| |
|
|
|
|
|
 |
| |
|
Á¦ÀÏ¿¡Çdz×ÇÁ¸°ÁÖ»ç¾× JEIL EPINEPHRINE INJ.
|
Àü¹®ÀǾàǰ | »èÁ¦ | ºÐ¾÷¿¹¿ÜÀǾàǰ(52)
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
650500420[A04900341]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml/¾ÚÇÃ(2016.10.01)(ÇöÀç¾à°¡)
\338 ¿ø/1ml/¾ÚÇÃ(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»öÀÇ Åõ¸íÇÑ ¾×ÀÌ µç °¥»ö Åõ¸íÇÑ ¾ÚÇÃÁÖ»çÁ¦.
ÀÌ ¾àÀº °ø±â ¶Ç ´Â ºû¿¡ ÀÇÇÏ¿© õõÈ÷ ¿¯Àº Àû»öÀ¸·Î µÇ°í ´ÙÀ½¿¡ °¥»öÀ¸·Î µÈ´Ù. [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
1ml/¾ÚÇÃ X 50¾ÚÇÃ |
| ÁÖ¼ººÐÄÚµå |
152601BIJ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
±â°üÁö õ½Ä ¹ßÀÛÀÇ ¿ÏÈ, Ç÷ûº´. µÎµå·¯±â. ¸Æ°ü½Å°æ¼º ºÎÁ¾ÀÇ Áõ»ó ¿ÏÈ, ¾à¹°¿¡ ÀÇÇÑ ¼ï. ½ÉÁ¤ÁöÀÇ º¸Á¶Ä¡·á, ±¹¼Ò¸¶ÃëÁ¦ È¿·ÂÀÇ Áö¼Ó
|
| ¾à¹°À½½Ä°£ »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
0.1% ÁÖ»ç¾×À¸·Î¼ 1ȸ¿¡ ´ÙÀ½ÀÇ ¾çÀ» »ç¿ëÇÑ´Ù.
1. ÇÇÇÏ ¹× ±ÙÁÖ : ¾ÖÇdz×ÇÁ¸°À¸·Î¼ 1ȸ 0.2-1.0mL Åõ¿©ÇÑ´Ù.
2. Á¤¸ÆÁÖ»ç : ½ÉÁ¤Áö µî ±ä±Þ½Ã¿¡´Â ÀÌ ¾à 0.25mL¸¦ ³ÑÁö ¾Ê´Â ¹üÀ§ ³»¿¡¼ »ý¸® ½Ä¿° ÁÖ»ç ¾× µî¿¡ Èñ¼®ÇÏ¿© õõÈ÷ ÁÖ»çÇÑ´Ù.
3. ±¹¼Ò¸¶ÃëÁ¦¿Í º´¿ë½Ã : ±¹¼Ò¸¶ÃëÁ¦ 10mL¿¡ ÀÌ ¾à 1-2¹æ¿ïÀÇ ºñÀ²·Î ÷°¡ÇÏ¿© »ç¿ëÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
1) µ¿¸Æ°æÈÁõ(³úµ¿¸ÆÆ÷ÇÔ) ȯÀÚ(Ç÷°ü¼öÃàÀÛ¿ë¿¡ ÀÇÇØ Æó»ö¼º Ç÷°üÀå¾Ö°¡ ÃËÁøµÇ°í, °üµ¿¸Æ¤ý³úÇ÷°ü µîÀÇ ¼öÃà, ±âÁúÀû Æó»öÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
2) ±âÁú¼º ½ÉÁúȯ ȯÀÚ
3) ½ÉÈ®Àå ȯÀÚ
4) °íÇ÷¾Ð ȯÀÚ(Ç÷°ü¼öÃà¿¡ ÀÇÇØ ±Þ°ÝÇÑ Ç÷¾Ð»ó½ÂÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
5) ±âÁú¼º ³ú¼Õ»ó ȯÀÚ
6) ¸¸¼º ÄÚÄ«ÀÎ Áßµ¶ ȯÀÚ(ÄÚÄ«ÀÎÀº ±³°¨½Å°æ È¿´É¾à ¸»´Ü¿¡ Ä«Å×ÄݾƹÎÀÇ ÀçÈí¼ö¸¦ ¹æÇØÇÏ¿© ÀÌ ¾àÀÇ ÀÛ¿ëÀ» Áõ°½Ãų ¼ö ÀÖ´Ù)
7) Á¤½Å½Å°æÁõ ȯÀÚ
8) °©»ó¼±±â´ÉÇ×ÁøÁõ ȯÀÚ(ºó¸Æ, ½É½Ç¼¼µ¿ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ¾Ç鵃 ¼ö ÀÖ´Ù)
9) ´ç´¢º´ ȯÀÚ(°£ÀÇ ±Û¸®ÄÚ°Õ ºÐÇØ¸¦ ÃËÁøÇϰí, Àν¶¸° ºÐºñ¸¦ ¾ïÁ¦ÇϹǷÎ, °íÇ÷´çÀ» ÃÊ·¡ÇÒ ¼ö ÀÖ´Ù)
10) Æó¼â°¢ ³ì³»Àå ȯÀÚ
11) Æó·Å ȯÀÚ³ª °´Ç÷ÀÇ À§ÇèÀÌ Àִ ȯÀÚ
12) ºÐ¸¸ ÁßÀΠȯÀÚ
13) ½ÉÀμº¤ý¿Ü»ó¼º¤ýÃâÇ÷¼º ¼ï ȯÀÚ
14) Å©·Ò Ä£È ¼¼Æ÷Á¾ ȯÀÚ
15) ÁßÁõ ½Å±â´É Àå¾Ö ȯÀÚ
16) ÀÜ´¢ Çü¼ºÀÌ ¼ö¹ÝµÇ´Â Àü¸³¼± ¼±Á¾ ȯÀÚ
17) Æó¼º½É(øËàõãý) ȯÀÚ
18) ¼Õ°¡¶ô, ¹ß°¡¶ô, ÄÚ, À½°æºÎÀ§ ¸¶Ãë ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀ» ¿øÄ¢À¸·Î ÇÏÁö¸¸ ´ÙÀ½ ȯÀÚ¿¡´Â ƯÈ÷ ÇÊ¿äÇÑ °æ¿ì¿¡ ÇÑÇÏ¿© ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
(1) ÀÌ ¾à¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
(2) ±³°¨½Å°æ È¿´É¾à¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ
(3) ÁßÁõ ºÎÁ¤¸Æ(½É½Ç¼º ºó¸Æ µî) ȯÀÚ
2) ¸¸¼º ±â°üÁö õ½Ä ȯÀÚ
3) °ü»ó µ¿¸Æ ±â´É ºÎÀü ȯÀÚ
4) ÇãÇ÷¼º ½ÉÁúȯ ȯÀÚ
5) ÆóºÎÁ¾ ȯÀÚ
6) MAO ÀúÇØÁ¦¸¦ Åõ¿©ÁßÀΠȯÀÚ
7) ÀÓºÎ, ¼Ò¾Æ ¹× °í·ÉÀÚ
8) ôÃ߸¶Ã븦 ½Ç½ÃÇÑ È¯ÀÚ(±¹¼Ò¸¶Ãë¿¡ ÷°¡ÇÏ¿© »ç¿ëÇÏ´Â °æ¿ì ô¼ö·ÎÀÇ Ç÷¾×°ø±ÞÀ» ¹æÇØÇÒ ¼ö ÀÖ´Ù)
9) ¾ÆÈ²»ê¼ö¼Ò³ªÆ®·ýÀÌ ÇÔÀ¯µÇ¾î ÀÖÀ¸¹Ç·Î ¾ÆÈ²»ê ¾Æ³ªÇʶô½Ã¿Í °°Àº ¾Ë·¹¸£±â¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¸ç, ÀϺΠ°¨¼ö¼º ȯÀÚ¿¡°Ô´Â »ý¸íÀ» À§ÇùÇÒ Á¤µµ ¶Ç´Â À̺¸´Ù ¾àÇÑ Ãµ½Ä¹ßÀÛÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. ÀÏ¹Ý »ç¶÷¿¡¼ÀÇ ¾ÆÈ²»ê °¨¼ö¼º¿¡ ´ëÇÑ ÃѰýÀûÀÎ ºóµµ´Â ¾Ë·ÁÁöÁö ¾Ê¾ÒÀ¸³ª ³·Àº °ÍÀ¸·Î º¸À̸ç, ¾ÆÈ² »ê °¨¼ö¼ºÀº ºñõ½Ä ȯÀÚº¸´Ù õ½ÄȯÀÚ¿¡¼ ºó¹øÇÑ °ÍÀ¸·Î ³ªÅ¸³µ´Ù.
|
| ÀÌ»ó¹ÝÀÀ |
1) ¼øÈ¯±â°è : ½É°èÇ×Áø, ½É±ÙÇãÇ÷, ½ºÆ®·¹½º ½É±Ùº´Áõ, ¶§¶§·Î Èä³» µ¿Åë, ºó¸Æ, ºÎÁ¤¸Æ, ½É°èÇ×Áø, ¾È¸éÈ«Á¶, â¹é, Ç÷¾ÐÀÌ»ó»ó½Â, Çù½ÉÁõ, Áß´ëÇÑ ÀÌ»ó¹ÝÀÀÀ¸·Î ½ÉÁ¤Áö, ½É½Ç¼¼µ¿ ¹× ÁßÁõ °íÇ÷¾Ð¿¡¼ ¾ß±âµÈ ³úÃâÇ÷, ÆóºÎÁ¾ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ¿© Ãʱâ ÀÌ»ó Áõ»óÀÌ ³ªÅ¸³ª¸é Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
2) Á¤½Å½Å°æ°è : µÎÅë, ¾îÁö·¯¿ò, ºÒ¾È, ÁøÀüÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) ¼Òȱâ°è : ±¸¿ª, ±¸Åä µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) È£Èí±â°è : È£Èí°ï¶õÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ¿© ÀÌ»óÁõ»óÀÌ ³ªÅ¸³ª¸é Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
5) Á¡¾È, °á¸·ÇÏ ÁÖ»ç(¾È¿µ¿ª) »ç¿ë½Ã : Àå±â¿¬¿ë½Ã ¾È°Ë, °á¸·ÀÇ »ö¼ÒÄ§Âø, ºñ·ç°ü(ެרη)ÀÇ »ö¼ÒÄ§Âø¿¡ ÀÇÇÑ Æó¼â, ¹«¼öÁ¤Ã¼¾È ȯÀÚ¿¡ ¿¬¿ë½Ã Ȳ¹ÝºÎÀÇ ºÎÁ¾, ¹Ì¼ÒÃâÇ÷, Ç÷°ü°æ·ÃÀÌ ³ªÅ¸³¯ ¼ö ÀÖ°í, ¶§¶§·Î °á¸·, ¾È°Ë, ´« ÁÖÀ§ µîÀÇ °ú¹ÎÁõ»ó, °á¸·ÃæÇ÷, ¾ÈÅë, µå¹°°Ô Àå±â¿¬¿ë½Ã °¢¸·ÀÇ »ö¼ÒÄ§ÂøÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
6) ±¹¼Ò¿¡ ¹Ýº¹ ÁÖ»çÇÒ °æ¿ì Ç÷°ü¼öÃàÀÛ¿ëÀ¸·Î ÁÖ»çºÎÀ§¿¡ ±«»ç°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) ¼Õ ¶Ç´Â ¹ß¿¡ ¿¡Çdz×ÇÁ¸°À» ½Ç¼ö·Î Åõ¿©ÇÏ¿´À» °æ¿ì ¸»ÃÊÇãÇ÷ÁõÀÌ ¹ß»ýÇÒ ¼ö ÀÖ´Ù.
8) ´ëÅð¿¡ ¿¡Çdz×ÇÁ¸° ÁÖ»ç ÈÄ, ±«»ç¼º ±Ù¸·¿° ¹× Ŭ·Î½ºÆ®¸®µã¿¡ ÀÇÇÑ ±Ù±«»ç(°¡½º ±«Àú)¿Í °°Àº ÁßÁõ ÇǺΠ¹× ¿¬Á¶Á÷ °¨¿° »ç·Ê°¡ µå¹® ºóµµ·Î º¸°íµÇ¾ú´Ù.
9) ±âŸ : ¿°¨, ¹ßÇÑ, »çÁö³Ã°¢, °ú¹ÎÁõ, °íÇ÷´ç, Àå±â°£ ¶Ç´Â °ú·®Åõ¿©½Ã Àå°üºÎÀ§, ½ÅÀå ¹× ½É±Ù¿¡ ±«Àú°¡ ³ªÅ¸³ª°Å³ª ÁßÁõÀÇ ´ë»ç¼º »êÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ÇÒ·Îź µîÀÇ ÇÒ·Î°Õ ÇÔÀ¯ ÈíÀÔ¸¶ÃëÁ¦¿Í º´¿ëÅõ¿©½Ã ºó¸Æ, ½É½Ç¼¼µ¿, ±Þ¼º ÆóºÎÁ¾ÀÇ À§Ç輺ÀÌ Áõ°¡ÇϹǷΠº´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
2) Ç×Á¤½Åº´¾à(¸®½ºÆä¸®µ·, Æä³ëÄ¡¾ÆÁø°è ¾à¹°(¿¹:ÆÛÆä³ªÁø, Ŭ·ÎÇÁ·Î¸¶Áø µî), ºäÆ¿·ÎÆä³í°è ¾à¹°(¿¹:ÇÒ·ÎÆä¸®µ¹, ºê·ÒÆä¸®µ¹ µî) µî), ¾ËÆÄ Â÷´ÜÁ¦¿Í º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ Ç÷¾Ð»ó½ÂÀÛ¿ëÀÇ ¹ÝÀü¿¡ ÀÇÇØ ÀúÇ÷¾ÐÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
3) À̼ÒÇÁ·¹³¯¸° µîÀÇ Ä«Å×ÄÝ¾Æ¹Î°è ¾à¹°, ÇÁ·ÎÅ×·¹³î µîÀÇ ¿¡Çdz×ÇÁ¸° È¿´É¾à°ú º´¿ëÅõ¿©½Ã ½ÉºÎÁ¤¸ÆÀ̳ª °æ¿ì¿¡ µû¶ó¼ ½ÉÁ¤Áö¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ¼Ò»ý µîÀÇ À§±Þ »óȲ ÀÌ¿ÜÀÇ °æ¿ì¿¡´Â º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
4) MAO ÀúÇØÁ¦, Ä«Å×ÄÝ-O-¸ÞÅ»ÀüÀÌ È¿¼Ò¾ïÁ¦Á¦(COMT-inhibitors), »ïȯ°è Ç׿ì¿ï¾à, ºÐ¸¸ÃËÁøÁ¦, µ¶»çǪ¶÷, Ŭ·Î´Ïµò, ·¹º¸Æ¼·Ï½Å³ªÆ®·ý, ƯÁ¤ Ç×È÷½ºÅ¸¹ÎÁ¦(µðÆæÈ÷µå¶ó¹Î, Ŭ·Î¸£Æä´Ï¶ó¹Î, Æ®¸®Æç·»¾Æ¹Î)¿Í º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ ÀÛ¿ëÀÌ Áõ°µÇ¾î Ç÷¾ÐÀÇ ÀÌ»ó»ó½ÂÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
5) °½É¹è´çü(µð±âÅ»¸®½º, Äû´Ïµò µî), ÀÌ´¢Á¦, Ç׺ÎÁ¤¸ÆÁ¦(µð°î½Å µî) º¹¿ë Áß ¿¡Çdz×ÇÁ¸° º´¿ëÅõ¿©½Ã ½ÉÀå ºÎÁ¤¸Æ(À̼Ҽº ºÎÁ¤¸Æ, ½É½Ç¼¼µ¿ µî) ¹ß»ý ¿©ºÎ¿¡ ´ëÇØ ÁÖÀÇÇÑ´Ù.
6) °©»ó¼±Á¦(Ä¡·Ï½Å µî)¿Í º´¿ëÅõ¿©½Ã °üºÎÀü ¹ßÀÛÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
7) ÇÁ·ÎÇÁ¶ó³î·Ñ µîÀÇ ºñ¼±Åüº º£Å¸Â÷´ÜÁ¦¿Í º´¿ëÅõ¿©½Ã Ç÷¾Ð»ó½Â, ¼¸ÆÀÌ ¹ß»ýÇÒ ¼ö ÀÖÀ¸¸ç, ÀÌ ¾àÀÇ ±â°üÁö È®ÀåÈ¿°ú¸¦ ¾ïÁ¦ÇÒ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
8) Àν¶¸° µîÀÇ Ç÷´ç°ÇÏÁ¦¿Í º´¿ëÅõ¿©½Ã Ç÷´ç°ÇÏÁ¦ÀÇ ÀÛ¿ëÀ» °¨¼Ò½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
9) ¸Æ°¢ ¾ËÄ«·ÎÀ̵å´Â ¾ËÆÄ ¾Æµå·¹³¯¸° Â÷´ÜÀÛ¿ëÀ» ÇϹǷΠÀÌ ¾àÀÇ È¿°ú¸¦ °¨¼Ò½ÃŲ´Ù.
10) ±¸¾Æ³×Ƽµò°ú º´¿ëÅõ¿©½Ã µ¿¸Æ¾ÐÀÇ ÇöÀúÇÑ »ó½ÂÀ» À¯¹ßÇϹǷΠÁÖÀÇÇÑ´Ù.
11) ÀÌ´¢Á¦, Ç÷°üÈ®ÀåÁ¦ ¹× Ç×°íÇ÷¾ÐÁ¦´Â ÀÌ ¾àÀÇ È¿°ú¸¦ °¨¼Ò½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
12) Ä®·ý °í°¥¼º ÀÌ´¢Á¦, ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å, Å׿ÀÇʸ°Àº ÀúÄ®·ýÇ÷ÁõÀ» À¯¹ßÇÒ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
650500420[A04900341]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml/¾ÚÇÃ(2016.10.01)(Ãֽžడ)
\338 ¿ø/1ml/¾ÚÇÃ(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
|
| Á¦Ç°¼º»ó |
¹«»öÀÇ Åõ¸íÇÑ ¾×ÀÌ µç °¥»ö Åõ¸íÇÑ ¾ÚÇÃÁÖ»çÁ¦.
ÀÌ ¾àÀº °ø±â ¶Ç ´Â ºû¿¡ ÀÇÇÏ¿© õõÈ÷ ¿¯Àº Àû»öÀ¸·Î µÇ°í ´ÙÀ½¿¡ °¥»öÀ¸·Î µÈ´Ù.
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
1ml/¾ÚÇÃ X 50¾ÚÇÃ |
| º¸°ü¹æ¹ý |
Â÷±¤ÇÑ ¹ÐºÀ¿ë±â |
µ¿ÀÏÁÖ¼ººÐÄÚµå °Ë»ö¼øÀ§ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
Ư¼ö°ü¸®ÀǾàǰ ºÎ°¡Á¤º¸ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(ÀÓ»ó ¿¬±¸¿¡¼ À§Ç輺 º¸°íµÊ. -Briggs G, et al. Drugs in Pregnancy and Lactation 7th edit. )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Epinephrine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Epinephrine works via the stimulation of alpha and beta-1 adrenergic receptors, and a moderate activity at beta-2 adrenergic receptors.
|
| Pharmacology |
Epinephrine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Epinephrine is indicated for intravenous injection in treatment of acute hypersensitivity, treatment of acute asthmatic attacks to relieve bronchospasm, and treatment and prophylaxis of cardiac arrest and attacks of transitory atrioventricular heart block with syncopal seizures (Stokes-Adams Syndrome). The actions of epinephrine resemble the effects of stimulation of adrenergic nerves. To a variable degree it acts on both alpha and beta receptor sites of sympathetic effector cells. Its most prominent actions are on the beta receptors of the heart, vascular and other smooth muscle. When given by rapid intravenous injection, it produces a rapid rise in blood pressure, mainly systolic, by (1) direct stimulation of cardiac muscle which increases the strength of ventricular contraction, (2) increasing the heart rate and (3) constriction of the arterioles in the skin, mucosa and splanchnic areas of the circulation. When given by slow intravenous injection, epinephrine usually produces only a moderate rise in systolic and a fall in diastolic pressure. Although some increase in pulse pressure occurs, there is usually no great elevation in mean blood pressure. Accordingly, the compensatory reflex mechanisms that come into play with a pronounced increase in blood pressure do not antagonize the direct cardiac actions of epinephrine as much as with catecholamines that have a predominant action on alpha receptors.
|
| Metabolism |
Epinephrine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Half-life |
Epinephrine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 2 minutes
|
| Absorption |
Epinephrine¿¡ ´ëÇÑ Absorption Á¤º¸ Usually this vasodilator effect of the drug on the circulation predominates so that the modest rise in systolic pressure which follows slow injection or absorption is mainly the result of direct cardiac stimulation and increase in cardiac output.
|
| Pharmacokinetics |
Epinephrine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ±â°üÁö ÀÌ¿Ï È¿°úÀÇ ¹ßÇö½Ã°£
- ÇÇÇÏÁÖ»ç : 5-10ºÐ À̳»
- ÈíÀÔ : 1ºÐ À̳»
- °á¸· Á¡Àû
- È¿°ú¹ßÇö½Ã°£ (¾È¾Ð °¨¼Ò) : 1½Ã°£ À̳»
- ÃÖ°íÈ¿°ú ¹ßÇö½Ã°£ : 4-8½Ã°£ À̳»
- ´«¿¡ ´ëÇÑ ÀÛ¿ëÁö¼Ó½Ã°£ : 12-24 ½Ã°£
- Èí¼ö : °æ±¸ Åõ¿©½Ã À§Àå°ü, °£¿¡¼ ½Å¼ÓÈ÷ ´ë»çµÇ¹Ç·Î ¾à¸®ÀÛ¿ëÀ» ³ªÅ¸³»´Â Ç÷Á߳󵵿¡ µµ´ÞÇÏÁö ¸øÇÔ
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ
- ´ë»ç : Åõ¿© ÈÄ ¾Æµå·¹³¯¸°¼º ½Å°æ¼¼Æ÷¿¡ uptakeµÇ¾î monoamine oxidase¿Í catechol-o-methyltransferase¿¡ ÀÇÇØ ´ë»çµÊ. ¼øÈ¯ ¾à¹°Àº °£¿¡¼ ´ë»çµÊ
- ¼Ò½Ç : ºñȰ¼ºÇü ´ë»çü (metanephrine, mandelic acidÀÇ È²»ê ¶Ç´Â ¼ö»êÈ À¯µµÃ¼)¿Í ¼Ò·®Àº ¹Ìº¯Èü·Î ´¢¸¦ ÅëÇØ ¹è¼³µÊ
|
| Biotransformation |
Epinephrine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Epinephrine is rapidly inactivated in the body and is degraded by enzymes in the liver and other tissues. The larger portion of injected doses is excreted in the urine as inactivated compounds and the remainder either partly unchanged or conjugated. The drug becomes fixed in the tissues and is inactivated chiefly by enzymatic transformation to metanephrine or normetanephrine either of which is subsequently conjugated and excreted in the urine in the form of sulfates and glucuronides. Either sequence results in the formation of 3-methoxy-4-hydroxy-mandelic acid which also is detectable in the urine.
|
| Toxicity |
Epinephrine¿¡ ´ëÇÑ Toxicity Á¤º¸ Skin, LD50 = 62 mg/kg (rat)
|
| Drug Interactions |
Epinephrine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Acebutolol Hypertension, then bradycardiaAlseroxylon Increased arterial pressureAmitriptyline The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectAtenolol Hypertension, then bradycardiaBetaxolol Hypertension, then bradycardiaBevantolol Hypertension, then bradycardiaBisoprolol Hypertension, then bradycardiaCarteolol Hypertension, then bradycardiaCarvedilol Hypertension, then bradycardiaClomipramine The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectDeserpidine Increased arterial pressureDoxepin The tricyclic increases the sympathomimetic effectEntacapone Entacapone increases the effect and toxicity of sympathomimeticsMethylergonovine Possible marked increase of arterial pressureNortriptyline The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectEsmolol Hypertension, then bradycardiaGuanethidine The agent decreases the effect of guanethidineIsocarboxazid Increased arterial pressureLabetalol Hypertension, then bradycardiaLinezolid Possible increase of arterial pressureMethyldopa Increased arterial pressureMetoprolol Hypertension, then bradycardiaMidodrine Increased arterial pressureMoclobemide Moclobemide increases the sympathomimetic effectNadolol Hypertension, then bradycardiaPenbutolol Hypertension, then bradycardiaOxytocin Possible marked increase of arterial pressurePhenelzine Increased arterial pressurePindolol Hypertension, then bradycardiaPractolol Hypertension, then bradycardiaPropranolol Hypertension, then bradycardiaRasagiline Increased arterial pressureReserpine Increased arterial pressureSotalol Hypertension, then bradycardiaTimolol Hypertension, then bradycardiaTranylcypromine Increased arterial pressureTrimipramine The tricyclic increases the sympathomimetic effectErgonovine Possible marked increase of arterial pressureOxprenolol Hypertension, then bradycardiaPargyline Increased arterial pressure
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Epinephrine¿¡ ´ëÇÑ Description Á¤º¸ The active sympathomimetic hormone from the adrenal medulla in most species. It stimulates both the alpha- and beta- adrenergic systems, causes systemic vasoconstriction and gastrointestinal relaxation, stimulates the heart, and dilates bronchi and cerebral vessels. It is used in asthma and cardiac failure and to delay absorption of local anesthetics. [PubChem]
|
| Drug Category |
Epinephrine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic AgonistsAdrenergic alpha-AgonistsAdrenergic beta-AgonistsBronchodilator AgentsMydriaticsSympathomimeticsVasoconstrictor Agents
|
| Smiles String Canonical |
Epinephrine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CNCC(O)C1=CC(O)=C(O)C=C1
|
| Smiles String Isomeric |
Epinephrine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CNC[C@H](O)C1=CC(O)=C(O)C=C1
|
| InChI Identifier |
Epinephrine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1
|
| Chemical IUPAC Name |
Epinephrine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 4-[(1R)-1-hydroxy-2-methylaminoethyl]benzene-1,2-diol
|
| Drug-Induced Toxicity Related Proteins |
EPINEPHRINE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Interleukin-8 Drug:epinephrine Toxicity:inflammation. [¹Ù·Î°¡±â] Replated Protein:Leptin Drug:epinephrine Toxicity:epinephrine-induced suppression in human obesity. [¹Ù·Î°¡±â] Replated Protein:Glutathione reductase Drug:epinephrine Toxicity:cytotoxic. [¹Ù·Î°¡±â] Replated Protein:Alpha-2A adrenergic receptor Drug:epinephrine Toxicity:platelet aggregation. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-12-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|