|   | 
                  
                       | 
                      | 
                    
                        
                            
                                | 
                                  
                                 | 
                             
                             |  
                            
                                
                                    
                                        
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    Å×½ºÅä°Ö1%(Å×½ºÅ佺Å×·Ð)  TESTO GEL 1%  
                    
                 | 
               
              
                | 
                     Àü¹®ÀǾàǰ | ºñ±Þ¿©  
                        
                    	
                    
                 | 
               
              
                | 
					
                     
                     ¼öÀÔÀǾàǰ
	                
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |                   
                                        | 
                                             | 
                                         
                            
                                
                            
                            
                              
                                                        
                              
                                                
                            
 |   
    | 
      
     | 
 
 |  
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
  
  
    
      
  
    
       |  
      
        
          
            
                | Çã°¡Á¤º¸ | 
             
           
         | 
       
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        641105690  
	    
	    
            [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
                    [ºñ±Þ¿©]
                
       
      
       
       
     
      
      
     
      
    
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
      [Áúº´ÄÚµåÁ¶È¸]
     
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
  
   
    | Á¦Ç°¼º»ó | 
    Åõ¸í ¶Ç´Â ¾à°£ ºÒÅõ¸íÇÑ ¹«»öÀÇ °Ö  [Á¦ÇüÁ¤º¸ È®ÀÎ] |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    5g X  30Æ÷ | 
   
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            Æ÷ÀåÇüÅ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 5±×·¥ | 
            30 Æ÷ | 
            Æ÷ | 
            8806411056900 | 
            8806411056924 | 
             | 
	     
        
        
            | 5±×·¥ | 
            1 Æ÷ | 
            Æ÷ | 
            8806411056900 | 
            8806411056917 | 
             | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      451702CCM  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
 
  
  
    
  
  
  
  
  
  
  
  
  
  
 
  
  
  
 
  
  
  
  
  
  
   
    | Çã°¡»çÇ× ¿ø¹®Á¶È¸ | 
    
      
	    [Çã°¡»çÇ× ¿ø¹®Á¶È¸] 
     | 
   
  
  
  
  
     
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      ÀÓ»ó Áõ»ó°ú ½ÇÇè½Ç ºÐ¼®¿¡ ÀÇÇØ Å×½ºÅ佺Å×·Ð °áÇÌÀÌ È®ÀÎµÈ ³²¼º ¼º¼±±â´ÉÀúÇÏÁõ¿¡ ´ëÇÑ È£¸£¸ó´ëġġ·á
      
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
    
  
  
  
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
      [󹿾à¾î] 
      ¡Û ¼ºÀÎ ¹× °í·É ³²¼º 
  ÃʱâÅõ¿© ±ÇÀå·® : ±ú²ýÇÏ°í °ÇÁ¶ÇÑ ¾î±ú, ÆÈ ¶Ç´Â º¹ºÎ Á¤»ó ÇǺο¡ 1ÀÏ 1ȸ µÉ ¼ö ÀÖÀ¸¸é ¿ÀÀü¿¡ ÀÌ ¾à 5 g(Å×½ºÅ佺Å×·ÐÀ¸·Î¼ 50 mg)À» Àû¿ëÇÑ´Ù. Æ÷Àå °³ºÀ ÈÄ ¸ðµç ³»¿ë¹°À» ¼Õ¹Ù´Ú¿¡ Â¥¼ Áï½Ã Àû¿ë ºÎÀ§¿¡ ¹Ù¸£°í, ¼öºÐ°£ °ÇÁ¶½ÃŲ´Ù. ÀÌ ¾àÀ» »ç¿ëÇÑ ÈÄ¿¡´Â ¼ÕÀ» ºñ´©·Î ¾Ä¾î¾ß ÇÑ´Ù. ÀÌ ¾àÀº ƯÈ÷ ¼º±â¸¦ Æ÷ÇÔÇÑ ½ÅüÀÇ ´Ù¸¥ ºÎÀ§¿¡ Àû¿ëÇÏÁö ¾Ê´Â´Ù. Ç÷Àå Å×½ºÅ佺Å×·Ð ³óµµ´Â 2Àϰ ¾ÈÁ¤±â¿¡ µµ´ÞÇϹǷÎ, 3Àϰ Åõ¿© Àü¿¡ Ç÷Àå³óµµ¸¦ ÃøÁ¤Çϰí 1ÁÖÀϵ¿¾È ÃøÁ¤À» Áö¼ÓÇÑ´Ù. ¸¸ÀÏ Ç÷Àå Å×½ºÅ佺Å×·Ð ³óµµ°¡ Á¤»óÄ¡º¸´Ù ³·°Å³ª ¿øÇÏ´Â ÀÓ»ó¹ÝÀÀÀÌ ³ªÅ¸³ªÁö ¾ÊÀ¸¸é ÀÇ»çÀÇ Áö½Ã¿¡ ÀÇÇÏ¿© 1ÀÏ ¿ë·®À» 5 g¿¡¼ 7.5 gÀ¸·Î, 7.5 g¿¡¼ 10 g À¸·Î ´Ü°èÀûÀ¸·Î Áõ·®ÇÑ´Ù.
  
¡Û ¿©¼º°ú ¼Ò¾Æ 
  ÀÌ ¾àÀº ¼Ò¾Æ¿¡ »ç¿ëÇÏÁö ¾Ê´Â´Ù. 18¼¼ ¹Ì¸¸ û¼Ò³â¿¡ »ç¿ëÇÑ °æÇèÀÌ ¾ø´Ù. 
  ¿©¼º¿¡ »ç¿ëÇÏÁö ¾Ê´Â´Ù.     
      	
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
     1) ÀÌ ¾à ¶Ç´Â ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ 
 2) ¿©¼º(³²¼ºÈ È¿°ú°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.) 
 3) À¯¹æ¾ÏȯÀÚ ¶Ç´Â Àü¸³»ù¾ÏÀÌ Àְųª ÀǽɵǴ ȯÀÚ
 
  | 
   
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
     1) ¾ÏÀÇ °ñÀüÀÌ È¯ÀÚ(°íÄ®½·Ç÷Áõ ¹× °íÄ®½·´¢ÁõÀÇ À§ÇèÀÌ Àֱ⠶§¹®¿¡ Á¤±âÀûÀ¸·Î Ç÷Áß Ä®½·³óµµ¸¦ ¸ð´ÏÅ͸µÇØ¾ß ÇÑ´Ù.) 
 2) °íÇ÷¾Ð ȯÀÚ(Ç÷¾Ð »ó½ÂÀ» ¾ß±âÇÒ ¼ö ÀÖ´Ù.) 
 3) ÇãÇ÷¼º ½ÉÀåÁúȯ, °£Áú, ÆíµÎÅë ȯÀÚ(Áõ»óÀ» ¾ÇȽÃų ¼ö ÀÖ´Ù.) 
 4) ¼º¼±±â´ÉÀúÇÏÁõ Ä¡·á ȯÀÚ(ÀÚÁÖ ¿©¼ºÇü À¯¹æÁõÀÌ ¹ßÇöÇÏ¿© °£È¤ Áö¼ÓµÉ ¼ö ÀÖ´Ù.) 
 5) ½ÉÀå, ½ÅÀå, °£Àå Áúȯ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ(ºÎÁ¾À» ¾ß±âÇÒ ¼ö ÀÖ´Ù.) 
 6) °í·ÉÀÚ(Àü¸³»ùºñ´ëÁõ°ú Àü¸³»ù¾Ï ¹ßÇöÀ» Áõ°¡½Ãų ¼ö ÀÖ´Ù.)
 
  | 
   
  
    
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
       1) ¾ËÄÚ¿ÃÀÌ ÇÔÀ¯µÇ¾î Àֱ⠶§¹®¿¡ ÀæÀº Àû¿ëÀº ÇǺΠÀڱذú ÇǺΠ°ÇÁ¶ÀÇ ¿øÀÎÀÌ µÉ ¼ö ÀÖÀ¸¸ç, ¶§¶§·Î ¿©µå¸§ÀÌ »ý±æ ¼ö ÀÖ´Ù.
  
 2) 1ÀÏ °Ö 5 gÀÇ ±ÇÀå ¿ë·® »ç¿ë ½Ã °¡Àå °¡ÁÖ ÀϾ´Â ÀÌ»ó¹ÝÀÀÀ¸·Î¼ Àû¿ëºÎÀ§ ÀÌ»ó ¹ÝÀÀ, È«¹Ý, ¿©µå¸§ ¹× ÇǺΰÇÁ¶¿Í °°Àº ÇǺΠ¹ÝÀÀÀÌ »ý±â´Â °ÍÀ¸·Î °üÂûµÈ´Ù(10 %). ´ÙÀ½Àº ÀÓ»ó½ÃÇèÀ» ÅëÇØ º¸°íµÈ ÀÌ»ó¹ÝÀÀÀ» ³ªÅ¸³½ Ç¥ÀÌ´Ù. ½ÃÆÇ ÈÄ ÀÚ¹ßÀû º¸°í¿Í °ü·Ã µÈ °ÍÀº ºóµµ ÆÄ¾ÇÀÌ ºÒ°¡´ÉÇÏ´Ù. 
 
  
 3) ¹®Çå¿¡ º¸°íµÈ Å×½ºÅ佺Å×·ÐÀÇ °æ±¸ ¶Ç´Â ÁÖ»ç Åõ¿©·Î ÀÎÇÑ ÀÌ»ó¹ÝÀÀÀº ´ÙÀ½°ú °°´Ù. : ±× ¿ÜÀÇ ÀÌ»ó¹ÝÀÀ Áõ¼¼°¡ ÀÖÀ¸¸é Àǻ糪 ¾à»ç¿¡°Ô ¾Ë¸°´Ù.  
 
  
 4) ¿Ü±¹ÀÇ ½ÃÆÇ ÈÄ Á¶»ç¿¡¼ Å×½ºÅ佺Å׷п¡ °£Á¢ ³ëÃâµÈ ¼Ò¾ÆÀÇ ³²¼ºÈ »ç·Ê°¡ º¸°íµÇ¾ú´Ù. ÁõÈÄ¿Í Áõ»óÀ¸·Î´Â À½°æ ¶Ç´Â À½ÇÙÀÇ È®´ë, À½¸ðÀÇ Á¶±â ¹ß¸ð, ºó¹ß¼º ¶Ç´Â Áö¼Ó¼º ¹ß±â¿Í ¼º¿åÀÇ Áõ°¡, °ø°ÝÀûÀÎ Çൿ, °ñ¿¬·É Á¶±â ¼º¼÷ÀÌ´Ù. ´ëºÎºÐÀÇ °æ¿ì À̵é ÁõÈÄ¿Í Áõ»óÀº Å×½ºÅ佺Å×·Ð °Ö¿¡ ´õ ÀÌ»ó ³ëÃâµÇÁö ¾ÊÀ¸¸é ÀÌ»ó Áõ¼¼´Â »ç¶óÁ³Áö¸¸ ÀϺÎÀÇ °æ¿ì, ºñÁ¤»óÀûÀ¸·Î ¼ºÀåÇÑ »ý½Ä±âÀÇ Å©±â°¡ ³ªÀÌ¿¡ ÀûÀýÇÑ Å©±â·Î ÁÙ¾îµéÁö ¾Ê¾ÒÀ¸¸ç, °ñ¿¬·ÉÀÌ ¼Ò¾ÆÀÇ ½ÇÁ¦ ³ªÀ̺¸´Ù ¾à°£ ´õ ³ôÀº ¼öÁØ¿¡¼ º¯ÈÇÏÁö ¾Ê¾Ò´Ù. °£Á¢ ³ëÃâÀÇ À§Ç輺Àº Å×½ºÅ佺Å×·Ð °ÖÀÇ »ç¿ë»óÀÇ ÁÖÀÇ»çÇ×À» ÁöŰÁö ¾ÊÀ» °æ¿ì Á» ´õ Áõ°¡ÇÏ¿´´Ù.
  
 5) ¿Ü±¹ÀÇ ½ÃÆÇ ÈÄ Á¶»ç¿¡¼ ½ÉºÎÁ¤¸ÆÇ÷ÀüÁõ°ú Æó»öÀüÁõÀ» Æ÷ÇÔÇÑ Á¤¸ÆÇ÷Àü»öÀüÁõÀÌ º¸°íµÇ¾ú´Ù.(¡®ÀϹÝÀûÁÖÀÇ Çס¯ ÂüÁ¶)
  
      
     | 
   
        
  
  
    
   
    | »óÈ£ÀÛ¿ë | 
     1) °æ±¸¿ë Ç×ÀÀ°íÁ¦ : ¸ÞÆ®¾Èµå·Î½ºÅ׳î·Ð°ú °°Àº Å×½ºÅ佺Å×·Ð C-17 ġȯÁ¦´Â °æ±¸¿ë Ç×ÀÀ°íÁ¦ÀÇ ¿ä±¸·®À» °¨¼Ò½ÃŰ´Â °ÍÀ¸·Î º¸°íµÇ¾ú´Ù. °æ±¸¿ë Ç×ÀÀ°íÁ¦ Åõ¿©È¯ÀÚ´Â ÇÁ·ÎÆ®·Òºó½Ã°£°ú INR ÃøÁ¤À» ¸é¹ÐÈ÷ ¸ð´ÏÅ͸µ ÇØ¾ß Çϸç, ƯÈ÷ ³²¼ºÈ£¸£¸ó ¿ä¹ýÀ» ½ÃÀÛ, Áß´Ü ¶Ç´Â ¿ë·®À» º¯°æ½Ãų ½Ã öÀúÇÑ ¸ð´ÏÅ͸µÀÌ ±ÇÀåµÈ´Ù. 
 2) ¿Á½ÃÆæºÎŸÁ¸°ú º´¿ë ½Ã Ç÷Áß ¿Á½ÃÆæºÎŸÁ¸ÀÇ ³óµµ¸¦ Áõ°¡½Ãų ¼ö ÀÖ´Ù.  
 3) ´ç´¢º´ ȯÀÚ¿¡¼ ³²¼ºÈ£¸£¸óÀÇ ´ë»çÈ¿°ú·Î Ç÷´çÀ» °¨¼Ò½ÃÄÑ Àν¶¸° ¿ä±¸·®À» °¨¼Ò½Ãų ¼ö ÀÖ´Ù.  
 4) ºÎ½ÅÇÇÁúÀÚ±ØÈ£¸£¸ó(ACTH) ¶Ç´Â ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å¿Í º´¿ë ½Ã ºÎÁ¾ °¡´É¼ºÀ» Áõ°¡½ÃŲ´Ù. µû¶ó¼ ½ÉÀå, ½ÅÀå, °£Àå ÁúȯÀÌ Àִ ȯÀÚ¿¡°Ô ƯÈ÷ ÁÖÀÇÇÏ¿© º´¿ëÅõ¿©ÇØ¾ß ÇÑ´Ù.
 
  | 
   
  
    
  
  
       	
  
     
  
  
  
  
  
  
  |  
     
   
  
    
       |  
      
        
          
            
                | Á¤º¸¿ä¾à |         
             
           
         | 
             	    
       |  
      | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
     
   
  
    
       |  
      
        
          
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |         
             
           
         | 
             	    
       |  
      | 	 |  
     
   
  
    
       |  
      
        
          
            
                | Á¦Ç°Á¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | º¹¾àÁ¤º¸ |            
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Xµî±Þ 
				        
				         (ÀӺο¡ »ç¿ë ±Ý±â. )
				        
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  
   
    ½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  
   
    | º¹¾à¶óº§ | 
    
    
    
      | À̹ÌÁö | 
      º¹¾à¼³¸í | 
     
    
    
        | 
      ¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
     |  
    
      
	
	  
            | *  | 
	    º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. | 
	   
	  
            | *  | 
	    º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. | 
	   
	  
            | *  | 
	    ±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. | 
	   
	   
     |   
     | 
   
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
     
   
  
    
       |  
      
        
          
            
                | ½É»çÁ¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
     
  
    
       |  
      
        
          
            
                | ÇмúÁ¤º¸ |          
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | µ¶¼ºÁ¤º¸ | 
    Testosterone¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â 
  Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do  | 
   
  
   
    | Mechanism of Action | 
    
       Testosterone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The effects of testosterone in humans and other vertebrates occur by way of two main mechanisms: by activation of the androgen receptor (directly or as DHT), and by conversion to estradiol and activation of certain estrogen receptors. Free testosterone (T) is transported into the cytoplasm of target tissue cells, where it can bind to the androgen receptor, or can be reduced to 5¥á-dihydrotestosterone (DHT) by the cytoplasmic enzyme 5¥á-reductase. DHT binds to the same androgen receptor even more strongly than T, so that its androgenic potency is about 2.5 times that of T. The T-receptor or DHT-receptor complex undergoes a structural change that allows it to move into the cell nucleus and bind directly to specific nucleotide sequences of the chromosomal DNA. The areas of binding are called hormone response elements (HREs), and influence transcriptional activity of certain genes, producing the androgen effects. 
     | 
   
  
   
    | Pharmacology | 
     
       Testosterone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Testosterone is a steroid hormone from the androgen group. Testosterone is primarily secreted in the testes of males and the ovaries of females although small amounts are secreted by the adrenal glands. It is the principal male sex hormone and an anabolic steroid. In both males and females, it plays key roles in health and well-being. Examples include enhanced libido, energy, immune function, and protection against osteoporosis. On average, the adult male body produces about twenty times the amount of testosterone than an adult female's body does. 
     | 
   
  
   
    | Protein Binding | 
    
       Testosterone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 40% of testosterone in plasma is bound to sex hormone-binding globulin and 2% remains unbound and the rest is bound to albumin and other proteins. 
     | 
   
  
   
    | Half-life | 
    
       Testosterone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 10-100 minutes 
     | 
   
  
   
    | Absorption | 
    
       Testosterone¿¡ ´ëÇÑ Absorption Á¤º¸ Approximately 10% of the testosterone dose applied on the skin surface is absorbed into systemic circulation 
     | 
   
  
   
    | Pharmacokinetics | 
    
       TestosteroneÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
 
- 	ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£ : 
 
 - 	ÀÛ¿ëÁö¼Ó½Ã°£ : Åõ¿© °æ·Î ¹× ¿° Á¾·ù¿¡ µû¶ó ´Ù¸£´Ù.
 
- 	   Testosterone cypionate, Testosterone enanthate : ±ÙÀ°ÁÖ»ç : 2-4ÁÖ
 
   
 - 	Èí¼ö : 
 
- 	   °æ±¸ : À§Àå°ü, ±¸° Á¡¸·À¸·ÎºÎÅÍ Èí¼öµÇ³ª ÃÊȸÅë°úÈ¿°ú°¡ ¸Å¿ì Å©´Ù.
 
 - 	   ±ÙÀ°ÁÖ»ç : ¼¼È÷ Èí¼öµÈ´Ù.
 
   
 - 	ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ
 
 - 	´Ü¹é°áÇÕ : 98% (transcortin ¹× albumin¿¡ °áÇÕÇÑ´Ù.)
 
 
 - 	´ë»ç : 
 
- 	   °æ±¸ Åõ¿©½Ã °ÅÀÇ ´ëºÎºÐÀÌ ÃÊȸÅë°ú ´ë»ç¸¦ ¹Þ´Â´Ù.
 
 - 	   °£¿¡¼ ´Ù¾çÇÑ 17-ketosteroids ¹× Æ÷ÇÕü·Î ´ë»çµÈ´Ù.
   
 - 	¹Ý°¨±â : 10-100ºÐ
 
- 	   À¯¸®Çü testosteroneÀÇ ¾ç¿¡ µû¶ó ¹Ý°¨±â°¡ º¯ÇϹǷΠÅõ¿© °æ·Î ¹× ¿° Á¾·ù¿¡ µû¶ó ´Ù¸£´Ù.
 
 - 	   Testosterone cypionate : ±ÙÀ°ÁÖ»ç : ¹Ý°¨±â°¡ ¾à 8ÀÏÀ̶ó°í º¸°íµÇ¾ú´Ù.
   
 - 	¼Ò½Ç : 90%´Â ÁÖ·Î ´ë»çü·Î¼ ´¢¸¦ ÅëÇØ, ¾à 10%´Â ´ãÁóÀ» °ÅÃÄ ´ëº¯À» ÅëÇØ ¹è¼³µÈ´Ù.
 
 
  
 
     | 
   
  
   
    | Biotransformation | 
    
       Testosterone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Testosterone is metabolized to 17-keto steroids through two different pathways. The major active metabolites are estradiol and dihydrotestosterone (DHT). 
     | 
   
  
   
    | Toxicity | 
    
       Testosterone¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects include amnesia, anxiety, discolored hair, dizziness, dry skin, hirsutism, hostility, impaired urination, paresthesia, penis disorder, peripheral edema, sweating, and vasodilation. 
     | 
   
  
   
    | Drug Interactions | 
    
       Testosterone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Description | 
    
       Testosterone¿¡ ´ëÇÑ Description Á¤º¸ A potent androgenic steroid and major product secreted by the leydig cells of the testis. Its production is stimulated by luteinizing hormone from the pituitary gland. In turn, testosterone exerts feedback control of the pituitary LH and FSH secretion. Depending on the tissues, testosterone can be further converted to dihydrotestosterone or estradiol. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Testosterone¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule	OralGel	TopicalLiquid	IntramuscularPatch	TransdermalSolution	Intramuscular 
     | 
   
  
   
    | Drug Category | 
    
       Testosterone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Androgens 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Testosterone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=CC(=O)CCC34C)C1CCC2O 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Testosterone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2O 
     | 
   
  
   
    | InChI Identifier | 
    
       Testosterone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Testosterone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one 
     | 
   
    
  |  
     
     
  
    
       |  
      
        
          
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ |           
             
           
         | 
             	  
       |  
       |  
     
         
 
     | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2023-12-02
              
 
              - 
                
                 º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
  
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |  
                           
                         | 
                       
                      | 
                   |