| |
|
|
|
|
|
 |
| |
|
º£ÀÚÇǵåÁ¤ BEZAPID TAB.[Bezafibrate]
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[A03503631]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2002.05.11)(ÇöÀç¾à°¡)
\73 ¿ø/1Á¤(2002.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ ¿øÇü Çʸ§ÄÚÆÃÁ¤Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¿ø¹ß¼º°íÁöÇ÷Áõ : °íÄÝ·¹½ºÅ×·ÑÇ÷Áõ(¥±aÇü), °íÄÝ·¹½ºÅ×·ÑÇ÷Áõ°ú °íÆ®¸®±Û¸®¼¼¶óÀ̵åÇ÷ÁõÀÇ º¹ÇÕÇü(¥±b, ¥²Çü), °íÆ®¸®±Û¸®¼¼¶óÀ̵åÇ÷Áõ(¥³, ¥´Çü)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : º£ÀÚÇǺ극ÀÌÆ®·Î¼ 1ȸ 200§· 1ÀÏ 2-3ȸ ½ÄÈÄ¿¡ °æ±¸Åõ¿©ÇϵÇ, ¹Ýµå½Ã ½ÄÀÌ¿ä¹ýÀ» º´ÇàÇÑ´Ù. À§ÀåÀÌ ¾àÇÑ È¯ÀÚ´Â 1ÀÏ 200§·¿¡¼ ½ÃÀÛÇÏ¿© 3-4ÀÏ ÈÄ¿¡´Â 1ÀÏ 400§·À» Åõ¿©Çϰí ÇÊ¿äÇϸé 3-4ÀÏ ÈÄ¿¡ ´Ù½Ã 1ÀÏ 600§·À¸·Î Áõ·®ÇÏ¿© Åõ¿©ÇÑ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
1) ÁßÁõÀÇ °£±â´ÉÀå¾Ö ȯÀÚ, ´ã³¶Áúȯ ȯÀÚ
2) ÁßÁõÀÇ ½Å±â´ÉÀå¾Ö ȯÀÚ(Ç÷û Å©·¹¾ÆÆ¼´ÑÄ¡ 2.5§·/§£ ÀÌ»ó)
3) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ, ¼öÀ¯ºÎ
4) ÀΰøÅõ¼® ȯÀÚ(º¹¸·Åõ¼® ȯÀÚ Æ÷ÇÔ)
5) ÀÌ ¾à¿¡ °ú¹ÎÁõ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) ½Å±â´ÉÀå¾Ö ȯÀÚ(Ç÷û Å©·¹¾ÆÆ¼´ÑÄ¡ 1.5§·/§£ ÀÌ»ó)
2) °£±â´ÉÀå¾Ö ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
3) ¼³Æ÷´Ò¿ä¼Ò°è Ç÷´ç°ÇÏÁ¦¸¦ Åõ¿©¹Þ°í Àִ ȯÀÚ
4) Àú¾ËºÎ¹ÎÇ÷Áõ(½ÅÁõÈıº) ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) °£Àå : ¶§¶§·Î ALT, AST, LDHÀÇ »ó½Â, ´ã¼®ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ALT°¡ 100mU ÀÌ»ó »ó½ÂÇϸé Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
2) ¼Òȱâ°è : ¶§¶§·Î º¹Åë, µå¹°°Ô ½Ä¿åºÎÁø, ±¸¿ª, ±¸Åä, º¹ºÎÆØ¸¸°¨, ¼³»ç, ±¸³»¿°, º¯ºñ°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) ÇǺΠ: ¶§¶§·Î °¡·Á¿ò, µÎµå·¯±â, ¹ßÁø µîÀÇ ¾Ë·¹¸£±â¼º ÇǺιÝÀÀ, µå¹°°Ô Å»¸ð°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) ½Å°æ°è : µÎÅë, ¾îÁö·¯¿ò, ¹«·Â°¨ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) °ñ°Ý±Ù : CPK»ó½Â, ±ÙÀ°Åë, ±Ù°æ·Ã, °ú·®Åõ¿©½Ã µå¹°°Ô Ⱦ¹®±ÙÀ¶ÇØÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ƯÈ÷ ½Å±â´ÉÀå¾Ö ȯÀÚ´Â ±ÙÀ°Åë, ¹«·Â°¨, CPK»ó½Â, Ç÷Áß ¹× ¿äÁß ¹Ì¿À±Û·Îºó»ó½ÂÀ» Ư¡À¸·Î Çϴ Ⱦ¹®±ÙÀ¶ÇØÁõ ¹× ÀÌ¿¡ ¼ö¹ÝµÇ´Â ±Þ°ÝÇÑ ½Å±â´É¾ÇȰ¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
6) Ç÷¾× : ºóÇ÷, Ç츶ÅäÅ©¸®Æ®°¨¼Ò, ¹éÇ÷±¸°¨¼Ò, ¸Å¿ì µå¹°°Ô È£»ê±¸Áõ´ÙÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) °ú¹ÎÁõ : ±¤°ú¹Î¼º ½ÀÁø µîÀÇ ±¤µ¶¼º, ±¤°ú¹Î¼º ¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
8) ½ÅÀå : ¶§¶§·Î BUN¡¤Å©·¹¾ÆÆ¼´Ñ»ó½ÂÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
9) ±âŸ : ¶§¶§·Î ¿ä»ê»ó½Â, µå¹°°Ô ÀúÇ÷´ç, Àü½Å±ÇۨÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) HMG-CoA ȯ¿øÈ¿¼ÒÀúÇØÁ¦(·Î¹Ù½ºÅ¸Æ¾ µî)¿Í º´¿ëÅõ¿©½Ã Ⱦ¹®±ÙÀ¶ÇØÁõÀÇ °¡´É¼ºÀÌ Áõ°¡ÇÒ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÏ°í °¡´ÉÇÏ¸é º´¿ëÅõ¿©¸¦ ÇÇÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
2) Ç×ÀÀ°íÁ¦ÀÇ ÀÛ¿ëÀ» Áõ°½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÇÁ·ÎÆ®·Òºó½Ã°£¿¡ µû¶ó Ç×ÀÀ°íÁ¦ÀÇ ¿ë·®À» Á¶ÀýÇÏ´Â µî ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
3) °æ±¸¿ë Ç÷´ç°ÇÏÁ¦ ¹× Àν¶¸°ÀÇ ÀÛ¿ëÀ» Áõ°½Ãų ¼ö ÀÖÀ¸¹Ç·Î ¿ë·®À» Á¶ÀýÇÑ´Ù.
4) °æ±¸¿ë ÇÇÀÓ¾à(¿¡½ºÆ®·Î°ÕÁ¦Á¦)Àº Ç÷Áß ÁöÁú³óµµ¸¦ Áõ°¡½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÀÌ ¾à°ú º´¿ëÅõ¿©ÇÏ´Â °æ¿ì¿¡´Â ÀÇ»ç¿Í »óÀÇÇÑ´Ù.
5) ¸»·¹Àλê¼ö¼ÒÆÛÇí½Ç¸°, MAOÀúÇØÁ¦ µî °£µ¶¼ºÀÇ À§ÇèÀÌ ÀÖ´Â ¾à¹°°ú º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
6) À̿±³È¯¼öÁö(ÄÝ·¹½ºÆ¼¶ó¹Î µî)¿Í º´¿ëÅõ¿©ÇÏ´Â °æ¿ì¿¡´Â ÀÌ ¾àÀÇ ¼ÒȰüÈí¼ö°¡ Áö¿¬µÉ ¼ö ÀÖÀ¸¹Ç·Î 2½Ã°£ ÀÌ»óÀÇ °£°ÝÀ» µÎ°í Åõ¿©ÇÑ´Ù.
7) ¸é¿ª¾ïÁ¦¿ä¹ýÁßÀÎ Àå±âÀÌ½Ä È¯ÀÚ¿¡¼ ÀÌ ¾àÀÇ º´¿ëÅõ¿©½Ã µå¹°°Ô Ç÷û Å©·¹¾ÆÆ¼´ÑÄ¡ »ó½ÂÀ» ¼ö¹ÝÇÏ´Â °¡¿ªÀûÀÎ ½Å±â´É¼Õ»óÀÌ º¸°íµÇ¾î ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â ½Å±â´ÉÀ» ¸é¹ÐÈ÷ °üÂûÇÏ°í ½ÇÇè½Ç °Ë»ç °á°ú ÀÌ»óÀÌ È®ÀεǸé Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Bezafibrate¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Like the other fibrates, bezafibrate is an agonist of PPAR¥á; some studies suggest it may have some activity on PPAR¥ã and PPAR¥ä as well.
|
| Pharmacology |
Bezafibrate¿¡ ´ëÇÑ Pharmacology Á¤º¸ Bezafibrate is an antilipemic agent that lowers cholesterol and triglycerides. It decreases low density lipoproteins and increases high density lipoproteins. Bezafibrate lowers elevated blood lipids (triglycerides and cholesterol). Elevated VLDL and LDL are reduced by treatment with bezafibrate, whilst HDL-levels are increased. The activity of triglyceride lipases (lipoprotein lipase and hepatic lipoproteinlipase) involved in the catabolism of triglyceride-rich lipoproteins is increased by bezafibrate. In the course of the intensified degradation of triglyceride-rich lipoproteins (chylomicrons, VLDL) precursors for the formation of HDL are formed which explains an increase in HDL. Furthermore, cholesterol biosynthesis is reduced by bezafibrate, which is accompanied by a stimulation of the LDL-receptor-mediated lipoprotein catabolism. Elevated fibrinogen appears to be an important risk-factor, alongside the lipids, smoking and hypertension, in the development of atheroma. Fibrinogen plays an important role in viscosity, and therefore blood flow, and also appears to play an important role in thrombus development and lysability. Bezafibrate exerts an effect on thrombogenic factors. A significant decrease in elevated plasma fibrinogen levels can be achieved. This may lead, amongst other things, to a reduction in both blood and plasma viscosity. Inhibition of platelet aggregation has also been observed. A reduction in blood glucose concentration due to an increase in glucose tolerance has been reported in diabetic patients. In the same patients, the concentration of fasting and postprandial free fatty acids was reduced by bezafibrate.
|
| Metabolism |
Bezafibrate¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Liver carboxylesterase
|
| Protein Binding |
Bezafibrate¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 94-96% of bezafibrate is bound to protein in human serum.
|
| Half-life |
Bezafibrate¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 1-2 hours
|
| Absorption |
Bezafibrate¿¡ ´ëÇÑ Absorption Á¤º¸ Bezafibrate is almost completely absorbed after oral administration. The relative bioavailability of bezafibrate retard compared to the standard form is about 70%.
|
| Biotransformation |
Bezafibrate¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic.
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Bezafibrate¿¡ ´ëÇÑ Description Á¤º¸ Antilipemic agent that lowers cholesterol and triglycerides. It decreases low density lipoproteins and increases high density lipoproteins. [PubChem]
|
| Drug Category |
Bezafibrate¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antilipemic Agents
|
| Smiles String Canonical |
Bezafibrate¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C)(OC1=CC=C(CCNC(=O)C2=CC=C(Cl)C=C2)C=C1)C(O)=O
|
| Smiles String Isomeric |
Bezafibrate¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(C)(OC1=CC=C(CCNC(=O)C2=CC=C(Cl)C=C2)C=C1)C(O)=O
|
| InChI Identifier |
Bezafibrate¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H20ClNO4/c1-19(2,18(23)24)25-16-9-3-13(4-10-16)11-12-21-17(22)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,22)(H,23,24)/f/h21,23H
|
| Chemical IUPAC Name |
Bezafibrate¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-07-24
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|