|   
    | 
      
     | 
 
 |  
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
  
  
    
      
  
    
       |  
      
        
          
            
                | Çã°¡Á¤º¸ | 
             
           
         | 
       
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        646500390[E20540431]  
	    
	    
            [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \0 ¿ø/28Á¤(2007.11.15)(ÇöÀç¾à°¡)
            \9,041 ¿ø/28Á¤(2005.10.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
      [Áúº´ÄÚµåÁ¶È¸]
     
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
  
   
    | Á¦Ç°¼º»ó | 
    ´ãȲ»öÀÇ ¾ç¸éÀÌ º¼·ÏÇÑ Å¸¿øÇü ´çÀÇÁ¤  [Á¦ÇüÁ¤º¸ È®ÀÎ] |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    28DRG | 
   
  
  
  
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      453500ATB  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
 
  
  
    
  
  
  
  
  
  
  
  
  
  
 
  
  
  
 
  
  
  
  
  
  
   
    | Çã°¡»çÇ× ¿ø¹®Á¶È¸ | 
    
      
	    [Çã°¡»çÇ× ¿ø¹®Á¶È¸] 
     | 
   
  
  
  
  
     
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      
ÀÚ±ÃÀ» ÀûÃâÇÏÁö ¾ÊÀº ¿©¼º¿¡ ÀÖ¾î¼ ´ÙÀ½ Áúȯ Ä¡·á½Ã »ç¿ëÇÑ´Ù.  
1. Æó°æ°ú °ü·ÃµÈ Áߵ ¹× ÁßÁõÀÇ Ç÷°ü¿îµ¿¼º ÁõÈÄ  
2. Æó°æ°ú °ü·ÃµÈ Áߵ ¹× ÁßÁõÀÇ ¿ÜÀ½À§ÃàÁõ ¹× ÁúÀ§ÃàÁõ.  
´ÜÁö ¿ÜÀ½À§ÃàÁõ ¹× ÁúÀ§ÃàÁõÀÇ Ä¡·á¸¸À» À§ÇØ Ã³¹æÇÒ °æ¿ì¿¡´Â ±¹¼Ò Áú Á¦Á¦¸¦ °í·ÁÇϵµ·Ï ÇÑ´Ù.  
 
      
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
    
  
  
  
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
      [󹿾à¾î] 
      
Æó°æ°ú °ü·ÃµÈ Áߵ ¹× ÁßÁõÀÇ Ç÷°ü¿îµ¿¼º ÁõÈÄ ¹×/¶Ç´Â ¿ÜÀ½À§ÃàÁõ, ÁúÀ§ÃàÁõÀÇ Ä¡·á : 1ÀÏ 1ȸ 1Á¤¾¿ ¸ÅÀÏ º¹¿ëÇÑ´Ù.  
ÃâÇ÷ ¹× Á¡ÀûÃâÇ÷ÀÌ ¹®Á¦·Î ³ªÅ¸³ª´Â ȯÀÚ¿¡ ´ëÇØ¼´Â, ÀûÀýÇÑ Æò°¡¸¦ÇÑ ÈÄ, ¿ë·®À» Áõ°¡ÇÔ¿¡ ÀÖ¾î ½ÅÁßÀ» ±âÇØ¾ß ÇÑ´Ù.  
¿¡½ºÆ®·Î°Õ ´Üµ¶»ç¿ë ¶Ç´Â ÇÁ·Î°Ô½ºÆ¾°úÀÇ º´¿ëÀº ¿©¼º °¢ °³Àο¡ ´ëÇÑ Ä¡·á¸ñÀû°ú À§Ç輺¿¡ µû¶ó ÃִܱⰣÀ¸·Î Á¦ÇѵǾî¾ßÇÑ´Ù. Áö¼ÓÀûÀÎ Ä¡·áÀÇ Çʿ伺 ¿©ºÎ¸¦ °áÁ¤Çϱâ À§Çؼ ȯÀÚ´Â ÀÓ»óÀûÀ¸·Î ÀûÀýÈ÷ Á¤±âÀû(3~6°³¿ù °£°Ý)À¸·Î ÀçÆò°¡µÇ¾î¾ß ÇÑ´Ù.  
ÀÚ±ÃÀÌ ÀÖ´Â ¿©¼ºÀÇ °æ¿ì, Áø´ÜµÇÁö ¾ÊÀº Áö¼ÓÀû ¶Ç´Â Àç¹ß¼º ºñÁ¤»óÀûÀÎ Áú ÃâÇ÷ÀÌ ÀÖÀ» ¶§¿¡´Â ¾Ç¼ºÁ¾¾çÀÇ °¡´É¼ºÀ» ¹èÁ¦Çϱâ À§Çؼ, ÇÊ¿äÇÑ °æ¿ì Àڱ󻸷»ùÇøµ°ú °°Àº ÀûÀýÇÑ Áø´Ü¹ýÀ» ½ÃÇàÇϵµ·Ï ÇÑ´Ù.  
      
      	
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    1) À¯¹æ ¶Ç´Â »ý½Ä±âÀÇ ¾ÏȯÀÚ ¶Ç´Â ¿¡½ºÆ®·Î°Õ ÀÇÁ¸¼ºÀ¸·Î ¾Ë·ÁÁ³°Å³ª ÀǽÉÀÌ µÇ´Â ´Ù¸¥ Á¾¾ç ȯÀÚ 
2) Áø´ÜµÇÁö ¾ÊÀº ÀÌ»ó Áú ¶Ç´Â »ý½Ä±â ÃâÇ÷ ȯÀÚ 
3) Ȱµ¿¼º ¶Ç´Â ÃÖ±ÙÀÇ µ¿¸Æ¼º Ç÷Àü»öÀüÁõ ȯÀÚ 
Ȱµ¿¼º ¶Ç´Â °ú°ÅÀÇ Á¤¸Æ¼º Ç÷Àü»öÀüÁõ(½ÉºÎÁ¤¸ÆÇ÷ÀüÁõ, Æó»öÀüÁõ) ȯÀÚ 
Ç÷Àü»öÀüÁõ, Ç÷Àü¼ºÁ¤¸Æ¿°ÀÌ ÀÖ´Â ÁßÁõÀÇ ½ÉÁúȯ ȯÀÚ 
4) ÁßÁõÀÇ ½ÅÁúȯ ȯÀÚ 
5) °£±â´É °Ë»çÄ¡°¡ Á¤»óÀûÀ¸·Î ȸº¹µÇ±â Èûµç °£±â´É Àå¾Ö, ÁßÁõÀÇ °£Áúȯ, ·ÎÅÍÁõÈıº ¹× µÎºó-Á¸½¼ÁõÈıº ȯÀÚ 
6) ÀӺΠ¶Ç´Â ¼öÀ¯ºÎ 
7) ÀÌ ¾à¿¡ °ú¹ÎÁõ ȯÀÚ 
 ¾÷µ¥ÀÌÆ®ÀÏ:2009-11-03/ ¾÷µ¥ÀÌÆ®Á¾·ù:Çã°¡»çÇ׺¯°æÁö½Ã
  | 
   
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
    1) À¯¹æ¾ÏÀÇ °¡Á··ÂÀ̳ª ¶Ç´Â À¯¹æ¼Ò°áÀý, ¼¶À¯³¶Æ÷¼ºÁúȯÀÇ º´·ÂÀÌ Àִ ȯÀÚ 
2) ¿¡½ºÆ®·Î°Õ°ú °ü·ÃµÈ(ÀÓ½ÅÁß) Ç÷Àü»öÀüÁõÁúȯ ¶Ç´Â Ư¹ß¼ºÀÇ Ç÷Àü»öÀüÁõ ÁúȯÀÇ º´·ÂÀÌ Àִ ȯÀÚ 
3) ÀÌ ¾àÀº ü¾×ÀÇ Àú·ù¸¦ ´Ù¼Ò À¯¹ßÇÒ ¼ö ÀÖÀ¸¹Ç·Î, ÀÌ·¯ÇÑ ¿äÀο¡ ÀÇÇÏ¿© ¿µÇâÀ» ¹ÞÀ» ¼ö ÀÖ´Â ÆíµÎÅë, õ½Ä, °£Áú, ½É ¶Ç´Â ½Å±â´ÉÀå¾ÖÀÚ 
4) °æÁõÀÇ ¸¸¼º °£Áúȯ ȯÀÚ 
5) °íÇ÷¾Ð ȯÀÚ 
6) ´ç´¢º´ ȯÀÚ 
7) ´ã³¶Áúȯ ȯÀÚ 
8) ¿¡½ºÆ®·Î°Õ°ú °ü·ÃµÈ û°¢Àå¾ÖÀÇ º´·ÂÀÌ Àִ ȯÀÚ 
9) ¿ì¿ïÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ 
10) ´ã³¶Áúȯ 
¿¡½ºÆ®·Î°Õ ´ëü¿ä¹ý(ERT)/È£¸£¸ó ´ëü¿ä¹ý(HRT)À» ¹ÞÀº ¿©¼º¿¡°Ô¼ ¼ö¼úÀ» ¿äÇÏ´Â ´ã³¶ÁúȯÀÇ À§ÇèÀÌ 2¢¦4¹è Áõ°¡ÇÑ °ÍÀ¸·Î º¸°íµÇ¾ú´Ù. 
11) ½Ã°¢ÀÌ»ó 
¿¡½ºÆ®·Î°ÕÀ» Åõ¿©¹ÞÀº ȯÀÚ¿¡°Ô¼ ¸Á¸·Ç÷°ü¼º Ç÷ÀüÁõÀÌ º¸°íµÇ¾ú´Ù. ¸¸¾à °©ÀÛ½º·´°Ô ºÎºÐ ¶Ç´Â ÀüüÀûÀÎ ½Ã°¢»ó½Ç, ¾È±¸µ¹Ãâ, º¹½Ã, ÆíµÎÅëÀÌ ¹ß»ýÇÑ °æ¿ì °Ë»çÇÒ ¶§±îÁö ¾à¹°Åõ¿©¸¦ Áß´ÜÇÑ´Ù. °Ë»ç°á°ú, ½Ã½Å°æÀ¯µÎºÎÁ¾ ¶Ç´Â ¸Á¸·Ç÷°ü¼º º´º¯ÀÎ °æ¿ì ¾à¹°Åõ¿©¸¦ Ã¶È¸ÇØ¾ß ÇÑ´Ù. 
 ¾÷µ¥ÀÌÆ®ÀÏ:2009-11-03/ ¾÷µ¥ÀÌÆ®Á¾·ù:Çã°¡»çÇ׺¯°æÁö½Ã
  | 
   
  
    
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      1) ºñ´¢»ý½Ä±â : ÁúÃâÇ÷, ÆÄ±«¼ºÃâÇ÷/Á¡ÀûÃâÇ÷, ¿ù°æºÒ¼ø, ¿ù°æ·®ÀÇ º¯È, ÀڱðæºÎÁø¹«¸§(¹Ì¶õ) ¹× °æºÎ ºÐºñ·®ÀÇ º¯È, ÀڱñÙÁ¾ÀÇ Å©±â Áõ°¡, Àڱ󻸷Áõ½ÄÁõ, Áú¿°, Áúĵð´ÙÁõ, ÀڱþÏ, °£Ç÷°üÁ¾ÀÇ È®Àå, ³¼Ò¾Ï 
2) À¯¹æ : µ¿Åë, ¾ÐÅë, È®´ë, ºÐºñ¹°, À¯·çÁõ, À¯¹æ¾Ï, ¼¶À¯³¶Æ÷¼ºÀ¯¼±ÁõÀÇ º¯È 
3) ¼Òȱâ°è : ±¸¿ª, º¹ºÎ°æ·Ã, °íâ, ´ã¼®Áõ/´ãÁó¿ïü¼ºÈ²´Þ, º¹ºÎÆØ¸¸°¨, º¹Åë, ±¸Åä, ÃéÀå¿°, ´ã³¶Áúȯ, ¼³»ç, ¼ÒȺҷ®, ÇãÇ÷¼º ´ëÀå¿° 
4) ÇǺΠ: Å»¸ðÁõ, ¹ßÁø, ¼Ò¾çÁõ, ´Ù¸ðÁõ, ¿©µå¸§, °£¹Ý/ÈæÇÇÁõ, ´ÙÇüÈ«¹Ý, °áÀýÈ«¹Ý 
5) ´« : ½Ã°¢Àå¾Ö, ÄÜÅÃÆ®·»Áî¿¡ ´ëÇÑ °¨¼ö¼º ÀÌ»ó, ¸Á¸·Ç÷°ü¼º Ç÷ÀüÁõ 
6) ÁßÃ߽Űæ°è : µÎÅë/½Å°æ°ú¹Î, ±âºÐ°ú ¼º¿åÀÇ º¯È, ºÒ¾È, ¾îÁö·¯¿ò, ÆíÅõÅë, ¿ì¿ïÁõ, Ä¡¸Å 
7) ¼øÈ¯±â°è : Á¤¸Æ¼º Ç÷Àü»öÀüÁõ, Ç¥À缺 Ç÷Àü¼ºÁ¤¸Æ¿°, Æó»öÀüÁõ, ½É±Ù°æ»öÁõ, Ç÷¾Ð»ó½Â 
8) ¸é¿ª°è : ¾Æ³ªÇʶô½Ã/¾Æ³ªÇʶô½Ã¾ç ¹ÝÀÀ, µÎµå·¯±â, ¸Æ°üºÎÁ¾ 
9) È£Èí±â°è : ºñ¿°, Àεο°, »ó±âµµ °¨¿°, ±âħ 
10) ±âŸ : üÁßÁõ°¡ ¶Ç´Â °¨¼Ò, ºÎÁ¾, Æ÷¸£ÇǸ°ÁõÀÇ ¾ÇÈ, °£ÁúÀÇ ¾ÇÈ, ³úÁ¹Áß, ¹«µµº´ÀÇ ¾ÇÈ, °üÀýÅë, ´Ù¸®°æ·Ã, ³»´ç·ÂÀå¾Ö, ÀúÄ®½·Ç÷Áõ, õ½ÄÀÇ ¾ÇÈ, ¿äÅë, Áß¼ºÁö¹æ Áõ°¡, ¾ç¼º ¼ö¸·Á¾ÀÇ ¼ºÀå°È 
 ¾÷µ¥ÀÌÆ®ÀÏ:2009-11-03/ ¾÷µ¥ÀÌÆ®Á¾·ù:Çã°¡»çÇ׺¯°æÁö½Ã 
      
     | 
   
        
  
  
    
   
    | »óÈ£ÀÛ¿ë | 
    1) ¾à¹° »óÈ£ÀÛ¿ëÀÇ ¿¬±¸¿¡¼, °áÇÕÇü ¿¡½ºÆ®·Î°Õ°ú ÃÊ»ê¸Þµå·Ï½ÃÇÁ·Î°ÔÅ©Å×·ÐÀ» µ¿½Ã¿¡ Åõ¿©Çصµ µÎ ¾à¹°ÀÇ ¾àµ¿ÇÐÀû Ư¼ºÀÌ º¯ÇÏÁö ¾ÊÀ½ÀÌ º¸°íµÇ¾ú´Ù. °áÇÕÇü ¿¡½ºÆ®·Î°Õ°úÀÇ ´Ù¸¥ ÀÓ»ó ¾à¹° »óÈ£ÀÛ¿ë ¿¬±¸´Â ½ÃÇàµÇÁö ¾Ê¾Ò´Ù. 
2) In vitro ¹× In vivo ½ÃÇè¿¡¼, °áÇÕÇü ¿¡½ºÆ®·Î°ÕÀÇ ¼ººÐ Áß ÇϳªÀÎ 17¥â-¿¡½ºÆ®¶óµð¿ÃÀº °£ È¿¼Ò(CYP3A4)¿¡ ÀÇÇØ ºÎºÐÀûÀ¸·Î ´ë»çµÇ´Â °ÍÀ¸·Î ³ªÅ¸³µ´Ù. °£ È¿¼Ò(CYP 3A4) À¯µµ¾à¹°µé[Ç×Àü°£Á¦(Ä«¸£¹Ù¸¶Á¦ÇÉ, Æä³ë¹Ù¸£ºñÅ», Æä´ÏÅäÀÎ, ÇÁ¸®¹Ìµ·), ¹Ù¸£ºñÅ»°è ¾à¹°, ±×¸®¼¼¿ÀÇ®ºó, ¸®ÆÊÇǽеî]Àº 17¥â-¿¡½ºÆ®¶óµð¿ÃÀÇ Ç÷Àå ³óµµ¸¦ °¨¼Ò½Ãų ¼ö ÀÖ´Ù. ÀÌ´Â È¿°úÀÇ °¨¼Ò ¹×/¶Ç´Â Áú ÃâÇ÷ ¾ç»óÀÇ º¯È¸¦ ÃÊ·¡ÇÒ ¼ö ÀÖ´Ù. ¹Ý¸é, °£ È¿¼Ò(CYP3A4) ÀúÇØ¾à¹°µî[½Ã¸ÞƼµò, ¿¡¸®½º·Î¸¶À̽Å, ÄÉÅäÄÚ³ªÁ¹]°ú º´¿ëÅõ¿© ½Ã 17¥â-¿¡½ºÆ®¶óµð¿ÃÀÇ Ç÷Àå³óµµ¸¦ Áõ°¡½ÃÄÑ ÀÌ»ó¹ÝÀÀÀ» ÃÊ·¡ÇÒ ¼ö ÀÖ´Ù. 
3) ¾Æ¹Ì³ëŬ·çÅ×Ä¡¹Ìµå(Aminoglutethimide)¸¦ ÃÊ»ê¸Þµå·Ï½ÃÇÁ·Î°Ô½ºÅ׷аú µ¿½ÃÅõ¿©ÇÒ °æ¿ì, ÃÊ»ê¸Þµå·Ï½ÃÇÁ·Î°Ô½ºÅ×·ÐÀÇ »ýü ³» ÀÌ¿ë·üÀÌ À¯ÀÇÇÏ°Ô ÀúÇϵȴÙ. 
4) ¿¡½ºÆ®·Î°Õ/È£¸£¸ó ´ëü¿ë¹ý°ú ¼¼ÀÎÆ®Á¸½ºÇ®(St. John's wort, Hypericum perforatum)À» µ¿½Ãº¹¿ëÇÑ È¯ÀÚ¿¡°Ô ¾È¸éÈ«Á¶ ¹× ÁúÃâÇ÷ÀÌ º¸°íµÇ¾ú´Ù. ¼¼ÀÎÆ®Á¸½ºÇ®Àº °£ È¿¼Ò¸¦ À¯µµÇÏ¿© ¿¡½ºÆ®·Î°Õ ´ëü¿ä¹ý ¹× È£¸£¸ó ´ëü¿ä¹ýÀÇ À¯È¿¼ºÀ» ÀúÇϽÃų ¼ö ÀÖ´Ù. 
 ¾÷µ¥ÀÌÆ®ÀÏ:2009-11-03/ ¾÷µ¥ÀÌÆ®Á¾·ù:Çã°¡»çÇ׺¯°æÁö½Ã
  | 
   
  
    
  
  
       	
  
     
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
       
     | 
      
  
  
  |  
     
   
  
    
       |  
      
        
          
            
                | Á¤º¸¿ä¾à |         
             
           
         | 
             	    
       |  
      | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
     
   
  
    
       |  
      
        
          
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |         
             
           
         | 
             	    
       |  
      | 	 |  
     
   
  
    
       |  
      
        
          
            
                | Á¦Ç°Á¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | º¹¾àÁ¤º¸ |            
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Xµî±Þ 
				        
				         (ÀӺΠÅõ¿© ±Ý±â )
				        
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  
   
    | º¹¾à¶óº§ | 
    
    
    
      | À̹ÌÁö | 
      º¹¾à¼³¸í | 
     
    
    
        | 
      ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö | 
     
    
       | 
     
    
    
        | 
      ¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
     |  
    
      
	
	  
            | *  | 
	    º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. | 
	   
	  
            | *  | 
	    º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. | 
	   
	  
            | *  | 
	    ±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. | 
	   
	   
     |   
     | 
   
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
     
   
  
    
       |  
      
        
          
            
                | ½É»çÁ¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
     
  
    
       |  
      
        
          
            
                | ÇмúÁ¤º¸ |          
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | µ¶¼ºÁ¤º¸ | 
    Progesterone¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â 
  Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do  | 
   
  
   
    | Mechanism of Action | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Progestins diffuse freely into target cells in the female reproductive tract, mammary gland, hypothalamus, and the pituitary and bind to the progesterone receptor. Once bound to the receptor, progestins slow the frequency of release of gonadotropin releasing hormone (GnRH) from the hypothalamus and blunt the pre-ovulatory LH surge. 
     | 
   
  
   
    | Pharmacology | 
     
       Medroxyprogesterone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Medroxyprogesterone is a synthetic progestin more potent than progesterone. 
     | 
   
  
   
    | Protein Binding | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 90% 
     | 
   
  
   
    | Half-life | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 50 days 
     | 
   
  
   
    | Absorption | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly absorbed from GI tract 
     | 
   
  
   
    | Pharmacokinetics | 
    
       Estrogens(conjugated)ÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
- Èí¼ö : À§Àå°ü¿¡¼ ½Å¼ÓÈ÷ Èí¼ö
 
 - ´ë»ç : °£¿¡¼ ºñȰ¼º ¹°Áú·Î ´ë»ç
 
 - ¼Ò½Ç : ¼Òº¯°ú ´ãÁóÀ¸·Î ¹è¼³
 
  
 Medroxyprogesterone AcetateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
  
- ÀÛ¿ëÁö¼Ó½Ã°£ : µ¥Æ÷Á¦Á¦ : 3 °³¿ù
 
 - Èí¼ö : ±ÙÀ°ÁÖ»ç : ¼¼È÷ Èí¼ö
 
 - »ýü³»ÀÌ¿ë·ü : °æ±¸ : 0.6-10 %
 
 - ´Ü¹é°áÇÕ : 90 %
 
 - ´ë»ç : °£´ë»ç
 
 - ¹Ý°¨±â : 38-46 ½Ã°£
 
 - Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 2.4 ½Ã°£
 
 - ¼Ò½Ç : ´¢ ¹× º¯¹è¼³
 
   
     | 
   
  
   
    | Biotransformation | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic 
     | 
   
  
   
    | Toxicity | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects include loss of bone mineral density, BMD changes in adult women, bleeding irregularities, cancer risks, and thromboembolic disorders. 
     | 
   
  
   
    | Drug Interactions | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital	The enzyme inducer decreases the effect of hormonesAprobarbital	The enzyme inducer decreases the effect of hormonesBosentan	Bosentan decreases the effect of contraceptiveButabarbital	The enzyme inducer decreases the effect of hormonesButalbital	The enzyme inducer decreases the effect of hormonesButethal	The enzyme inducer decreases the effect of hormonesEthotoin	The enzyme inducer decreases the effect of hormonesFosphenytoin	The enzyme inducer decreases the effect of hormonesMephenytoin	The enzyme inducer decreases the effect of hormonesPhenytoin	The enzyme inducer decreases the effect of hormonesGriseofulvin	The enzyme inducer decreases the effect of hormonesHeptabarbital	The enzyme inducer decreases the effect of hormonesHexobarbital	The enzyme inducer decreases the effect of hormonesMethohexital	The enzyme inducer decreases the effect of hormonesMethylphenobarbital	The enzyme inducer decreases the effect of hormonesPentobarbital	The enzyme inducer decreases the effect of hormonesPhenobarbital	The enzyme inducer decreases the effect of hormonesPrimidone	The enzyme inducer decreases the effect of hormonesSecobarbital	The enzyme inducer decreases the effect of hormonesTalbutal	The enzyme inducer decreases the effect of hormonesWarfarin	The agent increases the effect of anticoagulantAcenocoumarol	The agent increases the effect of anticoagulantDicumarol	The agent increases the effect of anticoagulantAnisindione	The agent increases the effect of anticoagulant 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Description | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Description Á¤º¸ (6 alpha)-17-Hydroxy-6-methylpregn-4-ene-3,20-dione. A synthetic progestational hormone used in veterinary practice as an estrus regulator. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Suspension	IntramuscularTablet	Oral 
     | 
   
  
   
    | Drug Category | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Drug_Category Á¤º¸ ContraceptivesContraceptives, Oral, SyntheticProgestins 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1CC2C(CCC3(C)C2CCC3(O)C(C)=O)C2(C)CCC(=O)C=C12 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@H]1C[C@@H]2[C@H](CC[C@@]3(C)[C@H]2CC[C@]3(O)C(C)=O)[C@@]2(C)CCC(=O)C=C12 
     | 
   
  
   
    | InChI Identifier | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C22H32O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h12-13,16-18,25H,5-11H2,1-4H3/t13-,16+,17-,18-,20+,21-,22-/m0/s1 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Medroxyprogesterone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one 
     | 
   
  
   
    | Drug-Induced Toxicity Related Proteins | 
    
      ESTROGEN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Angiotensinogen  Drug:estrogen Toxicity:rogesterone-induced luteinizing hormone surge.  [¹Ù·Î°¡±â] MEDROXYPROGESTERONE ACETATE (MPA) ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Estrogen receptor  Drug:medroxyprogesterone acetate (MPA) Toxicity:mammary adenocarcinoma.  [¹Ù·Î°¡±â] PROGESTERONE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Mitogen-activated protein kinase  Drug:progesterone Toxicity:progesterone-induced oocyte maturation .  [¹Ù·Î°¡±â] Replated Protein:Angiotensinogen  Drug:progesterone Toxicity:rogesterone-induced luteinizing hormone surge.  [¹Ù·Î°¡±â] Replated Protein:Retinol-binding protein, cellular Drug:progesterone  Toxicity:increase luteal cell progesterone accumulation.  [¹Ù·Î°¡±â] 
     | 
   
    
  |  
     
     
  
    
       |  
      
        
          
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ |           
             
           
         | 
             	  
       |  
       |  
     
         
 
     | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                 º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
  
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |