| |
|
|
|
|
|
 |
| |
|
µðºñ°Ö0.1%°Ö(¿¡½ºÆ®¶óµð¿Ã)
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
642000140[E00030221]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1g/Æ÷(2016.10.01)(ÇöÀç¾à°¡)
\174 ¿ø/1g/Æ÷(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö³»Áö À¯¹é»öÀÇ ºÎµå·¯¿î °Ö»óÀÇ ¸®´Ï¸àÆ®Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
Á¦Á¶¿ø |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 1±×·¥ |
28 Æ÷ |
Æ÷ |
8806420001403 |
8806420001427 |
|
| 1±×·¥ |
1 Æ÷ |
Æ÷ |
8806420001403 |
8806420001410 |
|
|
| ÁÖ¼ººÐÄÚµå |
154902CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ÀÚ¿¬Àû ¶Ç´Â ¿Ü°úÀû ¼ö¼ú·Î ÀÎÇÑ Æó°æ¿¡ µû¸£´Â ¿¡½ºÆ®·Î°Õ °áÇÌÁõ»ó : ¾È¸éÈ«Á¶, ¼ö¸éÀå¾Ö, Á¤¼Àå¾Ö, ºñ´¢»ý½Ä±â À§Ãà, °ñÁ¶Á÷ÀÇ ¼Õ½Ç
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1. ¿ë·®
¿¡½ºÆ®¶óµð¿Ã·Î¼ 1ÀÏ 0.5 ¢¦ 1.5 mg(°Ö¿ë·®À¸·Î 0.5 ¢¦1.5 g)À» ÁÖ±âÀûÀ¸·Î ȤÀº ¿¬¼ÓÀûÀ¸·Î »ç¿ëÇÑ´Ù. ´ëºÎºÐÀÇ °æ¿ì Àû´çÇÑ Ãʱâ¿ë·®Àº ¿¡½ºÆ®¶óµð¿Ã·Î¼ 1.0 mgÀÌ´Ù(1 g Æ÷ÀåÀ¸·Î 1Æ÷ ȤÀº 0.5 g Æ÷ÀåÀ¸·Î 2Æ÷).
ÁÖÆó°æ(Perimenopause)ÀÇ È¯ÀÚ´Â 1°³¿ù¾¿ÀÇ ÁֱⰡ ÃßõµÇ¸ç, ¿ÏÀüÆó°æÀÇ È¯ÀÚ´Â ÇÑÁֱⰡ 3°³¿ù±îÁö´Â ¿¬ÀåµÉ ¼ö ÀÖ´Ù.
ÀÚ±ÃÀûÃâ¼úÀ» ¹ÞÁö ¾ÊÀº ȯÀÚ´Â ÀÌ ¾à¿¡ ÁÖ±âÀûÀÎ ÇÁ·Î°Ô½ºÆ¾ ¿ä¹ý Áï, ÁÖ±âÀÇ ¸¶Áö¸· 10 ¢¦ 14ÀÏ¿¡ ³ë¸£¿¡Æ¼½ºÅ׷оƼ¼Å×ÀÌÆ® 1 ¢¦ 2 mg, µðµå·Î°Ô½ºÅ×·Ð 10 mg, ¸Þµå·Ï½ÃÇÁ·Î°Ô½ºÅ׷оƼ¼Å×ÀÌÆ® 10 mg, ³ë¸£¿¡Æ¼½ºÅ׷оƼ¼Å×ÀÌÆ® 2.5 mg, ¹ÌºÐÈÇÁ·Î°Ô½ºÅ×·Ð 200 ¢¦ 300 mgÀ» º´¿ëÅõ¿©ÇÑ´Ù.
2. ¿ë¹ý
´ÜȸÆ÷ÀåÀÇ 0.5 g 1Æ÷ ³»Áö 2Æ÷ ȤÀº 1 g 1Æ÷¿Í 0.5 g 1Æ÷¸¦ ¸öÅë ¾Æ·¡³ª ³ÐÀû´Ù¸®¿¡ ºÎµå·´°Ô ¹®Áú·¯ÁØ´Ù.
À¯¹æÀ̳ª ÀÚ±ØµÈ ÇǺο¡´Â ¹Ù¸£Áö ¾Ê´Â´Ù. ÀÌ ¾àÀ» Á¡¸·À§¿¡ Àû¿ëÇØ¼´Â ¾ÈµÈ´Ù.
|
| ±Ý±â |
1) À¯¹æ¾ÏÀÌ ¹ß°ßµÇ¾ú°Å³ª ÀǽÉÀÌ µÇ´Â ȯÀÚ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ
2) Àڱ󻸷Áõ½ÄÁõ ȯÀÚ
3) ÃÊ±â Æ¯¹ß¼º ¶Ç´Â ±âÁ¸ÀÇ Á¤¸Æ¼º Ç÷Àü»öÀüÁõ(ÁßÁõÀÇ Á¤¸Æ¼º Ç÷ÀüÁõ ¶Ç´Â Æó»öÀüÁõ)
4) ±Þ¼º µ¿¸ÆÇ÷Àü»öÀüÁõ(¿¹, Çù½ÉÁõ, ½É±Ù°æ»ö)
5) °£±â´É °Ë»ç°á°ú Á¤»ó¼öÄ¡°¡ ¾Æ´Ñ ±Þ¼º °£Áúȯ ¶Ç´Â °£Áúȯ º´·Â ȯÀÚ, ½ÉÇÑ °£Áúȯ ȯÀÚ
6) ½É¹ÚÁúȯ, ÆÇ¸·Áúȯ µîÀÇ Á¤¸Æ¤ýµ¿¸Æ¤ý½ÉÀå¿¡ ÁúȯÀ» °¡Áø ȯÀÚ
7) ³úÇ÷°ü ¼Õ»ó, Æ®·Òº¸Ç÷ÀüÁúȯ, Ç÷°ü¼º ¾È±¸ÁúȯÀ» °¡Áø ȯÀÚ
8) À¯ÁóºÐºñ°ú´Ù, ÇÁ·Ñ¶ôƾ ºÐºñ»ó½Â, À¯¹æÀ̳ª ÀÚ±Ã, ³úÇϼöü¿¡ Á¾¾çÀ» °¡Áø ȯÀÚ
9) Áø´ÜµÇÁö ¾ÊÀº ºñÁ¤»óÀûÀÎ »ý½Ä±â ÃâÇ÷ ȯÀÚ
10) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º
11) ÀÌ ¾à ¹× ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀÀÌ Àִ ȯÀÚ
12) ¿¡½ºÆ®·Î°Õ ÀÇÁ¸¼º ¾Ç¼º Á¾¾ç ¶Ç´Â µ¿ Áúȯ ÀǽÉ(ƯÈ÷ Àڱ󻸷¾ÏÁ¾) ȯÀÚ
13) ¾Ë·ÁÁø Ç÷Àü¼ºÇâÁõÀ» °¡Áø ȯÀÚ(¿¹, C´Ü¹é, S´Ü¹é ¶Ç´Â Çׯ®·Òºó°áÇÌÁõ)
14) Æ÷¸£ÇǸ°Áõ ȯÀÚ
15) ½ÅºÎÀü ȯÀÚ
16) ÇöÁ¸ ¶Ç´Â ÃÖ±Ù¿¡ ¹ßº´Çß´ø µ¿¸Æ Ç÷Àü»öÀüÁõ(ƯÈ÷ Çù½ÉÁõ, ½É±Ù°æ»ö)À» °¡Áø ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) ¾Æ·¡ÀÇ Ç׸ñ¿¡ Çϳª¶óµµ ÇØ´çÇϰųª, °ú°Å¿¡ ÇØ´çÇÏ¿´°í/¶Ç´Â ÀӽŠ±â°£Áß ¾ÇȵǾú°Å³ª °ú°Å È£¸£¸ó Ä¡·á°æÇèÀÌ ÀÖ¾ú´ø ȯÀÚ´Â ¸é¹ÐÈ÷ °ü¸®ÇÑ´Ù.
(1) ÆòȰ±ÙÁ¾À̳ª ¼¶À¯Á¾ ȯÀÚ, Àڱ󻸷Áõ ȯÀÚ
(2) Ç÷Àü»öÀüÁõ À§ÇèÀÎÀÚ º¸À¯ÀÚ
(3) ¿¡½ºÆ®·Î°Õ-ÀÇÁ¸¼º Á¾¾ç À§ÇèÀÎÀÚ º¸À¯ÀÚ(¿¹, ºÎ¸ð°¡ À¯¹æ¾Ï)
(4) °íÇ÷¾Ð ȯÀÚ
(5) °£Áúȯ(¿¹, °£¼±Á¾)
(6) Ç÷°ü°ú °ü·ÃµÇ°Å³ª °ü·ÃµÇÁö ¾ÊÀº ´ç´¢º´
(7) ´Ù¹ß¼º°æÈÁõ ȯÀÚ
(8) ´ã¼®Áõ ȯÀÚ
(9) ÆíµÎÅë ¶Ç´Â ÁßÁõÀÇ µÎÅë
(10) Àü½ÅÈ«¹Ý·çǪ½º(SLE) ȯÀÚ
(11) °£Áú ȯÀÚ
(12) õ½Ä ȯÀÚ
(13) ÀÌ(ì¼)°æÈÁõ ȯÀÚ
(14) À¯ÀüÀû Ç÷°üºÎÁ¾
2) ±äÀåÇ×ÁøÁõ ȯÀÚ
3) ½ÉÀå ¶Ç´Â ½Å±â´É ȯÀÚ
4) Ä¡·á¸¦ ½ÃÀÛÇϱâ Àü À§Ç輺ÀÌ Àִ ȯÀÚ¿¡°Ô À¯¹æÁ¶¿µ¼ºÀ» ½Ç½ÃÇÏ°í ±ÔÄ¢ÀûÀ¸·Î À̸¦ ¹Ýº¹Çϵµ·Ï ÇØ¾ß ÇÑ´Ù.
5) °£ ±â´ÉÀÇ ¾ÇÈ, Ȳ´Þ, ÆíµÎÅ뼺 µÎÅëÀÌ »õ·Î ¹ß»ýµÇ°Å³ª À¯ÀÇÀûÀÎ Ç÷¾ÐÀÇ »ó½Â, ÀÓ½ÅÀÎ °æ¿ì(ÀÌ ¾àÀÇ º¹¿ëÀ» ÁßÁöÇϰí Áï½Ã Àǻ翡°Ô ¾Ë·Á¾ß ÇÑ´Ù)
6) ºñÁ¤»óÀûÀ̰ųª ºÒ±ÔÄ¢ÀûÀÎ ÃâÇ÷ÀÌ ¹ß»ýÇÏ´Â °æ¿ì(Àڱ󻸷ÀÇ ºÎÀΰú °Ë»ç¸¦ ÇØ¾ß ÇÑ´Ù)
7) ¼ö¼úÀ» ¹ÞÀº °æ¿ì(¼ö¼ú ÈÄ ±â°£ µ¿¾ÈÀÇ Á¤¸ÆÇ÷Àü»öÀüÁõ ¹ß»ýÀ» ¿¹¹æÇϱâ À§ÇÑ ´ëÃ¥ÀÌ ÇÊ¿äÇÏ´Ù. ¸¸¾à ¿¹Á¤µÈ ¼ö¼ú(elective surgery)·Î ÀÎÇØ Àå±âÀûÀ¸·Î ¿òÁ÷ÀÏ ¼ö ¾ø´Â »óÅÂ(prolonged immobilization)°¡ ¿¹»óµÈ´Ù¸é, ÀÇ»ç´Â 4 ¢¦ 6ÁÖÀü¿¡ È£¸£¸ó´ëü¿ä¹ýÀ» ÀϽÃÀûÀ¸·Î ÁßÁöÇÒ °ÍÀ» °í·ÁÇÏ¿©¾ß ÇÑ´Ù. Ä¡·á´Â ¼ö¼ú¿¡¼ ¿ÏÀüÈ÷ ȸº¹µÈ ÈÄ È°µ¿ÀÌ °¡´ÉÇÏ¸é ´Ù½Ã ½ÃÀÛÇØ¾ß ÇÑ´Ù)
8) Á¤¸ÆÇ÷Àü»öÀüÁõ¿¡ ´ëÇÑ °ú°Å·ÂÀÌ ¾ø´Â ȯÀÚÀÌ´õ¶óµµ, ÀþÀº ³ªÀÌ¿¡ Ç÷ÀüÁõÀÇ °ú°Å·ÂÀÌ ÀÖ´Â 1ÃÌ Ç÷Á·ÀÌ ÀÖ´Â °æ¿ì
9) ¸¸¼º Ç×Ç÷ÀüÁ¦ Ä¡·á¸¦ ÇÏ´Â ¿©¼º(È£¸£¸ó´ëü¿ä¹ýÀÇ À¯Àͼº°ú À§Ç輺À» ÁÖÀÇ ±í°Ô °í·ÁÇÏ¿©¾ß ÇÑ´Ù)
|
| ÀÌ»ó¹ÝÀÀ |
1) ½ÃÆÇ Àü ÀÓ»ó½ÃÇè¿¡¼ ´ÙÀ½°ú °°Àº ÀÌ»ó¹ÝÀÀÀÌ °üÂûµÇ¾ú´Ù. ¸ðµÎ ¹ß»ýºóµµ°¡ 10 % ¹Ì¸¸¿¡ ¸Ó¹°·¶´Ù. ´ÙÀ½ÀÇ ÀÌ»ó¹ÝÀÀµéÀº ¿¡½ºÆ®·Î°Õ ´ëüġ·á½Ã¿¡ °üÂûµÇ¾ú´Ù.
(1) Á¤½Å½Å°æ°è : °ú¿ë·®½Ã °£ÁúÀÇ ¾ÇȰ¡ ÀϾ ¼ö ÀÖ´Ù.
(2) °¨°¢±â°è : ÄÜÅØÆ®·»Áî¿¡ ÀÇÇÑ ¾È±¸ÀÚ±ØÀÌ ÀϾ ¼ö ÀÖ´Ù.
(3) ¼Òȱâ°è : °¡½º°¡ Â÷´Â Çö»óÀÌ ÀÚÁÖ ³ªÅ¸³ª°í, °æ¿ì¿¡ µû¶ó¼´Â ±¸Åäµµ ¹ß»ýÇÒ ¼ö ÀÖ´Ù.
(4) ½ÉÇ÷°ü°è : Ç÷¾ÐÀÌ »ó½ÂÇϰųª ½ÉÇ÷°ü Áúȯ, Ç÷Àü, ½É°èÇ×Áø, Ç÷ÀüÁ¤¸Æ¿° ¹× Æó»öÀüÁõÀÌ ÀϾ ¼ö ÀÖ´Ù.
(5) »ý½Ä±â°è ¹× À¯¹æ : ÀÚ±ÃÃâÇ÷ ¹× À¯¹æÅëÀÌ ÀÚÁÖ ³ªÅ¸³µ´Ù. °æ¿ì¿¡ µû¶ó¼´Â ¾ç¼ºÀ¯¹æÁ¾¾ç ¹× À¯¹æ¾ÏÀÌ ³ªÅ¸³µ´Ù. À¯¹æÀÇ º¯Çü, ÀÚ±ÃÀÇ ÀÌ»óÁ¾¾ç, ¼±Á¾¾ç, À¯ÁóºÐºñ°ú´Ù µîÀÌ ÀϾ ¼ö ÀÖ´Ù. µå¹°°Ô ¿ÜÀ½ºÎÀÇ °¡·Á¿ò, ÈçÇÏÁö ¾Ê°Ô ¼ÒÅ𼺠ÃâÇ÷, ´ëÇÏ, ¿ÜÀ½ºÎÁ¾Ã¢°¨, ºñÁ¤±âÀû ÃâÇ÷(º¸Åë ¿¡½ºÆ®·Î°Õ °ú¿ë·®ÀÇ ÁõÈÄÀÓ) µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
(6) ÀÚÀ²½Å°æ°è : Áö¼ÓÀûÀÎ ¿°¨, ÀÏ»óÀû µÎÅë, ÆíµÎÅë, Áֱ⳻ ÃâÇ÷, Áú°ÇÁ¶ µîÀÇ °ú¼Ò¿¡½ºÆ®·Î°ÕÀÇ Â¡Èijª ±¸¿ª, À¯¹æ±äÀå, ÈïºÐ, ´Ù¸®°¡ ¹«°Å¿ò, ¹é´ëÇÏ µîÀÇ °ú´Ù¿¡½ºÆ®·Î°ÕÀÇ Â¡Èİ¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
(7) °£Àå : ÈçÇÏÁö ¾Ê°Ô Ç÷Áß ºô¸®·çºó ÃàÀû¿¡ ÀÇÇÑ ´ãÁó ¿ïü¼º Ȳ´ÞÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, °£±â´É Àå¾Ö(AST, ALT Ä¡ÀÇ »ó½Â µî), °£¼±Á¾(º¹°³» ÃâÇ÷¹ß»ýÀ» À¯¹ßÇÒ ¼ö ÀÖÀ½)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
(8) ±Ù°ñ°Ý°è : °æ¿ì¿¡ µû¶ó¼ °üÀýÅëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
(9) ÇǺΠ¹× ºÎ¼Ó±â°è : °æ¿ì¿¡ µû¶ó °¡·Á¿òÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
(10) ±âŸ : °æ¿ì¿¡ µû¶ó ÇǰïÇÔ, ºÎÁ¾, üÁߺ¯È°¡ ¹ß»ýÇÒ ¼ö ÀÖ´Ù.
2) ¿¡½ºÆ®·Î°Õ/ÇÁ·Î°Ô½ºÅ×·ÐÀ» ÀÌ¿ëÇÑ Ä¡·á¿¡¼ ³ªÅ¸³ª´Â ÀÌ»ó¹ÝÀÀÀº ´ÙÀ½°ú °°´Ù.
(1) ¿¡½ºÆ®·Î°Õ°ú °ü·ÃÀÌ ÀÖ´Â ¾ç¼º ½Å»ý¹° ¹× ¾Ç¼ºÁ¾¾ç(¿¹, Àڱ󻸷¾Ï)
(2) Ç÷Àü»öÀüÁõ, ´Ù¸®½Å°æ ³»Áö °ñ¹Ý½Å°æÀÇ Ç÷Àü ¹× Æó»öÀüÁõ(VTE)
(3) Ç÷°üºÎÁ¾À» Æ÷ÇÔÇÑ ¾Æ³«Çʶô½Ã½º/¾Æ³«Çʶô½Ã½º¸ð¾ç ¹ÝÀÀ
(4) ´ÙÀ½ Áõ»óµéÀº È£¸£¸ó´ëü¿ä¹ýÀ¸·Î Ä¡·á¸¦ ¹Þ´Â ¿©¼º ȯÀڵ鿡°Ô¼ ÀÌ·± Ä¡·á¸¦ ¹ÞÁö ¾Ê´Â ȯÀڵ麸´Ù ´õ ÀÚÁÖ ³ªÅ¸³´Ù. : ½É±Ù°æ»ö ¶Ç´Â ³úÁ¹Áß, ´ã³¶Áúȯ, ÇǺΠ¶Ç´Â ÇÇÇÏÁ¶Á÷ Áúȯ, ±â¹Ì, ´ÙÇü È«¹Ý, °áÀý¼º È«¹Ý, Ç÷°ü Àڹݺ´
3) ±¹³»¿¡¼ 6³â µ¿¾È 617¸íÀ» ´ë»óÀ¸·Î ½Ç½ÃÇÑ ½ÃÆÇÈÄ Á¶»ç°á°ú ÀÌ»ó¹ÝÀÀÀÇ ¹ßÇöºóµµÀ²Àº Àΰú°ü°è¿Í »ó°ü¾øÀÌ 11.5 %(75°Ç/617¸í)·Î º¸°íµÇ¾ú´Ù. À¯¹æÅëÀÌ 2.43 %(15°Ç), ÁúÃâÇ÷ 2.27 %(14°Ç)À¸·Î °¡Àå ¸¹¾Ò°í ±× ´ÙÀ½À¸·Î µÎÅë 1.62 %(10°Ç), ÇǺÎÀÚ±Ø 0.97 %(6°Ç/617¸í), °¡·Á¿òÁõ 0.81 %(5°Ç/617¸í)ÀÇ ¼øÀ¸·Î ³ªÅ¸³µ´Ù. ÀÌÁß ¾Ë·ÁÁöÁö ¾ÊÀº »õ·Î¿î ÀÌ»ó¹ÝÀÀÀ¸·Î µÎµå·¯±â°¡ 3°Ç, ¾îÁö·¯¿òÀÌ 2°Ç, ÇǺιÝÁ¡, ¼ÒȺҷ®, °¡½¿ÅëÁõ, Å»¸ð°¡ °¢°¢ 1°Ç¾¿ º¸°íµÇ¾ú´Ù.
|
| »óÈ£ÀÛ¿ë |
´Ù¸¥ ¾à¹°°úÀÇ »óÈ£ÀÛ¿ëÀ» ÇÇÇϱâ À§ÇØ Àǻ糪 ¾à»ç¿¡°Ô ´Ù¸¥ ¾à¹°Ä¡·á¸¦ ¾Ë·Á¾ß ÇÑ´Ù. ƯÈ÷, ¹Ù¸£ºñÅ», È÷´ÜÅäÀÎ, Ä«¸£¹Ù¸¶Á¦ÇÉ, ¸ÞÇÁ·Î¹Ù¸ÞÀÌÆ®, Æä´ÒºÎŸÁ¸ ¶Ç´Â ¸®ÆÊÇǽÅÀº ¿¡½ºÆ®·Î°ÕÀÇ ÀÛ¿ëÀ» ¾ÇȽÃų ¼ö ÀÖ´Ù.
1) CYP-P450°è µî °£È¿¼ÒÀÇ À¯µµÀÛ¿ëÀ» ÇÏ´Â °æ·Ã¹æÁöÁ¦(Æä³ë¹ÙºñÅ», Æä´ÏÅäÀÎ, È÷´ÜÅäÀÎ, Ä«¸£¹Ù¸¶Á¦ÇÉ µî), Ç×°¨¿°Á¦(¸®ÆÊÇǽÅ, ¸®ÆÄºÎƾ, ³×ºñ¶óÇÉ, ¾ÆÆäºñ·»Áî µî)´Â ¿¡½ºÆ®·Î°ÕÀÇ ½ÅÁø´ë»ç¸¦ Áõ°¡½ÃÄÑ ¿¡½ºÆ®·Î°ÕÀÇ ÀÛ¿ëÀ» ¾àȽÃų ¼ö ÀÖ´Ù. ±×·¯³ª °æÇÇ Àû¿ëÇÑ ¿¡½ºÆ®¶óµð¿Ã¿¡ ¹ÌÄ¡´Â ¿µÇâÀÌ ¾î´À Á¤µµÀÎÁö´Â ¹àÇôÁ® ÀÖÁö ¾Ê´Ù.
2) ¸®Å䳪ºñ¸£ ¹× ³ÚÇdzªºñ¸£ : ½ºÅ×·ÎÀ̵å È£¸£¸ó°ú °áÇÕÇÏ¿© ÀÌ ¾àÀÇ È¿´ÉÀ» °¨¼Ò½Ãų ¼ö ÀÖ´Ù.
3) ¿¡½ºÆ®·Î°ÕÀÇ ½ÅÁø´ë»ç Áõ°¡´Â È£¸£¸óÀÇ ±â´ÉÀúÇÏ·Î À̾îÁú ¼ö ÀÖÀ¸¸ç, ÀÚ±ÃÃâÇ÷¿¡ ¿µÇâÀ» ÁÙ ¼ö ÀÖ´Ù.
4) ³Æ÷È£¸£¸ó(ÁÖ·Î °áÇÕÇü ¿¡½ºÆ®·Î°Õ, ÇÕ¼º ¿¡½ºÆ®·Î°Õ)Àº ³»´ç·ÂÀÇ º¯È¸¦ ÀÏÀ¸ÄÑ Ç÷´ç»ó½ÂÀÛ¿ëÀ» ³ªÅ¸³»¹Ç·Î Ç÷´ç°ÇÏÁ¦¿Í º´¿ëÅõ¿©½Ã Ç÷´ç°ÇÏÀÛ¿ëÀÌ °¨¼ÒµÉ ¼ö ÀÖ´Ù. ±×·¯¹Ç·Î ´ç´¢º´ ȯÀÚ¿¡ ÀÌ ¾à Åõ¿©½Ã Ç÷´ç°ÇÏÁ¦ÀÇ ¿ë·®À» Á¶ÀýÇÏ´Â µî ÁÖÀÇÇÑ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: ESTRADIOL HEMIHYDRATEESTRASORB (ESTRADIOL HEMIHYDRATE)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
(estradiol valerate 1mg )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Estradiol¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Estradiol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Estradiol enters target cells freely (e.g., female organs, breasts, hypothalamus, pituitary) and interacts with a target cell receptor. When the estrogen receptor has bound its ligand it can enter the nucleus of the target cell, and regulate gene transcription which leads to formation of messenger RNA. The mRNA interacts with ribosomes to produce specific proteins that express the effect of estradiol upon the target cell. Estrogens increase the hepatic synthesis of sex hormone binding globulin (SHBG), thyroid-binding globulin (TBG), and other serum proteins and suppress follicle-stimulating hormone (FSH) from the anterior pituitary.
|
| Pharmacology |
Estradiol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Estradiol, the principal intracellular human estrogen, is substantially more active than its metabolites, estrone and estriol, at the cellular level.
|
| Metabolism |
Estradiol¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 1A2 (CYP1A2)Cytochrome P450 2A6 (CYP2A6)Glucuronosyltransferase
|
| Protein Binding |
Estradiol¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ >95%
|
| Half-life |
Estradiol¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 36 hours
|
| Absorption |
Estradiol¿¡ ´ëÇÑ Absorption Á¤º¸ 43%
|
| Pharmacokinetics |
Estradiol hemihydrateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À§Àå°ü¿¡¼ ½Å¼ÓÈ÷ Èí¼ö
Àå°£¼øÈ¯(enterohepatic recirculation)
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯ÁóºÐºñ
- ´Ü¹é°áÇÕ : 80 %
- ¹Ý°¨±â : 50-60 ºÐ
- ´ë»ç : °£¿¡¼ ºñȰ¼º ¹°Áú·Î ´ë»ç
- ¼Ò½Ç : ¼Òº¯°ú ´ãÁóÀ¸·Î ¹è¼³
|
| Biotransformation |
Estradiol¿¡ ´ëÇÑ Biotransformation Á¤º¸ Exogenous estrogens are metabolized using the same mechanism as endogenous estrogens. Estrogens are partially metabolized by cytochrome P450.
|
| Toxicity |
Estradiol¿¡ ´ëÇÑ Toxicity Á¤º¸ Can cause nausea and vomiting, and withdrawal bleeding may occur in females.
|
| Drug Interactions |
Estradiol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital The enzyme inducer decreases the effect of hormonesAprobarbital The enzyme inducer decreases the effect of hormonesButabarbital The enzyme inducer decreases the effect of hormonesButalbital The enzyme inducer decreases the effect of hormonesButethal The enzyme inducer decreases the effect of hormonesEthotoin The enzyme inducer decreases the effect of hormonesFosphenytoin The enzyme inducer decreases the effect of hormonesGriseofulvin The enzyme inducer decreases the effect of hormonesHeptabarbital The enzyme inducer decreases the effect of hormonesHexobarbital The enzyme inducer decreases the effect of hormonesMephenytoin The enzyme inducer decreases the effect of hormonesMethohexital The enzyme inducer decreases the effect of hormonesMethylphenobarbital The enzyme inducer decreases the effect of hormonesPentobarbital The enzyme inducer decreases the effect of hormonesPhenobarbital The enzyme inducer decreases the effect of hormonesPhenytoin The enzyme inducer decreases the effect of hormonesPrednisolone The estrogenic agent increases the effect of corticosteroidPrednisone The estrogenic agent increases the effect of corticosteroidPrimidone The enzyme inducer decreases the effect of hormonesSecobarbital The enzyme inducer decreases the effect of hormonesTalbutal The enzyme inducer decreases the effect of hormonesRaloxifene Association not recommendedUrsodeoxycholic acid Estrogens decreases the effect of ursodiol
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Estradiol¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food to decrease nausea.
|
| Drug Target |
[Drug Target]
|
| Description |
Estradiol¿¡ ´ëÇÑ Description Á¤º¸ Generally refers to the 17-beta-isomer of estradiol, an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans, it is produced primarily by the cyclic ovaries and the placenta. It is also produced by the adipose tissue of men and postmenopausal women. The 17-alpha-isomer of estradiol binds weakly to estrogen receptors (receptors, estrogen) and exhibits little estrogenic activity in estrogen-responsive tissues. Various isomers can be synthesized. [PubChem]
|
| Drug Category |
Estradiol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-menopausal AgentsAnticholesteremic AgentsEstrogens
|
| Smiles String Canonical |
Estradiol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CCC2O
|
| Smiles String Isomeric |
Estradiol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CC[C@H]3[C@@H](CCC4=C3C=CC(O)=C4)[C@@H]1CC[C@@H]2O
|
| InChI Identifier |
Estradiol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1
|
| Chemical IUPAC Name |
Estradiol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
|
| Drug-Induced Toxicity Related Proteins |
ESTRADIOL ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Myc proto-oncogene protein Drug:estradiol Toxicity:cytotoxic responses . [¹Ù·Î°¡±â] Replated Protein:3-hydroxy-3-methylglutaryl-coenzyme A reductase Drug:estradiol Toxicity:stimulate steroidogenesis. [¹Ù·Î°¡±â] Replated Protein:Stromelysin-2 Drug:estradiol Toxicity:nonbacterial prostatitis. [¹Ù·Î°¡±â] Replated Protein:Transcription factor E2F1 Drug:estradiol Toxicity:cytotoxic responses. [¹Ù·Î°¡±â] Replated Protein:Glucocorticoid receptor Drug:estradiol Toxicity:glucocorticoid resistance. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-12-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|