|   | 
                  
                       | 
                      | 
                    
                        
                            
                                | 
                                  
                                 | 
                             
                             |  
                            
                                
                                    
                                        
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    ±â°¡¿¬Áúĸ½¶  GIGA SOFT CAP.[Benzonatate]  
                    
                 | 
               
              
                | 
                     Àü¹®ÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |                   
                                        | 
                                             | 
                                         
                            
                                
                            
                            
                              
                                                        
                              
                                                
                            
 |   
    | 
      
     | 
 
 |  
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
  
  
    
      
  
    
       |  
      
        
          
            
                | Çã°¡Á¤º¸ | 
             
           
         | 
       
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        652902810[A37003141]  
	    
	    
            [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
              \0 ¿ø/1ĸ½¶(2005.11.01)(ÇöÀç¾à°¡)
            
                \139 ¿ø/1ĸ½¶(2004.07.01)(º¯°æÀü¾à°¡)
                  
	 
	   
	   
       
      
       
       
     
      
      
     
      
    
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
      [Áúº´ÄÚµåÁ¶È¸]
     
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
  
  
  
  
  
  
  
  
  
  
  
 
  
  
    
  
  
  
  
  
  
  
  
  
  
 
  
  
  
 
  
  
  
  
  
  
   
    | Çã°¡»çÇ× ¿ø¹®Á¶È¸ | 
    
      
	    [Çã°¡»çÇ× ¿ø¹®Á¶È¸] 
     | 
   
  
  
  
  
     
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      ±âħ(ÁøÇØ)
      
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
    
  
  
  
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
      [󹿾à¾î] 
      ¿ë¹ý.¿ë·® 
º¸Åë ¼ºÀÎ 1ÀÏ 3ȸ, 1ȸ 1ĸ½¶À» Åõ¿©ÇÑ´Ù.     
      	
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    ÀÌ ¾à ¶Ç´Â À¯»ç¹°Áú¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ 
  | 
   
  
  
  
  
    
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      1) °ú¹ÎÁõ : °¡·Á¿òÁõ, ÇǺιßÀû µîÀÇ °ú¹ÎÁõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù. 
2) ¼Òȱâ : µå¹°°Ô º¯ºñ, ±¸¿ª, À§ÀåÀå¾Ö µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. 
3) È£Èí±â°è : º¥Á¶³ªÅ×ÀÌÆ®¿Í °ü·ÃµÈ °·ÂÇÑ ÀÌ»ó¹ÝÀÀÀº ±â°üÁö°æ·Ã, ¼º¹®°æ·Ã, ½ÉÀåÇãÅ»À» Æ÷ÇÔÇÑ °ú¹Î¹ÝÀÀÀ̸ç, ÀÌ ¹ÝÀÀµéÀº ĸ½¶À» ¾Ã°Å³ª »¡¾ÒÀ» ¶§ ±¹¼Ò¸¶ÃëÀÛ¿ë¿¡ ±âÀÎÇÑ´Ù.  
4) Á¤½Å½Å°æ°è : µå¹°°Ô ÁøÁ¤, Çö±â, µÎÅë, Á¹À½, Á¤½ÅÂø¶õ, ȯ°¢µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯¼öÀÖ´Ù. 
5) À§Àå°ü°è : º¯ºñ, ¿À½É, ±¸Åä 
6) ÇǺΠ: ¼Ò¾ç°¨, ¹ßÁø 
7) ±âŸ : ÄÚÃæÇ÷, ´«ÀÇ ÀÛ¿°¨, ¿ÀÇÑ, È¥¸ù, °ú¹Î¹ÝÀÀ, µå¹°°Ô ÀÚÀÇÀû ¶Ç´Â ¿ì¿¬ÇÑ °ú·® º¹¿ë½Ã »ç¸ÁÇÒ ¼ö ÀÖ´Ù. 
 
      
     | 
   
        
  
  
  
    
  
  
       	
  
     
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
       
     | 
      
  
  
  |  
     
   
  
    
       |  
      
        
          
            
                | Á¤º¸¿ä¾à |         
             
           
         | 
             	    
       |  
      | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
     
   
  
    
       |  
      
        
          
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |         
             
           
         | 
             	    
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
  
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806529028103 | 
   
  
  
  
  
   
    | BIT ¾àÈ¿ºÐ·ù | 
    
      ÁøÇذŴãÁ¦ & ±âħ°¨±â¾à (Cough & Cold remedies)
     | 
   
  
  
  
   
    | ATC ÄÚµå | 
    
       
      ÄÚµåºÐ·ù»ó¼¼¼³¸í  
      R05DB01  
      
              
     | 
   
  
  
  
  
  
  
  
 
  
  
   
    | º¹ÁöºÎºÐ·ùÄÚµå | 
    
    222  (ÁøÇذŴãÁ¦                                                      )
      
     | 
   
  
  
  
   
    | ÀǾàǰ ¹ÙÄÚµåÁ¤º¸ | 
    
      
          
        ³»¿ëº¸±â
       	 
      
	8806108620629//º´//1 ´ÜÀ§/¼ö·®: 300*
       																								
     | 
   
  
  
  
  
  
   
    ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä | 
    
      
	[ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä]
     | 
   
   
  
     
  
  
  
  
   
    | Drugs By Indication | 
    
      [Àüüº¸±â]
     | 
   
  
   
    | Drugs By Classification | 
    
      [Àüüº¸±â]
     | 
     
 	 |  
     
   
  
    
       |  
      
        
          
            
                | Á¦Ç°Á¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | º¹¾àÁ¤º¸ |            
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        	
					  
					
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  
   
    | º¹¾à¶óº§ | 
    
    
    
      | À̹ÌÁö | 
      º¹¾à¼³¸í | 
     
    
    
        | 
      º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
     |  
    
      
	
	  
            | *  | 
	    º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. | 
	   
	  
            | *  | 
	    º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. | 
	   
	  
            | *  | 
	    ±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. | 
	   
	   
     |   
     | 
   
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
     
   
  
    
       |  
      
        
          
            
                | ½É»çÁ¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
     
  
    
       |  
      
        
          
            
                | ÇмúÁ¤º¸ |          
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Benzonatate¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Benzonatate acts peripherally, anesthetizing the stretch receptors of vagal afferent fibers in the alveoli of the lungs, bronchi, and pleura. When applied locally, Benzonatate binds within the intracellular portion of voltage-gated sodium channels, decreasing the rate of membrane depolarization and increasing the threshold for electrical excitability. 
     | 
   
  
   
    | Pharmacology | 
     
       Benzonatate¿¡ ´ëÇÑ Pharmacology Á¤º¸ Benzonatate, a non-narcotic antitussive agent chemically related to tetracaine and other ester-type local anesthetics, is used to suppress cough associated with both acute and chronic respiratory conditions. 
     | 
   
  
   
    | Pharmacokinetics | 
    
       BenzonatateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
	- ÀÛ¿ë¹ßÇö½Ã°£ : 15-20ºÐ À̳»
	
 - ÀÛ¿ëÁö¼Ó½Ã°£ : 3-8 ½Ã°£
  
     | 
   
  
   
    | Toxicity | 
    
       Benzonatate¿¡ ´ëÇÑ Toxicity Á¤º¸ Restlessness, tremors, seizures and unconsciousness. 
     | 
   
  
   
    | Drug Interactions | 
    
       Benzonatate¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Benzonatate¿¡ ´ëÇÑ Description Á¤º¸ Benzonatate is a non-narcotic oral antitussive (cough suppressant) drug which works by anesthetizing the tissues of the lungs and pleura responsible for the cough reflex. It is chemically related to other ester anesthetics such as procaine. It has an anesthetic (numbing) action similar to that of benzocaine and "numbs" the stretch sensors in the lungs. It is the stretching of these sensors with breathing that causes the cough. It was approved by the FDA in 1958 
     | 
   
  
   
    | Drug Category | 
    
       Benzonatate¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antitussives 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Benzonatate¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCCCNC1=CC=C(C=C1)C(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOC 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Benzonatate¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCCCNC1=CC=C(C=C1)C(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOC 
     | 
   
  
   
    | InChI Identifier | 
    
       Benzonatate¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C30H53NO11/c1-3-4-9-31-29-7-5-28(6-8-29)30(32)42-27-26-41-25-24-40-23-22-39-21-20-38-19-18-37-17-16-36-15-14-35-13-12-34-11-10-33-2/h5-8,31H,3-4,9-27H2,1-2H3 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Benzonatate¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-butylaminobenzoate 
     | 
   
    
  |  
     
     
  
    
       |  
      
        
          
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ |           
             
           
         | 
             	  
       |  
       |  
     
         
 
     | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                 º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
  
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |  
                           
                         | 
                       
                      | 
                   |