| |
|
|
|
|
|
 |
| |
|
¿¡¾î½Å½ÅÆÄ½º AIR SINSIN PAS
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
643800650
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»ö³»Áö ¹ÌȲ»ö(¿¬³ë¶û)ÀÇ ¾×ü·Î¼ ³»¾Ð¿ë±â¿¡ ÃæÁøÇÑ(ä¿öÁø) ¿¡¾î·ÎÁ¹ Á¦Á¦ÀÌ´Ù. [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
200ml, 280ml |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 300¹Ð¸®¸®ÅÍ |
1 °³ |
ĵ |
8806438006506 |
8806438006551 |
|
| 220¹Ð¸®¸®ÅÍ |
1 °³ |
ĵ |
8806438006506 |
8806438006544 |
|
| 100¹Ð¸®¸®ÅÍ |
1 °³ |
ĵ |
8806438006506 |
8806438006537 |
|
| 280¹Ð¸®¸®ÅÍ |
1 °³ |
ĵ |
8806438006506 |
8806438006520 |
|
| 200¹Ð¸®¸®ÅÍ |
1 °³ |
ĵ |
8806438006506 |
8806438006513 |
|
|
| ÁÖ¼ººÐÄÚµå |
B14100CAE
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½ Áõ»óÀÇ ÁøÅ롤¼Ò¿°(Ç׿°) : »ã, Ÿ¹Ú»ó, ±ÙÀ°Åë, °üÀýÅë, °ñÀýÅë, ¿ä(Ç㸮)Åë, ¾î±ú°á¸², ½Å°æÅë, ·ù¸¶Æ¼½º ÅëÁõ, ÇǺΰ¡·Á¿ò, ¹ú·¹¹°¸°µ¥, µ¿Ã¢(¾ð »óó)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1ȸ ~ ¼öȸ(¿©·¯ Â÷·Ê) ȯºÎ(Áúȯ ºÎÀ§)¿¡ Àû´ç·®À» »Ñ¸°´Ù
|
| ±Ý±â |
1) 30°³¿ù ÀÌÇÏÀÇ À¯¾Æ
2) ´«ÁÖÀ§, Á¡¸· µî
3) ½ÀÁø, ¿Ì µî¿¡ ÀÇÇÑ ÇǺο°, »óóºÎÀ§ |
| ½ÅÁßÅõ¿© |
1) Áö±Ý±îÁö ¾àÀ̳ª ÈÀåǰ µî¿¡ ÀÇÇÑ ¾Ë·¹¸£±â Áõ»ó(¿¹¸¦ µé¸é ¹ßÁø•¹ßÀû(ÃæÇ÷µÇ¾î ºÓ¾îÁü), °¡·Á¿ò, ¿Ì µî¿¡ ÀÇÇÑ ÇǺο° µî)ÀÌ ³ªÅ¸³ ÀûÀÌ Àִ ȯÀÚ
2) º»ÀÎ ¶Ç´Â °¡Á·ÀÌ ¾Ë·¹¸£±â üÁúÀΠȯÀÚ
3) ½ÀÀ±(½À±â Âü)À̳ª ¹Ì¶õ(Áþ¹«¸§)ÀÌ ½ÉÇÑ È¯ÀÚ
4) ÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ°í Àִ ȯÀÚ
5) ¼Ò¾Æ(°æ·ÃÀ» À¯¹ßÇÒ ¼ö ÀÖ´Ù)
6) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º
7) ¼öÀ¯ºÎ |
| ÀÌ»ó¹ÝÀÀ |
ÀÌ ¾àÀÇ »ç¿ëÀ¸·Î ÀÎÇØ ¹ßÁø•¹ßÀû(ÃæÇ÷µÇ¾î ºÓ¾îÁü), °¡·Á¿ò, ºÎÁ¾(ºÎ±â) µîÀÇ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÏ°í ¾à»ç ¶Ç´Â ÀÇ»ç¿Í »óÀÇÇÑ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Camphor¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Diphenhydramine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
L-Menthol¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Diphenhydramine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Diphenhydramine competes with free histamine for binding at HA-receptor sites. This antagonizes the effects of histamine on HA-receptors, leading to a reduction of the negative symptoms brought on by histamine HA-receptor binding.
|
| Pharmacology |
Diphenhydramine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Diphenhydramine is an antihistamine of the ethanolamine class. Ethanolamine antihistamines have significant antimuscarinic activity and produce marked sedation in most patients. In addition to the usual allergic symptoms, the drug also treats irritant cough and nausea, vomiting, and vertigo associated with motion sickness. It also is used commonly to treat drug-induced extrapyramidal symptoms as well as to treat mild cases of Parkinson's disease. Rather than preventing the release of histamine, as do cromolyn and nedocromil, diphenhydramine competes with free histamine for binding at HA-receptor sites. Diphenhydramine competitively antagonizes the effects of histamine on HA-receptors in the GI tract, uterus, large blood vessels, and bronchial muscle. Ethanolamine derivatives have greater anticholinergic activity than do other antihistamines, which probably accounts for the antidyskinetic action of diphenhydramine. This anticholinergic action appears to be due to a central antimuscarinic effect, which also may be responsible for its antiemetic effects, although the exact mechanism is unknown.
|
| Metabolism |
Diphenhydramine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2D6 (CYP2D6)Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Diphenhydramine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 98 to 99%
|
| Half-life |
Diphenhydramine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 1-4 hours
|
| Absorption |
Diphenhydramine¿¡ ´ëÇÑ Absorption Á¤º¸ Quickly absorbed with maximum activity occurring in approximately one hour.
|
| Pharmacokinetics |
L-mentholÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ¼Ò½Ç : Èí¼öµÈ ¾à¹°Àº glucuronide Æ÷ÇÕü·Î¼ ¼Òº¯ ¹× ´ãÁóÀ» ÅëÇØ ¹è¼³µÈ´Ù.
DiphenhydramineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÃÖ°í ÁøÁ¤ È¿°ú : 1-3 ½Ã°£
- ÀÛ¿ëÁö¼Ó½Ã°£ : 4-7 ½Ã°£
- Èí¼ö : ÃÊȸÅë°úÈ¿°ú°¡ ÀÖ¾î¼ 40 - 60 % Á¤µµ°¡ Àü½Å¼øÈ¯À¸·Î µé¾î°¨
- ´ë»ç : ´ëºÎºÐ °£´ë»ç, ÀϺδ Æó¿Í ½ÅÀå¿¡¼µµ ´ë»ç
- ´Ü¹é°áÇÕ : 78%
- ÃÖ°íÇ÷Áß³óµµ µµ´Þ½Ã°£ : 2-4 ½Ã°£
Methyl SalicylateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö :
- À§Àå°üÀ¸·ÎºÎÅÍ Àß Èí¼öµÈ´Ù.
- ¹þ°ÜÁø ÇǺθ¦ ÅëÇØ¼µµ Èí¼öµÉ ¼ö ÀÖ´Ù.
|
| Biotransformation |
Diphenhydramine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic and renal
|
| Toxicity |
Diphenhydramine¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=500 mg/kg (orally in rats). Considerable overdosage can lead to myocardial infarction (heart attack), serious ventricular dysrhythmias, coma and death.
|
| Drug Interactions |
Diphenhydramine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Atomoxetine The CYP2D6 inhibitor could increases the effect and toxicity of atomoxetineDonepezil Possible antagonism of actionGalantamine Possible antagonism of actionMesoridazine Increased risk of cardiotoxicity and arrhythmiasRivastigmine Possible antagonism of actionThioridazine Increased risk of cardiotoxicity and arrhythmias
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Diphenhydramine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Avoid alcohol.Take with food.
|
| Drug Target |
[Drug Target]
|
| Description |
Diphenhydramine¿¡ ´ëÇÑ Description Á¤º¸ A histamine H1 antagonist used as an antiemetic, antitussive, for dermatoses and pruritus, for hypersensitivity reactions, as a hypnotic, an antiparkinson, and as an ingredient in common cold preparations. It has some undesired antimuscarinic and sedative effects.
|
| Dosage Form |
Diphenhydramine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralCream TopicalElixir OralLiquid IntramuscularLiquid IntravenousLiquid OralLozenge OralStrip OralSyrup OralTablet OralTablet, chewable Oral
|
| Drug Category |
Diphenhydramine¿¡ ´ëÇÑ Drug_Category Á¤º¸ AnestheticsAnesthetics, LocalAnti-Allergic AgentsAntidyskineticsAntiemeticsAntiparkinson AgentsAntipruriticsAntitussivesEthanolamine DerivativesHistamine H1 AntagonistsHypnotics and Sedatives
|
| Smiles String Canonical |
Diphenhydramine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN(C)CCOC(C1=CC=CC=C1)C1=CC=CC=C1
|
| Smiles String Isomeric |
Diphenhydramine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN(C)CCOC(C1=CC=CC=C1)C1=CC=CC=C1
|
| InChI Identifier |
Diphenhydramine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C17H21NO/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3
|
| Chemical IUPAC Name |
Diphenhydramine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-[di(phenyl)methoxy]-N,N-dimethylethanamine
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2022-10-25
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|