrate The agent increases the effect of sulfonylureaCyclosporine The sulfonylurea increases the effect of cyclosporineDiazoxide Diazoxide/sulfonylurea: antagonism of actionGlucosamine Possible hyperglycemiaIsocarboxazid The MAO inhibitor increases the effect of the hypoglycemic agentPhenelzine The MAO inhibitor increases the effect of the hypoglycemic agentPhenylbutazone Phenylbutazone increases the effect of the hypoglycemic agentRepaglinide Similar mode of action - questionable associationRifampin Rifampin decreases the effect of sulfonylureaTranylcypromine The MAO inhibitor increases the effect of the hypoglycemic agent
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Glibenclamide¿¡ ´ëÇÑ Food Interaction Á¤º¸ Avoid alcohol.Avoid sugar and sugary food.Take 30-60 minutes before breakfast.
|
| Drug Target |
[Drug Target]
|
| Description |
Glibenclamide¿¡ ´ëÇÑ Description Á¤º¸ An antidiabetic sulfonylurea derivative with actions similar to those of chlorpropamide. [PubChem]
|
| Drug Category |
Glibenclamide¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antiarrhythmic AgentsHypoglycemic AgentsSulfonylureas
|
| Smiles String Canonical |
Glibenclamide¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ COC1=C(C=C(Cl)C=C1)C(=O)NCCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1
|
| Smiles String Isomeric |
Glibenclamide¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ COC1=C(C=C(Cl)C=C1)C(=O)NCCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1
|
| InChI Identifier |
Glibenclamide¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C23H28ClN3O5S/c1-32-21-12-9-17(24)15-20(21)22(28)25-14-13-16-7-10-19(11-8-16)33(30,31)27-23(29)26-18-5-3-2-4-6-18/h7-12,15,18H,2-6,13-14H2,1H3,(H,25,28)(H2,26,27,29)/f/h25-27H
|
| Chemical IUPAC Name |
Glibenclamide¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 5-chloro-N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-methoxybenzamide
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-12-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|