| |
|
|
|
|
|
 |
| |
|
¿¡½ºÆ®¶óµð¿Ã-µ¥Æ÷ÁÖ10mg(±æÃʻ꿡½ºÆ®¶óµð¿Ã) ESTRADIOL-DEPOT INJ.10mg
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
 |
Á¦Ç°º° ÀӺαݱ⠰í½Ã |
|
|
|
1µî±Þ: ¿øÄ¢Àû »ç¿ë±Ý±â / 2µî±Þ: ¸íÈ®ÇÑ ÀÓ»óÀû ±Ù°Å ¶Ç´Â »çÀ¯°¡ ÀÖ´Â °æ¿ì ºÎµæÀÌÇÏ°Ô »ç¿ë / Mµî±Þ: ÀÓ»óÀû»óȲ¿¡ µû¶ó 1µî±Þ ¶Ç´Â 2µî±ÞÀ¸·Î ºÐ·ùµÇ´Â ¼ººÐ
| ¼ººÐ¸í |
¼ººÐÄÚµå |
±Ý±âµî±Þ |
°í½Ã¹øÈ£ |
°í½ÃÀÏÀÚ |
ºñ°í |
| estradiol |
155030BIJ |
1 |
20160155 |
20161230 |
ÀӺο¡ ´ëÇÑ ¾ÈÀü¼º ¹ÌÈ®¸³. ¿¡½ºÆ®·Î°Õ ´ëü ¿ä¹ý¿¡ ÀÇÇØ ³²³à žÆÀÇ »ý½Ä±â°ü À¯ÀüÀû °áÇÔÀ» Áõ°¡, Èʳ¯ ¿©¼ºÀÇ °æ¿ì Áú¼±Áõ, ÀڱðæºÎ ÆíÆò¼¼Æ÷ Çü¼ºÀå¾Ö, ÀڱþÏÀÇ À§Çè Áõ°¡. ÀӽŠÁß ¿¡½ºÆ®·Î°Õ ´ëü ¿ä¹ýÀÌ ÇÊ¿äÇÑ ÀûÀÀÁõÀº ¾øÀ½. |
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
659600201[659600200]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹ÌȲ»ö À¯¼º¾×ÀÌ µé¾îÀÖ´Â °¥»ö ¾ÚÇà ÁÖ»ç [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
5 ¾ÚÇÃ/»óÀÚ(1¹Ð¸®¸®ÅÍ/¾ÚÇÃ),10 ¾ÚÇÃ/»óÀÚ(1¹Ð¸®¸®ÅÍ/¾ÚÇÃ)
|
| ÁÖ¼ººÐÄÚµå |
155030BIJ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½°ú °°Àº ¿¡½ºÆ®·Î°Õ °áÇÌ Áõ»óÀÇ Ä¡·á
1. ÀÚ¿¬Àû Æó°æ ¹× ³¼Ò ÀýÁ¦¼ú ÈÄ Æó°æ±â Áõ»ó
2. ºñ´¢»ý½Ä±â°üÀÇ ±â´É¼èÅðÁõ»ó
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : ¿¡½ºÆ®¶óµð¿Ã¹ß·¹·¹ÀÌÆ®·Î¼ 1ȸ 10 mgÀ» 2 ¢¦ 4ÁÖ¸¶´Ù ±ÙÀ°ÁÖ»çÇÑ´Ù.
Ä¡·á±â°£Àº ÀûÀÀÁõ ¹× ȯÀÚ»óÅ¿¡ µû¸¥´Ù.
|
| ±Ý±â |
1) Áø´ÜÀÌ µÇÁö ¾ÊÀº »ý½Ä±â ÃâÇ÷ÀÌ Àִ ȯÀÚ
2) ¿¡½ºÆ®·Î°Õ ÀÇÁ¸¼º ¾Ç¼º Á¾¾ç ¶Ç´Â µ¿ Áúȯ ÀǽÉ(ƯÈ÷ Àڱ󻸷¾ÏÁ¾) ȯÀÚ
3) Ç÷¼ÒÆÇ »öÀüÁõ ȯÀÚ
4) ÇöÁ¸ À¯¹æ¾Ï ¶Ç´Â ±× º´·Â ¶Ç´Â µ¿ Áúȯ ÀÇ½É È¯ÀÚ
5) Àڱ󻸷Áõ½ÄÁõ ȯÀÚ
6) Á¤¸ÆÇ÷Àü»öÀüÁõ ¶Ç´Â ±× º´·Â(ƯÈ÷ ½ÉÀçÁ¤¸ÆÇ÷ÀüÁõ, Æó»öÀüÁõ)À» °¡Áø ȯÀÚ
7) ÇöÁ¸ ¶Ç´Â ÃÖ±Ù¿¡ ¹ßº´Çß´ø µ¿¸Æ Ç÷Àü»öÀüÁõ(ƯÈ÷ Çù½ÉÁõ, ½É±Ù°æ»ö)À» °¡Áø ȯÀÚ
8) ±Þ¼º °£Áúȯ ¶Ç´Â °ü·Ã °£È¿¼Ò ¼öÄ¡°¡ Á¤»óȵÇÁö ¾ÊÀº °æ¿ì ÃÖ±Ù °£Áúȯ º´·Â ȯÀÚ
9) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º, ¼öÀ¯ºÎ
10) ´«ÀÇ Ç÷°üÁúȯ¿¡ ÀÇÇÑ ºÎºÐÀû ¶Ç´Â ¿ÏÀüÇÑ ½Ã°¢»ó½Ç ¹× º¹½Ã ȯÀÚ
11) ÀüÇüÀûÀÎ ÆíµÎÅë ȯÀÚ
12) ÀÌ ¾à ¶Ç´Â ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ
13) ¾Ë·ÁÁø Ç÷Àü¼ºÇâÁõÀ» °¡Áø ȯÀÚ(¿¹, C´Ü¹é, S´Ü¹é ¶Ç´Â Çׯ®·Òºó°áÇÌÁõ)
14) Æ÷¸£ÇǸ°Áõ ȯÀÚ |
| ½ÅÁßÅõ¿© |
1) ¾Æ·¡ÀÇ Ç׸ñ¿¡ Çϳª¶óµµ ÇØ´çÇϰųª, °ú°Å¿¡ ÇØ´çÇÏ¿´°í/¶Ç´Â ÀӽŠ±â°£Áß ¾ÇȵǾú°Å³ª °ú°Å È£¸£¸ó Ä¡·á°æÇèÀÌ ÀÖ¾ú´ø ȯÀÚ´Â ¸é¹ÐÈ÷ °ü¸®ÇÑ´Ù.
(1) ÆòȰ±ÙÁ¾ ¶Ç´Â Àڱ󻸷Áõ ȯÀÚ
(2) Ç÷Àü»öÀüÁõ À§ÇèÀÎÀÚ º¸À¯ÀÚ
(3) ¿¡½ºÆ®·Î°Õ-ÀÇÁ¸¼º Á¾¾ç À§ÇèÀÎÀÚ º¸À¯ÀÚ(¿¹, ºÎ¸ð°¡ À¯¹æ¾Ï)
(4) °íÇ÷¾Ð ȯÀÚ
(5) °£Áúȯ(¿¹, °£¼±Á¾)
(6) ´ç´¢º´ ȯÀÚ
(7) ´Ù¹ß¼º°æÈÁõ ȯÀÚ
(8) ´ã¼®Áõ ȯÀÚ
(9) ÆíµÎÅë ¶Ç´Â ÁßÁõÀÇ µÎÅë
(10) Àü½ÅÈ«¹Ý·çǪ½º ȯÀÚ
(11) °£Áú ȯÀÚ
(12) õ½Ä ȯÀÚ
(13) ÀÌ(ì¼)°æÈÁõ ȯÀÚ
(14) À¯Àü Ç÷°üºÎÁ¾
2) ¿ì¿ïÁõ ¹× º´·ÂÀÌ Àִ ȯÀÚ(¿ì¿ïÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
3) ½ÉÀå ¶Ç´Â ½Å±â´É ȯÀÚ(ü¾×Àú·ù°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
4) Á¤¸Æ·ù ȯÀÚ
5) °íÄ®½·Ç÷ÁõÀ¸·Î ÀÎÇÑ ´ë»ç¼º °ñÁúȯ ¹× ½ÅºÎÀü ȯÀÚ(Ä®½· ¹× ÀÎ ´ë»ç¿¡ ¿µÇâÀ» ÁØ´Ù)
6) °ñ°ÝÀÌ ¼ºÀå ÁßÀÎ »çÃá±â ÀÌÀüÀÇ ¼Ò¾Æ
7) Ä¡·á¸¦ ½ÃÀÛÇϱâ Àü À§Ç輺ÀÌ Àִ ȯÀÚ¿¡°Ô À¯¹æÁ¶¿µ¼ºÀ» ½Ç½ÃÇÏ°í ±ÔÄ¢ÀûÀ¸·Î À̸¦ ¹Ýº¹Çϵµ·Ï ÇØ¾ß ÇÑ´Ù.
8) °£ ±â´ÉÀÇ ¾ÇÈ, Ȳ´Þ, ÆíµÎÅ뼺 µÎÅë, Ç÷°üºÎÁ¾ÀÌ »õ·Î ¹ß»ýµÇ°Å³ª À¯ÀÇÀûÀÎ Ç÷¾ÐÀÇ »ó½Â, ÀÓ½ÅÀÎ °æ¿ì(ÀÌ ¾àÀÇ º¹¿ëÀ» ÁßÁöÇϰí Áï½Ã Àǻ翡°Ô ¾Ë·Á¾ß ÇÑ´Ù)
9) ºñÁ¤»óÀûÀ̰ųª ºÒ±ÔÄ¢ÀûÀÎ ÃâÇ÷ÀÌ ¹ß»ýÇÏ´Â °æ¿ì(Àڱ󻸷ÀÇ ºÎÀΰú °Ë»ç¸¦ ÇØ¾ß ÇÑ´Ù)
10) ¼ö¼úÀ» ¹ÞÀº °æ¿ì(¼ö¼ú ÈÄ ±â°£ µ¿¾ÈÀÇ Á¤¸ÆÇ÷Àü»öÀüÁõ ¹ß»ýÀ» ¿¹¹æÇϱâ À§ÇÑ ´ëÃ¥ÀÌ ÇÊ¿äÇÏ´Ù. ¸¸¾à ¿¹Á¤µÈ ¼ö¼ú(elective surgery)·Î ÀÎÇØ Àå±âÀûÀ¸·Î ¿òÁ÷ÀÏ ¼ö ¾ø´Â »óÅÂ(prolonged immobilization)°¡ ¿¹»óµÈ´Ù¸é, ÀÇ»ç´Â 4 ¢¦ 6ÁÖÀü¿¡ È£¸£¸ó´ëü¿ä¹ýÀ» ÀϽÃÀûÀ¸·Î ÁßÁöÇÒ °ÍÀ» °í·ÁÇÏ¿©¾ß ÇÑ´Ù. Ä¡·á´Â ¼ö¼ú¿¡¼ ¿ÏÀüÈ÷ ȸº¹µÈ ÈÄ È°µ¿ÀÌ °¡´ÉÇÏ¸é ´Ù½Ã ½ÃÀÛÇØ¾ß ÇÑ´Ù)
11) Á¤¸ÆÇ÷Àü»öÀüÁõ¿¡ ´ëÇÑ °ú°Å·ÂÀÌ ¾ø´Â ȯÀÚÀÌ´õ¶óµµ, ÀþÀº ³ªÀÌ¿¡ Ç÷ÀüÁõÀÇ °ú°Å·ÂÀÌ ÀÖ´Â 1ÃÌ Ç÷Á·ÀÌ ÀÖ´Â °æ¿ì
12) ¸¸¼º Ç×Ç÷ÀüÁ¦ Ä¡·á¸¦ ÇÏ´Â ¿©¼º(È£¸£¸ó´ëü¿ä¹ýÀÇ À¯Àͼº°ú À§Ç輺À» ÁÖÀÇ ±í°Ô °í·ÁÇÏ¿©¾ß ÇÑ´Ù) |
| ÀÌ»ó¹ÝÀÀ |
1) ¿¡½ºÆ®¶óµð¿Ã ´Ù·® Åõ¿©½Ã ÀϹÝÀûÀÎ ÀÌ»ó¹ÝÀÀÀº À¯¹æÀÇ ¾ÐÅë À¯µÎÀÇ ¹Î°¨ÁõÀ» µ¿¹ÝÇÏ´Â À¯¹æÅëÀÌ´Ù. ¶ÇÇÑ ºÎÁ¾ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. À̵é ÀÌ»ó¹ÝÀÀÀº Åõ¿©·®À» ÁÙÀÓÀ¸·Î½á Ä¡À¯µÉ ¼ö ÀÖ´Ù.
2) Ç÷ÀüÁõ : Àå±â¿¬¿ë¿¡ ÀÇÇØ Ç÷ÀüÁõÀÌ ³ªÅ¸³µ´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
3) °ú¹Î¹ÝÀÀ : ¹ßÁø µîÀÇ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
4) Á¤½Å½Å°æ°è : Á¤½ÅÀå¾ÖÀÇ Àç¹ß(Á¤½ÅÀå¾ÖÀÇ º´·ÂÀÌ Àִ ȯÀÚ¿¡ Àç¹ßÀÌ ³ªÅ¸³ª´Â °æ¿ì Åõ¿©¸¦ ÁßÁöÇÑ´Ù)
5) ÀüÇØÁú´ë»ç : °íÄ®·ýÇ÷Áõ, ³ªÆ®·ý¤ýü¾×ÀÇ Àú·ù
6) »ý½Ä±â°è ¹× À¯¹æ : ¼ÒÅ𼺠ÃâÇ÷, ºñÁ¤±âÀû ÃâÇ÷, À¯¹æÅë
7) Åõ¿©ºÎÀ§ : ÅëÁõ, ¹ßÀû, °æ°á µî
8) ±âŸ : µÎÅë
|
| »óÈ£ÀÛ¿ë |
1) °£È¿¼ÒÀÇ Áõ°¡¸¦ ÀÏÀ¸Å°´Â ¾à¹°(¸®ÆÊÇǽÅ, ¹Ù¸£ºñÅ» µî)Àº ¿¡½ºÆ®¶óµð¿ÃÀÇ È¿°ú¸¦ °¨¼Ò½Ãų ¼ö ÀÖ´Ù. ¿¡½ºÆ®¶óµð¿Ã °æ±¸ Åõ¿©½Ã ¼º È£¸£¸ó, °©»ó»ù ¹× ºÎ½ÅÇÇÁú È£¸£¸ó °áÇÕ ±Û·ÎºÎ¸°ÀÇ »ý¼ºÀ» ÀÚ±ØÇÑ´Ù. ÀÌ´Â °©»ó»ù È£¸£¸ó Áø´Ü½Ã °í·ÁµÇ¾î¾ß ÇÑ´Ù.
2) ³Æ÷È£¸£¸ó(ÁÖ·Î °áÇÕÇü ¿¡½ºÆ®·Î°Õ, ÇÕ¼º ¿¡½ºÆ®·Î°Õ)Àº ³»´ç·ÂÀÇ º¯È¸¦ ÀÏÀ¸ÄÑ Ç÷´ç»ó½ÂÀÛ¿ëÀ» ³ªÅ¸³»¹Ç·Î Ç÷´ç°ÇÏÁ¦¿Í º´¿ëÅõ¿©½Ã Ç÷´ç°ÇÏÀÛ¿ëÀÌ °¨¼ÒµÉ ¼ö ÀÖ´Ù. ±×·¯¹Ç·Î ´ç´¢º´ ȯÀÚ¿¡ ÀÌ ¾à Åõ¿©½Ã Ç÷´ç°ÇÏÁ¦ÀÇ ¿ë·®À» Á¶ÀýÇÏ´Â µî ÁÖÀÇÇÑ´Ù.
3) ¿¡½ºÆ®·Î°ÕÀ» ÇÔÀ¯ÇÑ È£¸£¸ó ÇÇÀÓ¾àÀº ¶ó¸ðÆ®¸®Áø ±Û·çÄí·Î´ÏµåÈ À¯µµ·Î ÀÎÇØ º´¿ë Åõ¿© ½Ã ¶ó¸ðÆ®¸®Áø ³óµµ¸¦ À¯ÀÇÇÏ°Ô °¨¼Ò½ÃŰ´Â °ÍÀ¸·Î ³ªÅ¸³µ´Ù. ÀÌ·Î ÀÎÇØ ¹ßÀÛ Á¶ÀýÀÌ °¨¼ÒµÉ ¼ö ÀÖ´Ù. È£¸£¸ó ´ëü ¿ä¹ý°ú ¶ó¸ðÆ®¸®Áø »çÀÌÀÇ ÀáÀçÀûÀÎ »óÈ£ÀÛ¿ëÀº ¿¬±¸µÇÁö ¾Ê¾ÒÁö¸¸ À¯»çÇÑ »óÈ£ÀÛ¿ëÀÌ Á¸ÀçÇÏ¿© µÎ ¾à¹°À» ÇÔ²² º¹¿ëÇÏ´Â °æ¿ì ¹ßÀÛ Á¶ÀýÀÌ °¨¼ÒÇÒ ¼ö ÀÖÀ» °ÍÀ¸·Î ¿¹»óµÈ´Ù. |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Estradiol¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Estradiol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Estradiol enters target cells freely (e.g., female organs, breasts, hypothalamus, pituitary) and interacts with a target cell receptor. When the estrogen receptor has bound its ligand it can enter the nucleus of the target cell, and regulate gene transcription which leads to formation of messenger RNA. The mRNA interacts with ribosomes to produce specific proteins that express the effect of estradiol upon the target cell. Estrogens increase the hepatic synthesis of sex hormone binding globulin (SHBG), thyroid-binding globulin (TBG), and other serum proteins and suppress follicle-stimulating hormone (FSH) from the anterior pituitary.
|
| Pharmacology |
Estradiol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Estradiol, the principal intracellular human estrogen, is substantially more active than its metabolites, estrone and estriol, at the cellular level.
|
| Metabolism |
Estradiol¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 1A2 (CYP1A2)Cytochrome P450 2A6 (CYP2A6)Glucuronosyltransferase
|
| Protein Binding |
Estradiol¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ >95%
|
| Half-life |
Estradiol¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 36 hours
|
| Absorption |
Estradiol¿¡ ´ëÇÑ Absorption Á¤º¸ 43%
|
| Pharmacokinetics |
Estradiol valerateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À§Àå°ü¿¡¼ ½Å¼ÓÈ÷ Èí¼ö
Àå°£¼øÈ¯(enterohepatic recirculation)
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯ÁóºÐºñ
- ´Ü¹é°áÇÕ : 80 %
- ¹Ý°¨±â : 50-60 ºÐ
- ´ë»ç : °£¿¡¼ ºñȰ¼º ¹°Áú·Î ´ë»ç
- ¼Ò½Ç : ¼Òº¯°ú ´ãÁóÀ¸·Î ¹è¼³
|
| Biotransformation |
Estradiol¿¡ ´ëÇÑ Biotransformation Á¤º¸ Exogenous estrogens are metabolized using the same mechanism as endogenous estrogens. Estrogens are partially metabolized by cytochrome P450.
|
| Toxicity |
Estradiol¿¡ ´ëÇÑ Toxicity Á¤º¸ Can cause nausea and vomiting, and withdrawal bleeding may occur in females.
|
| Drug Interactions |
Estradiol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital The enzyme inducer decreases the effect of hormonesAprobarbital The enzyme inducer decreases the effect of hormonesButabarbital The enzyme inducer decreases the effect of hormonesButalbital The enzyme inducer decreases the effect of hormonesButethal The enzyme inducer decreases the effect of hormonesEthotoin The enzyme inducer decreases the effect of hormonesFosphenytoin The enzyme inducer decreases the effect of hormonesGriseofulvin The enzyme inducer decreases the effect of hormonesHeptabarbital The enzyme inducer decreases the effect of hormonesHexobarbital The enzyme inducer decreases the effect of hormonesMephenytoin The enzyme inducer decreases the effect of hormonesMethohexital The enzyme inducer decreases the effect of hormonesMethylphenobarbital The enzyme inducer decreases the effect of hormonesPentobarbital The enzyme inducer decreases the effect of hormonesPhenobarbital The enzyme inducer decreases the effect of hormonesPhenytoin The enzyme inducer decreases the effect of hormonesPrednisolone The estrogenic agent increases the effect of corticosteroidPrednisone The estrogenic agent increases the effect of corticosteroidPrimidone The enzyme inducer decreases the effect of hormonesSecobarbital The enzyme inducer decreases the effect of hormonesTalbutal The enzyme inducer decreases the effect of hormonesRaloxifene Association not recommendedUrsodeoxycholic acid Estrogens decreases the effect of ursodiol
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Estradiol¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food to decrease nausea.
|
| Drug Target |
[Drug Target]
|
| Description |
Estradiol¿¡ ´ëÇÑ Description Á¤º¸ Generally refers to the 17-beta-isomer of estradiol, an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans, it is produced primarily by the cyclic ovaries and the placenta. It is also produced by the adipose tissue of men and postmenopausal women. The 17-alpha-isomer of estradiol binds weakly to estrogen receptors (receptors, estrogen) and exhibits little estrogenic activity in estrogen-responsive tissues. Various isomers can be synthesized. [PubChem]
|
| Dosage Form |
Estradiol¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Disc TransdermalGel TransdermalLiquid IntramuscularPatch TransdermalRing IntravaginalTablet IntravaginalTablet Oral
|
| Drug Category |
Estradiol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-menopausal AgentsAnticholesteremic AgentsEstrogens
|
| Smiles String Canonical |
Estradiol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CCC2O
|
| Smiles String Isomeric |
Estradiol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CC[C@H]3[C@@H](CCC4=C3C=CC(O)=C4)[C@@H]1CC[C@@H]2O
|
| InChI Identifier |
Estradiol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1
|
| Chemical IUPAC Name |
Estradiol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
|
| Drug-Induced Toxicity Related Proteins |
ESTRADIOL ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Myc proto-oncogene protein Drug:estradiol Toxicity:cytotoxic responses . [¹Ù·Î°¡±â] Replated Protein:3-hydroxy-3-methylglutaryl-coenzyme A reductase Drug:estradiol Toxicity:stimulate steroidogenesis. [¹Ù·Î°¡±â] Replated Protein:Stromelysin-2 Drug:estradiol Toxicity:nonbacterial prostatitis. [¹Ù·Î°¡±â] Replated Protein:Transcription factor E2F1 Drug:estradiol Toxicity:cytotoxic responses. [¹Ù·Î°¡±â] Replated Protein:Glucocorticoid receptor Drug:estradiol Toxicity:glucocorticoid resistance. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-10-14
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|